diff --git a/.buildinfo b/.buildinfo new file mode 100644 index 0000000..704c60b --- /dev/null +++ b/.buildinfo @@ -0,0 +1,4 @@ +# Sphinx build info version 1 +# This file hashes the configuration used when building these files. When it is not found, a full rebuild will be done. +config: 655f24f2821d611a95845215dcf2e240 +tags: 645f666f9bcd5a90fca523b33c5a78b7 diff --git a/.nojekyll b/.nojekyll new file mode 100644 index 0000000..e69de29 diff --git a/README.html b/README.html new file mode 100644 index 0000000..f2fe809 --- /dev/null +++ b/README.html @@ -0,0 +1,662 @@ + + + + + + + + + + + + Welcome to the NEON Tutorial 2023 — NEON Tutorial 2023 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+
+ + + Ctrl+K +
+
+ + + +
+
+ +
+ + + +
+ + + + +
+ +
+
+ + +
+
+
+ + +
+
+ + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + +
+ + +
+ + + + + + +
+ + +
+ + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Welcome to the NEON Tutorial 2023

+ +
+ +
+
+ + + + +
+ +
+

Welcome to the NEON Tutorial 2023#

+

Jupyter Build

+

GitHub license +Made withJupyter +Commits +Contributors

+

This tutorial will be used as a resource during the 2023 NEON Tutorial, Flux Course 2023 & ESA 2023 workshop.

+ +

The materials and notebooks in this tutorial is published as a Jupyter book here.

+

These tutorials are designed as an introduction to running the Community Terrestrial Systems Model (CTSM). Users can begin with the notebooks in the Getting Started directory, which contains:

+
    +

  1. An introduction to CTSM, CESM-Lab, and Git

    2. +

  2. Running CTSM simulations at NEON tower sites

    3. +

  3. Evaluating CTSM at NEON tower sites

    4. +
+

We’ll also have opportunities to explore more ProjectExamples which describe how to:

+
    +

  • Plot data

    • +

  • Make simple code modifications

    • +

  • Change simulated plant type

    • +

  • Change model options (eg, FATES)

    • +

  • Identify how to change model output

    • +
+
+
+

Quick Start#

+
+

Step 1: Open up CESM-Lab#

+
    +

  • In your web browser go to https://neon2023.cesm.cloud

    +

    It will automatically open up a portal to connect to the cloud:

    + +

    Jupyterhub Login Page

    +
    • +

  • Enter your username and password provided with your tutorial registration

    • +

  • This should launch a JupyterLab window in your browser.

    • +
+
+
+

Step 2: Navigate to notebooks directory#

+
    +

  • Click on the CTSM-Tutorial directory

    • +

  • Click on the notebooks directory

    • +

  • Click on the GettingStarted directory

    • +

  • Click on the 1_GitStarted.ipynb notebook in the sidebar of your JupyterLab window.

    • +
+

Now you’re ready to get started with the pre-tutorial homework. Let’s get started by following along in the first notebook.

+
+
+

IF you need to update the tutorial repository, you can clone CTSM Tutorial Repository:#

+
    +

  • Click on the Terminal icon to open a terminal window.

    • +
+

Screen Shot 2022-05-17 at 2 05 32 AM

+
    +

  • If the directory does not already exist (everything should be pre-staged, so you shouldn’t have to do this), run the following command to clone this repository. (Just copy and paste the text below into the terminal window that opens in JupyterLab)

    • +
+
git clone -b NEON_Tutorial_2023 https://github.com/NCAR/CTSM-Tutorial
+
+
+

Then, run the following command from within CTSM-Tutorial to update.

+
git pull
+
+
+

This gives you an updated local copy of the material you’ll need for the tutorial

+

Can you see a new directory on your navigation sidebar called CTSM-Tutorial? (See the left sidebar of your JupyterLab window) +CTSM_Tutorial_git_clone.png

+
+
+

Notebook Table of Contents#

+
    +

  • GettingStarted: These notebooks are the building blocks for all additional notebooks.

    +
      +

    • 1_NEON_Simulation_Tutorial.ipynb : This notebook shows how to run a NEON simulation

      • +

    • 2_NEON_Simulation_Visualization.ipynb : This notebook shows how to visualize NEON simulation output

      • +
    +
    • +

  • ProjectExamples: These notebooks are project-specific and build upon the GettingStarted notebooks

    +
      +

    • Basic_CTSM-NEON_Plots.ipynb : This notebook shows how to create plots from NEON data, as well as perform time averaging, etc

      • +

    • CTSMsp_NEON_fromScratch.ipynb : This notebook focuses on using CTSM with satellite phenology

      • +

    • Clone_Case.ipynb : This notebook shares how to clone a case

      • +

    • FATES_NEON_fromScratch.ipynb : This notebook works on creating a FATES case from scratch with NEON

      • +

    • Plot_flux_climatology.ipynb : This notebook provides climatology plotting examples

      • +

    • QuickPlot_CTSM-FATESsp.ipynb : This notebook provides plotting tools for use with FATES run with satellite phenology

      • +

    • QuickPlot_CTSM_h0.ipynb : This plots monthly CTSM data

      • +

    • QuickPlot_CTSM_spinup.ipynb : This plots CTSM cases that have been spun up

      • +

    • customizeCase_PRISM.ipynb : This customizes a case to use PRISM precipitation input data

      • +

    • customizeCase_modelFeatures.ipynb : This customizes various model features

      • +

    • customizeCase_parameterModifications.ipynb : This notebook provides tools for parameter modifications and takes input that is generated from modifyParameterFile.ipynb

      • +

    • modifyParameterFile.ipynb : This notebook modifies a parameter file that can then be used by customizeCase_parameterModifications.ipynb

      • +

    • modifySurfdataFile.ipynb : This notebook modifies a surface data file that can then be used by customizeCase_modelFeatures.ipynb

      • +
    +
    • +

  • ContributedNotebooks: These notebooks are contributed by workshop participants who dove further into a particular project.

    • +
+
+
+

📚 Resources#

+

CTSM Repository which includes the CTSM Wiki page that has lots of resources, including much of the following:

+ +

CLM5 Overview Paper Lawrence et al. 2019 JAMES

+

CLM5 Diagnostic plots, from the overview paper.

+

CLM5 ILAMB page, also from the overview paper.

+
+
+

❓ Questions#

+

For questions about running simulations, please use DiscussCESM Forums:

+

Containers & Cloud Platforms Forum

+

CTSM Forum

+
+
+

👍 Acknowledgements#

+

A number of people have been critical to this effort, including:

+
    +

  • Adrianna Foster, Negin Sobhani, Danica Lombardozzi, Will Wieder, Gordon Bonan, & Teagan King who put together tutorial materials.

    • +

  • Brian Dobbins, who put together the AWS configuration of CESM-Lab;

    • +

  • Jackie Shuman, Polly Buotte, & Keith Oleson, who tested tutorial materials;

    • +

  • Erik Kluzek & Bill Sacks, who made CTSM tags needed for running simulations.

    • +

  • Elizabeth Faircloth and Ryan Johnson who helped with tutorial registration, logistics and webpages; and finally the rest of the

    • +

  • TSS staff who provided lecture materials and helped answer questions during the tutorial.

    • +
+

This material is based upon work supported by the National Center for Atmospheric Research (NCAR), which is a major facility sponsored by the National Science Foundation (NSF) under Cooperative Agreement No. 1852977. Staff time on this project was also supported by NSF award numbers 2039932, 2031238, 1926413, and 2120804.

+
+
+
+
+
+
+
+
+
+
+
+
+ + + + +
+ + + + + + +
+ + + +
+ +
+
+ Contents +
+
+ +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/_images/2b78be3105637e8dc159d3ae76cf27d4aba3a23ab675745c2eaa35a5c436b171.png b/_images/2b78be3105637e8dc159d3ae76cf27d4aba3a23ab675745c2eaa35a5c436b171.png new file mode 100644 index 0000000..bdc4a16 Binary files /dev/null and b/_images/2b78be3105637e8dc159d3ae76cf27d4aba3a23ab675745c2eaa35a5c436b171.png differ diff --git a/_images/CTSM_Tutorial_git_clone.png b/_images/CTSM_Tutorial_git_clone.png new file mode 100644 index 0000000..f5762a2 Binary files /dev/null and b/_images/CTSM_Tutorial_git_clone.png differ diff --git a/_images/STER_tower.png b/_images/STER_tower.png new file mode 100644 index 0000000..ca8cbd7 Binary files /dev/null and b/_images/STER_tower.png differ diff --git a/_images/WOOD.BTRAN.ad_spin.png b/_images/WOOD.BTRAN.ad_spin.png new file mode 100644 index 0000000..1fa7def Binary files /dev/null and b/_images/WOOD.BTRAN.ad_spin.png differ diff --git a/_images/WOOD.BTRAN.postad.png b/_images/WOOD.BTRAN.postad.png new file mode 100644 index 0000000..a5d10ce Binary files /dev/null and b/_images/WOOD.BTRAN.postad.png differ diff --git a/_images/WOOD_H2OSOI.png b/_images/WOOD_H2OSOI.png new file mode 100644 index 0000000..6149b4c Binary files /dev/null and b/_images/WOOD_H2OSOI.png differ diff --git a/_images/cesmlab_login.png b/_images/cesmlab_login.png new file mode 100644 index 0000000..c1cf3d9 Binary files /dev/null and b/_images/cesmlab_login.png differ diff --git a/_images/f0df3fe36c3a845c67e95e16bacb76f7e519930fba3467ad9886a31fe0685d71.png b/_images/f0df3fe36c3a845c67e95e16bacb76f7e519930fba3467ad9886a31fe0685d71.png new file mode 100644 index 0000000..2ae1a18 Binary files /dev/null and b/_images/f0df3fe36c3a845c67e95e16bacb76f7e519930fba3467ad9886a31fe0685d71.png differ diff --git a/_sources/README.md b/_sources/README.md new file mode 100644 index 0000000..c72368e --- /dev/null +++ b/_sources/README.md @@ -0,0 +1,143 @@ + +# Welcome to the [NEON Tutorial 2023](https://github.com/NCAR/CTSM-Tutorial/blob/NEON_Tutorial_2023/README.md) + +[![Jupyter Build](https://img.shields.io/github/actions/workflow/status/NCAR/CTSM-Tutorial/gh-page_builder.yml?label=JupyterBook&logo=GitHub&style=flat-square)](https://ncar.github.io/CTSM-Tutorial/README.html) + +[![GitHub license](https://img.shields.io/github/license/Naereen/StrapDown.js.svg?style=flat-square)](https://github.com/NCAR/CTSM-Tutorial/blob/main/LICENSE) +[![Made withJupyter](https://img.shields.io/badge/Made%20with-Jupyter-green?style=flat-square&logo=Jupyter&color=green)](https://jupyter.org/try) +[![Commits](https://img.shields.io/github/last-commit/NCAR/CTSM-Tutorial?label=Last%20commit&style=flat-square&color=green)](https://github.com/NCAR/CTSM-Tutorial/commits/NEON_Tutorial_2023) +[![Contributors](https://img.shields.io/github/contributors/NCAR/CTSM-Tutorial?label=Contributors&logo=github&style=flat-square&color=green)](https://img.shields.io/github/contributors/NCAR/CTSM-Tutorial?logo=github) + + +This tutorial will be used as a resource during the 2023 NEON Tutorial, Flux Course 2023 & ESA 2023 workshop. + + + + +The materials and notebooks in this tutorial is published as a Jupyter book here. + +These tutorials are designed as an introduction to running the Community Terrestrial Systems Model (CTSM). Users can begin with the notebooks in the `Getting Started` directory, which contains: + +1. An introduction to CTSM, CESM-Lab, and Git +2. Running CTSM simulations at NEON tower sites +3. Evaluating CTSM at NEON tower sites + +We'll also have opportunities to explore more `ProjectExamples` which describe how to: +- Plot data +- Make simple code modifications +- Change simulated plant type +- Change model options (eg, FATES) +- Identify how to change model output + +# Quick Start +## Step 1: Open up CESM-Lab +- In your web browser go to https://neon2023.cesm.cloud + + It will automatically open up a portal to connect to the cloud: + + + ![Jupyterhub Login Page](/images/cesmlab_login.png) + +- Enter your username and password provided with your tutorial registration +- This should launch a JupyterLab window in your browser. + +## Step 2: Navigate to `notebooks` directory +- Click on the `CTSM-Tutorial` directory +- Click on the `notebooks` directory +- Click on the `GettingStarted` directory +- Click on the `1_GitStarted.ipynb` notebook in the sidebar of your JupyterLab window. + +Now you're ready to get started with the pre-tutorial homework. Let's get started by following along in the first notebook. + + +## IF you need to update the tutorial repository, you can clone CTSM Tutorial Repository: + +- Click on the `Terminal` icon to open a terminal window. + +![Screen Shot 2022-05-17 at 2 05 32 AM](https://user-images.githubusercontent.com/17344536/168761721-b87d21a0-f92a-4040-9296-926f9b234113.png) + + +- If the directory does not already exist (everything should be pre-staged, so you shouldn't have to do this), run the following command to clone this repository. (Just copy and paste the text below into the terminal window that opens in JupyterLab) + +``` +git clone -b NEON_Tutorial_2023 https://github.com/NCAR/CTSM-Tutorial +``` + +Then, run the following command from within CTSM-Tutorial to update. + +``` +git pull +``` + + +This gives you an updated local copy of the material you'll need for the tutorial + +*Can you see a new directory on your navigation sidebar called `CTSM-Tutorial`?* (See the left sidebar of your JupyterLab window) +![CTSM_Tutorial_git_clone.png](/images/CTSM_Tutorial_git_clone.png) + + +## Notebook Table of Contents + - GettingStarted: These notebooks are the building blocks for all additional notebooks. + - 1_NEON_Simulation_Tutorial.ipynb : This notebook shows how to run a NEON simulation + - 2_NEON_Simulation_Visualization.ipynb : This notebook shows how to visualize NEON simulation output + - ProjectExamples: These notebooks are project-specific and build upon the GettingStarted notebooks + - Basic_CTSM-NEON_Plots.ipynb : This notebook shows how to create plots from NEON data, as well as perform time averaging, etc + - CTSMsp_NEON_fromScratch.ipynb : This notebook focuses on using CTSM with satellite phenology + - Clone_Case.ipynb : This notebook shares how to clone a case + - FATES_NEON_fromScratch.ipynb : This notebook works on creating a FATES case from scratch with NEON + - Plot_flux_climatology.ipynb : This notebook provides climatology plotting examples + - QuickPlot_CTSM-FATESsp.ipynb : This notebook provides plotting tools for use with FATES run with satellite phenology + - QuickPlot_CTSM_h0.ipynb : This plots monthly CTSM data + - QuickPlot_CTSM_spinup.ipynb : This plots CTSM cases that have been spun up + - customizeCase_PRISM.ipynb : This customizes a case to use PRISM precipitation input data + - customizeCase_modelFeatures.ipynb : This customizes various model features + - customizeCase_parameterModifications.ipynb : This notebook provides tools for parameter modifications and takes input that is generated from modifyParameterFile.ipynb + - modifyParameterFile.ipynb : This notebook modifies a parameter file that can then be used by customizeCase_parameterModifications.ipynb + - modifySurfdataFile.ipynb : This notebook modifies a surface data file that can then be used by customizeCase_modelFeatures.ipynb + - ContributedNotebooks: These notebooks are contributed by workshop participants who dove further into a particular project. + +## 📚 Resources + +[CTSM Repository](https://github.com/ESCOMP/ctsm) which includes the [CTSM Wiki page](https://github.com/ESCOMP/CTSM/wiki) that has lots of resources, including much of the following: +- [CTSM Technical Documentation](https://escomp.github.io/ctsm-docs/versions/master/html/index.html) +- [CTSM User's Guide](https://escomp.github.io/ctsm-docs/versions/master/html/users_guide/index.html) +- [Quickstart Guide for Various Model Configuraions](https://escomp.github.io/CESM/release-cesm2/quickstart.html#create-a-case) +- [Running single-point cases other than NEON](https://escomp.github.io/ctsm-docs/versions/master/html/users_guide/running-single-points/single-point-and-regional-grid-configurations.html) +- [Running NEON cases with a container](https://ncar.github.io/ncar-neon-books/intro.html) -- Running CTSM for NEON cases on a laptop + +[CLM5 Overview Paper](https://doi.org/10.1029/2018MS001583) Lawrence et al. 2019 JAMES + +[CLM5 Diagnostic plots](https://www.cesm.ucar.edu/experiments/cesm2.0/land/diagnostics/clm_diag_PCKG.html), from the overview paper. + +[CLM5 ILAMB page](https://www.cesm.ucar.edu/experiments/cesm2.0/land/diagnostics/clm_diag_ILAMB.html), also from the overview paper. + + +## ❓ Questions + +For questions about running simulations, please use DiscussCESM Forums: + +[Containers & Cloud Platforms Forum](https://bb.cgd.ucar.edu/cesm/forums/containers-cloud-platforms.162/) + +[CTSM Forum](https://bb.cgd.ucar.edu/cesm/forums/ctsm-clm-mosart-rtm.134/) + +## 👍 Acknowledgements + +A number of people have been critical to this effort, including: +- Adrianna Foster, Negin Sobhani, Danica Lombardozzi, Will Wieder, Gordon Bonan, & Teagan King who put together tutorial materials. +- Brian Dobbins, who put together the AWS configuration of CESM-Lab; +- Jackie Shuman, Polly Buotte, & Keith Oleson, who tested tutorial materials; +- Erik Kluzek & Bill Sacks, who made CTSM tags needed for running simulations. +- Elizabeth Faircloth and Ryan Johnson who helped with tutorial registration, logistics and webpages; and finally the rest of the +- TSS staff who provided lecture materials and helped answer questions during the tutorial. + +This material is based upon work supported by the National Center for Atmospheric Research (NCAR), which is a major facility sponsored by the National Science Foundation (NSF) under Cooperative Agreement No. 1852977. Staff time on this project was also supported by NSF award numbers 2039932, 2031238, 1926413, and 2120804. diff --git a/_sources/faq.md b/_sources/faq.md new file mode 100644 index 0000000..8f90745 --- /dev/null +++ b/_sources/faq.md @@ -0,0 +1,48 @@ +# Frequently Asked Questions (FAQ) + +* **How can I access CESM-Lab after the tutorial?** + - You can always find all the tutorial materials [here](https://ncar.github.io/CTSM-Tutorial/README.html). + - Your can continue to access AWS through August 2023, and then access will be depracted. However, you can still access CESM-Lab using an AWS account (check with your lab or university). + - You can also run CTSM using Docker on your own laptops. Details on running CTSM using containers through our CTSM-NEON tutorial tool are available [here](https://ncar.github.io/NEON-visualization/). + +* **How can I transfer my progress/data outside the cloud or on another machine?** + - You can transfer Jupyter notebooks, case directories, and other files you created or modified during the tutorial from CESM-Lab to your personal computer (or any other machine) using `rsync`. + - Open a terminal window (or SSH into, for a machine like NCAR's Cheyenne) in the machine you would like the files transferred to. On Macs you can generally access a terminal via Applications > Utilities > Terminal. On Windows machines you may need to download a software like [PuTTY](https://www.putty.org/). + - Inside the terminal, navigate to the location you would like the files downloaded to and type: + `rsync -avz @ctsmworkshop2022.cesm.cloud: .` + - Your computer may say it cannot "recognize the authenticity of the host", but you can enter `yes` + - Then you will be prompted to enter your CTSM Tutorial 2022 password (the password you used to log into CESM-Lab) + - **Alternatively** on CESM-Lab you can directly download any individual files by right clicking on them in the left-hand file navigation pane and clicking `Download`. Directories can be downloaded by first `tar`-ing them (e.g. `tar -zcvf my_files.tar.gz clm_tutorial_cases`). Then right click on the tarred file in the file navigation pane to download it as you would a file. + + +* **I messed up the notebooks. How can I find what it should be??** + + You can look at the notebooks on GitHub and correct small mistakes, or you can do the following: + - Open up terminal window + - Navigate to CTSM-Tutorial-2022 directory (`cd ~/CTSM-Tutorial-2022`) + - Run `git status` to check the status of your notebooks and which branch you are on. + - If you are on the main branch, run `git stash` which stashes your progress and whatever you saved in your notebooks. + - Next, run `git pull` to get a clean version of the tutorial notebooks from the original repository. + +* **How do I see what jobs are running on AWS?** + - You can either use `qstat` or `squeue` in terminal to list all your jobs and their status. + - Below is the list of acronyms in the `ST` column and their meanings: + + | Status | Code | Description | + | --- | ----------- | ----------- | + | Completed | C | Job just successfully completed. | + | Running | R | The Job is currently running. | + | Queued/Waiting | Q / PD | The job is waiting for allocation in the queue. | + + +* **How do I kill a job that’s running?** + - You can either use `qdel JOBID` or `scancel JOBID`. You should replace `JOBID` with the job ids that you'd want to stop. Please note that you can get your `JOBID` by using `qstat` or `squeue`. + + +* **I get a message saying that there is an existing directory and cannot run my code. What do I do??** + + * Remove the existing directory, which was likely created for an earlier failed case. Alternatively, if this error occurs when using the `run_neon` script, you can use the `--overwrite` option. + +* **Which parameters need to have a re-build after changing them?** + + * You only need to rebuild if you've changed something in `env_build.xml` or `env_mach_pes.xml`. You can change `env_run.xml` or `user_nl_*` files without rebuilding. The only exception to that is if you are restarting and trying to change the years you are running over for DATM. For more information on when a rebuild is necessary, please see section 4.2 on [this website.](https://esmci.github.io/cime/versions/ufs_release_v1.0/html/users_guide/building-a-case.html) diff --git a/_sources/intro.md b/_sources/intro.md new file mode 100644 index 0000000..b6b7f94 --- /dev/null +++ b/_sources/intro.md @@ -0,0 +1,36 @@ +# Welcome to the 2022 CTSM mini-tutorial + +These tutorials are designed as an introduction to running the Community Terrestrial Systems Model (CTSM). We we will run through three configurations that include running a: +1. Supported NEON tower site, +2. Global FATES simution, and +3. Generic single point simulation. + +Using models can enhance the impact of ecological, hydrological, and atmospheric science research. Regardless of whether you are a seasoned modeler or a novice, this tutorial introduces different ways to set up and run CTSM in different configurations using the latest scientific and software developments in the Community Earth System Model (CESM). ngle point NCAR-NEON collaboration makes the process simple. + +We have developed new capabilities to easily run Community Land Model (CLM) simulations at NEON tower sites by setting up the appropriate model configurations, datasets, and initial conditions. With this new tool, CLM uses gap-filled meteorology from NEON tower sites, the dominant plant species is mapped to the appropriate model plant functional type (PFT), and soil characteristics used in the simulations are updated to match observations from NEON’s soil megapits. Gap-filled NEON tower flux data are also available for model evaluation. Additionally, all the commands to run the model are combined into a script that you can easily call from a single line of code. This part of the tutorial was supported by an NSF investment to foster NCAR-NEON collaborations to generate cyberinfrastructure tools for the university research and teaching community. + +These new capabilities are packaged into a Docker container, CESM-Lab, so that you can run simulations on any computing system, including your laptop or the cloud. Within the CESM-Lab container, you will find tutorials that guide you through how to run a CLM simulation and help you to access, process, visualize and evaluate model simulations. + +This tutorial will guide you through setting up a container on your local system and it will guide you through running a simulation and provides example of basic visualization and analysis of the simulation results. + + + +## Resources + +[CTSM Technical Documentation](https://escomp.github.io/ctsm-docs/versions/master/html/index.html) + +[CTSM User's Guide](https://escomp.github.io/ctsm-docs/versions/master/html/users_guide/index.html) + +[Quickstart Guide for Various Model Configuraions](https://escomp.github.io/CESM/release-cesm2/quickstart.html#create-a-case) + +[Running single-point cases other than NEON](https://escomp.github.io/ctsm-docs/versions/master/html/users_guide/running-single-points/single-point-and-regional-grid-configurations.html) + + +## Questions + +For questions about running simulations, please use DiscussCESM Forums: + +[Containers & Cloud Platforms Forum](https://bb.cgd.ucar.edu/cesm/forums/containers-cloud-platforms.162/) + +[CTSM Forum](https://bb.cgd.ucar.edu/cesm/forums/ctsm-clm-mosart-rtm.134/) + diff --git a/_sources/notebooks/ContributedNotebooks/README.md b/_sources/notebooks/ContributedNotebooks/README.md new file mode 100644 index 0000000..0f69359 --- /dev/null +++ b/_sources/notebooks/ContributedNotebooks/README.md @@ -0,0 +1,10 @@ +If you'd like to contribute notebooks, please add them in this directory! + +Suggested workflow: Please open a pull request by forking the NEON_Tutorial_2023 branch of the CTSM-Tutorial. + +If you find any issues, please add them to our [issues board](https://github.com/NCAR/CTSM-Tutorial/issues). + +Feel free to reach out to us with any questions: +- Teagan King tking@ucar.edu +- Will Wieder wwieder@ucar.edu + diff --git a/_sources/notebooks/GettingStarted/1_NEON_Simulation_Tutorial.ipynb b/_sources/notebooks/GettingStarted/1_NEON_Simulation_Tutorial.ipynb new file mode 100644 index 0000000..558ed07 --- /dev/null +++ b/_sources/notebooks/GettingStarted/1_NEON_Simulation_Tutorial.ipynb @@ -0,0 +1,407 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## Tutorial 1: *CTSM Simulations at NEON Tower Sites*\n", + "\n", + "This tutorial is an introduction to running the Community Terrestrial Systems Model (CTSM) at [NEON tower sites](https://www.neonscience.org/). It will guide you through running a simulation and provides example visualization of the simulation results. If you want to dive deeper, after you complete a NEON tower simulation in this tutorial, you can use the [NEON_Visualization_Tutorial](https://github.com/NCAR/NEON-visualization) to explore observation and model data further.\n", + "

\n", + "\n", + "![NEON Tower](../../images/STER_tower.png)\n", + "\n", + "\n", + "**A few notes about the model:** There are several configuration options of CTSM, and throughout this tutorial we will use the Community Land Model (CLM) configuration which is the climate and biogeochemistry mode of CTSM. Throughout the rest of this tutorial, we refer to the model as CLM and will use version 5.1 with active biogeochemistry (CLM5.1-BGC).\n", + "\n", + "Additional information about CTSM and CLM is available [on the website](https://www.cesm.ucar.edu/models/cesm2/land/), including [technical documentation](https://escomp.github.io/ctsm-docs/versions/master/html/tech_note/index.html), a [user's guide](https://escomp.github.io/ctsm-docs/versions/master/html/users_guide/index.html), and a [quickstart guide](https://escomp.github.io/CESM/release-cesm2/quickstart.html#create-a-case) for running various model configurations beyond what is covered in this tutorial. Details on [history field (or output variables)](https://escomp.github.io/ctsm-docs/versions/master/html/users_guide/setting-up-and-running-a-case/master_list_nofates.html) and variable naming conventions are also available.\n", + "\n", + "Specifically, this example runs a single point case with data from a flux tower that's part of the National Ecological Observatory Network (NEON). You can find out more about the [NCAR-NEON collaboration at this website](https://github.com/NCAR/NEON-visualization). This effort aims to links NCAR’s modeling capabilities with NEON’s measurement network through an NSF supported cyberinfrastructure project.\n", + "\n", + "**Questions about this tutorial?** Please post them on the [CTSM forum in the CESM Bulletin Board](https://bb.cgd.ucar.edu/cesm/forums/ctsm-clm-mosart-rtm.134/). Note that this resource will require you to register and log in so that you can be notified of responses to your inquiries. You can also file issues on the [CTSM tutorial 2022 GitHub repository](https://github.com/NCAR/CTSM-Tutorial-2022).\n", + "***" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## In this tutorial\n", + "\n", + "The tutorial has several components. Below you will find steps to: \n", + "1. Set up and run a simulation\n", + "2. Locate CLM model data\n", + "3. Look at plots of simulated soil temperature and moisture data" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "

1. Set up and run a simulation

\n", + "\n", + "*This step guides you through running a CLM model simulation for a NEON flux tower using meteorology observations from the tower. Here, the many steps to run CLM are condensed into a single function. On Day 2 of the tutorial we'll provide instructions for modifying code.*
\n", + "\n", + "***\n", + "

1.1 Select a NEON tower site to simulate.

\n", + "\n", + "NEON towers currently available for simulation includes: \n", + "\n", + "```\n", + "ABBY,BARR,BART,BLAN,BONA,CLBJ,CPER,DCFS,DEJU,DELA,DSNY,\n", + "GRSM,GUAN,HARV,HEAL,JERC,JORN,KONA,KONZ,LAJA,LENO,MLBS,\n", + "MOAB,NIWO,NOGP,OAES,ONAQ,ORNL,OSBS,PUUM,RMNP,SCBI,SERC,\n", + "SJER,SOAP,SRER,STEI,STER,TALL,TEAK,TOOL,TREE,UKFS,UNDE,\n", + "WOOD,WREF,YELL\n", + "```\n", + "\n", + "**NOTE:** NIWO and PUUM have data gaps that prevent us from running for a full calendar year\n", + "\n", + "The [NEON website](https://www.neonscience.org/field-sites/explore-field-sites) describes tower sites in more detail.\n", + "\n", + "Before running the below code, keep in mind:\n", + "- The executable code below selects the **KONZ** site for simulation. If you would like to simulate a different tower, select the NEON tower from the above list and change the 4-character site name inside the quotes below.\n", + "- The site must be defined correctly so you do not get an error in the next step.\n", + " - use all capital letters \n", + " - double-check that the letters match one of the above site names\n", + "\n", + "*Execute the cell below by clicking in the cell below, and then either clicking the play button in the menu bar above, or pressing 'shift+enter'*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#Change the 4-character NEON site below.\n", + "neon_site= \"KONZ\"\n", + "\n", + "# Set an environment variable to the site we want to use, for easier use in scripts\n", + "import os\n", + "os.environ['site'] = neon_site" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "***\n", + "

1.2 Create and run a NEON tower site simulation.

\n", + "\n", + "The executable code below runs a python script, `run_neon.py`. This script:\n", + "\n", + "* creates (`create_newcase`)\n", + "* sets up (`case.setup`)\n", + "* compiles (`case.build`)\n", + "* runs (`case.submit`)\n", + " \n", + "We'll go over all of these in more detail for the Day 1 tutorial.\n", + "\n", + "Bellow we'll run a simulation for the tower site you specified above for all years that tower meteorology data are available. The text in parentheses show the commands that are typically required to set up and run a simulation. These steps are automated for you in the `run_neon` script.\n", + "\n", + "Note that this step requires input data (~2.5GB) for the model simulation. For the cloud environment, this data is predownloaded and ready to use. If you're doing this tutorial in the single-user containerized CESM-Lab environment, downloading this data may take several minutes to complete, depending on your internet speeds, so please be patient. Many things will print below the cell as data are downloaded and the model compiles. \n", + "\n", + "\n", + "
\n", + "NOTE: You might see lines that say 'ERROR', 'WARNING' or 'file not found'; this is ok if the simulation continues running to completion, and will be addressed in future changes to our data download process.\n", + "
\n", + "\n", + "Run the command below - **note that it will take several minutes without printing additional updates, so be patient!** We are using a 'helper' script here, 'qcmd', which will allocate a small compute node for each individual to build and run the case. \n", + "\n", + "**When the build completes successfully you'll see a notice that the MODEL BUILD HAS FINISHED SUCCESSFULLY.** You can read on, but before executing any code blocks in the notebook **wait for the model to build. This can take a while.**\n", + "\n", + "\n", + "
\n", + "\n", + "NOTE: The command qcmd -- ./case.build is specific for NCAR environments, including Cheyenne and cloud configurations, and runs the command on a computing node, reducing the load on the login node. You must include qcmd -- when running on Cheyenne, and it's highly advised on shared cloud systems too.\n", + "
\n", + "\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "qcmd -- run_neon --neon-sites $site --output-root ~/scratch/NEON_cases" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "

1.3 Check your job status

\n", + "\n", + "At this point, your job is submitted, but jobs on shared systems like Cheyenne and the cloud often need to wait for resources. You can check to see if your job is complete by running the 'qstat' command.\n", + "\n", + "Try that now in the following cell, and re-run this cell periodically until it no longer shows any output for you. This will take up to 25 minutes in total - about 5 for building the model, and 20 for running it for the 44 simulated months. So grab a coffee or a snack, and check back after!" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "!qstat -u ${USER}" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "---\n", + "Once your jobs are complete (or show the 'C' state under the 'Use' column, which means complete), we can check the CaseStatus file to ensure there were no errors and it completed successfully. To do this, we'll 'tail' the end of the CaseStatus file:" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "!tail ~/scratch/NEON_cases/${site}.transient/CaseStatus" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "You should see several lines, with the middle one saying 'case.run success'. \n", + "\n", + "Before that you'll see notifications about xml changes, case.setup, and case.submit, and case.run" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "Congratulations! \n", + " \n", + "You've created and run CLM for the NEON tower you selected.\n", + "Follow the steps below to see a few example plots from simulated data.**\n", + "
\n", + "\n", + "**Note:** If your model simulation did not complete, there will likely be an error message with more information. If you do not understand the error message, please post your question on the [CTSM forum in the CESM Bulletin Board](https://bb.cgd.ucar.edu/cesm/forums/ctsm-clm-mosart-rtm.134/).\n" + ] + }, + { + "cell_type": "markdown", + "metadata": { + "tags": [] + }, + "source": [ + "***\n", + "

Optional

\n", + "\n", + "If you would like to see additional and more advanced options for running NEON tower site simulations, many are listed in the python script you just executed. You can use the `--help` option to see more.

\n", + "\n", + "*Executing the below cell is optional and will print options available options in the `run_neon` python script*:\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "run_neon --help" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "------------\n", + "\n", + "#### Below are a few additional tips for running simulations: \n", + "\n", + " __Tip:__ You can run multiple neon sites at once by choosing multiple neon sites in the command line argument. For example:\n", + ">\n", + ">```\n", + ">run_neon.py --neon-sites ABBY BART BLAN\n", + ">```\n", + "\n", + "
\n", + "\n", + " __Tip:__ Use the `--overwrite` option to overwrite existing case directories.\n", + ">\n", + ">If you run a simulation for a NEON site that you have previously simulated, you will see an error like the following:\n", + ">```\n", + ">Case already exists in /home//scratch/NEON_cases/ABBY.transient, not overwritting.\n", + ">```\n", + ">The overwrite option (e.g., adding `--overwrite` to the end of the `run_neon` command) can be used to avoid this error. \n", + "\n", + "\n", + "
\n", + "\n", + " __Tip:__ You can run the above `run_neon` command in your terminal shell. You will need to specify the NEON site and the output-root path by replacing `` and `` below with the appropriate values:\n", + "\n", + ">```\n", + ">run_neon.py --neon-sites --output-root \n", + ">```\n", + "\n", + "
\n", + " \n", + " __Tip:__ The container will not overwrite existing files. If there are newer versions of a tutorial or input data you want to download, you must delete the existing tutorials or data first. You can do this by moving the files from the `Simulations` folder on your Desktop into the trash.\n", + " \n", + "
\n", + " \n", + "**Note:** More information about setting up and modifying simulations, including changing model code, will be available in an upcoming tutorial. \n" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "________\n", + "

2. Explore CTSM model data

\n", + "\n", + "*When your simulation completes, this step guides you through exploring the data.\n", + "There are countless ways of analyzing and processing model data. \n", + "The below steps step through where to find model data and creates a plot to visualize some model data.*\n", + "***" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "

2.1 Locate model data

\n", + "\n", + "When a simulation completes, the data are stored in the `archive` directory. In this directory you will find files that include data for every day of the simulation, as well as files that average model variables monthly.

\n", + "\n", + "*Run the code below to see a subset of the files listed.*\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "!ls ~/scratch/NEON_cases/archive/$site.transient/lnd/hist/*2018*.nc |head -20" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "\n", + "Notice that each line includes the location of the file (`/home/user/archive/{simulation_name}/lnd/hist/`) and file name. The file names are automatically generated and are composed of:\n", + "* the simulation name, which includes:\n", + " * the NEON site\n", + " * the type of simulation \n", + " * The simulation you ran is \"transient\". This means the model was initialized and ran for the full length of available data. The initial conditions files for the transient tower simulations were created by cycling over 2018-2019 tower meteorological data. \n", + "* the date of simulated data\n", + "\n", + "The files are saved in netcdf format (denoted with the `.nc` file extension), a file format commonly used for storing large, multi-dimensional scientific variables.\n", + "Netcdf files are platform independent and self-describing; each file includes metadata that describes the data, including: **variables**, **dimensions**, and **attributes**. You can explore the files more in the NEON_Simple_Visualization_Tutorial\n", + "\n", + "The NEON tower simulations generate two types of files:\n", + "* `*h0*`: Variables that are averaged monthly. One file is available for every month of the simulation. These files include hundreds of variables.\n", + "* `*h1*`: Variables that are recorded every 30 minutes. Values are aggregated into one file for each day of the simulation. Each file includes 48 data points for selected variables.\n", + "\n", + "*Note that you can also find the model data in the 'Simulation' folder on your desktop, which was created as part of this tutorial.*\n", + "****\n" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "

2.2 Visualize the output

\n", + "\n", + "Below we create a plot of simulated soil temperature using a predefined function, `plot_soil_profile_timeseries`.\n", + "\n", + "\n", + "The `plot_soil_profile_timeseries` function points to the simulated data files in your `archive` directory, extracts a variable (soil temperature, `TSOI`, in this case), and plots the soil profile. The y-axis shows soil depth and the x-axis shows time. Note that time is currently set for the year 2018. You can change the `year` variable below to plot different years from 2018 through 2020." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "import os\n", + "from neon_utils import plot_soil_profile_timeseries\n", + "username = os.environ['USER'] # Get our username, for use in paths\n", + "sim_path = \"/scratch/\"+username+\"/NEON_cases/archive/\"+neon_site+\".transient/lnd/hist/\"\n", + "\n", + "case_name = neon_site+\".transient.clm2\"\n", + "year = 2018\n", + "\n", + "plot_soil_profile_timeseries(sim_path, neon_site, case_name, 'TSOI', year)" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "You might also be interested in the soil moisture at this site. The `plot_soil_profile_timeseries` function can also plot soil moisture (`H2OSOI`). Run the below cell to see the soil moisture profile for 2018. You can change the `year` variable below to plot different years from 2018 through 2020.\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "case_name = neon_site+\".transient.clm2\"\n", + "year = 2018\n", + "\n", + "plot_soil_profile_timeseries(sim_path, neon_site, case_name, 'H2OSOI', year)" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "Congratulations! \n", + " \n", + "You have now completed a NEON tower simulation, located the files, and made a plot from the simulation data.\n", + "
\n", + "\n", + "\n", + "**Additional examples of visualizations and evaluation of your NEON simulation against NEON observations are available in the [NEON Visualization Tutorial](./2_NEON_Simulation_Visualization.ipynb).**\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.9.12" + } + }, + "nbformat": 4, + "nbformat_minor": 4 +} diff --git a/_sources/notebooks/GettingStarted/2_NEON_Simulation_Visualization.ipynb b/_sources/notebooks/GettingStarted/2_NEON_Simulation_Visualization.ipynb new file mode 100644 index 0000000..8d87596 --- /dev/null +++ b/_sources/notebooks/GettingStarted/2_NEON_Simulation_Visualization.ipynb @@ -0,0 +1,1218 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# Tutorial 2: *CTSM Evaluations at NEON Tower Sites*\n", + "\n", + "This tutorial is an introduction to evaluating CTSM at a NEON tower site. It provides example visualizations and evaluation of simulated latent heat flux using NEON tower observations. This tutorial uses results from the case you ran in `1_NEON_Simulation_Tutorial`, but you don't have to wait for those runs to complete before doing this tutorial. We've pre-staged model results from this simulation in a shared directory so that you can analyze results of your simulations regardless of whether they've completed.\n", + "\n", + "------\n", + "\n", + "**This tutorial uses a Jupyter Notebook.** A Jupyter Notebook is an interactive computing environment that enables the creation and sharing of documents that contain discrete cells of text or documentation and executable code, including plots. It allows users to access, run, and edit the code in a browser. To interact with this notebook:\n", + "\n", + "- Execute or \"run\" cells of executable code (cells denoted with '[ ]:') using the play button in the menu at the top (see below image)\n", + "\n", + "- The results of running code, such as plots, will appear below that cell\n", + "\n", + "- Each step must be followed in order, otherwise you may encounter errors\n", + "\n", + "![run cell](https://problemsolvingwithpython.com/02-Jupyter-Notebooks/images/run_cell.png)\n", + "\n", + "For more information on Jupyter notebooks please see the [Jupyter Notebook Quick Start Guide](https://jupyter-notebook-beginner-guide.readthedocs.io/en/latest/what_is_jupyter.html). \n", + "\n", + "***" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## In this tutorial :\n", + "\n", + "The tutorial has several components. Below you will find steps and instructions to:\n", + "1. Become familiar with Jupyter notebooks\n", + "1. Begin getting acquainted with python packages and their utilities\n", + "1. Explore CLM model data\n", + "1. Explore NEON observation data\n", + "1. Compare CLM and NEON latent heat flux data" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "________\n", + "# 1. Explore CLM model data\n", + "\n", + "There are countless ways of analyzing and processing model data. This tutorial uses Matplotlib, a comprehensive data visualization and plotting library for Python. For more information on Matplotlib, please see the [User's Guide](https://matplotlib.org/stable/users/index.html)." + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Before diving in, set the NEON site that you simulated in the cell below. As a refresher, NEON tower sites include:\n", + "\n", + "```\n", + "ABBY,BARR,BART,BLAN,BONA,CLBJ,CPER,DCFS,DEJU,DELA,DSNY,\n", + "GRSM,GUAN,HARV,HEAL,JERC,JORN,KONA,KONZ,LAJA,LENO,MLBS,\n", + "MOAB,NIWO,NOGP,OAES,ONAQ,ORNL,OSBS,PUUM,RMNP,SCBI,SERC,\n", + "SJER,SOAP,SRER,STEI,STER,TALL,TEAK,TOOL,TREE,UKFS,UNDE,\n", + "WOOD,WREF,YELL\n", + "```\n", + "\n", + "**NOTE:** NIWO and PUUM have data gaps that prevent us from running for a full calendar year and cannotbe plotted\n", + "\n", + "\n", + "*The tutorial is currently set to use the KONZ site. If you ran a simulation for a different tower site, please change the 4-character site name in quotes below to the same as your simulation.*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#Change the 4-character NEON site below to point to your NEON site:\n", + "neon_site = \"KONZ\"" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "***\n", + "## 1.1 Locate model data\n", + "\n", + "When the simulation completes, the data are transferred to an `archive` directory. In this directory, there are files that include data for every day of the simulation, as well as files that average model variables monthly.

\n", + " \n", + "In this tutorial, we are using pre-staged results, but the results should be identical to the NEON cases you just ran.\n", + " \n", + "*Run the cell below to see a subset of the files listed:*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "!ls /scratch/data/NEONv2/hist/{neon_site}.transient/lnd/hist |head -20" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Each line of the list above includes the file path (`/scratch/data/NEONv2/hist/{simulation_name}/lnd/hist/`) and file name. The file names are automatically generated and comprise:\n", + "* the simulation name, which includes:\n", + " * the NEON site\n", + " * the type of simulation \n", + " * The simulation you ran is \"transient\". This means the model was initialized and ran for the full length of available data. The initial conditions files for the transient tower simulations were created by cycling over 2018-2019 tower meteorological data. \n", + "* the date of simulated data\n", + "\n", + "The NEON tower simulations generate two types of files:\n", + "* `*h0*`: Variables that are averaged monthly. One file is available for every month of the simulation.\n", + "* `*h1*`: Variables that are recorded every 30 minutes. Values are aggregated into one file for each day of the simulation. Each file includes 48 data points.\n", + "\n", + "**Note:** Only a subset of CLM variables are included on the `*h1*` files, with many more variables included on the monthly-averaged `*h0*` files. A full list of variables that are simulated by CLM is available [on this website](https://escomp.github.io/ctsm-docs/versions/master/html/users_guide/setting-up-and-running-a-case/master_list_nofates.html).\n", + "\n", + "*Note that you can also find the model data in the 'Simulation' folder on your desktop, which was created as part of this tutorial.*\n", + "****\n" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "The files are saved in netcdf format (denoted with the `.nc` file extension), a file format commonly used for storing large, multi-dimensional scientific variables.\n", + "Netcdf files are platform independent and self-describing; each file includes metadata that describes the data, including: **variables**, **dimensions**, and **attributes**.\n", + "\n", + "The figure below provides a generic example of the data structure in a netcdf file. The dataset illustrated has two variables (temperature and pressure) that have three dimensions. Coordinate data (e.g., latitude, longitude, time) that describe the data are also included. \n", + "\n", + "*Note that while each file for NEON tower simulations has multiple variables, the simulation ran for a single site rather than a larger spatial grid and therefore do not include the latitude and longitude dimensions illustrated here. Within each multi-variable file, most of the variables have one dimension (time), while a few soil variables (e.g., moisture, temperature) have two dimensions (time x depth).*\n", + "\n", + "\"isolated\"\n", + "****" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 1.2 Explore Simulated Data\n", + "\n", + "This step has several components, which are broken into smaller steps. \n" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### 1.2.1 Load Python Libraries\n", + "\n", + "To dig deeper into our model results, we'll use this notebook and some python packages to look at the data. \n", + "\n", + "*Run the below code to import the required python libraries*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#Import Libraries\n", + "%matplotlib inline\n", + "\n", + "import os\n", + "import time\n", + "import datetime\n", + "from glob import glob\n", + "from os.path import join, expanduser\n", + "\n", + "import numpy as np\n", + "import pandas as pd\n", + "import xarray as xr\n", + "\n", + "import matplotlib.pyplot as plt\n", + "from scipy import stats\n", + "from neon_utils import download_eval_files\n", + "\n", + "# suppress Future Warnings that are annoying...\n", + "import warnings\n", + "warnings.simplefilter(\"ignore\", category=FutureWarning)" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### 1.2.2 Select Simulation Year\n", + "\n", + "For simplicity, we focus on analyzing and evaluating a single year of data.

\n", + "\n", + "The code below uses data for **2018**, but data are available through this year. You can select a different year by changing the year in the quotes below.

\n", + "*Run the below code to identify the year of interest for making the plots. Note that the same year will be used to download observational data below*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#Specify the year below\n", + "year = \"2018\"" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Paths are different for every user based on their usernames, so we get the username to use for paths:\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "username = os.environ['USER'] " + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### 1.2.3 Load model data files\n", + "\n", + "For reading the netCDF files, we are using the `xarray` Python package. You can learn more about [xarray on this website](http://xarray.pydata.org/en/stable/).\n", + "\n", + "The variable `sim_path` points to the location where simulation data are stored.\n", + "\n", + "*Run the code below to load the model data files. The code will print how many files were loaded*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#--The following line points to your directory:\n", + "#sim_path = \"/home/\"+username+\"/scratch/NEON_cases/archive/\"+neon_site+\".transient/lnd/hist/\"\n", + "\n", + "#-- But for now let's look at the pre-staged results: TODO check for latest directory\n", + "sim_path = \"/scratch/data/NEONv2/hist/\"+neon_site+\".transient/lnd/hist/\"\n", + "\n", + "\n", + "sim_files = sorted(glob(join(sim_path,neon_site+\".transient.clm2.h1.\"+year+\"*.nc\")))\n", + "\n", + "print(\"All Simulation files: [\", len(sim_files), \"files]\")" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### 1.2.4 Open model data files\n", + "\n", + "Here we use the python function `xarray.open_mfdataset`, which opens multiple netcdf files as a single xarray dataset. For more information on this xarray function, visit [the xarray website](\n", + "http://xarray.pydata.org/en/stable/generated/xarray.open_mfdataset.html).\n", + "\n", + "*Run the below cell to read in the data files. Note that this step might take a few minutes.* Please note that here for faster pre-processing we select only a few variables of interest. " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "ctsm_vars = ['FCEV', 'FCTR', 'FGEV','GPP']\n", + "\n", + "\n", + "'''select the variables we want to read in'''\n", + "def preprocess(ds, fields=ctsm_vars):\n", + " return ds[fields]\n", + "\n", + "start = time.time()\n", + "\n", + "ds_ctsm = xr.open_mfdataset(sim_files, decode_times=True, combine='by_coords', preprocess=preprocess)\n", + "\n", + "end = time.time()\n", + "print(\"Reading all simulation files took:\", end-start, \"seconds.\")" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Hint: To read all the variables of ctsm h1 history output files you can use the following block of code, but it will take longer." + ] + }, + { + "cell_type": "raw", + "metadata": {}, + "source": [ + "start = time.time()\n", + "\n", + "ds_ctsm = xr.open_mfdataset(sim_files, decode_times=True, combine='by_coords',parallel=True)\n", + "\n", + "end = time.time()\n", + "print(\"Reading all simulation files took:\", end-start, \"seconds.\")" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### 1.2.5 Optional Step: Explore dataset from simulations\n", + "\n", + "This step looks at the dataset that was just created from the simulation data. This step is not required, but will allow you to explore the python dataset and become familiar with the data.\n", + "\n", + "*Run the below cell to find more information about the data*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "ds_ctsm" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "In the output, you can click on `Dimensions`, `Coordinates`, `Data Variables`, and `Attributes` to expand and see the details and metadata associated with this dataset. \n", + "\n", + "If you click on `Data Variables`, you will see a list of all the available variables. You can click on the 'note' icon at the right end of the line for each variable to see a description of the variable (the `long_name`) and its `units`, as well as other information. Here are a few questions to consider:\n", + "\n", + "**Questions to consider** \n", + "1. What variables are available in the dataset?\n", + "2. What is the `long_name` and `unit` of the variable `FSH`? \n", + "3. Can you find the dimensions of this variable? \n", + "\n", + "**💡 Tip**: \n", + "Xarray has built-in plotting functions. For quick inspection of a variable, we can use `.plot()` to see it. The code below will make a basic plot of the Gross Primary Production (`GPP`) variable:" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "ds_ctsm['GPP'].plot()" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "You can select to plot only specific time period using .sel option.\n", + "\n", + "For example,let’s check GPP for June of 2018:" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "ds_ctsm.GPP.sel(time=slice('2018-06-01', '2018-06-30')).plot() ;" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "________\n", + "# 2. Explore NEON Tower Observation Data\n", + "\n", + "## 2.1 Download NEON data\n", + "\n", + "**A note about NEON evaluation data**: NEON data for evaluation are pulled from the API and the least restrictive quality control flags are applied. The data are subsequently gap-filled using a redundant data stream regression, while data that are still missing are filled using a Marginal Distribution Sampling (MDS) gap-filling technique. Unit conversions are performed and the data are formatted and supplied as monthly netCDF files. \n", + "\n", + "\n", + "To download the data, this step uses a preestablished function (`download_eval_files`) to download the NEON observational data files for the site and year specified above. The preprocessed NEON data are available for download from NEON's S3 bucket, with the full listing of available data [here](https://s3.data.neonscience.org/neon-ncar/listing.csv).\n", + "\n", + "\n", + ">Note that this downloads the evaluation data based on the year you selected above. If you would like to download all available NEON evaluation data from this site, change the word `year` to `\"all\"` (quotes included) below: `download_eval_files(neon_site, eval_dir, \"all\")`\n", + "\n", + "\n", + "*Run the cell below to download available NEON data from the site you selected above.*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "eval_dir = os.path.join(\"/home\", username, \"scratch/evaluation_files\")\n", + "\n", + "download_eval_files(neon_site, eval_dir, year)" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Hint: If the download does not work, you can directly point to the pre-staged results by uncommenting the cell below\n", + "\n", + "**NOTE, this is also faster for more years / sites**" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#eval_dir = '/scratch/data/NEONv2/eval'" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 2.2 Load NEON data\n", + " \n", + "*Run the two cells of code below. The code will print a list of files for the year specified above and read them into a dataset.*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "eval_path = os.path.join(eval_dir,neon_site)\n", + "\n", + "eval_files = sorted(glob(join(eval_path,neon_site+\"_eval_\"+year+\"*.nc\")))\n", + "\n", + "print(\"All Observation files:\")\n", + "print(*eval_files,sep='\\n')" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "start = time.time()\n", + "\n", + "ds_eval = xr.open_mfdataset(eval_files, decode_times=True, combine='by_coords')\n", + "\n", + "end = time.time()\n", + "print(\"Reading all observation files took:\", end-start, \"s.\")" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "__________\n", + "# 3. Compare CLM and NEON latent heat flux data\n", + "\n", + "So far, we uploaded files of observational and model data. In this section we will compare observed and simulated **latent heat fluxes**. You can also explore other available variables with this code.\n", + "***\n", + "\n", + "### Format Data\n", + "The next cell of code processes the data into a common format to make analysis easier.\n", + "
\n", + "\n", + "**A note about model timestamps:** The CTSM history includes an initial 0th timestep for each model simulation. This offset in the time dimension can cause challenges when analyzing and evaluating model data if not treated properly. You may notice in the last line of the below cell, we shift the value by -1 to address this issue.\n", + "\n", + "*Run the below cell of code to extract the variables needed for this notebook and create a single dataframe that includes all the extracted variables*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#Convert CTSM data to a Pandas Dataframe for easier handling:\n", + "ctsm_vars = ['FCEV', 'FCTR', 'FGEV']\n", + "\n", + "df_ctsm = pd.DataFrame({'time':ds_ctsm.time})\n", + "\n", + "for var in ctsm_vars:\n", + " field = np.ravel ( ds_ctsm[var]) \n", + " df_ctsm[var]=field\n", + "\n", + "\n", + "#Convert NEON data to a Pandas Dataframe for easier handling:\n", + "eval_vars = ['EFLX_LH_TOT']\n", + "\n", + "df_eval = pd.DataFrame({'time':ds_eval.time})\n", + "\n", + "for var in eval_vars:\n", + " field = np.ravel ( ds_eval[var]) \n", + " df_eval[var]=field\n", + "\n", + "#-- make df_all that includes both obs and sim\n", + "df_all = df_eval\n", + "\n", + "#-- add simulation data to df_all and adjust for offset time dimension:\n", + "for var in ctsm_vars:\n", + " sim_var_name = \"sim_\"+var\n", + " #-- shift simulation data by one\n", + " df_all[sim_var_name]=df_ctsm[var].shift(-1).values" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "*The next cell gives us a quick look at the dataframe to make sure the data are available*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "df_all.head()" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 3.1 What is latent heat flux?\n", + "\n", + "Below we explore how well CLM simulates latent heat flux, which is directly observed at NEON towers. Latent heat flux is the energy for water evaporation from the ecosystem. Latent heat flux is a combination of plant transpiration, evaporation from leaf surfaces (e.g., from dew, after precipitation events, etc.), and evaporation from the soil:\n", + "\n", + "$$ Latent Heat Flux = Transpiration + Canopy Evaporation + Ground Evaporation $$\n", + "\n", + "Although NEON towers cannot distinguish how much each of these processes contributes to latent heat flux, CLM simulations can help us to disentangle the role of each. " + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "First we will calculate latent heat flux simulated by CLM by summing the component fluxes in the above equation. The CLM variables are:\n", + "\n", + ">$FCEV$: Canopy evaporation (W m-2)
\n", + ">$FCTR$: Canopy transpiration (W m-2)
\n", + ">$FGEV$: Ground evaporation (W m-2)
\n", + "\n", + "*Run the below cell to calculate simulated latent heat flux*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "clm_var = 'sim_EFLX_LH_TOT'\n", + "\n", + "#EFLX_LH_TOT = FCEV + FCTR +FGEV\n", + "df_all [clm_var] = df_all['sim_FCEV'] \\\n", + " + df_all['sim_FCTR']\\\n", + " + df_all['sim_FGEV']\n", + "\n", + "df_all.head()" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "******************\n", + "### Optional:\n", + "If you are unfamiliar with reading and using the netcdf file format that model and evaluation data are provided, you can save data different formats. The next cell of code will save the pre-processed data in `.csv`, or comma-seperated file format. \n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# Make the figures directory if it's not already there\n", + "out_dir = os.path.realpath(os.path.expanduser('~/scratch/NEON_cases/postprocessed_data'))\n", + "if not os.path.isdir(out_dir):\n", + " os.makedirs(out_dir, exist_ok=True)\n", + " \n", + "csv_out = os.path.join(out_dir, \"preprocessed_\"+neon_site+\"_\"+year+\".csv\")\n", + "df_all.to_csv(csv_out,index=False)" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "****\n", + "## 3.2 Plotting latent heat flux" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### 3.2.1 Daily Timeseries\n", + "This creates a time-series plot comparing daily average latent heat flux from observations (NEON) and simulations (CLM). To start, we need calculate the daily averages. Run the below cells of code to create the averages and plot.\n", + "\n", + "*First, we need to extract year, month, day and hour from time column*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#-- extract year, month, day, hour information from time\n", + "df_all['year'] = df_all['time'].dt.year\n", + "df_all['month'] = df_all['time'].dt.month\n", + "df_all['day'] = df_all['time'].dt.day\n", + "df_all['hour'] = df_all['time'].dt.hour" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "*Next, calculate daily averages*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "df_daily = df_all.groupby(['year','month','day']).mean('numeric_only').reset_index()\n", + "df_daily['time']=pd.to_datetime(df_daily[[\"year\", \"month\", \"day\"]])" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Using the daily averages, we will create a plot using Python's [matplotlib package](https://matplotlib.org/)\n", + "\n", + "*Run the below cell to create the plot:*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "plot_var = 'EFLX_LH_TOT'\n", + "sim_var = 'sim_'+plot_var\n", + "\n", + "plot_var_desc = \"Latent Heat Flux\"\n", + "plot_var_unit= \"W m$^{-2}$\"\n", + "\n", + "plt.figure(num=None, figsize=(13, 5), facecolor='w', edgecolor='k')\n", + " \n", + "ax = plt.gca()\n", + "df_daily.plot ( x= 'time', y = plot_var , marker = 'o' ,ax =ax , color = 'b',label=\"NEON\")\n", + "df_daily.plot ( x= 'time', y = 'sim_'+plot_var , marker = 'o' ,ax =ax , color = 'r',label=\"CLM\")\n", + "\n", + "plt.xlabel('Time', fontsize=17)\n", + "plt.ylabel(plot_var_desc+\" [\"+plot_var_unit+\"]\", fontsize=17)\n", + "plt.title(year+\" \"+neon_site, fontweight='bold',fontsize=17)\n", + "plt.show()" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "#### **Are the simulations and observations in the plot similar?**\n", + "\n", + "It is important to also look at variability, as this gives us an indication of when and where simulations are outside the range of observed values. \n", + "\n", + "*Let's explore variability by adding the daily standard deviation as a shaded area to the plot*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "df_daily_std = df_all.groupby(['year','month','day']).std().reset_index()\n", + "df_daily_std['time'] = pd.to_datetime(df_daily_std[[\"year\", \"month\", \"day\"]])\n", + "\n", + "plt.figure(num=None, figsize=(13, 5), facecolor='w', edgecolor='k')\n", + "\n", + "plt.plot ( df_daily.time, df_daily[plot_var], marker = 'o' , color = 'b',label=\"NEON\")\n", + "plt.plot ( df_daily.time, df_daily[sim_var], marker = 'o' , color = 'r',label=\"CLM\")\n", + "\n", + "plt.fill_between(df_daily.time, df_daily[plot_var]-df_daily_std[plot_var], df_daily[plot_var]+df_daily_std[plot_var] ,alpha=0.1, color = 'b')\n", + "plt.fill_between(df_daily.time, df_daily[sim_var]-df_daily_std[sim_var], df_daily[sim_var]+df_daily_std[sim_var] ,alpha=0.1, color = 'r')\n", + "\n", + "plt.legend()\n", + "plt.xlabel('Time', fontsize=17)\n", + "plt.ylabel(plot_var_desc+\" [\"+plot_var_unit+\"]\", fontsize=17)\n", + "plt.title(year+\" \"+neon_site, fontweight='bold',fontsize=17)\n", + "plt.show()" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "The standard deviation allows us to see when CLM underpredicts or overpredicts the NEON tower observations.\n", + "\n", + "#### **Questions to consider:**\n", + "\n", + "1. When is the latent heat hlux highest at this site? When is it lowest?
\n", + "1. Do fluxes simulated by CLM fall within the range of NEON tower observation variability?
\n", + "1. What times of year does CLM shows the best and worst performance in predicting latent heat flux ?
" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "*****\n", + "### 3.2.2 Monthly Averages & Component Fluxes: Absolute Values\n", + "\n", + "Next we will disentangle whether transpiration, canopy evaporation, or ground evaporation is the dominant contribution to latent heat flux during each month using CLM data. As mentioned in section 3.1, NEON observations cannot distinguish how much each of these processes contributes to latent heat fluxes. \n", + "\n", + "*Run the cell below to calculate monthly averages*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "df_monthly = df_all.groupby(['year','month']).mean('numeric_only').reset_index()\n", + "df_monthly[\"day\"]=15\n", + "df_monthly['time']=pd.to_datetime(df_monthly[[\"year\", \"month\",\"day\"]])" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "##### Next, create a stacked bar chart showing components of simulated latent heat flux over different months\n", + "\n", + "*Run the cell below to create the plot*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "def line_format(label):\n", + " \"\"\"\n", + " Helper function to convert time label to the format of pandas line plot\n", + " \"\"\"\n", + " month = label.month_name()[:3]\n", + " if month == 'Jan':\n", + " month += f'\\n{label.year}'\n", + " return month\n", + "\n", + "\n", + "plt.figure(num=None, figsize=(13, 5), facecolor='w', edgecolor='k')\n", + " \n", + "ax = plt.gca()\n", + "\n", + "df_monthly.plot ( x= 'time', y = 'EFLX_LH_TOT' , marker = 'o' ,ax =ax , color = 'black',label=\"NEON Latent Heat Flux\",use_index=False)\n", + "df_monthly[['time','sim_FCEV','sim_FCTR','sim_FGEV']].plot.bar ( x= 'time',stacked='True',ax=ax,rot=0)\n", + "\n", + "ax.set_xticklabels(map(line_format, df_monthly.time))\n", + "\n", + "#set labels for the legend\n", + "ax.legend([\"NEON Latent Heat Flux\", \"Canopy Evaporation\", \"Canopy Transpiration\", \"Ground Evaporation\"]);\n", + "\n", + "plt.xlabel('Time')\n", + "plt.ylabel(plot_var_desc+\" [\"+plot_var_unit+\"]\")\n", + " \n", + "plt.title(year+\" \"+neon_site, fontweight='bold')\n", + "plt.show()" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "The monthly averages of NEON latent heat flux observation are plotted as a line on top of the barplot of CLM data for reference.\n", + "\n", + "#### **Questions to consider:**\n", + "\n", + "1. Which months does CLM overestimate and underestimate observed latent heat fluxes for this site? \n", + "1. What times of year is *canopy transpiration* the largest contributor to the total CLM latent heat flux?\n", + "1. What times of year are *canopy evaporation* and *ground evaporation* important contributors to the total CLM latent heat flux? \n", + "1. What is the dominant component flux when CLM overestimates observed latent heat fluxes? When CLM underestimates latent heat fluxes?\n", + "****" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### 3.2.3 Monthly Averages & Component Fluxes: Proportional Contributions\n", + "It might be easier to see the proportional contributions of transpiration and evaporation fluxes to total latent heat flux. The code below makes a more advanced plot with two y-axes that helps to illustrate the absolute values of monthly latent heat fluxes and the proportion of component fluxes each month. " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#-- calculate the percentage of total latent heat flux\n", + "df_monthly ['sim_FCEV_perc']= df_monthly ['sim_FCEV']/(df_monthly ['sim_FCEV']+df_monthly ['sim_FCTR']+df_monthly ['sim_FGEV'])*100\n", + "df_monthly ['sim_FCTR_perc']= df_monthly ['sim_FCTR']/(df_monthly ['sim_FCEV']+df_monthly ['sim_FCTR']+df_monthly ['sim_FGEV'])*100\n", + "df_monthly ['sim_FGEV_perc']= df_monthly ['sim_FGEV']/(df_monthly ['sim_FCEV']+df_monthly ['sim_FCTR']+df_monthly ['sim_FGEV'])*100\n", + "\n", + "plt.figure(num=None, figsize=(13, 7), facecolor='w', edgecolor='k')\n", + " \n", + "ax = plt.gca()\n", + "\n", + "df_monthly[['time','sim_FCEV_perc','sim_FCTR_perc','sim_FGEV_perc']].plot.bar ( x= 'time',stacked='True',ax=ax,rot=0)\n", + "\n", + "ax.set_xticklabels(map(line_format, df_monthly.time))\n", + "ax.set_ylabel('% Components Latent Heat Flux', fontsize=16)\n", + "ax.legend(bbox_to_anchor=(1.04,0), loc=\"lower left\",labels=[\"% Canopy Evaporation\",\"% Canopy Transpiration\",\"% Ground Evaporation\"])\n", + "ax2 = ax.twinx()\n", + "df_monthly.plot ( x= 'time', y = 'sim_EFLX_LH_TOT' , marker = 'o' ,ax =ax2 , color = 'b',label=\"CLM Latent Heat\",use_index=False)\n", + "df_monthly.plot ( x= 'time', y = 'EFLX_LH_TOT' , marker = 'o' ,ax =ax2 , color = 'r',label=\"NEON Latent Heat\",use_index=False)\n", + "\n", + "plt.ylabel(plot_var_desc+\" [\"+plot_var_unit+\"]\")\n", + "plt.legend(bbox_to_anchor=(1.04,1), loc=\"upper left\")\n", + "\n", + "plt.title(year+\" \"+neon_site, fontweight='bold')\n", + "plt.show()" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "______________" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### 3.2.4 Annual and Seasonal Correlations\n", + "Scatter plots can help to describe the relationship between latent heat flux and the component transpiration and evaporation fluxes. We can look at these relationships using data from CLM simulations.\n", + "\n", + "First, plot annual average relationships.\n", + "\n", + "*Run the cells below to first define a generic function that plot scatter diagrams and add a regression line, and then to generate the plots.*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#Defining generic function for scatter plots\n", + "def detailed_scatter (x, y, color):\n", + " plt.scatter (x,y, marker=\"o\",color = color)\n", + " slope, intercept, r_value, p_value, std_err = stats.linregress(x,y)\n", + " line = slope*x+intercept\n", + " plt.plot(x,line,'black', label='y={:.2f}x+{:.2f}'.format(slope,intercept)+\" (R2=\"+\"{:.2f}\".format(r_value)+\")\")\n", + " plt.legend(fontsize=13)" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#Generating plots\n", + "plt.figure(num=None, figsize=(15, 5), facecolor='w', edgecolor='k')\n", + "\n", + "plt.subplot(1, 3, 1)\n", + "detailed_scatter (df_daily.sim_FCEV, df_daily.sim_EFLX_LH_TOT, '#1f77b4')\n", + "plt.ylabel('Latent Heat [Wm-2]')\n", + "plt.xlabel('Canopy Evaporation [Wm-2]')\n", + "\n", + "plt.subplot(1, 3, 2)\n", + "detailed_scatter (df_daily.sim_FCTR, df_daily.sim_EFLX_LH_TOT, '#ff7f0e')\n", + "\n", + "plt.ylabel('Latent Heat [Wm-2]')\n", + "plt.xlabel('Canopy Transpiration [Wm-2]')\n", + "\n", + "plt.subplot(1, 3, 3)\n", + "detailed_scatter (df_daily.sim_FGEV, df_daily.sim_EFLX_LH_TOT,'#2ca02c')\n", + "\n", + "plt.ylabel('Latent Heat [Wm-2]')\n", + "plt.xlabel('Ground Evaporation [Wm-2]')\n", + "\n", + "plt.suptitle(year+\" \"+neon_site+\" Scatter Plots\", fontweight='bold')\n", + "\n", + "plt.tight_layout()\n", + "plt.show()" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "****\n", + "Since the relationships between latent heat flux and the component transpiration and evaporation fluxes likely vary throughout the year, we can investigate how the relationships change during different seasons.\n", + "\n", + "*Run the cell below to generate scatter plots by season*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "df_daily['season'] = ((df_daily['month']%12+3)//3).map({1:'DJF', 2: 'MAM', 3:'JJA', 4:'SON'})\n", + "\n", + "fig= plt.figure(num=None, figsize=(18,12), facecolor='w', edgecolor='k')\n", + "\n", + "season = 'MAM'\n", + "df_season = df_daily[df_daily['season']==season]\n", + "\n", + "plt.subplot(3, 4, 1)\n", + "detailed_scatter (df_season.sim_FCEV, df_season.sim_EFLX_LH_TOT, '#1f77b4')\n", + "plt.title(season, fontweight='bold')\n", + "plt.ylabel('Latent Heat [Wm-2]')\n", + "plt.xlabel('Canopy Evaporation [Wm-2]')\n", + "\n", + "plt.subplot(3, 4, 5)\n", + "detailed_scatter (df_season.sim_FCTR, df_season.sim_EFLX_LH_TOT, '#ff7f0e')\n", + "plt.ylabel('Latent Heat [Wm-2]')\n", + "plt.xlabel('Canopy Transpiration [Wm-2]')\n", + "\n", + "\n", + "plt.subplot(3, 4, 9)\n", + "detailed_scatter (df_season.sim_FGEV, df_season.sim_EFLX_LH_TOT,'#2ca02c')\n", + "plt.ylabel('Latent Heat [Wm-2]')\n", + "plt.xlabel('Ground Evaporation [Wm-2]')\n", + "\n", + "\n", + "season = 'JJA'\n", + "df_season = df_daily[df_daily['season']==season]\n", + "\n", + "plt.subplot(3, 4, 2)\n", + "detailed_scatter (df_season.sim_FCEV, df_season.sim_EFLX_LH_TOT, '#1f77b4')\n", + "plt.title(season, fontweight='bold')\n", + "plt.ylabel('Latent Heat [Wm-2]')\n", + "plt.xlabel('Canopy Evaporation [Wm-2]')\n", + "\n", + "plt.subplot(3, 4, 6)\n", + "detailed_scatter (df_season.sim_FCTR, df_season.sim_EFLX_LH_TOT, '#ff7f0e')\n", + "plt.ylabel('Latent Heat [Wm-2]')\n", + "plt.xlabel('Canopy Transpiration [Wm-2]')\n", + "\n", + "plt.subplot(3, 4, 10)\n", + "detailed_scatter (df_season.sim_FGEV, df_season.sim_EFLX_LH_TOT,'#2ca02c')\n", + "plt.ylabel('Latent Heat [Wm-2]')\n", + "plt.xlabel('Ground Evaporation [Wm-2]')\n", + "\n", + "\n", + "season = 'SON'\n", + "df_season = df_daily[df_daily['season']==season]\n", + "\n", + "plt.subplot(3, 4, 3)\n", + "detailed_scatter (df_season.sim_FCEV, df_season.sim_EFLX_LH_TOT, '#1f77b4')\n", + "plt.title(season, fontweight='bold')\n", + "plt.ylabel('Latent Heat [Wm-2]')\n", + "plt.xlabel('Canopy Evaporation [Wm-2]')\n", + "\n", + "plt.subplot(3, 4, 7)\n", + "detailed_scatter (df_season.sim_FCTR, df_season.sim_EFLX_LH_TOT, '#ff7f0e')\n", + "plt.ylabel('Latent Heat[Wm-2]')\n", + "plt.xlabel('Canopy Transpiration [Wm-2]')\n", + "\n", + "plt.subplot(3, 4, 11)\n", + "detailed_scatter (df_season.sim_FGEV, df_season.sim_EFLX_LH_TOT,'#2ca02c')\n", + "plt.ylabel('Latent Heat [Wm-2]')\n", + "plt.xlabel('Ground Evaporation [Wm-2]')\n", + "\n", + "season = 'DJF'\n", + "df_season = df_daily[df_daily['season']==season]\n", + "\n", + "plt.subplot(3, 4, 4)\n", + "detailed_scatter (df_season.sim_FCEV, df_season.sim_EFLX_LH_TOT, '#1f77b4')\n", + "plt.title(season, fontweight='bold')\n", + "plt.ylabel('Latent Heat [Wm-2]')\n", + "plt.xlabel('Canopy Evaporation [Wm-2]')\n", + "\n", + "plt.subplot(3, 4, 8)\n", + "detailed_scatter (df_season.sim_FCTR, df_season.sim_EFLX_LH_TOT, '#ff7f0e')\n", + "plt.ylabel('Latent Heat [Wm-2]')\n", + "plt.xlabel('Canopy Transpiration [Wm-2]')\n", + "\n", + "plt.subplot(3, 4, 12)\n", + "detailed_scatter (df_season.sim_FGEV, df_season.sim_EFLX_LH_TOT, '#2ca02c')\n", + "plt.ylabel('Latent Heat [Wm-2]')\n", + "plt.xlabel('Ground Evaporation [Wm-2]')\n", + "\n", + "fig.suptitle(year+\" \"+neon_site+ \" Seasonal Scatter Plots\", fontweight='bold')\n", + "fig.tight_layout()\n", + "\n", + "plt.show()" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "--------\n", + "### 3.2.5 Average Diel Cycle\n", + "\n", + "Latent heat flux also changes throughout the day. Does CLM capture the diel cycle that NEON observes? We can compare the average diel cycle from NEON observations and CLM simulations to find out. \n", + "\n", + "The `time` variable in the data is in Greenwich Mean Time (GMT). In the below plots, we adjust for the timezone so that the data are centered on local noon.\n", + "\n", + "\n", + "*Run the cell below to convert to local time*\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "tzone_shift = ds_eval.TimeDiffUtcLt\n", + "#convert to local time\n", + "df_all['local_time']= df_all['time'] + datetime.timedelta(hours=int(tzone_shift))\n", + "\n", + "df_all['local_hour'] = df_all['local_time'].dt.hour" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "*Run the cells below to calculate the annual average diel cycle and to generate a plot*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# Calculate annual average diel cycle and bias\n", + "diel_df_mean = df_all.groupby('local_hour').mean('numeric_only').reset_index()\n", + "diel_df_std = df_all.groupby('local_hour').std().reset_index()\n", + "\n", + "diel_df_mean['EFLX_LH_TOT_bias'] = diel_df_mean['sim_EFLX_LH_TOT']- diel_df_mean['EFLX_LH_TOT']\n", + "diel_df_mean.head()" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# Plot annual average diel cycle and bias\n", + "plt.figure(num=None, figsize=(13, 9), facecolor='w', edgecolor='k')\n", + " \n", + "plt.subplot(2, 1, 1) \n", + " \n", + "plt.plot ( diel_df_mean.local_hour, diel_df_mean[plot_var], marker = 'o' , color = 'b',label=\"NEON\")\n", + "plt.plot ( diel_df_mean.local_hour, diel_df_mean[sim_var], marker = 'o' , color = 'r',label=\"CLM\")\n", + "\n", + "plt.fill_between(diel_df_mean.local_hour, diel_df_mean[plot_var]-diel_df_std[plot_var], diel_df_mean[plot_var]+diel_df_std[plot_var] ,alpha=0.1, color = 'b')\n", + "plt.fill_between(diel_df_mean.local_hour, diel_df_mean[sim_var]-diel_df_std[sim_var], diel_df_mean[sim_var]+diel_df_std[sim_var] ,alpha=0.1, color = 'r')\n", + "plt.ylabel('Latent Heat Flux [Wm-2]', fontsize=16)\n", + "plt.axvline(x=12, color = 'gray',linestyle='dashed',alpha=0.75)\n", + "\n", + "plt.title(\"Diurnal Cycle of Latent Heat Flux \"+neon_site+\" \"+year, fontweight='bold')\n", + "plt.legend()\n", + "plt.subplot(4, 1, 3) \n", + "\n", + "ax = plt.gca() \n", + "diel_df_mean.plot ( x= 'local_hour', y = 'EFLX_LH_TOT_bias' , marker = 'o' ,ax =ax , color = 'black',label='Bias')\n", + "plt.xlabel('Hour', fontsize=16)\n", + "plt.ylabel('Bias', fontsize=16)\n", + "plt.axvline(x=12, color = 'gray',linestyle='dashed',alpha=0.75)\n", + "\n", + "plt.show()" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "#### How do transpiration and evaporation components of latent heat flux change throughout the day? \n", + "We can add a panel to the above plot that shows how CLM partitioned latent heat flux to find out. \n", + "\n", + "*Run the cells below to add a panel to the plot*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#Calculating diel cycle flux proportions\n", + "diel_df_mean['sim_FCEV_perc']= diel_df_mean ['sim_FCEV']/(diel_df_mean ['sim_FCEV']+diel_df_mean ['sim_FCTR']+diel_df_mean ['sim_FGEV'])*100\n", + "diel_df_mean ['sim_FCTR_perc']= diel_df_mean ['sim_FCTR']/(diel_df_mean ['sim_FCEV']+diel_df_mean ['sim_FCTR']+diel_df_mean ['sim_FGEV'])*100\n", + "diel_df_mean ['sim_FGEV_perc']= diel_df_mean ['sim_FGEV']/(diel_df_mean ['sim_FCEV']+diel_df_mean ['sim_FCTR']+diel_df_mean ['sim_FGEV'])*100" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#plotting diel cycl flux proportions\n", + "from matplotlib import gridspec\n", + "\n", + "fig= plt.figure(num=None, figsize=(13, 10), facecolor='w', edgecolor='k')\n", + "\n", + "gs = gridspec.GridSpec(3, 1, height_ratios=[3, 1, 2]) \n", + "\n", + "ax0 = plt.subplot(gs[0])\n", + " \n", + "ax0.plot ( diel_df_mean.local_hour, diel_df_mean['EFLX_LH_TOT'], marker = 'o' , color = 'b',label=\"NEON\")\n", + "ax0.plot ( diel_df_mean.local_hour, diel_df_mean['sim_EFLX_LH_TOT'], marker = 'o' , color = 'r',label=\"CLM\")\n", + "\n", + "ax0.fill_between(diel_df_mean.local_hour, diel_df_mean[plot_var]-diel_df_std[plot_var], diel_df_mean[plot_var]+diel_df_std[plot_var] ,alpha=0.1, color = 'b')\n", + "ax0.fill_between(diel_df_mean.local_hour, diel_df_mean[sim_var]-diel_df_std[sim_var], diel_df_mean[sim_var]+diel_df_std[sim_var] ,alpha=0.1, color = 'r')\n", + "plt.ylabel('Latent Heat Flux [Wm-2]', fontsize=16)\n", + "\n", + "plt.legend()\n", + "plt.title(\"Diurnal Cycle of Latent Heat Flux \"+neon_site+\" \"+year, fontweight='bold')\n", + "\n", + "ax1 = plt.subplot(gs[1])\n", + "diel_df_mean.plot ( x= 'local_hour', y = 'EFLX_LH_TOT_bias' , marker = 'o' ,ax =ax1 , color = 'black',label='Bias')\n", + "plt.xlabel('', fontsize=18)\n", + "plt.ylabel('Bias', fontsize=16)\n", + "\n", + "ax2 = plt.subplot(gs[2])\n", + "diel_df_mean[['local_hour','sim_FCEV','sim_FCTR','sim_FGEV']].plot.bar ( x= 'local_hour',stacked='True',ax=ax2,rot=0)\n", + "plt.ylabel('%Latent Heat Components', fontsize=16)\n", + "plt.xlabel('Hour', fontsize=16)\n", + "\n", + "plt.tight_layout()\n", + "\n", + "fig.show()" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "

\n", + "Congratulations! \n", + " \n", + "You have:\n", + "1. Accessed the CTSM model data\n", + "1. Accessed the NEON observational data\n", + "1. Evaluated CTSM latent heat fluxes compared to NEON tower observations\n", + "1. Determined when transpiration and evaporation fluxes drive latent heat fluxes\n", + "1. Learned how to average over different time periods and create different types of plots\n", + "
\n", + "\n", + "\n", + "\n", + "You can also use this script to explore additional CLM and NEON data by changing the variables in section 3 of this script.\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.11.3" + } + }, + "nbformat": 4, + "nbformat_minor": 4 +} diff --git a/_sources/notebooks/ProjectExamples/Basic_CTSM-NEON_Plots.ipynb b/_sources/notebooks/ProjectExamples/Basic_CTSM-NEON_Plots.ipynb new file mode 100644 index 0000000..8625ac1 --- /dev/null +++ b/_sources/notebooks/ProjectExamples/Basic_CTSM-NEON_Plots.ipynb @@ -0,0 +1,883 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "51f96e25-587b-4108-a7d9-34666f7a50e6", + "metadata": {}, + "source": [ + "# Basic plotting \n", + "## Examples of typical plots used to look at CTSM variables\n", + "\n", + "This tutorial uses [xarray](https://docs.xarray.dev/en/stable/user-guide/terminology.html) and [matplotlib](https://matplotlib.org/stable/index.html) to create several types of plots. You will find examples for how to:\n", + "\n", + "1. Load datasets with xarray\n", + "2. Manipulate data & make plots for:\n", + "> 2.1 Raw dataset;
\n", + "> 2.2 Diel averages for given months of the year;
\n", + "> 2.3 Daily and annual fluxes; and
\n", + "> 2.4 Annual climatologies\n", + "3. Export data to other file types (*e.g., .csv files*).\n", + "\n", + "------\n", + "\n", + "**This tutorial uses a Jupyter Notebook.** \n", + "For more information on Jupyter notebooks please see the information in the Getting Started tutorials or visit the [Jupyter Notebook Quick Start Guide](https://jupyter-notebook-beginner-guide.readthedocs.io/en/latest/what_is_jupyter.html). \n", + "\n", + "***" + ] + }, + { + "cell_type": "markdown", + "id": "7edf783f-9442-4a1b-ab7c-e9455be3ac5b", + "metadata": {}, + "source": [ + "# 1. Load Datasets\n", + "\n", + "## 1.1 Load Python Libraries\n", + "It is necessary to start by loading in the libraries that will be used in the script. Note that this list is a good starting point for most of your plotting needs. Not all the libraries loaded here will be used in this tutorial.\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "87882ecf-c37c-4b01-bfb4-24e56d671777", + "metadata": {}, + "outputs": [], + "source": [ + "import os\n", + "import time\n", + "import datetime\n", + "\n", + "import numpy as np\n", + "import pandas as pd\n", + "import xarray as xr\n", + "\n", + "from glob import glob\n", + "from os.path import join\n", + "\n", + "import matplotlib\n", + "import matplotlib.pyplot as plt\n", + "import matplotlib.dates as mdates\n", + "\n", + "from neon_utils import fix_time_h1\n", + "\n", + "# suppress Future Warnings that are annoying...\n", + "import warnings\n", + "warnings.simplefilter(\"ignore\", category=FutureWarning)" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "a2ea9556-75d1-4aa8-921b-8cd347edf263", + "metadata": {}, + "outputs": [], + "source": [ + "print('numpy '+np.__version__) ##-- was working with 1.23.5\n", + "print('pandas '+pd.__version__) ##-- was working with 1.5.3\n", + "print('xarray '+xr.__version__) ##-- was working with 2023.1.0" + ] + }, + { + "cell_type": "markdown", + "id": "1db2ec48-9370-422a-a4e4-893bc39906e2", + "metadata": {}, + "source": [ + "## 1.2 Point to history files \n", + "\n", + "### 1.2.1 Where are my simulation results?\n", + "When you run simulations, history files are all saved in the archive directory within your scratch directory. For the NEON simulations, this directory is `/scratch/NEON_cases/archive/`.\n", + "\n", + "We can print a list of the simulations in this directory. Because this is a python script and we want to use a [bash](https://opensource.com/resources/what-bash) command, we have to use bash magic, `%%bash` or `!` which turns the python cell block below into a bash cell. " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "acf88bc1-a2ab-4ae5-bfcb-232cc5d6ad82", + "metadata": {}, + "outputs": [], + "source": [ + "%%bash\n", + "ls ~/scratch/NEON_cases/archive/" + ] + }, + { + "cell_type": "markdown", + "id": "a2819f0e-486e-4e39-b019-1cc83842d30e", + "metadata": {}, + "source": [ + "#### Alternatively, we have all these cases you can run" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "e9cdd273-7082-4c9f-bcb8-1e76abb96c76", + "metadata": {}, + "outputs": [], + "source": [ + "%%bash\n", + "ls /scratch/data/NEONv2/hist/\n" + ] + }, + { + "cell_type": "markdown", + "id": "7caf652c-e127-4cb8-89cb-a4423b29f2b4", + "metadata": {}, + "source": [ + "\n", + "---\n", + "\n", + "### 1.2.2 Point to the data folder with history files \n", + "**The below code sets the following:**\n", + "- the NEON site; \n", + "- the path to the archive directory;\n", + "- and the subdirectory with data.\n", + "\n", + "**To Do:**\n", + "In the code below, change the name of the NEON site you simulated and want to create plots for" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "44e3bee8-fa6b-4c37-ae55-f62151640598", + "metadata": {}, + "outputs": [], + "source": [ + "neon_site = 'KONZ' #NEON site we're going to look at\n", + "archive = '~/scratch/NEON_cases/archive' #Path to archive directory\n", + "\n", + "# Alternatively, prestaged data from all NEON sites are here\n", + "# archive = '/scratch/data/NEONv2/hist/'\n", + "\n", + "# this unpacks the and expands the shortcut we used above\n", + "archive = os.path.realpath(os.path.expanduser(archive)) \n", + "\n", + "# Create a path to the data folder\n", + "data_folder = archive+'/'+neon_site+'.transient/lnd/hist'\n", + "data_folder" + ] + }, + { + "cell_type": "markdown", + "id": "70d25741-5010-496f-b61a-f15e1c135989", + "metadata": {}, + "source": [ + "**Is this the path for the simulated data, `data_folder`, correct?** \n", + "If not, you can set the `data_folder` variable manually. \n", + "
*HINT:* You can check in the terminal window or using bash magic.\n", + "\n", + "---\n", + "\n", + "### 1.2.3 Create functions to use when opening the data files\n", + "1. `preprocess` reads in a subset of variables using an xarray function. This saves time and memory resources.\n", + "2. `fix_time` adjusts a time offset that is a feature of the CTSM history files.\n", + "
**A note about model timestamps:** The CTSM history includes an initial 0th timestep for each model simulation. This offset in the time dimension can cause challenges when analyzing and evaluating model data if not treated properly.\n", + "
*Don't worry too much about the details of these functions right now*\n", + "\n", + "**To Do:** You can change the 'variables' list below to add or remove variables that you are interested in plotting. Make sure to follow the same formatting. " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "7f2a23fe-7273-4370-8f2c-fe3dfad5029e", + "metadata": {}, + "outputs": [], + "source": [ + "# -- read only these variables from the whole netcdf files\n", + "def preprocess (ds):\n", + " variables = ['FCEV', 'FCTR', 'FGEV','FSH','GPP','FSA','FIRA','AR','HR','ELAI']\n", + "\n", + " ds_new= ds[variables].isel(lndgrid=0)\n", + " return ds_new\n" + ] + }, + { + "cell_type": "markdown", + "id": "3919e8c9-4c08-485f-9e01-8c42f6b5ddad", + "metadata": {}, + "source": [ + "Now we have created the functions needed to manipulate our datasets\n", + "\n", + "---\n", + "\n", + "### 1.2.4 List all the files we're going to open\n", + "The the 30-minute, high frequency data (**'h1' files**) are written out every day for NEON simulations. CTSM typically saves files as monthly averages (the 'h0' files) and many more variables are available at this frequency. \n", + "\n", + "To open all of the `*h1*`files in our `data_folder`, we use the `glob` python function. \n", + "\n", + "You will notice that **several python functions are combined in a single line of code** that runs through a `for` loop over defined simulation years (written as a list of strings).\n", + "\n", + "
\n", + "Note If you're new to python it's dense, but efficient. This code is borrowed from Negin Sobhani. Sharing code is really helpful!\n", + "
\n", + "\n", + "**To Do:** You can change the years of data that you will read in below. Make sure that you do not add years where data are not available, though! You can check by listing the files in your `data_folder`" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "617ea958-499e-4dda-92da-8e531b152fe0", + "metadata": {}, + "outputs": [], + "source": [ + "# This list gives you control over the years of data to read in\n", + "years = [\"2018\",\"2019\",\"2020\",\"2021\"] \n", + "\n", + "# Create an empty list of all the file names to extend\n", + "sim_files = []\n", + "for year in years:\n", + " sim_files.extend(sorted(glob(join(data_folder,\"*h1.\"+year+\"*.nc\"))))\n", + "\n", + "print(\"All simulation files for all years: [\", len(sim_files), \"files]\")\n", + "print(sim_files[-1])" + ] + }, + { + "cell_type": "markdown", + "id": "4d280416-00b4-431d-944a-bb2ca7b4cceb", + "metadata": {}, + "source": [ + "How many files are you going to read in? What is the last day of the simulation you'll be looking at?\n", + "\n", + "---\n", + "\n", + "### 1.2.5 Read in the data\n", + "`.open_mfdataset` will open all of these data files and concatinate them into a single **xarray dataset**.\n", + "\n", + "There are lot of files so this can take a long time! Be patient, it will be done in < 1 minute. This can be done more quickly with dask, which parallelizes python code, but we do not use that here.\n", + "\n", + "1. `preprocess` will limit the number of variables we're reading in. This is an xarray feature that helps save time (and memory resources).\n", + "2. `fix_time_h1` corrects anoying features related to how CTSM history files handle time and is provided in `neon_utils.py`.\n", + "*Don't worry too much about the details of these functions right now*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "aee5a387-f155-4fe8-a6e8-bfe2f95a2f35", + "metadata": {}, + "outputs": [], + "source": [ + "start = time.time()\n", + "print ('---------------------------')\n", + "print (\"Reading in data for \"+neon_site)\n", + "ds_ctsm = xr.open_mfdataset(sim_files, decode_times=True, combine='by_coords',preprocess=preprocess)\n", + "ds_ctsm = fix_time_h1 (ds_ctsm)\n", + "\n", + "end = time.time()\n", + "print(\"Reading all simulation files took:\", end-start, \"s.\")\n" + ] + }, + { + "cell_type": "markdown", + "id": "05bc09ba-c7f3-4b37-bdd0-22a13d3f26ef", + "metadata": {}, + "source": [ + "#### Take a quick look at the dataset.\n", + "- What are your coodinate variables?\n", + "- How long is the time dimension?\n", + "- What variables are available to look at?\n", + "- What are the 'long names', or descriptions, of some of these variables? (HINT: try `ds_ctsm.GPP`)\n", + "- What other metadata are associated with this dataset? " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "8ecd9859-fb98-470d-8cbf-fbeed70302f5", + "metadata": {}, + "outputs": [], + "source": [ + "ds_ctsm" + ] + }, + { + "cell_type": "markdown", + "id": "6656c923-3ce1-4a20-a711-48b1188add9c", + "metadata": {}, + "source": [ + "---\n", + "\n", + "# 2. Manipulating data and making plots\n", + "The data frequency in the **h1 files** is 30 minutes. The below examples focus on different ways to average the time dimension of the data to visualize results.\n", + "\n", + "While several variables are read in, this example focuses on gross primary production (GPP). You can change the variable to look at other variables of intereset.\n", + "\n", + "---\n", + "\n", + "## 2.1 Plotting the full time series\n", + "It's often helpful to visualize the raw data.\n", + "This is quick and easy if you:\n", + "- point your dataset `ds_ctsm`, \n", + "- select a variable `GPP` and use \n", + "- `.plot()` function that's built into xarray. \n", + "\n", + "These three actions are combined in a single line of code" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "9038c557-6398-4c07-8d90-2d0a981376a4", + "metadata": {}, + "outputs": [], + "source": [ + "ds_ctsm.GPP.plot() ;" + ] + }, + { + "cell_type": "markdown", + "id": "e9c0287b-c569-4aa8-973e-599ee726aac4", + "metadata": { + "tags": [] + }, + "source": [ + "When looking at this figure:\n", + "- Do you see clear peaks for each year's growing season? \n", + "- What other trends are evident in the data? \n", + "- Are patterns similar for other variables?\n", + "\n", + "It can be challenging to interpret patterns and trends with this volume of data. Below are a few examples to summarize data in different ways\n", + "\n", + "---\n", + "## 2.2 Mean diel cycle\n", + "The high frequcncy data allows us to look at an average daily cycle of fluxes. \n", + "\n", + "**Let's start by looking at just a few days of data.**\n", + "\n", + "We will subset the data by adding the following xarray features to our previous `ds_ctsm.GPP.plot()` command:\n", + "- `.isel` the *index select* on the coorinate variable, *time*, and: \n", + "- `slice` which let's us slice out a range of data, instead of a single time point." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "7d8a9b13-545a-45f8-b838-0d43f9cbe03d", + "metadata": {}, + "outputs": [], + "source": [ + "# Select the data range. Below selects a few days of July (Julian Day 181 to 185)\n", + "# at 30 minute frequency (this means 48 times recorded / day, which is why the Julian Day is multiplied by 48)\n", + "first_time = (181*48)\n", + "last_time = (185*48)\n", + "\n", + "ds_ctsm.GPP.isel(time=slice(first_time,last_time)).plot() ;" + ] + }, + { + "cell_type": "markdown", + "id": "397f4f42-ade5-4892-8cfe-a67aa4b26019", + "metadata": {}, + "source": [ + "*From this plot, you notice that at night GPP goes to zero. That's why there are zero values in the middle of summer!*\n", + "\n", + "**You can also subset data to explore a single month.** \n", + "\n", + "Here, we look at data for all of July using the xarray `.where` function, which requires a: \n", + " - logical to evaluate. In the below example, this is when the time dimension equals our selected month; and \n", + " - 'dropping', or not using, the remaining data where the logical is false (optional). " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "64ca1dae-4c9c-468d-9e05-7849396d3bdd", + "metadata": {}, + "outputs": [], + "source": [ + "sel_month = 7\n", + "month_GPP = ds_ctsm['GPP'].where(ds_ctsm.time.dt.month == sel_month, drop=True)\n", + "print(\"month \"+str(sel_month)+\" has length = \"+str(len(month_GPP.time)))" + ] + }, + { + "cell_type": "markdown", + "id": "96c89720-c942-469c-a7bd-b41298b770a1", + "metadata": {}, + "source": [ + "Does the time dimension have the right length? (48 times/day * n days/month * n year of simulations) \n", + "\n", + "\n", + "
\n", + "Note You can also do this other ways. For example, using the xarray select function `.sel` should produce idential results.\n", + "\n", + "> `month_GPP = ds_ctsm.GPP.sel(time=ds_ctsm.time.dt.month.isin([sel_month]))` \n", + "\n", + "
\n", + "\n", + "**Calculate at the average diel cycle for a month.**\n", + "\n", + "We can accomplish this using the:\n", + "- `.groupby` function for combined \n", + "- `local_time` variable (which is made by adding the hour to a decimal minute for each day) and \n", + "- `.plot`, which again gives us a quck look at an xarray data array." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "31a77877-e131-479a-bbe9-eb8598c0359d", + "metadata": {}, + "outputs": [], + "source": [ + "month_GPP['local_time'] = month_GPP[\"time.hour\"]+month_GPP[\"time.minute\"]/60\n", + "month_GPP.groupby(month_GPP[\"local_time\"]).mean().plot() ;" + ] + }, + { + "cell_type": "markdown", + "id": "cb123684-8ffa-431d-9fcb-c40821087b96", + "metadata": {}, + "source": [ + "CTSM simulations are run with GMT, not local_time.\n", + "\n", + "We'll shift these results here, centering to local noon for now.\n", + "CPER is in the Mountain time zone (GMT-7), meaning we should:\n", + "- `.shift` -14 timesteps (one timestep = 30 minutes), repeating the \n", + "- `.groupby` function on our `local_time variable`, and then taking the \n", + "- `.mean` or `.std`\n", + "\n", + "You can layer all these steps into a sigle line of code!" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "1476b827-e20c-4016-b23d-84a238e2c533", + "metadata": {}, + "outputs": [], + "source": [ + "# calculate mean and standard deviation \n", + "mean = month_GPP.shift(time=-14).groupby(month_GPP[\"local_time\"]).mean()\n", + "std = month_GPP.shift(time=-14).groupby(month_GPP[\"local_time\"]).std()" + ] + }, + { + "cell_type": "markdown", + "id": "4371bfd8-31c8-4700-b4fd-35bd219fb288", + "metadata": {}, + "source": [ + "**Now make the plots!**\n", + "Here we'll switch to plotting with matplotlib, loaded as `plt` for convenience, which has intuitive functions like:\n", + "- `.plot`(x, y, ...)\n", + "- `.fill_between`(x, y+z, y-z, ...) and plot control of features like\n", + "- `.xlabel`, `.ylabel`, `.title`, and `.grid`\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "db8af133-27ae-4223-beea-06907f33a2c6", + "metadata": {}, + "outputs": [], + "source": [ + "plt.plot(mean['local_time'], mean, marker = 'o')\n", + "plt.fill_between(mean['local_time'], mean+std,mean-std, alpha=0.3)\n", + "plt.xlabel('local_time (h)')\n", + "plt.ylabel(month_GPP.attrs['long_name']+\" (\"+month_GPP.attrs['units']+\")\")\n", + "plt.title(neon_site+\" diel mean, month=\"+str(sel_month), \n", + " loc='left',fontweight='bold') \n", + "plt.grid() ;" + ] + }, + { + "cell_type": "markdown", + "id": "7c8d0d4c-05d5-42cd-9812-07728cd433ca", + "metadata": {}, + "source": [ + "**OK just for fun, lets go crazy by plotting mean diel cycles for each month of the year.**\n", + "\n", + "We can do this in a `for` loop with just a few lines of code by layering multiple functions into each line.\n", + "\n", + "
\n", + "Note: conditionals in python use indent spacing to define what's happening inside the loop. This helps make the code easier to read and write. See the example below.\n", + "
" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "cf45bc8b-1222-4c00-b3d0-203c4ee8e577", + "metadata": {}, + "outputs": [], + "source": [ + "for m in range(1,13):\n", + " month_GPP = ds_ctsm.GPP.sel(time=ds_ctsm.time.dt.month.isin([m]))\n", + " month_GPP['local_time'] = month_GPP[\"time.hour\"]+month_GPP[\"time.minute\"]/60\n", + " month_GPP.shift(time=-14).groupby(month_GPP[\"local_time\"]).mean().plot(label=str(m))\n", + "\n", + "# Note with newer versions of xarray this generates a 'FutureWarning', which is being suppressed\n", + "\n", + "plt.title(neon_site+\" diel mean\", loc='left',fontweight='bold') \n", + "plt.legend(title='month') ;" + ] + }, + { + "cell_type": "markdown", + "id": "edee4cb6-82c5-4c09-897e-a71a1b22900e", + "metadata": { + "tags": [] + }, + "source": [ + "**Look at these results!**\n", + "- What months have the highest daily fluxes at this site?\n", + "- Why does the breadth of each curve change for different months?\n", + "\n", + "---\n", + "\n", + "\n", + "## 2.3 Daily mean flux calculations\n", + "\n", + "The above examples have calculated the mean and not changed units (*currently gC/m^2/s*). Since each day has the same number of timesteps (48) and we are plotting diel cycles, the averaging and native units work. However, it is helpful to consider how data are being grouped in other types of averages and whether you might need to adjust the units. For example, you may want to calculate a weighted mean at times (e.g. each month has a different number of days) or change units to make them better reflect your calculations. **You can think about this as you are working** by printing the outputs of calculations at the end of each code cell and thinking about their dimensions, attributes, etc.\n", + "\n", + "
\n", + "Note: Weighted averages and units changes can be calculated several ways. \n", + "\n", + "For example, you can use `.resample` or `.groupby` in xarray \n", + " \n", + "For one-dimensional variables it is more computationally efficient to use these functions in a pandas dataframe. For simplicity in this example, we will keep using xarray.\n", + "\n", + "
\n", + "\n", + "To calculate a daily mean we'll focus on: \n", + "- `GPP` as the variable of interest\n", + "- the `.resample` function in xarray, as this handles the time dimension most intuitively\n", + "- the daily time dimension, `time='D'`" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "2c8499b1-dc88-4319-9977-349dfeb0bb8a", + "metadata": {}, + "outputs": [], + "source": [ + "#-- Calculate daily average for every day \n", + "daily_GPP = ds_ctsm.GPP.resample(time='D').mean()\n", + "daily_GPP" + ] + }, + { + "cell_type": "markdown", + "id": "7d720f5c-33af-4b7f-802d-25d45d779625", + "metadata": {}, + "source": [ + "**Take a look at your new data array:**\n", + "- Do the values of the time coordinate seem appropriate? \n", + "- Is the length of the time coordinate accurate?\n", + "\n", + "
\n", + "Note: Variable attributes were carried forward to this new xarray data array, but we can modify this to get more sensible results.\n", + "
\n", + "\n", + "Now we can modify the rate of the GPP fluxes from units of *per second* to units of *per day* and quickly `.plot()` results.\n", + "\n", + "
\n", + "Be careful when changing values of variable! \n", + " \n", + "If you run a code block like the one below repeatedly, you'll modify your GPP values every time. To avoid this, you can recalculate `daily_GPP` at the start of this cell by uncommenting out the first line of the code, below. Even though it's a little slower, it may ultimately be safer.\n", + "
\n", + "\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "e58b1b2b-f808-48cf-9f37-4387e1e35933", + "metadata": {}, + "outputs": [], + "source": [ + "# daily_GPP = ds_ctsm.GPP.resample(time='D').mean()\n", + "\n", + "sec_per_day = 60. * 60. * 24.\n", + "daily_GPP = daily_GPP * sec_per_day\n", + "\n", + "# Then change the attirbute\n", + "daily_GPP.attrs['units'] = 'gC/m^2/day'\n", + "\n", + "# Now plot results\n", + "daily_GPP.plot() ;" + ] + }, + { + "cell_type": "markdown", + "id": "48aacde3-216a-496b-946c-1232c88ec47e", + "metadata": {}, + "source": [ + "Notice how averaging makes the results look smoother. We can also more easily see the interannual variability in GPP that is simulated in different years.\n", + "\n", + "**What is the range in annual GPP that CTSM simulates at this NEON site?**\n", + "\n", + "We can assess this by creating a different plot: \n", + "- use the `.resample` function \n", + "- adjust the time dimension to the start of the year, `time='AS'`\n", + "- convert the `.mean()` to an annual flux with appropriate units (**NOTE** this assumes that all years have 365 days) \n", + "- create a bar plot (only available as a Pandas series, not in xarray). Use `.to_series()` to convert to a pandas.Series and `.plot.bar()` to make a bar plot \n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "36cc1f07-c5b0-42a7-a24a-e7e4e203db65", + "metadata": {}, + "outputs": [], + "source": [ + "(ds_ctsm.GPP.resample(time='AS').mean()*sec_per_day*365).to_series().plot.bar() ;" + ] + }, + { + "cell_type": "markdown", + "id": "ed5cebc4-c690-4db4-83b2-dacf66a999ae", + "metadata": {}, + "source": [ + "**There's even more to think about here:**\n", + "- What could cause this kind of interannual variability in GPP? \n", + "- Are similar patterns common across multiple NEON sites in the region?\n", + "- Where is this site and what kind of vegetation grows there? \n", + "- Are these annual GPP values realistic for this type of ecosystem? \n", + "
" + ] + }, + { + "cell_type": "markdown", + "id": "34ec31fa-6c50-48e5-bbeb-20acb83084b4", + "metadata": {}, + "source": [ + "---\n", + "\n", + "## 2.4 Annual climatology\n", + "\n", + "Sometimes it's helpful to look at the seaonal cycle. Averaging across multiple years to generate a mean annual cycle is called a climatology. This example uses the `.groupby` function.\n", + "\n", + "We have already calculated the daily mean and will also need to calculate the daily standard deviation `.std` to understand how the variability in the **daily** fluxes contributes to seasonal variability across years.\n", + "\n", + "This will create two data arrays for the variable `GPP` (the mean and the standard deviation). We want to:\n", + "- use `.rename` to facilitate combining the data arrays\n", + "- combine the variable names and their array values into a dataset, `xr.Dataset`" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "d5c36dd3-b71e-4d64-923d-4bf3e83a9cb2", + "metadata": {}, + "outputs": [], + "source": [ + "# Calculate mean and standard deviation for variables\n", + "climo_GPP_mean = daily_GPP.groupby(daily_GPP[\"time.dayofyear\"]).mean()\n", + "climo_GPP_std = daily_GPP.groupby(daily_GPP[\"time.dayofyear\"]).std()\n", + "\n", + "## rename this variable for this data array\n", + "climo_GPP_std = climo_GPP_std.rename('std')\n", + "\n", + "# combine the data arrays into a dataset\n", + "climo_GPP = xr.Dataset({\"GPP\": climo_GPP_mean, \"std\": climo_GPP_std})\n", + "\n", + "# print a variable from the dataset\n", + "climo_GPP['GPP']" + ] + }, + { + "cell_type": "markdown", + "id": "49453c40-a4dd-4b00-be30-30e35bd74a79", + "metadata": {}, + "source": [ + "Since we are already using daily values, the units are correct.\n", + "\n", + "You'll notice that using `.groupby` changes the time coordinates. Let's adjust these back to a datetime format using the `.rename` function again (here on a coordinate variable)." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "a4aa749b-3bab-493e-9ba4-1922e6f0570b", + "metadata": {}, + "outputs": [], + "source": [ + "# rename the coordinate variable\n", + "climo_GPP = climo_GPP.rename({'dayofyear': 'time'})\n", + "\n", + "#create a pandas dataframe of the same length\n", + "# It's true our climatology is the mean of simulated daily vales between 2018-2021, \n", + "# but datetime objects are simpler to work with if you provide a year\n", + "time = pd.date_range(\"2020-01-01\", periods=366)\n", + "\n", + "#replace time coordinate values\n", + "climo_GPP['time'] = time \n", + "\n", + "# Check that it all worked\n", + "climo_GPP" + ] + }, + { + "cell_type": "markdown", + "id": "55e5b1d7-ca89-4124-8f27-bc7f64c16594", + "metadata": {}, + "source": [ + "**Now plot the data!** \n", + "We've done a lot of work. Let's:\n", + "1. Save this figure. We can do this in a new directory, `plot_dir`, under the `NEON_cases` directory.\n", + "2. Plot interanual variability around the daily means using matplotlib. Note that this code is a little more complex to make a nice looking figure, so don't worry about understanding the details now. Instead, refer back to this as you become more familiar with analyses in python and plotting in matplotlib" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "ce5c2abc-c5bd-46a1-b9c5-ee422f4ef566", + "metadata": {}, + "outputs": [], + "source": [ + "# Make the figures directory if it's not already there\n", + "plot_dir = os.path.realpath(os.path.expanduser('~/scratch/NEON_cases/figures'))\n", + "if not os.path.isdir(plot_dir):\n", + " os.makedirs(plot_dir, exist_ok=True)" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "d332e817-7067-45b3-bc45-9f2d9dc961ec", + "metadata": {}, + "outputs": [], + "source": [ + "# Now plot the climatological mean\n", + "f, ax = plt.subplots()\n", + "ax.plot(climo_GPP.time,climo_GPP.GPP)\n", + "\n", + "# Add shading around the mean +/- one sigma of daily mean\n", + "ax.fill_between(climo_GPP.time, (climo_GPP.GPP-climo_GPP['std']), \n", + " (climo_GPP.GPP+climo_GPP['std']), alpha=0.3)\n", + "\n", + "ax.set_ylabel('GPP ('+climo_GPP.GPP.attrs['units']+')',fontweight='bold')\n", + "ax.set_title(neon_site+\" annual climatology\", loc='left',fontweight='bold')\n", + "\n", + "\n", + "# format x axis for monthly dates\n", + "locator = mdates.MonthLocator() # every month\n", + "# Specify the format - %b gives us Jan, Feb...\n", + "fmt = mdates.DateFormatter('%b') \n", + " \n", + "X=ax.xaxis\n", + "X.set_major_locator(locator)\n", + "X.set_major_formatter(fmt)\n", + "ax.grid() ; \n", + "\n", + "# Save out a .pdf. Other options include .png, .eps, ect.\n", + "print(' -- saving figure -- ')\n", + "plot_name = neon_site+'_'+'GPP_climatology.pdf'\n", + "plt.savefig (os.path.join(plot_dir,plot_name), \n", + " dpi=300,bbox_inches='tight', format = 'pdf')" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "323c98cb-9445-49df-89eb-03d04497f1a0", + "metadata": {}, + "outputs": [], + "source": [ + "# We can check the image was created\n", + "!ls ~/scratch/NEON_cases/figures" + ] + }, + { + "cell_type": "markdown", + "id": "124c6fa1-2f6f-4a3c-ba1a-8f390c584efc", + "metadata": {}, + "source": [ + "---\n", + "# Export postprocessed data\n", + "\n", + "Finally! We did a lot of work to generate this climatology. You want to save the data as a different file type to work with later (e.g. .csv) so that you don't need to rely on this python script. To do this: \n", + "1. Create a directory to save the file\n", + "2. Define the file name for our postprocessed data\n", + "3. Generate a pandas dataframe from the climotology (xarray) dataset using the `.to_dataframe` function \n", + "4. Save the dataframe as a .csv file using the `.to_csv` function" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "bc395ddd-9c72-4334-8c92-c07ad28e7edb", + "metadata": {}, + "outputs": [], + "source": [ + "# Make the figures directory if it's not already there\n", + "out_dir = os.path.realpath(os.path.expanduser('~/scratch/NEON_cases/postprocessed_data'))\n", + "if not os.path.isdir(out_dir):\n", + " os.makedirs(out_dir, exist_ok=True)\n", + " \n", + "# define the file name and directory\n", + "file_out = out_dir+'/'+neon_site+'_'+'GPP_climatology.csv'\n", + "\n", + "# Create a dataframe and write out the .csv file\n", + "climo_GPP.to_dataframe().to_csv(file_out)\n", + "print('wrote '+ file_out)" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "1900e97b-100f-4a88-9697-7d349ce2bf20", + "metadata": {}, + "outputs": [], + "source": [ + "# Check, does this file exist.\n", + "!ls /scratch/${USER}/NEON_cases/postprocessed_data/" + ] + }, + { + "cell_type": "markdown", + "id": "8b6a0edb-015a-4fc1-bc07-aaeca72c8438", + "metadata": {}, + "source": [ + "#### Check the .csv file\n", + "- Is there much metadata associated with the .csv file?\n", + "- Will you be able to remember how you generated these data if you use them elsewhere or share them with colleagues?\n", + "\n", + "
\n", + "Congratulations! \n", + " \n", + "You've manipulated and plotted data from one site and one variable. \n", + " \n", + "What would you like to look at now?\n", + "
\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "7f11e37f-8301-4ba6-87b4-bf990912017f", + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.9.12" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/_sources/notebooks/ProjectExamples/CTSMsp_NEON_fromScratch.ipynb b/_sources/notebooks/ProjectExamples/CTSMsp_NEON_fromScratch.ipynb new file mode 100644 index 0000000..ebbdcb1 --- /dev/null +++ b/_sources/notebooks/ProjectExamples/CTSMsp_NEON_fromScratch.ipynb @@ -0,0 +1,734 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# CTSM-SP simulations at NEON sites\n", + "\n", + "### *run_neon* doesn't work for satelite phenology (SP cases), so we'll create these cases from *'scratch'*\n", + "\n", + "The `run_neon` script we've been using is very useful, but it simplifies a number of steps that users may want to take control of in their workflow. We'll introduce how you can control aspects of your case setup and configuration here. For example, a deeper understanding of the model is need if your want to run a satelite phenology (SP) case an unsupported tower (non-NEON) site, a generic single point simulation, a regional domain, or for global case.\n", + "\n", + "If you're new to running CTSM, this is a somewhat advanced tutorial. We're planning on doing all of our examples in the workshop using `run_neon`, so the information in this tutorial may not be needed. That said, it illustrates some important features of how to run the model, how to get initial condition files, and more.\n", + "\n", + "
\n", + "\n", + "---\n", + "\n", + "## In this tutorial\n", + "\n", + "The tutorial has several components. Below you will find steps to: \n", + "1. Create, setup, build, and run a CTSM-SP case at a NEON site from scratch\n", + "2. Locate history files\n", + "\n", + "
\n", + "\n", + "NOTICE: If you're running this notebook through the NCAR JupyterHub login you need to be on a Cheyenne login node (NOT Casper). \n", + "\n", + "
" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "

1. Set up and run a simulation

\n", + "\n", + "### CTSM can be run in 4 simple steps.\n", + "\n", + "1. **Create** a new case\n", + " - *This step sets up a new simulation. It is the most complicated of these four steps because it involves making choices to set up the model configuration*\n", + "\n", + "2. **Setup** the case \n", + " - *This step configures the model so that it can compile*\n", + "\n", + "3. **Build** the executable\n", + " - *This step compiles the model*\n", + "\n", + "4. **Submit** your run to the batch queue\n", + " - *This step submits the model simulation*\n", + " \n", + "**NOTE:** We'll also customine our case with xml and namelist changes." + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "***\n", + "

1.1 create a new case

\n", + "\n", + "*Set up a new simulation*\n", + "***\n", + "\n", + "\n", + "
\n", + " \n", + "TIP: If you're running on Cheyenne, creating a softlink to scratch in your home directory is helpful. \n", + " \n", + "You can create this with the following: `ln -s /glade/scratch/$USER ~/scratch`\n", + "\n", + "
" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 1.1.1 Navigate to the source code directory\n", + "\n", + "Your source code is in your home directory" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/CTSM/cime/scripts\n", + "\n", + "# Change the 4-character NEON site below.\n", + "export neon_site=\"YELL\"" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 1.1.1 Create a new case" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# then create a new case.\n", + "./create_newcase --case ~/scratch/NEON_cases/${neon_site}_sp_test \\\n", + " --res CLM_USRDAT \\\n", + " --compset I1PtClm51SpRs \\\n", + " --output-root ~/scratch/NEON_cases/ \\\n", + " --run-unsupported \\\n", + " --user-mods-dir NEON/${neon_site} " + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "***\n", + "The code above doesn't always render properly online. Here's what the code actually says:\n", + "\n", + "```\n", + "./create_newcase --case ~/scratch/NEON_cases/${neon_site}_sp_test \\\n", + " --res CLM_USRDAT \\\n", + " --compset I1PtClm51SpRs \\\n", + " --output-root ~/scratch/NEON_cases/ \\\n", + " --run-unsupported \\\n", + " --user-mods-dir NEON/${neon_site} \n", + "```\n", + "***\n", + "### **./create_newcase**\n", + "\n", + "
\n", + "\n", + "NOTE: There is a lot of information that goes into creating a case.\n", + "\n", + "You can learn more about the options by typing ./create_newcase --help on the the command line or in a new code cell.\n", + "\n", + "We'll briefly go over some of the highlights here.\n", + "\n", + "
\n", + "\n", + "---\n", + "\n", + "### Required arguments to create a new case\n", + "There are 3 Required arguments Needed to create a new case. These include \n", + "1. `--case`, which specifies the *location* and *name* of the case being created\n", + " - `~/scratch` = the alias to your scratch directory\n", + " - `NEON_cases` = the subdirectory we created to store your other cases\n", + " - `${neon_site}_sp_test` = the name of the case you're creating\n", + " - *Recommendation:* Use meaningful names, including model version, type of simulation, and any additional details to help you remember the configuration of this simulation\n", + "

\n", + "2. `--res` Defines the model *resolution*, or grid,\n", + " - `CLM_USRDAT`, which is an option to get a case setup without having to define the grid resolution, yet. \n", + " - In global cases, the land model is commonly run at a nominal 1 degree `f09_g17` or 2 degree `f19_g17` resolution \n", + " - Using `./query_config --grids` provides a list of supported model resolutions\n", + "

\n", + "3. `--compset` Defines the *component set* for your case, \n", + " - The Component set specifies the default configuration for the case which includes:\n", + " - Component models (e.g. active vs. data vs. stub), \n", + " - Time period of simulations and forcing scenarios (e.g. 1850 vs 2000 vs. HIST) and \n", + " - Physics options (e.g. CLM5.1 vs CLM5.0). \n", + " - `I1PtClm51SpRs` is alias that actually describes a much longer set of components that are being used for this single point case. \n", + " - All CLM-only compsets start with *\"I\"*.\n", + " - Using `./query_config --compsets clm` provides examples of other CLM compsets\n", + "
\n", + "\n", + "*There are a few other **optional** flags used to create this new case that we'll briefly touch on here*\n", + "
\n", + "\n", + "4. `--output-root`, which specifies the *location* of your run directory\n", + " - `~/scratch/NEON_cases` = the subdirectory we already created \n", + "
\n", + "\n", + "5. `--user-mods-dirs` sets up the configuration of the case with a user modification directory that defines the location of the site.\n", + " - `NEON/FATES/${neon_site}` has files that format of the history files and a few other custom settings for your case. \n", + " - This inludes setting some of .xml variables and name list settings correctly for a FATES simulation in a NEON single point case. \n", + "
\n", + "\n", + "6. `--run-unsupported` avoids error using compsets are not scientifically supported \n", + "\n", + "
\n", + "\n", + "NOTE: You may notice an error about project codes when you create your case. The project code isn't important for these simulations. But you may need to change this if you're running on Cheyenne.\n", + "\n", + "
\n", + "\n", + "***" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "

1.2 Customize your SP case

\n", + "\n", + "*Modifications for an SP case*\n", + "\n", + "### 1.2.1 Move to your SP case directory\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/scratch/NEON_cases/${neon_site}_sp_test" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "**Background**\n", + "\n", + "For an SP case, we want to run NEON sites for a bit to let soil water and temperatures the equilibrate before comparing to observations. Luckily, this only takes a few years (in most cases).\n", + "\n", + "**What years is the model set up to run over by default?** We can look by using `./xmlquery`" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./xmlquery DATM_YR_START DATM_YR_ALIGN DATM_YR_END" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Most NEON sites we have 4 complete years of data to work with (2018-2021). \n", + "\n", + "If this is true for your site, we can use xml commands to modify our case\n", + "\n", + "\n", + "In general, we want to run for twice as many years as we have NEON observations. \n", + "- CLM will just cycle over the meterological data that NEON provides. \n", + " - e.g. data from 2018-2021 will be used for 2014-2017 and then again for 2018-2021\n", + "- This will allow the second cycle of our our simulation to end with the same dates over which we have NEON observations, making the comaprision with observations easier. \n", + "\n", + "### 1.2.2 xml changes to modify env_run options\n", + "xml changes are one way you can control your case to customize the simulation\n", + "- We won't cover this here, but other tutorials cover more about xml changes.\n", + "\n", + "**NOTE** `RUN_STARTDATE` is totally arbitrary. It's just the model date when the simulation starts. \n", + "- xml variables like `DATM_YR_START` and `DATM_YR_ALIGN` determine the data that's being read into for your simulation. " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./xmlchange RUN_STARTDATE=2014-01-01 \n", + "./xmlchange STOP_N=8 " + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### 1.2.3 Modify user_nl_clm\n", + "We also won't discuss namelist modificaiton here, but they are another way to customize your case.\n", + "\n", + "Specifically, we're using usermod directories to write out high frequency history variables for your case in SP mode.\n", + "- **Remember** beyond simulating GPP, simulations in SP mode don't have a carbon cycle. The variable for GPP in SP mode is called `FPSN`, which has different units than GPP.\n", + "\n", + "You can look at the variables we'll write out on the `h1` history files (30 minute frequency on daily files)" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cat user_nl_clm | tail -1" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 1.3 Setup and build your case\n", + "\n", + "*This step configures the model so that it can then compile* \n", + "\n", + "### 1.3.1 case.setup\n", + "The `./case.setup` script:\n", + "1. configures the model\n", + "2. creates files to modify input data and run options" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./case.setup" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "***\n", + "

1.3.2 Build the executable

\n", + "\n", + "*This step compiles the model*\n", + "\n", + "It also takes a long time, so be patient.\n", + "***\n", + "\n", + "The `./case.build` script:\n", + "1. Checks input data\n", + "2. Creates a build/run directory with model executable and namelists\n", + "\n", + "This takes some time, and will throw a bunch of errors and WARNINGS... \n", + "\n", + "--- **don't worry, be patient, and just give it time** ---\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "qcmd -- ./case.build" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "\n", + "---\n", + "\n", + "**When the build completes successfully you'll see a notice that the `MODEL BUILD HAS FINISHED SUCCESSFULLY`**\n", + "\n", + "\n", + "You can read on, but before executing any code blocks in the notebook **wait for the model to build.**\n", + "This can take a while.\n", + "\n", + "---" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "

1.4 Submit your case

\n", + "\n", + "Now you're ready to submit the case!\n", + "\n", + "*This step submits the model simulation*\n", + "- You'll also be downloading all the meterological data from NEON for your site, this also takes a little time and prints lots of information to the screen\n", + "***" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./case.submit" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "When you submit a job, you will see confirmation that it successfully submitted:\n", + "\n", + "### Congratulations! \n", + "### You've created and submitted a single point NEON run from scratch.\n", + "\n", + "Next, you will probably want to check on the status of your jobs.\n", + "\n", + "
\n", + "\n", + "TIP: This is dependent on the scheduler that you're using. \n", + "\n", + "
    \n", + "
  • Cheyenne uses PBS where status is checked with qstat -u $USER
    • \n", + "
  • This is also enabled in the cloud for you, try it in the code block below
\n", + "\n", + "If you want to stop the simulation, you can do so with qdel here (or on Cheyenne).\n", + "
    \n", + "
  • Find your Job ID after typing qstat
    • \n", + "
  • Type qdel {Job ID}
    • \n", + "
\n", + "
" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "qstat -u $USER" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "---\n", + "Once your jobs are complete (or show the 'C' state under the 'Use' column, which means complete), we can check the CaseStatus file to ensure there were no errors and it completed successfully. To do this, we'll 'tail' the end of the CaseStatus file:" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "tail ~/scratch/NEON_cases/${neon_site}_sp_test/CaseStatus" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "You should see several lines, with the middle one saying 'case.run success'. \n", + "\n", + "Before that you'll see notifications about xml changes, case.setup, and case.submit, and case.run\n", + "\n", + "
\n", + "Congratulations! \n", + " \n", + "You've created a CTSM case for the NEON tower you selected.\n", + "\n", + "We'll build on these basics in additional tutorials to customize your simulations.\n", + "
\n", + "\n", + "\n", + "****" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "\n", + "# 2 Create a parallel BGC case for comparison\n", + "This is an optional example if you want to compare your SP case with a BGC case at the same site.\n", + "- Your `base-case` is the very first case you ran in the GettingStarted tutorial. \n", + "- We'll use this to create a clone for a BGC experiment that doesn't have to rebuild." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "export base_case='KONZ' # This can be the very first case you ran in the GettingStarted tutorial \n", + "cd ~/CTSM/tools/site_and_regional/\n", + "./run_neon.py --neon-sites $neon_site \\\n", + " --base-case ~/scratch/NEON_cases/$base_case \\\n", + " --output-root ~/scratch/NEON_cases " + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 2.1 Now check to see how your cases are different.\n", + "First we'll look at the `env_run.xml` files" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/scratch/NEON_cases/${neon_site}_sp_test\n", + "diff env_run.xml ../${neon_site}.transient/env_run.xml" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Some of these differences are casued by the compset and our xml changes: \n", + "- 2000_DATM vs. HIST_DATM provides constant vs. transient CO2\n", + "- SP vs. BGC\n", + "- time period of the simulation.\n", + "\n", + "You can use the `diff` command to compare differences in the configuration of your SP and BGC case (hint look in CaseDocs):\n", + "- lnd_in\n", + "- datm.streams.xml" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [] + }, + { + "cell_type": "markdown", + "metadata": { + "tags": [] + }, + "source": [ + "***\n", + "# 3. Create a Clone\n", + "

This step is optional, but provides helpful information

\n", + " \n", + "Creating and building a new case is slow. \n", + "\n", + "Cloning cases can speed this up!\n", + "\n", + "

3.1 Create a clone

\n", + "\n", + "- Clones use the same resolution, compset, and output root.\n", + "- Clones can also share the same executable (build), which can save time!\n", + "\n", + "
\n", + "\n", + "WARNING: If you're making code modifications be careful using clones that share the same build. The example below is a good way to run the same model configuration at different NEON sites.\n", + "\n", + "
\n", + "\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# Move back to your source code directory\n", + "cd ~/CTSM/cime/scripts\n", + "\n", + "# Change the 4-character new NEON site you want to run.\n", + "export neon_site2=\"TEAK\"" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# then create a cloned case.\n", + "./create_clone --case ~/scratch/NEON_cases/${neon_site2}_sp_test \\\n", + " --clone ~/scratch/NEON_cases/${neon_site}_sp_test \\\n", + " --user-mods-dirs ~/CTSM/cime_config/usermods_dirs/NEON/${neon_site2} \\\n", + " --keepexe" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "\n", + "### **./create_clone**\n", + "\n", + "
\n", + "\n", + "NOTE: There is a lot of information that goes into creating a clone.\n", + "\n", + "You can learn more about the options by typing ./create_clone --help on the the command line or in a new code cell.\n", + "\n", + "We'll briefly go over some of the highlights here.\n", + "\n", + "
\n", + "\n", + "\n", + "### Required arguments to create a clone\n", + "There are 2 required arguments needed to create a clone. These include: \n", + "1. `--case`, this is the path and name of the new case your cloning.\n", + "

\n", + "2. `--clone`, this is the path and name of the existing case you want to clone.\n", + "

\n", + "### Additional information we provided here were: \n", + "3. `--user-mods-dirs` as before, this sets up the configuration of the case with a user modification directory that defines the location of the new site we're running, but it requires the full path to the `user-mods-dir` you want to use.\n", + "

\n", + "4. `--keepexe` Point to original build from the case being cloned.\n", + "\n", + "---" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "

3.2 Customize the clone?

\n", + "\n", + "*Because you created a clone and point to an existing build we can skip the `case.setup` and `case.build` steps* \n", + "***\n", + "\n", + "### 3.2.1 Move to your case directory and compare env_run" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/scratch/NEON_cases/${neon_site2}_sp_test\n", + "diff env_run.xml ../${neon_site}_sp_test/env_run.xml" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### 3.2.2 Make xml changes\n", + "In the example above the **TEAK** data record only starts in 2019, meaning we have 3 years of meterological data to cycle through (2019-2021)\n", + "- CLM will cycle through the observational record for data that's available.\n", + "- If you want the observational record to line up correctily for sites that AREN'T standard (2018-2021), you may have made some custom XML changes\n", + "- Let's look at some particulars of time " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./xmlquery RUN_STARTDATE STOP_OPTION STOP_N DATM_YR_START DATM_YR_ALIGN DATM_YR_END" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "For the **TEAK** example, if we start in 2014 our observational record will not align with the model years being simulated.\n", + "\n", + "Uncomment out the code below to start in 2013 and cycle through the datm record three times.\n", + "- **NOTE** You may have to modify things differently for particular NEON sites" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#./xmlchange RUN_STARTDATE=2013-01-01 \n", + "#./xmlchange STOP_N=9 " + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "***\n", + "

3.3 Submit the case

\n", + "\n", + "*Because you created a clone and point to an existing build we can skip the `case.setup` and `case.build` steps* \n", + "***\n", + "\n", + "- As before, you'll be downloading all the meterological data, which takes a little time and prints lots of information to the screen\n", + "***\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./case.submit" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "Congratulations! \n", + " \n", + "You've created and run a clone Fof CLM- for the NEON tower you selected.\n", + "
\n", + "\n", + "\n", + "You can track progress on your run using steps outlined in part #2 of this tutorial.\n", + "You can also work on visualizing your results for different sites using visualization code provided\n", + "\n" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "If you're developing this tutorial:\n", + "Before saving and pushing this code to github go to `Kernel` and `Restart kernel and clear all outputs...`" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "ls -lrt ~/scratch/NEON_cases/${neon_site2}_sp_test/run/ | tail -10" + ] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Bash", + "language": "bash", + "name": "bash" + }, + "language_info": { + "codemirror_mode": "shell", + "file_extension": ".sh", + "mimetype": "text/x-sh", + "name": "bash" + } + }, + "nbformat": 4, + "nbformat_minor": 4 +} diff --git a/_sources/notebooks/ProjectExamples/Clone_Case.ipynb b/_sources/notebooks/ProjectExamples/Clone_Case.ipynb new file mode 100644 index 0000000..9ab8fbf --- /dev/null +++ b/_sources/notebooks/ProjectExamples/Clone_Case.ipynb @@ -0,0 +1,424 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "metadata": { + "tags": [] + }, + "source": [ + "# Cloning a NEON case\n", + "\n", + "**This is an optional tutorial** it's a little bit more advanced, but it will help you think about how to modify the model configuration to run new sites or model experiments. \n", + "\n", + "The `run_neon` script we used in the [introductory Gettig Started tutorial](../GettingStarted/1_NEON_Simulation_Tutorial.ipynb) created and ran a base case as well as a `.transient` case. \n", + "\n", + "You'll recall that building the case was pretty time consuming. Luckily, if you aren't changing the model code, you can run from this base case without rebuilding multiple times. \n", + "\n", + "
\n", + "\n", + "---\n", + "\n", + "## In this tutorial\n", + "\n", + "The tutorial has several components. Below you will find steps to: \n", + "1. Create a clone for a new NEON site from the base case you already built.\n", + "2. Introduce ways to customize the configuration of your cases.\n", + "\n", + "
\n", + "\n", + "NOTICE: This tutorial assumes that you've done your homework! \n", + " \n", + "If you haven't downloaded CTSM from the GitHub repository you need to go back to: \n", + "
    \n", + "
  • GettingStarted/1_NEON_Simulation_Tutorial
    • \n", + "
\n", + " \n", + "Do these first!\n", + "\n", + " \n", + "
\n" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "\n", + "NOTICE: If you're running this notebook through the NCAR JupyterHub login, you need to be on a Cheyenne login node (NOT Casper). \n", + "\n", + "
\n" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "

1. Create a clone

\n", + "\n", + "CTSM cases can be cloned to save time and create model experiments for different sites or different configurations that are otherwise identical to each other. \n", + "\n", + "### 1.1.1 Set up environment\n", + "It is important in order to have all the tools and packages you need to run simulations. \n", + "\n", + "*The code below **is not** needed in the cloud*.\n", + "\n", + "
\n", + " \n", + "TIP: If you're running on Cheyenne, you may need to uncomment the the following two lines of code. This will set up your conda environment correctly.\n", + "\n", + "This is not required if your running CESM-Lab in the cloud.\n", + "\n", + "
" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#module purge\n", + "#module load conda ncarenv" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### 1.1.2 Navigate to your source code" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/CTSM/tools/site_and_regional" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 1.2 Create a clone with `run_neon.py`\n", + "We'll just use run_neon again, but point to the **base case** you created in the first GettingStarted tutorial.\n", + "\n", + "The following code will:\n", + "- create a clone, \n", + "- download input data from NEON\n", + "- submit the simulation\n", + "\n", + "As before, it takes a little bit for all this to happen, but you'll notice it's MUCH faster since we don't have to build the model.\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# Change the 4-character NEON site below.\n", + "export base_case='KONZ' # should match the base case you created in the GettingStarted tutorial\n", + "export new_case='HARV' # the new site you want to run" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# then run_neon\n", + "./run_neon.py --neon-sites $new_case \\\n", + " --output-root ~/scratch/NEON_cases \\\n", + " --base-case ~/scratch/NEON_cases/$base_case \\\n", + " --overwrite" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Two new flags are being used here:\n", + "- `--base-case` points to base case that's already been built, letting you run your new simulation more quickly. \n", + "- `--overwrite` will let you overwrite an existing case. \n", + "\n", + "
\n", + "\n", + "NOTICE: \n", + " \n", + "- Creating clones while pointing to a `--base-case` saves time by sharing the built model executable.\n", + "- Creating clones like this also requires that your base-case and new-case are the same type of simulation, `.transient` simulations in this example. \n", + "- It also assumes that you're not making modifications to the model source code that would require you to rebuild a case. \n", + "\n", + "
\n", + "\n", + "\n", + "You can check to make sure things are running as expected. On the command line of a terminal window you can enter (HINT, you'll likely have to define `new_case` in the terminal window, as above in the notebook: \n", + "> `ls ~/scratch/NEON_cases/$new_case.transient/run` **or** \n", + "\n", + ">`qstat -u $USER` **or**\n", + "\n", + ">`tail ~/scratch/NEON_cases/${new_case}.transient/CaseStatus`\n", + "\n", + "
\n", + "How are our simulations different? let's take a quick look to see.\n", + "
" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "----\n", + "# 2. Introduction to controling case configuration\n", + "\n", + "There are a few places that summarize differences in simulations. These files include:\n", + "- `env_run.xml`, which are variables that can be changed to configure your case; \n", + "- `lnd_in`, which cannot be modified directly, but that gets information from user_nl_clm (and provides addition control over the way the land model is configured in your simulation); \n", + "- `datm.streams.xml`, which also cannot be modified directly, but modified with user_datm_streams to point to different data atmosphere streams.\n", + "\n", + "The easiest way to do this is by differencing the same files in each case directory with the `diff` command. \n", + "\n", + "## 2.1 `env_run.xml` " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/scratch/NEON_cases\n", + "diff $new_case.transient/env_run.xml $base_case.transient/env_run.xml " + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "**What are the differences between these two cases**, based on their `env_run.xml` files?\n", + "\n", + "These differences are expected, because NEON cases are set up with `usermod_dirs` that control some of these .xml variables.\n", + "\n", + "You can look at particlar changes for your $new_case below." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cat ~/CTSM/cime_config/usermods_dirs/NEON/$new_case/shell_commands" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "We won't really go into usermod directories here, but they are a useful way to modify the way cases are configured for different model experiments.\n", + "\n", + "usermod_dirs were used when you created your NEON cases with run_neon. \n", + "- The shell_command and user_nl_* files are copied from `~/CTSM/cime_config/usermods_dirs/NEON` into your case directory. \n", + "- Shell commands are executed after the case is created.\n", + "- This makes is easier set up cases in a consistent, repeatable way.\n", + "**Pretty slick software engineering!**\n", + "\n", + "Some NEON sites have additional changes, notably for sites with gaps in the NEON input data. These sites have shorter run times (than the 2018-2021 defaults). " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cat ~/CTSM/cime_config/usermods_dirs/NEON/MOAB/shell_commands" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "These .xml changes set up high-level control over how your simulation is run. What are some of the specifics related to the land model? We can see this by looking at our `lnd_in` file.\n", + "\n", + "## 2.2 `lnd_in` \n", + "\n", + "**What are the differences between these two cases**, based on their `lnd_in` files?" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "diff $new_case.transient/CaseDocs/lnd_in $base_case.transient/CaseDocs/lnd_in " + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "\n", + "
\n", + "REMEMBER:\n", + " \n", + "- The lnd_in file provides a high level summary of all the name list chagnes and files that are being used by CLM. \n", + "- It can be found in the CaseDocs directory, or in your run directory. \n", + "- You cannot directly modifiy the lnd_in file, instead users can modify user_nl_clm.\n", + "\n", + "
\n", + "\n", + "**Initial conditions dataset:** `finidat`\n", + " - These are initial conditions files that we created by spinning up the model. \n", + " - Spin up requires starting the model from bare ground conditions (we call it a *coldstart*).\n", + " - Spin up takes a few hundred years of simulations so that ecosystem carbon and nitrogen pools acheive steady state conditions (e.g. average net ecosystem exchange equals zero). \n", + " - Since this takes a long time, we provide initial conditions for you to start from.\n", + " - **This also means that if you change model parameterizations, input data, or anything else you ahve to spin up the model again!** \n", + "\n", + "**Surface dataset:** `fsurdat`\n", + " - The surface datasets describe what vegetation is growing in a grid cell, characteristics of soil physical properties, and much more information about what the land surface 'looks like' to the model. \n", + " - We modifed these the default surface dataset for each NEON simulation with information about the dominant plant functional type (PFT) and soil properties, based on NEON measurements. \n", + " - This could likely be further refined, but it's a step towards making the model look more like the real world ecosystems we are trying to simulate.\n", + "\n", + "\n", + "There are other differences in the build, but this is basically just reflecting the different case directories for the two NEON cases.\n", + "\n", + "---\n", + "\n", + "The `lnd_in` files are controlled by `user_nl_clm`. Let's see how these are different." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "diff $new_case.transient/user_nl_clm $base_case.transient/user_nl_clm" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "It looks like the only difference here are initial conditions, but that's because we used environmental variables to get the right surface dataset\n", + "\n", + "If you open one of the `user_nl_clm` files you'll see:\n", + "```\n", + "fsurdat = \"$DIN_LOC_ROOT/lnd/clm2/surfdata_map/NEON/surfdata_1x1_NEON_${NEONSITE}_hist_78pfts_CMIP6_simyr2000_c230111.nc\"\n", + "```\n", + "\n", + "We saw this already by `diff`ing the `env_run.xml files`, above, but now we'll use `.xmlquery` to see how these are different in each case." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "echo moving to base_case directory\n", + "cd ~/scratch/NEON_cases/$base_case.transient/\n", + "./xmlquery NEONSITE\n", + "\n", + "echo moving to new_case directory\n", + "cd ~/scratch/NEON_cases/$new_case.transient/\n", + "./xmlquery NEONSITE\n" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "You can also see what **parameter file** is being used for your case. Since we haven't changed this, the model just points to the default CTSM5.1 parameter file." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cat ~/scratch/NEON_cases/$base_case.transient/CaseDocs/lnd_in | grep paramfile\n", + "cat ~/scratch/NEON_cases/$new_case.transient/CaseDocs/lnd_in | grep paramfile\n" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "The land model is using site specific initial conditions and surface data for each NEON site. How else are our simulations different? \n", + "\n", + "## 2.3 `datm.streams.xml` \n", + "\n", + "**What are the differences between these two cases**, based on their `datm.streams.xml` files?\n", + "\n", + "The answer here isn't very interesting... the two cases likely point to different input data reflecting local meterology at each site. It's still helpful to know about how these files are set up.\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/scratch/NEON_cases/\n", + "cat $new_case.transient/CaseDocs/datm.streams.xml | head -20" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "*Which aspects of this file could be changed for a different site?*\n", + "\n", + "You can see check with this code *(HINT: you'll have to paste it in the command line on into a code cell).*\n", + "\n", + "> ```\n", + "> diff $new_case.transient/CaseDocs/datm.streams.xml $base_case.transient/CaseDocs/datm.streams.xml \n", + "> ```\n", + "\n", + "
\n", + "REMEMBER: \n", + "\n", + "- The datm.stream.xml file points to all of the atmospheric boundary conditions (input data) that are being read in for a case. \n", + "- Like your lnd_in files, it can be found in the CaseDocs directory, or in your run directory. \n", + "- You cannot directly modifiy this file, instead users can modify user_nl_datm_streams. \n", + "\n", + "
\n", + "\n", + "---\n", + "\n", + "
\n", + "Congratulations! \n", + " \n", + "You have now cloned a CTSM case to run a simulation at a new NEON tower site, check that yoe can locate the history files from this site and try to plot up some of these data for these new results.\n", + "
\n", + "\n", + "---" + ] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Bash", + "language": "bash", + "name": "bash" + }, + "language_info": { + "codemirror_mode": "shell", + "file_extension": ".sh", + "mimetype": "text/x-sh", + "name": "bash" + } + }, + "nbformat": 4, + "nbformat_minor": 4 +} diff --git a/_sources/notebooks/ProjectExamples/FATESsp_NEON_fromScratch.ipynb b/_sources/notebooks/ProjectExamples/FATESsp_NEON_fromScratch.ipynb new file mode 100644 index 0000000..69b08f3 --- /dev/null +++ b/_sources/notebooks/ProjectExamples/FATESsp_NEON_fromScratch.ipynb @@ -0,0 +1,801 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# FATES-sp simulations at NEON sites\n", + "\n", + "### *run_neon* doesn't work for FATES cases, so we'll create these cases from *'scratch'*\n", + "\n", + "The `run_neon` script we've been using is very useful, but it simplifies a number of steps that users may want to take control of in their workflow. We'll introduce how you can control aspects of your case setup and configuration here. For example, a deeper understanding of the model is need if your want to run FATES case, an unsupported tower (non-NEON) site, a generic single point simulation, a regional domain, or for global case.\n", + "\n", + "If you're new to running CTSM, this is a somewhat advanced tutorial. We're planning on doing all of our examples in the workshop using `run_neon`, so the information in this tutorial may not be needed. That said, it illustrates some important features of how to run the model, how to get initial condition files, and more.\n", + "\n", + "
\n", + "\n", + "---\n", + "\n", + "## In this tutorial\n", + "\n", + "The tutorial has several components. Below you will find steps to: \n", + "1. Create, setup, build, and run a CTSM-FATES-SP case at a NEON site from scratch\n", + "2. Locate history files\n", + "\n", + "
\n", + "\n", + "NOTICE: If you're running this notebook through the NCAR JupyterHub login you need to be on a Cheyenne login node (NOT Casper). \n", + "\n", + "
" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "

1. Set up and run a simulation

\n", + "\n", + "### CTSM can be run in 4 simple steps.\n", + "\n", + "1. **Create** a new case\n", + " - *This step sets up a new simulation. It is the most complicated of these four steps because it involves making choices to set up the model configuration*\n", + "\n", + "2. **Setup** the case \n", + " - *This step configures the model so that it can compile*\n", + "\n", + "3. **Build** the executable\n", + " - *This step compiles the model*\n", + "\n", + "4. **Submit** your run to the batch queue\n", + " - *This step submits the model simulation*\n", + " \n", + "**NOTE:** We'll also customize our case with xml and namelist changes.\n", + "\n", + "
\n", + "\n", + "NOTE: If you haven't done this already, you'll want to create the following directory\n", + "\n", + "`mkdir ~/scratch/NEON_cases`\n", + " \n", + "TIP: If you're running on Cheyenne, creating a softlink to scratch in your home directory is helpful. \n", + " \n", + "You can create this with the following: `ln -s /glade/scratch/$USER ~/scratch`\n", + "\n", + "
\n" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "---\n", + "\n", + "

1.1 create a new case

\n", + "\n", + "## 1.1.1 Navigate to the source code directory\n", + "\n", + "Your source code is in your home directory" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/CTSM/cime/scripts" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 1.1.1 Create a new case" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# Change the 4-character NEON site below.\n", + "export neon_site=\"SOAP\"\n", + "# then create a new case.\n", + "./create_newcase --case ~/scratch/NEON_cases/${neon_site}_FATESsp_test \\\n", + " --res CLM_USRDAT \\\n", + " --compset I1PtClm51Fates \\\n", + " --output-root ~/scratch/NEON_cases/ \\\n", + " --run-unsupported \\\n", + " --user-mods-dir NEON/FATES/${neon_site} \\\n", + " --handle-preexisting-dirs r" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "***\n", + "The code above doesn't always render properly online. Here's what the code actually says:\n", + "\n", + "```\n", + "./create_newcase --case ~/scratch/NEON_cases/${neon_site}_FATESsp_test \\\n", + " --res CLM_USRDAT \\\n", + " --compset I1PtClm51Fates \\\n", + " --output-root ~/scratch/NEON_cases/ \\\n", + " --run-unsupported \\\n", + " --user-mods-dir NEON/FATES/${neon_site} \\\n", + " --handle-preexisting-dirs r\n", + "```\n", + "***\n", + "### **./create_newcase**\n", + "\n", + "
\n", + "\n", + "NOTE: There is a lot of information that goes into creating a case.\n", + "\n", + "You can learn more about the options by typing ./create_newcase --help on the the command line or in a new code cell.\n", + "\n", + "We'll briefly go over some of the highlights here.\n", + "\n", + "
\n", + "\n", + "---\n", + "\n", + "### Required arguments to create a new case\n", + "There are 3 Required arguments Needed to create a new case. These include \n", + "1. `--case`, which specifies the *location* and *name* of the case being created\n", + " - `~/scratch` = the alias to your scratch directory\n", + " - `NEON_cases` = the subdirectory we created to store your other cases\n", + " - `${neon_site}_FATESsp_test` = the name of the case you're creating\n", + " - *Recommendation:* Use meaningful names, including model version, type of simulation, and any additional details to help you remember the configuration of this simulation\n", + "

\n", + "2. `--res` Defines the model *resolution*, or grid,\n", + " - `CLM_USRDAT`, which is an option to get a case setup without having to define the grid resolution, yet. \n", + " - In global cases, the land model is commonly run at a nominal 1 degree `f09_g17` or 2 degree `f19_g17` resolution \n", + " - Using `./query_config --grids` provides a list of supported model resolutions\n", + "

\n", + "3. `--compset` Defines the *component set* for your case, \n", + " - The Component set specifies the default configuration for the case which includes:\n", + " - Component models (e.g. active vs. data vs. stub), \n", + " - Time period of simulations and forcing scenarios (e.g. 1850 vs 2000 vs. HIST) and \n", + " - Physics options (e.g. CLM5.1 vs CLM5.0). \n", + " - `I1PtClm51Fates` is alias that actually describes a much longer set of components that are being used for this single point case. \n", + " - All CLM-only compsets start with *\"I\"*.\n", + " - Using `./query_config --compsets clm` provides examples of other CLM compsets\n", + "
\n", + "\n", + "*There are a few other **optional** flags used to create this new case that we'll briefly touch on here*\n", + "
\n", + "\n", + "4. `--output-root`, which specifies the *location* of your run directory\n", + " - `~/scratch/NEON_cases` = the subdirectory we already created \n", + "
\n", + "\n", + "5. `--user-mods-dirs` sets up the configuration of the case with a user modification directory that defines the location of the site.\n", + " - `NEON/FATES/${neon_site}` has files that format of the history files and a few other custom settings for your case. \n", + " - This inludes setting some of .xml variables and name list settings correctly for a FATES simulation in a NEON single point case. \n", + "
\n", + "\n", + "6. `--run-unsupported` avoids error using compsets are not scientifically supported \n", + "\n", + "
\n", + "\n", + "NOTE: You may notice an error about project codes when you create your case. The project code isn't important for these simulations. But you may need to change this if you're running on Cheyenne.\n", + "\n", + "
\n", + "\n", + "***\n" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "***\n", + "

1.2 Customize your case

\n", + "\n", + "*Modifications for a FATESsp case*\n", + "\n", + "### 1.2.1 Move to your case directory\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/scratch/NEON_cases/${neon_site}_FATESsp_test" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "**Background**\n", + "\n", + "For an SP case, we want to run NEON sites for a bit to let soil water and temperatures the equilibrate before comparing to observations. Luckily, this only takes a few years (in most cases).\n", + "\n", + "**What years is the model set up to run over by default?** We can look by using `./xmlquery`" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./xmlquery DATM_YR_START DATM_YR_ALIGN DATM_YR_END\n", + "./xmlquery STOP_OPTION STOP_N CLM_FORCE_COLDSTART" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Most NEON sites we have 4 complete years of data to work with (2018-2021). \n", + "\n", + "If this is true for your site, we can use xml commands to modify our case\n", + "\n", + "\n", + "In general, we want to run for twice as many years as we have NEON observations. \n", + "- CLM will just cycle over the meterological data that NEON provides. \n", + " - e.g. data from 2018-2021 will be used for 2014-2017 and then again for 2018-2021\n", + "- This will allow the second cycle of our our simulation to end with the same dates over which we have NEON observations, making the comaprision with observations easier. \n", + "\n", + "### 1.2.2 xml changes to modify env_run options\n", + "xml changes are one way you can control your case to customize the simulation\n", + "- We won't cover this here, but other tutorials cover more about xml changes.\n", + "\n", + "**NOTE** `RUN_STARTDATE` is totally arbitrary. It's just the model date when the simulation starts. \n", + "- xml variables like `DATM_YR_START` and `DATM_YR_ALIGN` determine the data that's being read into for your simulation.\n", + "- `CLM_FORCE_COLDSTART` makes it so we don't look for an initial conditions file" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./xmlchange RUN_STARTDATE=2014-01-01 \n", + "./xmlchange STOP_OPTION=nyears\n", + "./xmlchange STOP_N=8 \n", + "./xmlchange DATM_YR_END=2021 #this is the last complete year of input data\n", + "./xmlchange CLM_FORCE_COLDSTART=on" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### 1.2.3 Modify user_nl_clm\n", + "We also won't discuss namelist modificaiton here, but they are another way to customize your case.\n", + "\n", + "Specifically these namelist changes:\n", + "- set up a FATES-SP case.\n", + "- modifies history file output for an SP case.\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#user_nl_clm changes, if sp is true, thne nocomp and fixed_biogeog are too\n", + "echo \"use_fates_sp = .true.\" >> user_nl_clm\n", + "echo \"hist_fincl2 = 'FCEV','FCTR','FGEV','FIRA','FSA','FSH','FATES_GPP','FATES_GPP_PF','H2OSOI','SNOW_DEPTH','TBOT','TSOI'\" >> user_nl_clm" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 1.3 Setup and build your case\n", + "\n", + "*This step configures the model so that it can then compile* \n", + "\n", + "### 1.3.1 case.setup\n", + "The `./case.setup` script:\n", + "1. configures the model\n", + "2. creates files to modify input data and run options" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./case.setup" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./preview_namelists" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#### Chekc that you lnd_in file looks OK (e.g. use_fates_sp = .true., fsurdat = *16pfts*, etc)" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cat CaseDocs/lnd_in | head -60" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "***\n", + "

1.3.2 Build the executable

\n", + "\n", + "*This step compiles the model*\n", + "\n", + "It also takes a long time, so be patient.\n", + "***\n", + "\n", + "The `./case.build` script:\n", + "1. Checks input data\n", + "2. Creates a build/run directory with model executable and namelists" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "qcmd -- ./case.build" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "\n", + "---\n", + "This takes some time, and will throw a bunch of errors... don't worry, just give it time\n", + "\n", + "\n", + "**When the build completes successfully you'll see a notice that the `MODEL BUILD HAS FINISHED SUCCESSFULLY`**\n", + "\n", + "\n", + "You can read on, but before executing any code blocks in the notebook **wait for the model to build.**\n", + "This can take a while.\n", + "\n", + "---" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "

1.4 Submit your case

\n", + "\n", + "Now you're ready to submit the case!\n", + "\n", + "*This step submits the model simulation*\n", + "- You'll also be downloading all the meterological data from NEON for your site, this also takes a little time and prints lots of information to the screen\n", + "***" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./case.submit" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "When you submit a job, you will see confirmation that it successfully submitted:\n", + "\n", + "### Congratulations! \n", + "### You've created and submitted a single point NEON run from scratch.\n", + "\n", + "Next, you will probably want to check on the status of your jobs.\n", + "\n", + "
\n", + "\n", + "TIP: This is dependent on the scheduler that you're using. \n", + "\n", + "
    \n", + "
  • Cheyenne uses PBS where status is checked with qstat -u $USER
    • \n", + "
  • This is also enabled in the cloud for you, try it in the code block below
\n", + "\n", + "If you want to stop the simulation, you can do so with qdel here (or on Cheyenne).\n", + "
    \n", + "
  • Find your Job ID after typing qstat
    • \n", + "
  • Type qdel {Job ID}
    • \n", + "
\n", + "
" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "qstat -u $USER" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "---\n", + "Once your jobs are complete (or show the 'C' state under the 'Use' column, which means complete), we can check the CaseStatus file to ensure there were no errors and it completed successfully. To do this, we'll 'tail' the end of the CaseStatus file:" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "tail ~/scratch/NEON_cases/${neon_site}_FATESsp_test/CaseStatus" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "You should see several lines, with the middle one saying 'case.run success'. \n", + "\n", + "Before that you'll see notifications about xml changes, case.setup, and case.submit, and case.run\n", + "\n", + "
\n", + "Congratulations! \n", + " \n", + "You've created a CTSM case for the NEON tower you selected.\n", + "\n", + "We'll build on these basics in additional tutorials to customize your simulations.\n", + "
\n", + "\n", + "\n", + "\n", + "\n", + "****\n", + "# 2. Locate model history files\n", + "Your simulation will likely take some time to complete. The information\n", + "provided next shows where the model output will be located while the\n", + "model is running and once the simulation is complete. We also provide\n", + "files from a simulation that is already complete so that you can do the\n", + "next exercises before your simulation completes. \n", + "\n", + "
\n", + "\n", + "When your simulation is running history files go to your scratch directory: \n", + "\n", + "
    \n", + "
  • ~/scratch/NEON_cases/{CASE}
    • \n", + "
\n", + "\n", + "Within this directory you can find /run and /bld subdirectories.\n", + "\n", + "When the simulation is complete, a short-term archive directory is created, and history files are moved here: \n", + "\n", + "
    \n", + "
  • ~/scratch/NEON_cases/archive/{CASE}/lnd/hist/
    • \n", + "
\n", + "\n", + "Note that files necessary to continue the run are left in the run directory: ~/scratch/NEON_cases/{CASE}/run\n", + "
\n", + "\n", + "## 2.1 Run directory\n", + "*What's in your run directory?*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "ls ~/scratch/NEON_cases/${neon_site}_FATESsp_test/run" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "*Do you see any log or history files?*\n", + "- log files look like `lnd.log*`\n", + "- history files look like `${neon_site}.transient.clm2.h0.*.nc`\n", + "\n", + "You can keep running the cell above until you see log and history files, then the model is running.\n", + "\n", + "---\n", + "\n", + "## 2.2 Archive directory\n", + "*What's in your archive directory?*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "ls ~/scratch/NEON_cases/archive/${neon_site}_FATESsp_test/lnd/hist | head -5" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "You can drop the `| head -5` part of the cell above if you want to see ALL the files that have been archived.\n", + "\n", + "If you don't see any history files your simulation is likely still running or in the queue (check using squeue or qstat). Check again before you leave today to see if your simulation completed and if the files were transferred to archive. Even if your run isn't finished, you can move on in this tutorial.\n", + "\n", + "If you'd like to visualize these results you can go back to tutorial Day0c and modify to point to these results from the neon_site you just ran." + ] + }, + { + "cell_type": "markdown", + "metadata": { + "tags": [] + }, + "source": [ + "***\n", + "# 3. Create a Clone\n", + "

This step is optional, but provides helpful information

\n", + " \n", + "Creating and building a new case is slow. \n", + "\n", + "Cloning cases can speed this up!\n", + "\n", + "

3.1 Create a clone

\n", + "\n", + "- Clones use the same resolution, compset, and output root.\n", + "- Clones can also share the same executable (build), which can save time!\n", + "\n", + "
\n", + "\n", + "WARNING: If you're making code modifications be careful using clones that share the same build. The example below is a good way to run the same model configuration at different NEON sites.\n", + "\n", + "
\n", + "\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# Move back to your source code directory\n", + "cd ~/CTSM/cime/scripts\n", + "\n", + "# Change the 4-character new NEON site you want to run.\n", + "export neon_site2=\"TEAK\"\n", + "\n", + "# then create a cloned case.\n", + "./create_clone --case ~/scratch/NEON_cases/${neon_site2}_FATESsp_test \\\n", + " --clone ~/scratch/NEON_cases/${neon_site}_FATESsp_test \\\n", + " --user-mods-dirs ~/CTSM/cime_config/usermods_dirs/NEON/FATES/${neon_site2} \\\n", + " --keepexe" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "As before, the code above doesn't always render properly online. Here's what we're doing:\n", + "\n", + "```\n", + "./create_clone --case ~/scratch/NEON_cases/${neon_site2}_FATESsp_test \\\n", + " --clone ~/scratch/NEON_cases/${neon_site}_FATESsp_test \\\n", + " --user-mods-dirs ~/CTSM/cime_config/usermods_dirs/NEON/FATES/${neon_site2} \\\n", + " --keepexe\n", + "```\n", + "\n", + "***\n", + "\n", + "### **./create_clone**\n", + "\n", + "
\n", + "\n", + "NOTE: There is a lot of information that goes into creating a clone.\n", + "\n", + "You can learn more about the options by typing ./create_clone --help on the the command line or in a new code cell.\n", + "\n", + "We'll briefly go over some of the highlights here.\n", + "\n", + "
\n", + "\n", + "\n", + "### Required arguments to create a clone\n", + "There are 2 required arguments needed to create a clone. These include: \n", + "1. `--case`, this is the path and name of the new case your cloning.\n", + "

\n", + "2. `--clone`, this is the path and name of the existing case you want to clone.\n", + "

\n", + "### Additional information we provided here were: \n", + "3. `--user-mods-dirs` as before, this sets up the configuration of the case with a user modification directory that defines the location of the new site we're running, but it requires the full path to the `user-mods-dir` you want to use.\n", + "

\n", + "4. `--keepexe` Point to original build from the case being cloned.\n", + "\n", + "---\n", + "We'll also create a non-FATES case clone for comparison" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/CTSM/tools/site_and_regional\n", + "./run_neon.py --neon-sites $neon_site2 \\\n", + " --output-root ~/scratch/NEON_cases \\\n", + " --setup-only \\\n", + " --overwrite" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "***\n", + "

3.2 Customize the clone?

\n", + "\n", + "*Because you created a clone and point to an existing build we can skip the `case.setup` and `case.build` steps* \n", + "***\n", + "\n", + "### 3.2.1 Move to your case directory and compare env_run" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/scratch/NEON_cases/${neon_site2}_FATESsp_test\n", + "diff env_run.xml ../${neon_site2}.transient/env_run.xml" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### 3.2.2 Make xml changes\n", + "In the example above the teak data record only starts in 2019, meaning we have 3 years of meterological data to cycle through" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./xmlchange RUN_STARTDATE=2016-01-01 \n", + "./xmlchange STOP_OPTION=nyears\n", + "./xmlchange STOP_N=6 \n", + "./xmlchange DATM_YR_END=2021 #this is the last complete year of input data\n", + "./xmlchange CLM_FORCE_COLDSTART=on\n", + "\n", + "# Check that chagnes look as expected from the other FATESsp case\n", + "diff env_run.xml ../${neon_site}_FATESsp_test/env_run.xml" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### 3.2.3 Copy user_nl_clm\n", + "We can just copy the `user_nl_clm` into our cloned case" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cp ../${neon_site}_FATESsp_test/user_nl_clm ." + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "***\n", + "

3.3 Submit the case

\n", + "\n", + "*Because you created a clone and point to an existing build we can skip the `case.setup` and `case.build` steps* \n", + "***\n", + "\n", + "- As before, you'll be downloading all the meterological data, which takes a little time and prints lots of information to the screen\n", + "***\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./case.submit" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "Congratulations! \n", + " \n", + "You've created and run a clone Fof CLM- for the NEON tower you selected.\n", + "
\n", + "\n", + "\n", + "You can track progress on your run using steps outlined in part #2 of this tutorial.\n", + "You can also work on visualizing your results for different sites using visualization code provided\n", + "\n" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "If you're developing this tutorial:\n", + "Before saving and pushing this code to github go to `Kernel` and `Restart kernel and clear all outputs...`" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "ls -lrt ~/scratch/NEON_cases/${neon_site2}_FATESsp_test/run/ | tail -10" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Bash", + "language": "bash", + "name": "bash" + }, + "language_info": { + "codemirror_mode": "shell", + "file_extension": ".sh", + "mimetype": "text/x-sh", + "name": "bash" + } + }, + "nbformat": 4, + "nbformat_minor": 4 +} diff --git a/_sources/notebooks/ProjectExamples/PRISM_Precip_Plots/Plot_PRISM_vs_NEON_Precip.ipynb b/_sources/notebooks/ProjectExamples/PRISM_Precip_Plots/Plot_PRISM_vs_NEON_Precip.ipynb new file mode 100644 index 0000000..9c165cc --- /dev/null +++ b/_sources/notebooks/ProjectExamples/PRISM_Precip_Plots/Plot_PRISM_vs_NEON_Precip.ipynb @@ -0,0 +1,299 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "c9bd9132-a4f6-4d85-8553-0e7d1fa48c55", + "metadata": {}, + "source": [ + "# Compare NEON and PRISM data:" + ] + }, + { + "cell_type": "markdown", + "id": "050df3b3-429a-4e80-919c-87dc4e29d0cb", + "metadata": {}, + "source": [ + "### Use this notebook to generate timeseries & cumulative precipitation plots" + ] + }, + { + "cell_type": "code", + "execution_count": 1, + "id": "0051bc6d-ad33-4036-a5d5-d949c2ca4c59", + "metadata": { + "tags": [] + }, + "outputs": [], + "source": [ + "# Import Libraries\n", + "%matplotlib inline\n", + "from datetime import datetime\n", + "from glob import glob\n", + "import matplotlib\n", + "import matplotlib.pyplot as plt\n", + "import numpy as np\n", + "import pandas as pd\n", + "import xarray as xr" + ] + }, + { + "cell_type": "markdown", + "id": "84f5a6b7-a051-472c-9374-a5348c91cf2b", + "metadata": {}, + "source": [ + "# Choose site and retrieve PRISM data" + ] + }, + { + "cell_type": "code", + "execution_count": 68, + "id": "b803a754-b87f-4f7e-8cac-3a06364d7b08", + "metadata": {}, + "outputs": [], + "source": [ + "# Choose Year and Site (please use strings, e.g. put quotes around the year, as well)\n", + "year = '2019' # if you change this, be sure to locate the correct site index in the csv files for your site (see prism_2019_site_start_index as example)\n", + "site = 'KONZ'\n", + "username= 'tking' # CHANGE TO YOUR USERNAME" + ] + }, + { + "cell_type": "code", + "execution_count": 88, + "id": "9987732b-846d-44b4-8ea9-474577fec006", + "metadata": {}, + "outputs": [], + "source": [ + "# Get prism data for particular year and site\n", + "pd.set_option('mode.chained_assignment', None)\n", + "prism_files_per_year = {'2018': 'PRISM_ppt_tmean_stable_4km_20180101_20181231.csv',\n", + " '2019': 'PRISM_ppt_tmean_stable_4km_20190101_20191231.csv',\n", + " '2020': 'PRISM_ppt_tmean_stable_4km_20200101_20201231.csv',\n", + " '2021': 'PRISM_ppt_tmean_stable_4km_20210101_20211231.csv',\n", + " '2022': 'PRISM_ppt_tmean_stable_4km_20220101_20220430.csv'}\n", + "\n", + "# TODO: include site_start_index for other years, as well\n", + "prism_2019_site_start_index = {'BART': 11, 'HARV': 377, 'BLAN': 743, 'SCBI': 1109, 'SERC': 1474, 'DSNY': 1841,\n", + " 'JERC': 2207, 'OSBS': 2573, 'STEI': 2939, 'TREE': 3305, 'UNDE': 3671, 'KONA': 4037,\n", + " 'KONZ': 4403, 'UKFS': 4769, 'GRSM': 5135, 'MLBS': 5501, 'ORNL': 5867, 'DELA': 6233,\n", + " 'LENO': 6599, 'TALL': 6965, 'DCFS': 7331, 'NOGP': 7697, 'WOOD': 8063, 'CPER': 8429,\n", + " 'RMNP': 8795, 'STER': 9161, 'CLBJ': 9527, 'OAES': 9893, 'YELL': 10259, 'MOAB': 10625,\n", + " 'NIWO': 10991, 'JORN': 11357, 'SRER': 11723, 'ONAQ': 12089, 'ABBY': 12455,\n", + " 'WREF': 12821, 'SJER': 13187, 'SOAP': 13553, 'TEAK': 13919\n", + " }\n", + "\n", + "\n", + "prism_2020_site_start_index = {'BART': 11, 'HARV': 378, 'BLAN': 745, 'SCBI': 1121, 'SERC': 1479, 'DSNY': 1846,\n", + " 'JERC': 2236, 'OSBS': 2598, 'STEI': 2964, 'TREE': 3330, 'UNDE': 3697, 'KONA': 4062,\n", + " 'KONZ': 4428, 'UKFS': 4799, 'GRSM': 5160, 'MLBS': 5526, 'ORNL': 5892, 'DELA': 6258,\n", + " 'LENO': 6624, 'TALL': 6990, 'DCFS': 7356, 'NOGP': 7722, 'WOOD': 8088, 'CPER': 8454,\n", + " 'RMNP': 8820, 'STER': 9186, 'CLBJ': 9553, 'OAES': 9920, 'YELL': 10287, 'MOAB': 10654,\n", + " 'NIWO': 11021, 'JORN': 11388, 'SRER': 11755, 'ONAQ': 12122, 'ABBY': 12489,\n", + " 'WREF': 12856, 'SJER': 13223, 'SOAP': 13590, 'TEAK': 13957\n", + " }\n", + "start_index = {'2019': prism_2019_site_start_index,\n", + " '2020': prism_2020_site_start_index}\n", + "\n", + "# perform conversions and gather relevant data\n", + "prism_df = pd.read_csv(prism_files_per_year[year], sep=';')\n", + "\n", + "# find relevant rows based on whether or not site is in cell\n", + "prism_data = prism_df[prism_df['PRISM Time Series Data'].str.contains(site)]\n", + "\n", + "new_df = prism_data[\"PRISM Time Series Data\"].str.split(\",\", expand = True)\n", + "\n", + "prism_data[\"Precip\"] = new_df[5] # rain is 6th value in csv file, indexing starts at 0, so index #6\n", + "prism_data[\"Time\"] = new_df[4] # date is 5th value in csv file, indexing starts at 0, so index #4\n", + "\n", + "# Perform unit conversions\n", + "prism_data['Precip'] = prism_data['Precip'].astype(float)" + ] + }, + { + "cell_type": "code", + "execution_count": 89, + "id": "67f2f15a-e137-4377-9c1b-05299b5291cc", + "metadata": {}, + "outputs": [], + "source": [ + "# read in NEON data\n", + "\n", + "# EITHER use default data\n", + "# half_hourly_files = '/scratch/data/NEONv2/datm/{}/{}_atm_{}-*.nc'.format(site,site, year)\n", + "\n", + "# OR use data from the case you ran\n", + "half_hourly_files = '/home/{}/scratch/NEON_cases/{}.PRISM.transient/run/inputdata/atm/cdeps/v2/{}/{}_atm_{}-*.nc'.format(username, site, site, site, year)\n", + "\n", + "half_hourly_neon_dataset = xr.open_mfdataset(half_hourly_files, parallel=True)" + ] + }, + { + "cell_type": "code", + "execution_count": 90, + "id": "1a31bc30-e341-4748-8024-b83d56be709a", + "metadata": {}, + "outputs": [], + "source": [ + "# resample NEON data to be daily\n", + "daily_neon_prect_dataset = half_hourly_neon_dataset['PRECTmms'].resample(time='D').mean()" + ] + }, + { + "cell_type": "code", + "execution_count": 91, + "id": "bfd30461-68a8-41de-b920-90f8db9a2c64", + "metadata": { + "tags": [] + }, + "outputs": [], + "source": [ + "# get correct units (mm/s * (3600s/hr) * (24hr/day) = mm/day)\n", + "daily_neon_prect = daily_neon_prect_dataset[:,0,0] * 3600 * 24 " + ] + }, + { + "cell_type": "code", + "execution_count": 92, + "id": "ce8029a7-0c8c-4b60-909f-fae949d816c1", + "metadata": {}, + "outputs": [], + "source": [ + "# gather time and precipitation data from PRISM files, and use reformat time values\n", + "prism_time_vals = prism_data['Time']\n", + "prism_precip_vals = prism_data['Precip']\n", + "\n", + "prism_times=[]\n", + "for val in prism_time_vals:\n", + " prism_times.append(datetime.strptime(val,'%Y-%m-%d'))" + ] + }, + { + "cell_type": "markdown", + "id": "4d2e06f2-8212-4f39-bbd2-6194cc5e0699", + "metadata": {}, + "source": [ + "### Calendar year daily precipitation plot" + ] + }, + { + "cell_type": "code", + "execution_count": 93, + "id": "ee878737-796f-4e76-a284-7ce57ad078c2", + "metadata": {}, + "outputs": [ + { + "data": { + "image/png": "iVBORw0KGgoAAAANSUhEUgAABM0AAAHUCAYAAAApy98MAAAAOXRFWHRTb2Z0d2FyZQBNYXRwbG90bGliIHZlcnNpb24zLjcuMSwgaHR0cHM6Ly9tYXRwbG90bGliLm9yZy/bCgiHAAAACXBIWXMAAA9hAAAPYQGoP6dpAAEAAElEQVR4nOzdeZwT9f0/8NccSXYXFlQEFgQRFE/UqlgUD/AApXi0VFuLtlpbq0Vr8fiqFA+0FRT7s3yVqm21glrU2qLfWuuBF2q9EG+8lctjRa5d2CvJzOf3x8xnMpNjN7ObZCbJ6/l4rC6T67PJ5Jh33ocihBAgIiIiIiIiIiIihxr0AoiIiIiIiIiIiMKGQTMiIiIiIiIiIqI0DJoRERERERERERGlYdCMiIiIiIiIiIgoDYNmREREREREREREaRg0IyIiIiIiIiIiSsOgGRERERERERERURoGzYiIiIiIiIiIiNIwaEZERERERERERJSGQTMiIioLCxYsgKIoqKmpwerVqzNOHz9+PEaNGuXZttNOO0FRlKw/48ePz7iOl19+GSeffDIGDRqEaDSKhoYGnHTSSXjppZcKsp6gKYqCWbNmdXqeVatWee4nVVXRr18/fOc738m4H9Lv0z59+mDs2LG49957M65X3l+vvfaaZ/vjjz+OiRMnYvDgwYjFYhg8eDDGjx+P6667znM++Vhme9wA4K677nLW8eyzz3b6Nz777LOedUejUfTv3x+HHHIIZs6cmfXxzJe8/xYsWOBsk3/7qlWrun29brNmzcpY//Dhw/HrX/8amzdvLsht+DF+/Picj0tXst03ixYtwrx583q0pltuucXzGEjZHp+wee+99zBr1qy895dcz63169dj9OjR6N27N5YsWeJsL+brXPq+meunM8uXL8e5556LvffeG/X19Rg4cCCOPvpoPP3001nP/9lnn2HKlCnYZptt0Lt3b0yYMAGvv/56xvnuuusunHLKKdhtt92gqip22mmnnGt49dVXccwxx6C+vh69e/fGEUccgf/+97+drpuIiCoTg2ZERFRWOjo6cPnll+d9/kMOOQQvvfRSxs8tt9ziOd/NN9+MQw45BJ9//jnmzp2LJ598Er///e/xxRdf4NBDD8X8+fMLsp5y8atf/QovvfQSnn/+ecyZMwdvvfUWjjjiCLzxxhue88mD7RdffBG33XYbmpubMXXqVCxatKjL27jttttw7LHHok+fPpg/fz4ef/xxXH/99dhjjz3wj3/8I+P89fX1eO655/Dpp59mnPbXv/4Vffr08fU3zp49Gy+99BKeeeYZ3HHHHRg/fjz++te/Yo899sDf/vY3X9clDRo0CC+99BImT57crcv78dhjj+Gll17CI488gu9+97u4+eabMWnSJAghin7bbrfcckvG8ylfkydPxksvvYRBgwY524oZNCvl49Nd7733Hq6++uoeBVk///xzHHbYYfjss8/w5JNPYsKECQCK/zr385//POvr7UsvveQE7L/73e92eh333nsvXn31VZx55pn4v//7P9x+++2IxWI46qijcNddd3nO+8033+Cwww7DRx99hL/+9a/4+9//jvb2dowfPx4ffvih57x33303VqxYgW9/+9vYeeedc97+smXLcPjhh6OtrQ1333037r77brS3t+Ooo47KGlgkIqIKJ4iIiMrAnXfeKQCIY489VqiqKt58803P6ePGjRN77bWXZ9uwYcPE5MmTu7zuF154QaiqKo477jiRSCQ8pyUSCXHccccJVVXFCy+80KP1BA2AuOqqqzo9z8qVKwUAccMNN3i2P/XUUwKA+PnPf+65vnPPPddzvlWrVgkA4vDDD/dsl/fXsmXLnG077rhjxvkkwzA8/x42bJiYNGmSGDJkiPjNb37jOe2TTz4RiqKIs846SwAQzzzzTKd/4zPPPCMAiAceeCDjtA0bNoj99ttP6Lou3n777U6vJ1/yb1+5cmVBru+qq64SAMQ333zj2f7jH/9YAPDsp+laWloKsoZimjx5shg2bFiPrmOvvfYS48aNK8h6Su2BBx7Iaz+W0p9bH330kdhxxx3FoEGDPPtwkK9zn376qdh2223FbrvtJpqamjo979dff52xLZlMin322UfsvPPOnu3/8z//IyKRiFi1apWzrampSWy//fbiBz/4gee87teUzvaxY445RgwcONDzXGlubhbbb7+9GDt2bKdrJyKiysNMMyIiKiuXXHIJ+vXrh0svvbRg1zlnzhwoioJbb70Vuq57TtN1HbfccgsURckoGSzEepYsWYITTzwRQ4YMQU1NDXbZZRecffbZWL9+ved8suxpxYoV+NGPfoS+ffti4MCBOPPMM9HU1OQ5b3NzM8466yz069cPvXv3xrHHHouPPvqoW+uTDjroIADosnRx2LBh6N+/P77++usur3PDhg2eDCM3Vc38iKKqKn7yk59g4cKFME3T2f7Xv/4VQ4cOxdFHH93lbXZlu+22w5/+9Cckk0n84Q9/cLZ/8skn+OlPf4qRI0eirq4OO+ywA44//ni88847nsvnU/7329/+FrquY+3atRmnnXnmmejXrx/a29t9rz39MZKlc8899xzGjh2Luro6nHnmmQCsfeTiiy/G8OHDEY1GscMOO2D69OloaWnxXKdpmrj55pvxrW99C7W1tdhmm21w0EEH4V//+pdznvTyTHkfzJ07F9deey123HFH1NTUYPTo0Xjqqac8159enjl+/Hg88sgjWL16ddZyvquvvhpjxozBdttthz59+mD//ffHHXfc4cmu22mnnbBixQosXbrUubwsxcv1+Lzwwgs46qijUF9fj7q6OowdOxaPPPJI1rU+88wz+OUvf4ntt98e/fr1w5QpU/Dll192+fi89tprOOWUU7DTTjuhtrYWO+20E370ox95nlMLFizAySefDAA44ogjnPXnW0765ptv4tBDD4Wu63jhhRew9957O6cF9TrX0tKC7373u0gkEnjwwQe7zAgdMGBAxjZN03DAAQdkPGcefPBBHHnkkRg2bJizrU+fPpgyZQoefvhhJJNJZ3u215Rs/vvf/2L8+PGoq6tzttXX1+Pwww/Hiy++iK+++iqv6yEiosrAoBkREZWV+vp6XH755Xj88cdz9rhxE0IgmUxm/MiDbMMw8Mwzz2D06NEYMmRI1usYOnQoDjjgADz99NMwDKNH60n36aef4uCDD8att96KJ554AldeeSVeeeUVHHrooUgkEhnn//73v49dd90V//znP3HZZZdh0aJFuOCCCzx/73e/+13cfffduOiii/Dggw/ioIMOwqRJk3yvze2TTz4BAPTv37/T8zU1NWHjxo3Yddddu7zOgw8+GP/85z8xa9YsvPXWWxn3bTZnnnkmvvzySzz++OMArMdv4cKFOOOMM/I+KO7KgQceiEGDBuG5555ztn355Zfo168frrvuOjz22GP44x//CF3XMWbMmIwysK6cffbZ0HUdf/rTnzzbN27ciPvuuw8/+9nPUFNT43vd2R6jr776CqeddhqmTp2K//znP5g2bRpaW1sxbtw4LFy4EOeffz4effRRXHrppViwYAFOOOEETwDqjDPOwK9//WsceOCBuP/++3HffffhhBNOyKt0cP78+Xjssccwb9483HPPPVBVFZMmTeq0xO2WW27BIYccgoaGBk9pn7Rq1SqcffbZ+Pvf/47FixdjypQp+NWvfoXf/va3znkefPBBjBgxAvvtt59z+QcffDDnbS5duhRHHnkkmpqacMcdd+Dee+9FfX09jj/+eNx///0Z5//5z3+OSCSCRYsWYe7cuXj22Wdx2mmndXl/rFq1CrvtthvmzZvnlCJ/9dVXOPDAA50g+eTJkzF79mwAwB//+Edn/fmUk77wwgsYP348BgwYgBdeeAEjRoxwTgvyde5nP/sZ3nnnHSxYsAB77LGHr8tKyWQSzz//PPbaay9nW1tbGz799FPss88+GeffZ5990NbWhs8++8z3bcXjccRisYztclt6oJyIiCpcoHluREREeXKXIHV0dIgRI0aI0aNHC9M0hRC5yzMBZP357W9/K4QQorGxUQAQp5xySqe3/8Mf/lAAcEqHurOerpimKRKJhFi9erUAIP7v//7POU2W5M2dO9dzmWnTpomamhrndh999FEBQPzv//6v53zXXnutr/LM66+/XiQSCdHe3i6WL18uDjzwQAFAPPLII855AYhp06aJRCIh4vG4+Oijj8QJJ5wg6uvrxWuvvea53mzlmZ988okYNWqU85jU1taKo446SsyfP1/E43HP5d2ltuPGjRMnnXSSEEKIRx55RCiKIlauXJl3WVtn5ZnSmDFjRG1tbc7Tk8mkiMfjYuTIkeKCCy7IuP/uvPPOjL/dXZ55+umniwEDBoiOjg5n2/XXXy9UVe2yjFPuC42NjSKRSIhNmzaJe+65R9TW1oqhQ4eKtrY2IYR1PwEQTz31lOfyc+bMEaqqeh4LIYT4xz/+IQCI//znP0IIIZ577jkBQMycObPT9YwbN85TCinvg8GDBztrEcIqcdtuu+3E0Ucf3el9k295pmEYIpFIiGuuuUb069fPeQ4Ikbs8M9vjc9BBB4kBAwaILVu2ONuSyaQYNWqUGDJkiHO9cq3Tpk3zXOfcuXMFAPHVV191uWa3ZDIptm7dKnr16uV5vna3PBOA6Nu3r1i3bl3GeYJ6nZP3zWWXXZbX35LLzJkzBQDx0EMPOdu++OILAUDMmTMn4/yLFi0SAMSLL76Y9fo628e+9a1viV133dVTzplIJMSIESMEALFo0aIe/S1ERFRemGlGRERlJxqN4ne/+x1ee+01/P3vf+/0vIceeiiWLVuW8fOzn/3M120KO/sm2+Q3P+tJt27dOpxzzjkYOnQodF1HJBJxSo3ef//9jPOfcMIJnn/vs88+aG9vx7p16wAAzzzzDADg1FNP9Zxv6tSpvtZ16aWXIhKJoKamBgcccADWrFmDP/3pT/jOd77jOd8tt9yCSCSCaDSKXXfdFY8++ijuvfdeHHDAAV3exs4774y33noLS5cuxdVXX42jjz4ay5Ytw3nnnYeDDz44Z4nimWeeiX/961/YsGED7rjjDhxxxBGdTsLrDuHKtgKsTJfZs2djzz33RDQaha7riEaj+Pjjj7M+Tl359a9/jXXr1uGBBx4AYJVB3nrrrZg8eXLef0tDQwMikQi23XZbnHbaadh///3x2GOPebLUtt12Wxx55JGey/373//GqFGj8K1vfcuTfXnMMcd4po8++uijAIBzzz3X998HAFOmTPGsRWZvPffcc3llFWbz9NNP4+ijj0bfvn2haRoikQiuvPJKbNiwwXkO+NHS0oJXXnkFJ510Enr37u1s1zQNP/7xj/H5559nZBJmew4CXZcub926FZdeeil22WUX6LoOXdfRu3dvtLS0dGsfSnfCCSegqakJ06dP7/b9W8jXuSeffBIzZszAhAkTcO2113ZrPQBw++2349prr8VFF12EE088MeP0zqZxdjWpM5tf/epX+Oijj3Deeefhiy++wNq1a3HOOec4j2+hMlqJiKg88FWfiIjK0imnnIL9998fM2fOzFrGKPXt2xejR4/O+JG9tLbffnvU1dVh5cqVnd7eqlWrUFdXh+22265H63EzTRMTJ07E4sWLcckll+Cpp57Cq6++ipdffhmAVX6Url+/fp5/y5Ihed4NGzZA1/WM8zU0NOS1JunXv/41li1bhuXLl+PTTz/FV199hV/84hcZ5/vBD36AZcuW4cUXX8Sf/vQn1NfX45RTTsHHH3+c1+2oqorDDz8cV155Jf71r3/hyy+/xA9/+EMsX74cf/3rX7Ne5qSTTkJNTQ3+8Ic/4OGHH/YdAM3HmjVrMHjwYOffF154Ia644gp897vfxcMPP4xXXnkFy5Ytw7777pv1cerKfvvth8MOOwx//OMfAViBrFWrVuG8887L+zqefPJJLFu2DG+++SbWr1+PF154AXvuuafnPNl6xn399dd4++23EYlEPD/19fUQQjilgt988w00TfO970jZLtfQ0IB4PI6tW7f6vr5XX30VEydOBAD85S9/wX//+18sW7YMM2fOBJD9+dKVTZs2QQiR9X6Sj/+GDRs827t6DuYydepUzJ8/Hz//+c/x+OOP49VXX8WyZcvQv3//bq093RVXXIErr7wSixYtwmmnneYJnJX6dW7VqlU45ZRTMGTIENx7773dDjTdeeedOPvss/GLX/wCN9xwg+e0bbfdFoqiZDw+gFXqDCDn39GZM888E9dddx3uvvtuDBkyBDvuuCPee+89XHzxxQCAHXbYoRt/CRERlSu967MQERGFj6IouP766zFhwgT8+c9/7vb1aJqGI444Ao899hg+//zzrP1+Pv/8cyxfvhyTJk2CpmkFW8+7776Lt956CwsWLMDpp5/ubJe9qbqjX79+SCaT2LBhg+fgvrGx0df1DBkyBKNHj+7yfP3793fOd/DBB2OPPfbAuHHjcMEFF+Df//63v8UD6NWrF2bMmIH7778f7777btbz1NXV4ZRTTsGcOXOcpt+F9Oqrr6KxsdETjLvnnnvwk5/8xOk3Ja1fvx7bbLNNt27n/PPPx8knn4zXX38d8+fPx6677ooJEybkffl9990X22+/fafnyZZps/3226O2tjZnUFJeZ//+/WEYBhobG3MObOhMtn2usbER0WjUk9WVr/vuuw+RSAT//ve/PRlsDz30kO/rkrbddluoqpq1ubts7t/VfZyPpqYm/Pvf/8ZVV12Fyy67zNne0dHhBHgK4eqrr4aiKLj66qthmib+9re/Qdf1kr7OtbW1YcqUKWhpacETTzyREWTM15133omf//znOP3003Hbbbdl7Mu1tbXYZZddsvYYe+edd1BbW+vp6+bHpZdeiunTp+Pjjz9GfX09hg0bhrPPPhu9evXKK4uWiIgqBzPNiIiobB199NGYMGECrrnmmm5lrkgzZsyAEALTpk3LKGsyDAO//OUvIYTAjBkzCroeeRCY3nQ6vUG8H0cccQQA4G9/+5tn+6JFi7p9nX4cdthh+MlPfoJHHnmk04bvAHJOoZOlau5Mr3S//OUvcfzxx+PKK6/sVtP8XDZu3IhzzjkHkUjEM2BBUZSMx+mRRx7BF1980e3b+t73vocdd9wRF110EZ588klMmzatW+Vkfh133HH49NNP0a9fv6xZmLI8VA6PuPXWW7t1O4sXL/aU2G7ZsgUPP/wwDjvssJxBGcB6PmTLvFIUxQkASW1tbbj77rvzvo50vXr1wpgxY7B48WLP+U3TxD333IMhQ4bkNdSiK4qiQAiRsQ/dfvvtGa85+Wau5TJr1ixcffXV+Pvf/46pU6c6EyRL9Tp31lln4Y033sBtt92G/fffv1t/w4IFC/Dzn/8cp512Gm6//facz4vvfe97ePrppz1TNbds2YLFixfjhBNOyJgS6kcsFsOoUaMwbNgwrFmzBvfffz/OOuss1NbWdvs6iYio/DDTjIiIytr111+PAw44AOvWrfNMVpM2b97slDu6xWIx7LfffgCAQw45BPPmzcP06dNx6KGH4rzzzsOOO+6INWvW4I9//CNeeeUVzJs3D2PHju3xetx233137LzzzrjssssghMB2222Hhx9+GEuWLMnzr880ceJEHH744bjkkkvQ0tKC0aNH47///W/WwEKx/Pa3v8X999+PK664Ak8++WTO8+2111446qijMGnSJOy8885ob2/HK6+8gv/3//4fBg4c2GnZ5be+9a0eZRgBwMcff4yXX34Zpmliw4YNeOWVV3DHHXegubkZd911l+fxO+6447BgwQLsvvvu2GeffbB8+XLccMMNOScR5kPTNJx77rm49NJL0atXL5xxxhk9+nvyNX36dPzzn//E4YcfjgsuuAD77LMPTNPEmjVr8MQTT+Ciiy7CmDFjcNhhh+HHP/4xfve73+Hrr7/Gcccdh1gshjfeeAN1dXX41a9+1eXfN2HCBFx44YUwTRPXX389mpubcfXVV3d6ub333huLFy/GrbfeigMOOACqqmL06NGYPHkybrzxRkydOhW/+MUvsGHDBvz+97/POulw7733xn333Yf7778fI0aMQE1NDfbee++stzdnzhxMmDABRxxxBC6++GJEo1HccsstePfdd3HvvfcWJJDZp08fHH744bjhhhuw/fbbY6eddsLSpUtxxx13ZGQqjho1CgDw5z//GfX19aipqcHw4cN9ZWxdeeWVUFUVV1xxBYQQuPfee0vyOve///u/+Nvf/oYjjzwSu+22W9bXXsAqT872uAHAAw88gJ/97Gf41re+hbPPPhuvvvpqzstefPHFuPvuuzF58mRcc801iMViuO6669De3o5Zs2Z5Lvfee+/hvffeA2BlPLa2tuIf//gHAGDPPfd0Spvfffdd/POf/8To0aMRi8Xw1ltv4brrrsPIkSM9U1qJiKhKBDN/gIiIyJ9s0xelqVOnCgC+pmfusMMOGdfz0ksviZNOOkkMHDhQ6LouBgwYIKZMmZJ1Alt31pPNe++9JyZMmCDq6+vFtttuK04++WSxZs2ajEmXcmLiN998k3Ud7umDmzdvFmeeeabYZpttRF1dnZgwYYL44IMPfE3PvOGGG7pcOwBx7rnnZj3tf/7nfwQAsXTpUs863ffXn/70JzFlyhQxYsQIUVdXJ6LRqNh5553FOeecI9auXeu5Pvf0zFz8Ts+UP7qui379+omDDz5Y/OY3vxGrVq3KuMymTZvEz372MzFgwABRV1cnDj30UPH888/nnBzZ1fRMadWqVQKAOOecczpds1uufSFdZ5MNt27dKi6//HKx2267iWg0Kvr27Sv23ntvccEFF4jGxkbnfIZhiD/84Q9i1KhRzvkOPvhg8fDDD3tuJ9t9cP3114urr75aDBkyRESjUbHffvuJxx9/3LOObPfNxo0bxUknnSS22WYboSiKcH9c/etf/yp22203EYvFxIgRI8ScOXPEHXfckXEdq1atEhMnThT19fUCgDMpMdvjI4QQzz//vDjyyCNFr169RG1trTjooIM8f6N7renPebk/dbXfff755+L73/++2HbbbUV9fb049thjxbvvviuGDRsmTj/9dM95582bJ4YPHy40Tcu63nzWJURqau6UKVOcibTFfJ2TE1u7+ulsQuzpp5/u67KffPKJ+O53vyv69Okj6urqxFFHHSWWL1+ecb3yeZPtx/26+OGHH4rDDz9cbLfddiIajYpddtlFXH755WLr1q0510xERJVLESJtPBQRERERlcTNN9+M888/H++++26XmYnlYtWqVRg+fDhuuOEGp3k6ERERUTlieSYRERFRib3xxhtYuXIlrrnmGpx44okVEzAjIiIiqiQMmhERERGV2Pe+9z00NjbisMMOw2233Rb0coiIiIgoC5ZnEhERERERERERpVGDXgAREREREREREVHYMGhGRERERERERESUhkEzIiIiIiIiIiKiNBU/CMA0TXz55Zeor6+HoihBL4eIiIiIiIiIiAIkhMCWLVswePBgqGrufLKKD5p9+eWXGDp0aNDLICIiIiIiIiKiEFm7di2GDBmS8/SKD5rV19cDsO6IPn36BLwaIiIiIiIiIiIKUnNzM4YOHerEjHKp+KCZLMns06cPg2ZERERERERERAQAXbbx4iAAIiIiIiIiIiKiNAyaERERERERERERpWHQjIiIiIiIiIiIKE3F9zQjIiIiIiIiIgoDwzCQSCSCXkbF0zQNuq532bOsKwyaEREREREREREV2datW/H5559DCBH0UqpCXV0dBg0ahGg02u3rYNCMiIiIiIiIiKiIDMPA559/jrq6OvTv37/HGVCUmxAC8Xgc33zzDVauXImRI0dCVbvXnYxBMyIiIiIiIiKiIkokEhBCoH///qitrQ16ORWvtrYWkUgEq1evRjweR01NTbeuh4MAiIiIiIiIiIhKgBlmpdPd7DLPdRRgHURERERERERERBWFQTMiIiIiIiIiIqI0DJoRERERERERERGlYdCMiIiIiIiIiIgynHHGGVAUBdddd51n+0MPPeT0Z3v22WehKErWn8bGRucyGzduxPTp07HTTjshGo1i0KBB+OlPf4o1a9b4vs1SYdCMiIiIiIiIiIiyqqmpwfXXX49NmzZ1er4PP/wQX331lednwIABAKyA2UEHHYQnn3wSt9xyCz755BPcf//9+PTTT3HggQfis88+69ZtFhuDZkREREQB+uypz/D67a9DmCLopRAREVGpCAEYHcH8CH+fOY4++mg0NDRgzpw5nZ5vwIABaGho8PzICZYzZ87El19+iSeffBLf+c53sOOOO+Lwww/H448/jkgkgnPPPbdbt1lseqC3TkRERFTlPn3iU7Rvbscux+6CPkP6BL0cIiIiKgUzDiw/P5jbPuAmQIvlfXZN0zB79mxMnToV559/PoYMGeLr5kzTxH333YdTTz0VDQ0NntNqa2sxbdo0XH755di4cSO22267gtxmoTDTjIiIiChAwrC+7TUNM+CVEBEREWX3ve99D9/61rdw1VVX5TzPkCFD0Lt3b+dnt912AwB888032Lx5M/bYY4+sl9tjjz0ghMAnn3zi+zaLjZlmRERERAFyyjJZnUlERFQ91KiV8RXUbXfD9ddfjyOPPBIXXXRR1tOff/551NfXO//W9fxCTsIuF83W5L+r2yy2QDPNkskkLr/8cgwfPhy1tbUYMWIErrnmGphm6ptWIQRmzZqFwYMHo7a2FuPHj8eKFSsCXDURERFR4cgPisJnfxEiIiIqY4pilUgG8dPNCZSHH344jjnmGPzmN7/Jevrw4cOxyy67OD877bQTAKB///7YZptt8N5772W93AcffABFUbDzzjv7vs1iCzRodv311+O2227D/Pnz8f7772Pu3Lm44YYbcPPNNzvnmTt3Lm688UbMnz8fy5YtQ0NDAyZMmIAtW7YEuHIiIiKiwpCZZhwEQERERGF33XXX4eGHH8aLL76Y92VUVcUPfvADLFq0CI2NjZ7T2tracMstt+CYY45x+pkV4jYLJdCg2UsvvYQTTzwRkydPxk477YSTTjoJEydOxGuvvQbA+sZ13rx5mDlzJqZMmYJRo0Zh4cKFaG1txaJFi4JcOhEREVFhiLT/ExEREYXU3nvvjVNPPdWT7CStW7cOjY2Nnp9EIgEAuPbaa50kqEcffRRr167Fc889h2OOOQaJRAJ//OMfu3WbxRZo0OzQQw/FU089hY8++ggA8NZbb+GFF17Ad77zHQDAypUr0djYiIkTJzqXicViGDduXM4IY0dHB5qbmz0/RERERGHlZJqxPJOIiIjKwG9/+9usn1t22203DBo0yPOzfPlyAMD222+Pl19+GUcccQTOPvtsjBgxAj/4wQ8wYsQILFu2DCNGjOjWbRZboIMALr30UjQ1NWH33XeHpmkwDAPXXnstfvSjHwGAk7Y3cOBAz+UGDhyI1atXZ73OOXPm4Oqrry7uwomIiIgKhIMAiIiIKKwWLFiQsW3YsGFob293/j1+/Pi8Alrbb789brrpJtx0U+cDEPK5zVIJNNPs/vvvxz333INFixbh9ddfx8KFC/H73/8eCxcu9JwvfYKCECLrVAUAmDFjBpqampyftWvXFm39RERERD3FnmZERERE4RRoptn//M//4LLLLsMpp5wCwKpTXb16NebMmYPTTz8dDQ0NAKyMs0GDBjmXW7duXUb2mRSLxRCLxYq/eCIiIqIC4PRMIiIionAKNNOstbUVqupdgqZpME0TgDWutKGhAUuWLHFOj8fjWLp0KcaOHVvStRIREREVmjtQxkwzIiIionAJNNPs+OOPx7XXXosdd9wRe+21F9544w3ceOONOPPMMwFYZZnTp0/H7NmzMXLkSIwcORKzZ89GXV0dpk6dGuTSiYiIiHrMEyhjzIyIiIgoVAINmt1888244oorMG3aNKxbtw6DBw/G2WefjSuvvNI5zyWXXIK2tjZMmzYNmzZtwpgxY/DEE0+gvr4+wJUTERER9Zw7aMZMMyIiIqJwUUSFN9Bobm5G37590dTUhD59+gS9HCIiIiKHETfwn1/9BwBw4LQD0bBvQ8ArIiIiomJob2/HypUrMXz4cNTU1AS9nKrQ2X2eb6wo0J5mRERERNWMmWZERERE4cWgGREREVFA2NOMiIiIKLwYNCMiIiIKiGd6ZmV3zCAiIiIqOwyaEREREQWEmWZERERE4cWgGREREVFQ3DEz9jQjIiKikDnjjDOgKAoURUEkEsGIESNw8cUXo6WlBatWrXJOUxQFffv2xUEHHYSHH37Ycx0LFizANtts4/zbMAzMmTMHu+++O2pra7HddtvhoIMOwp133plxu+ecc07GmqZNmwZFUXDGGWcU6892MGhGREREFBDPIACWZxIREVEIHXvssfjqq6/w2Wef4Xe/+x1uueUWXHzxxc7pTz75JL766iu88sor+Pa3v43vf//7ePfdd3Ne36xZszBv3jz89re/xXvvvYdnnnkGZ511FjZt2uQ539ChQ3Hfffehra3N2dbe3o57770XO+64Y+H/0Cz0ktwKEREREWXwBMoYMyMiIqoaQggYcSOQ29aiGhRFyfv8sVgMDQ0NAICpU6fimWeewUMPPYRLL70UANCvXz80NDSgoaEB1157LW6++WY888wzGDVqVNbre/jhhzFt2jScfPLJzrZ9990343z7778/PvvsMyxevBinnnoqAGDx4sUYOnQoRowYkff6e4JBMyIiIqKAeDLNWJ5JRERUNYy4gUfPfzSQ25500yTose6Hg2pra5FIJDK2JxIJ/OUvfwEARCKRnJdvaGjA008/jWnTpqF///6d3tZPf/pT3HnnnU7Q7K9//SvOPPNMPPvss91evx8szyQiIiIKCMsziYiIqJy8+uqrWLRoEY466ihn29ixY9G7d2/U1NTgoosuwk477YQf/OAHOa/jxhtvxDfffIOGhgbss88+OOecc/Doo9kDiD/+8Y/xwgsvYNWqVVi9ejX++9//4rTTTiv435ULM82IiIiIAsJMMyIiouqkRTVMumlSYLftx7///W/07t0byWQSiUQCJ554Im6++Wa0trYCAO6//37svvvu+OijjzB9+nTcdttt2G677XJe35577ol3330Xy5cvxwsvvIDnnnsOxx9/PM444wzcfvvtnvNuv/32mDx5MhYuXAghBCZPnoztt9/e/x/dTQyaEREREQVF5PidiIiIKpqiKD0qkSylI444ArfeeisikQgGDx7slF6uWrUKgNWwf+TIkRg5ciR69+6N73//+3jvvfcwYMCAnNepqioOPPBAHHjggbjgggtwzz334Mc//jFmzpyJ4cOHe8575pln4rzzzgMA/PGPfyzOH5lrnSW9NSIiIiJyMNOMiIiIwq5Xr17YZZddMGzYsE57lQHAuHHjMGrUKFx77bW+bmPPPfcEALS0tGScduyxxyIejyMej+OYY47xdb09VR5hTSIiIqIKxJ5mREREVGkuuuginHzyybjkkkuwww47ZJx+0kkn4ZBDDsHYsWPR0NCAlStXYsaMGdh1112x++67Z5xf0zS8//77zu+lxEwzIiIiooB4AmWMmREREVEFOO6447DTTjvlzDY75phj8PDDD+P444/HrrvuitNPPx277747nnjiCeh69tyuPn36oE+fPsVcdlaKqPCvNZubm9G3b180NTUFcgcTERER5bJ59WY8P/t5AMBeJ++FEUePCHhFREREVAzt7e1YuXIlhg8fjpqamqCXUxU6u8/zjRUx04yIiIgoKO5Es8r+HpOIiIio7DBoRkRERBQQT/N/xsyIiIiIQoVBMyIiIqKAcHomERERUXgxaEZEREQUEHdJJssziYiIiMKFQTMiIiKigLA8k4iIqLrwS7LSKcR9zaAZERERUUBYnklERFQdNE0DAMTj8YBXUj1aW1sBAJFIpNvXoRdqMURERETkE6dnEhERVQVd11FXV4dvvvkGkUgEqsocpmIRQqC1tRXr1q3DNtts4wQsu4NBMyIiIqKAMNOMiIioOiiKgkGDBmHlypVYvXp10MupCttssw0aGhp6dB0MmhEREREFhD3NiIiIqkc0GsXIkSNZolkCkUikRxlmEoNmRERERAHxTM9kphkREVHFU1UVNTU1QS+D8sQiWiIiIqKAeMoz2dOMiIiIKFQYNCMiIiIKisjxOxEREREFjkEzIiIiooBwEAARERFReDFoRkRERBQQlmcSERERhReDZkREREQB8QTKGDMjIiIiChUGzYiIiIgCwvJMIiIiovBi0IyIiIgoICzPJCIiIgqvQINmO+20ExRFyfg599xzAVgfHmfNmoXBgwejtrYW48ePx4oVK4JcMhEREVHBeLLLGDMjIiIiCpVAg2bLli3DV1995fwsWbIEAHDyyScDAObOnYsbb7wR8+fPx7Jly9DQ0IAJEyZgy5YtQS6biIiIqDDcMTOWZxIRERGFSqBBs/79+6OhocH5+fe//42dd94Z48aNgxAC8+bNw8yZMzFlyhSMGjUKCxcuRGtrKxYtWhTksomIiIgKguWZREREROEVmp5m8Xgc99xzD84880woioKVK1eisbEREydOdM4Ti8Uwbtw4vPjiizmvp6OjA83NzZ4fIiIiojByB8qYaUZEREQULqEJmj300EPYvHkzzjjjDABAY2MjAGDgwIGe8w0cONA5LZs5c+agb9++zs/QoUOLtmYiIiKinmBPMyIiIqLwCk3Q7I477sCkSZMwePBgz3ZFUTz/FkJkbHObMWMGmpqanJ+1a9cWZb1EREREPcaeZkREREShpQe9AABYvXo1nnzySSxevNjZ1tDQAMDKOBs0aJCzfd26dRnZZ26xWAyxWKx4iyUiIiIqEPY0IyIiIgqvUGSa3XnnnRgwYAAmT57sbBs+fDgaGhqciZqA1fds6dKlGDt2bBDLJCIiIioolmcSERERhVfgmWamaeLOO+/E6aefDl1PLUdRFEyfPh2zZ8/GyJEjMXLkSMyePRt1dXWYOnVqgCsmIiIiKgwOAiAiIiIKr8CDZk8++STWrFmDM888M+O0Sy65BG1tbZg2bRo2bdqEMWPG4IknnkB9fX0AKyUiIiIqLJZnEhEREYWXIir8E1pzczP69u2LpqYm9OnTJ+jlEBERETk+fPhDfPTvjwAADfs24MBpBwa8IiIiIqLKl2+sKBQ9zYiIiIiqETPNiIiIiMKLQTMiIiKioLjnALCnGREREVGoMGhGREREFBBOzyQiIiIKLwbNiIiIiALC6ZlERERE4cWgGREREVFA2NOMiIiIKLwYNCMiIiIKCnuaEREREYUWg2ZEREREAWFPMyIiIqLwYtCMiIiIKCCe8kxmmhERERGFCoNmRERERAFhTzMiIiKi8GLQjIiIiCggnkAZY2ZEREREocKgGREREVFAmGlGREREFF4MmhEREREFhD3NiIiIiMKLQTMiIiKioIgcvxMRERFR4Bg0IyIiIgoIyzOJiIiIwotBMyIiIqKAuANlLM8kIiIiChcGzYiIiIgC4gmUMWZGREREFCoMmhEREREFxR0zY6YZERERUagwaEZEREQUEPY0IyIiIgovBs2IiIiIAuIJmjHTjIiIiChUGDQjIiIiCgh7mhERERGFF4NmRERERAHh9EwiIiKi8GLQjIiIiCgg7GlGREREFF4MmhEREREFhOWZREREROHFoBkRERFRUNwxM2aaETlMwwx6CURERAyaEREREQWF0zOJMq3/YD0e+/VjWP386qCXQkREVY5BMyIiIqKAeLLLGDMjAgBsWrkJRsLAps82Bb0UIiKqcgyaEREREQWEgwCIsrCfCsy+JCKioDFoRkRERBQQlmcSZZLPBT4niIgoaAyaEREREQVF5PidqIoxaEZERGHBoBkRERFRQJhpRpSJQTMiIgoLBs2IiIiIAsKeZkSZnOcCnxJERBQwBs2IiIhKJNGWwCePfYLW9a1BL4VCgplmRJmYaUZERGEReNDsiy++wGmnnYZ+/fqhrq4O3/rWt7B8+XLndCEEZs2ahcGDB6O2thbjx4/HihUrAlwxERFR93zxyhd4/8H38cnjnwS9FAoJT3YZ4wNEAFxBM2ZfEhFRwAINmm3atAmHHHIIIpEIHn30Ubz33nv4f//v/2GbbbZxzjN37lzceOONmD9/PpYtW4aGhgZMmDABW7ZsCW7hRERE3dCxpQMAkGxLBrwSCguWZxJlIaszmWlGREQB04O88euvvx5Dhw7FnXfe6WzbaaednN+FEJg3bx5mzpyJKVOmAAAWLlyIgQMHYtGiRTj77LNLvWQiIqJuMzoMADwQJJe0XUEIAUVRglkLUUg4r5F8qSQiooAFmmn2r3/9C6NHj8bJJ5+MAQMGYL/99sNf/vIX5/SVK1eisbEREydOdLbFYjGMGzcOL774Ytbr7OjoQHNzs+eHiIgoDJLtVoYZg2YkZewL3DWInKxLvlYSEVHQAg2affbZZ7j11lsxcuRIPP744zjnnHNw/vnn46677gIANDY2AgAGDhzoudzAgQOd09LNmTMHffv2dX6GDh1a3D+CiIgoT8kOBs3IK70kk/sGEQcBEBFReAQaNDNNE/vvvz9mz56N/fbbD2effTbOOuss3HrrrZ7zpZcpdFa6MGPGDDQ1NTk/a9euLdr6iYiI/JCZZqZhBrwSCov0oAD7mhExaEZEROERaNBs0KBB2HPPPT3b9thjD6xZswYA0NDQAAAZWWXr1q3LyD6TYrEY+vTp4/khIiIKA9nTjCV4JGUEzRgkIEoNAmAQmYiIAhZo0OyQQw7Bhx9+6Nn20UcfYdiwYQCA4cOHo6GhAUuWLHFOj8fjWLp0KcaOHVvStRIREfUUM80oQ3pMgDECImaaERFRaAQ6PfOCCy7A2LFjMXv2bPzgBz/Aq6++ij//+c/485//DMAqy5w+fTpmz56NkSNHYuTIkZg9ezbq6uowderUIJdORETkG3uaUTpmmhFlYtCMiIjCItCg2YEHHogHH3wQM2bMwDXXXIPhw4dj3rx5OPXUU53zXHLJJWhra8O0adOwadMmjBkzBk888QTq6+sDXDkREZF/sjyTB4IksacZUSbnecGnAxERBSzQoBkAHHfccTjuuONynq4oCmbNmoVZs2aVblFERERFIMszGTQjKWNf4K5B5ASP+VpJRERBC7SnGRERUbUQQrA8kzKkZ5Yx04zIVZ7J5wMREQWMQTMiIqISMJNm6kDQ4IEgWdjTjCgLWZ3J5wMREQWMQTMiIqISkKWZALMnyIXTM4kycBAAERGFBYNmREREJSCHAADMNCOLEILlmURZMGhGRERhwaAZERFRCXgyzXggSEDWrDLuG0Su4DGfDkREFDAGzYiIiEpADgEAGBghS9b9gLsGETPNiIgoNBg0IyIiKgFmmlG6bKWY3DeIGDQjIqLwYNCMiIioBDw9zXggSPDuB6pufSRjTzMiV9CMzwciIgoYg2ZEREQl4C7PNA0zwJVQaLjiAapmB80YUCVynht8PhARUdAYNCMiIioBd3km+1YR4A0IKKpibwxoMUQh4jw3+HwgIqKAMWhGRERUAu7yTGaaEcDyTKJc5POAmWZERBQ0Bs2IiIhKgIMAKJ07QCYzzbhvEHEQABERhQeDZkRERCXg7mnGA0ECUvuBoigszyRyYdCMiIjCgkEzIiKiEuD0TErn7AeK/QOWZ1JprP9wPZrWNgW9jNxkSzM+H4iIKGAMmhEREZUAyzMpnZNppiosz6SSSbQm8PK8l/Hqza8GvZScmGlGRERhwaAZERFRCaSXZzKDgmQ2jaIqUBSWZ1JpJFoTEKZAx5aOoJeSE4NmREQUFgyaERERlYA70wwAgyPkyTRjeSaVSjkEpJy1hXeJRERUJRg0IyIiKgF3TzMg3AesVBoyQKYoqUwz7hdUbO7AbFiDtHJdQjArl4iIgsWgGRERUQm4yzMBBkcoe08zZtZQsblfe4QRzh3O8/oYziUSEVGVYNCMiIioBNLLMxk0I3dPM6c8k/sFFZknaBbWLC53zIzPCSIiChCDZkRERCWQXp5pGmZAK6GwcIIBClLTM8MaxKCKUW6ZZnxOEBFRkBg0IyIiKjIhBMszKYOnPJM9zahEPAGpkO5v5bBGIiKqDgyaERERFVl6lhnAA0FyBc0U9jSj0imHgJQnuyycSyQioirBoBkREVGRySwzRVGgatZbb1gPVql0nOmZMmAGlqJR8ZVF0KwM1khERNVBD3oBRERElU4OAdBimtVDyOCBILn2gc1vQ2nZAIgDuV9Q0ZVDQKoc1khERNWBmWZERERFJssz9RodisbeVWRxyjMT66GYbUCylaVoVHxlMJmSQTMiIgoLBs2IiIiKTGaa6TE9NSWRB4Ikh2cqwvkHyzOp2NyTe0P7OuQO7PE5QUREAWLQjIiIqMhkTzO9xhU0M3ggWO1SgwBMWMMzRXiDGFQx3PuYO4AWJsw0IyKisGDQjIiIqMhkeaYW05hpRg5nEAAEFBUABMszqfjKoTxTMGhGREThwKAZERFRkTnlmTUsz6SUVKaZABQAQrAUjYquHLK4POsK5xKJiKhKMGhGRERUZE55JnuakZvsaaaasPcK7hdUdOUWNAvrGomIqDowaEZERFRkzDSjbFL7gCzPBLNqqOjCHpBKz7Zk9iUREQUp0KDZrFmzoCiK56ehocE5XQiBWbNmYfDgwaitrcX48eOxYsWKAFdMRETkn7unmapZb71hbcBNpSNMq4eZoiJVnhnCIAZVlrAHzdIDx6FcIxERVY3AM8322msvfPXVV87PO++845w2d+5c3HjjjZg/fz6WLVuGhoYGTJgwAVu2bAlwxURERP5kyzRjRhFZwQABRbH7moE9zaj4wh40S19TGNdIRETVQw98AbruyS6ThBCYN28eZs6ciSlTpgAAFi5ciIEDB2LRokU4++yzs15fR0cHOjo6nH83NzcXZ+FERER5ytbTjJlmZAXIBBTFCpyxpxmVQrkFzfgFAxERBclX0EwIgaVLl+L555/HqlWr0Nraiv79+2O//fbD0UcfjaFDh/pewMcff4zBgwcjFothzJgxmD17NkaMGIGVK1eisbEREydOdM4bi8Uwbtw4vPjiizmDZnPmzMHVV1/tex1ERETFIssz2dOM3JxMM9Uu0YRggICKzhM0M8K3w2X0NONrJRERBSiv8sy2tjbMnj0bQ4cOxaRJk/DII49g8+bN0DQNn3zyCa666ioMHz4c3/nOd/Dyyy/nfeNjxozBXXfdhccffxx/+ctf0NjYiLFjx2LDhg1obGwEAAwcONBzmYEDBzqnZTNjxgw0NTU5P2vXrs17PURERMUgyzO1mMagGTmsnmYC9uhMK2bG8kwqMvc+Fsb9jeWZREQUJnllmu26664YM2YMbrvtNhxzzDGIRCIZ51m9ejUWLVqEH/7wh7j88stx1llndXm9kyZNcn7fe++9cfDBB2PnnXfGwoULcdBBBwEAFEXxXEYIkbHNLRaLIRaL5fNnERERlYRTnlmjQ9EYNCObvQtYPc2sDdwvqNhCn2nGoBkREYVIXplmjz76KP7xj3/guOOOyxowA4Bhw4ZhxowZ+PjjjzF+/PhuLaZXr17Ye++98fHHHzt9ztKzytatW5eRfUZERBRmziCAmO588cMDQWJ5JgWh3HqahTEbjoiIqkdeQbNRo0blfYXRaBQjR47s1mI6Ojrw/vvvY9CgQRg+fDgaGhqwZMkS5/R4PI6lS5di7Nix3bp+IiKiIHh6mslMsxBmeFBpCWGVZyqKXaIpOD2Tii/sQbP0wHEo10hERFWjW9Mz29vb8fbbb2PdunUwTe/0rxNOOCHv67n44otx/PHHY8cdd8S6devwu9/9Ds3NzTj99NOhKAqmT5+O2bNnY+TIkRg5ciRmz56Nuro6TJ06tTvLJiIiCkTWnmYMjlQ9J9NMARRYvzPTjIot7EEzTs8kIqIw8R00e+yxx/CTn/wE69evzzhNURQYhpH3dX3++ef40Y9+hPXr16N///446KCD8PLLL2PYsGEAgEsuuQRtbW2YNm0aNm3ahDFjxuCJJ55AfX2932UTEREFxulpFnNNz2SmWdXLLM8MZxCDKkvog2acnklERCHiO2h23nnn4eSTT8aVV17Z495i9913X6enK4qCWbNmYdasWT26HSIioqCYSRNm0srK1mt0Ts+kFAFreiZgT9BkeSYVn/u1xzTMTs4ZDA4CICKiMMmrp5nbunXrcOGFF7IZPxERUR5klhmQVp7JA8Gq58k0kz3NuF9QkXn2sRDubhwEQEREYeI7aHbSSSfh2WefLcJSiIiIKo8cAqDqKlTN+gEYNKO0nmZ2plkYgxhUYVz7WBgzzTgIgIiIwsR3eeb8+fNx8skn4/nnn8fee++NSCTiOf38888v2OKIiIjKnbufGQC7DI8HgmTvAwKp6ZlgphkVX+h7mrE8k4iIQsR30GzRokV4/PHHUVtbi2effRaKojinKYrCoBkREZGLnJyp11hvuTLTLJQZHlRSVtlZWnkmS9GoyNyvPWEMSDFoRkREYeI7aHb55ZfjmmuuwWWXXQZV9V3dSUREVFVkeaYW0wDA6WnGMjzy9jQTrm1EReRuaRbC/S1jTeFbIhERVRHfUa94PI4f/vCHDJgRERHlIT3TTAbNmGlG7umZimpvYICAiiz05ZmCmWZERBQeviNfp59+Ou6///5irIWIiKjiyJ5mWtSbacYDQXJnmjk9zVieSUXmCZoZ4dvfOD2TiIjCxHd5pmEYmDt3Lh5//HHss88+GYMAbrzxxoItjoiIqNzJg1JVt76nYtCMJKenmSJjZsw0o+LzBM3CGJDi9EwiIgoR30Gzd955B/vttx8A4N133/Wc5h4KQERERICZtMownaCZxqAZWazpmYLTM6mkyi7TjM8JIiIKkO+g2TPPPFOMdRAREVUk2bvMCZopDJqRxTMIwO5pFsrMH6oooe9pxkEAREQUIuzmT0REVEROeaaWlmkWwgwPKjG5CyiAotj/5m5BRRb6oBkHARARUYj4zjRrb2/HzTffjGeeeQbr1q2DaXqnf73++usFWxwREVG5k+WZMljm9DRjRlHVs4IBJlLdLVieScUX+qAZyzOJiChEfAfNzjzzTCxZsgQnnXQSvv3tb7OPGRERUScyepqpzDQji9XTzMoyU1QrzSwswVQhBD56+CP0GtgLQ8YMCXo5VEDufSyMASkGzYiIKEx8B80eeeQR/Oc//8EhhxxSjPUQERFVFKenmcbpmeTl6WmmuLcFr21DGz565CPE6mMMmlWYsss0C0kgmYiIqpPvnmY77LAD6uvri7EWIiKiiiMzyjLKM0N4sEqlZQUDrOmZVk8zMzQ9zYy44fk/VY6wB83SnwOhXCMREVUN30Gz//f//h8uvfRSrF69uhjrISIiqijp5Zky44wHgmSVZ1qZZghZppnMkAzLeqhwwh404/RMIiIKE9/lmaNHj0Z7eztGjBiBuro6RCIRz+kbN24s2OKIiIjKnVOeaQfNwhYcoQAJ5z9W4CxMPc3s/VPuv1Q53K89YXx8OT2TiIjCxHfQ7Ec/+hG++OILzJ49GwMHDuQgACIiok7I8kyZYSb/H8aDVSotT08zABAiNFk1cr9lwKLylFumWRjXSERE1cN30OzFF1/ESy+9hH333bcY6yEiIqoosjwzvadZWIIjFBynp5lTnilCEyBwB3WFEPyStIKEPWiW0dMsJNmXRERUnXz3NNt9993R1tZWjLUQERFVnPSeZjJoxkwzsnqaWfEyRbUCaGEJEMhMs/TfqfyFPWjGTDMiIgoT30Gz6667DhdddBGeffZZbNiwAc3NzZ4fIiIiSnF6mmneoBkPBMnaB0woqj09EwhNBmLYAyvUA66HM4yPLYNmREQUJr7LM4899lgAwFFHHeXZLlP3DYOjyYmIiCSZpZNenskDQZKZZnACZuEpz2TQrHKF/bFl0IyIiMLEd9DsmWeeKcY6iIiIKlJGeabGoBnZ7OmZihK+6Znu8mGWElcWT7+6EL4OZawpfEskIqIq4jtoNm7cuGKsg4iIqCI55ZkyaKYwaEYWz/RMexBAWAIEnp5m3Fcri7s8M4T96tIDx9z/iIgoSHn1NFuzZo2vK/3iiy+6tRgiIqJKIw9KnZ5mMtMshAerVFpO0IzlmVRCnsc2JJmNbhnlmSFcIxERVY+8gmYHHnggzjrrLLz66qs5z9PU1IS//OUvGDVqFBYvXlywBRIREZUzWZ6Z0dOsQg4Ev1j2BTav2hz0MsqSEAIQ7vLM8OwXYS/ho+7zBM3CGLxPr87k/kdERAHKqzzz/fffx+zZs3HsscciEolg9OjRGDx4MGpqarBp0ya89957WLFiBUaPHo0bbrgBkyZNKva6iYiIykJGTzO1cjLNWta14PXbX0fvgb1xxDVHBL2cspMqz5T7QogyzYyQB1ao28KeRcieZkREFCZ5ZZptt912+P3vf48vv/wSt956K3bddVesX78eH3/8MQDg1FNPxfLly/Hf//6XATMiIiIXp6eZlhY0C+HBql/xrXEAQKI1EfBKypR7EEDYepqFPLBC3Rf2x5Y9zYiIKEx8DQKoqanBlClTMGXKlGKth4iIqKLILJ2M8swKOBCUAUGZTUf+CNMOkoWwpxmnZ1Yud1AqLPubW0ZPsxCukYiIqofv6ZlERESUv/TyTJlxVgkHgvJvY9Cse6zghXD6mQEiND3Nwp6NRN0X9smoDJoREVGYMGhGRERURE55ph00k1lFlXAgaCbsoBkzkbolY3omEJ7yzJAHVqj73I9nGJ+7DJoREVGY5NXTjIiIiLpHBh9khpn8fxgPVv2SGWbCDE9ZYTmxyjNdQbOQlmeGZU1UGJ5sxhA+tBlBs5BkXxIRUXUKTdBszpw5UBQF06dPd7YJITBr1iwMHjwYtbW1GD9+PFasWBHcIomIiHySgaX0nmZhPFj1i32vekZmmkGREzRDWp7J6ZkVJeyZZumvjQzaEhFRkEIRNFu2bBn+/Oc/Y5999vFsnzt3Lm688UbMnz8fy5YtQ0NDAyZMmIAtW7YEtFIiIiJ/0nuayaBZKA9WfZLlmQADK90S5umZLM+sWGHvV5expvAtkYiIqki3gmYffvghzjvvPBx11FE4+uijcd555+HDDz/s1gK2bt2KU089FX/5y1+w7bbbOtuFEJg3bx5mzpyJKVOmYNSoUVi4cCFaW1uxaNGinNfX0dGB5uZmzw8REVFQnJ5mmjdoFsaDVb/cAwAqIQhYak55pnsQQEj2C5ZnVq7QB83Ssi3DuEYiIqoevoNm//jHPzBq1CgsX74c++67L/bZZx+8/vrrGDVqFB544AHfCzj33HMxefJkHH300Z7tK1euRGNjIyZOnOhsi8ViGDduHF588cWc1zdnzhz07dvX+Rk6dKjvNRERERWCcPWoSi/PrIQDQU/QjBM0fXMGAah2ppkIZ3kmA6KVJfRBM/Y0IyKiEPE9PfOSSy7BjBkzcM0113i2X3XVVbj00ktx8skn531d9913H15//XUsW7Ys47TGxkYAwMCBAz3bBw4ciNWrV+e8zhkzZuDCCy90/t3c3MzAGRERBcJd4uaUZ2oMmpHFCgYIa6Cq/BozJLsFyzMrV9iDZvI5oOoqzKQZzjUSEVHV8J1p1tjYiJ/85CcZ20877TQn0JWPtWvX4te//jXuuece1NTU5Dyf4pnDbn3ATN/mFovF0KdPH88PERFRENwZOk7QTKnMoBl7mvnnZCGqABQAIjwBgtAHVqjbwv7YyjXJkvYwrpGIiKqH76DZ+PHj8fzzz2dsf+GFF3DYYYflfT3Lly/HunXrcMABB0DXdei6jqVLl+Kmm26CrutOhll6IG7dunUZ2WdERERh5A4qOT3NZKZZBQSZmGnWQwJ2TzMB+X1gWErR2NOscpVL0KySsnKJiKh8+S7PPOGEE3DppZdi+fLlOOiggwAAL7/8Mh544AFcffXV+Ne//uU5by5HHXUU3nnnHc+2n/70p9h9991x6aWXYsSIEWhoaMCSJUuw3377AQDi8TiWLl2K66+/3u+yiYiISk4GxhRFsTKJ4OppFpLgSE9wEEDPyJ5mQGp6ZlgCBJ7yzAoI8JKL6+EM42PrZJrZ2blhKVkmIqLq5DtoNm3aNADALbfcgltuuSXraYB1gGAYRs7rqa+vx6hRozzbevXqhX79+jnbp0+fjtmzZ2PkyJEYOXIkZs+ejbq6OkydOtXvsomIiEpOBpUUTXHKMp2gWQgPVv1ieWbPeKdn2gG0kNyNYc9Gou4L+2Mrv1BgeSYREYWB76CZaZbum+RLLrkEbW1tmDZtGjZt2oQxY8bgiSeeQH19fcnWQERE1F0y+8rJmACnZ1KKMwhAScXKwrJfuDMHmUVYWYQhgOaPAK0GonbnoJeTgeWZREQUJr6DZsX07LPPev6tKApmzZqFWbNmBbIeIiKinpCBJJkxATBoRimyPFNR7PJMYYambNeTORiOJVGBiGQ70P41oKgQ5oigl5MhYxBASJ4TRERUnfIKmt100034xS9+gZqaGtx0002dnvf8888vyMKIiIjKndPTTEtNfa6kkiP2NOsZp6eZYk/QBICQ7Bfu/ZOPbeUQQkAI+/EM0bRWD3tJMkM3lGskIqKqkVfQ7A9/+ANOPfVU1NTU4A9/+EPO8ymKwqAZERGRLVt5JlxTEoUQTq+zcmQkUr1LmWnWDa7pmUKEKwMx7H2vqJvsfc75ZwgDohwEQEREYZJX0GzlypVZfyciIqLcspVnun8XpvBkoZUbTljsGU95ptwWklI0d3YZH9vK4Z7Yav07hEEzwZ5mREQUHmrXZyEiIqLukMGGbIMAgPAcDApToGVdi+/LsTyzZ5yG56q7PDMc96MnIBqS/ZR6Tk5sdf4doj56UkZPM+5/REQUIN9Bs5NOOgnXXXddxvYbbrgBJ598ckEWRUREVAlkUMmdTRbGoNmKv6/A01c8jfUfrvd1OZZn9owQAhCmNQRAsfaFsGT+sDyzMqVnmkGI0D2+nJ5JRERh4jtotnTpUkyePDlj+7HHHovnnnuuIIsiIiKqBNl6moUxaCazzPxmm3F6Zs84wYGwl2eGZD+lnrMeS/dztbhBMyNhINme9HWZ9J5mYXlOEBFRdfIdNNu6dSui0WjG9kgkgubm5oIsioiIqBJk62kWxqCZDJCYCX+BL/Y06yFh/cdTninCEXx0P54sva0c6eWZxc40e37283j68qc9WaldktMzWZ5JREQh4DtoNmrUKNx///0Z2++77z7sueeeBVkUERFRJZCBB0+zf9evYTkYlOv0my3G8syecUrlFJGaqhqSfYKZZpUpozwTZtEC3kIIbPlyCzq2dCC+NZ7/5VieSUREIZLX9Ey3K664At///vfx6aef4sgjjwQAPPXUU7j33nvxwAMPFHyBRERE5SpreaaiQFEVCFOEJjvLyTTzGfjiIICekVk/imKVaFrbwnE/sqdZZcqaaVak8kfPPuTjtS59EAC4+xERUYB8B81OOOEEPPTQQ5g9ezb+8Y9/oLa2Fvvssw+efPJJjBs3rhhrJCIiKkvZyjMBpIJmIQlGyANaXyVU8AbNwhIALCdWsCI9aBaO+7G7AQ8KN7nPqRpgGgBQvOC9ex/yE1SXQTynp1lInhNERFSdfAfNAGDy5MlZhwEQERFRijwYdWeaAam+ZmE5GCxIphnLM33zZJrJXSQsmWYGM80qkSzPlPucKGJPs+72PMwoz+QgACIiCpDvnmYAsHnzZtx+++34zW9+g40bNwIAXn/9dXzxxRcFXRwREVE5k4EkT08zhC9oJtfhdxAAg2bdlwoEWIMAoFj/DmKfaP68GRs+2uDZxp5mlckJmqnCzm4sXtDMvQ/5Kt/mIAAiIgoR35lmb7/9No4++mj07dsXq1atws9//nNst912ePDBB7F69WrcddddxVgnERFR2cnW0wwI38FgdwcBsKdZ96Uee2sIgAyrigCmZ746/1W0N7Vj4u8nItormra+8Oyn1HNOdqMKKEIAMEObacbyTCIiCgPfmWYXXnghzjjjDHz88ceoqalxtk+aNAnPPfdcQRdHRERUzjrraQaE52BQBrx60tOMmWY+uR56RRGp8swAStE6mjsgTIFES8LZ5g5yMCBaOTKGTxSxPLO7mWacnklERGHiO2i2bNkynH322Rnbd9hhBzQ2NhZkUURERJVABh5CX57ZjUyz9EEGbBbvj3PfCVmemba9VOsQImtPO5ZnViZ3TzNVA4pZnlmoTDNOzyQioiD5DprV1NSgubk5Y/uHH36I/v37F2RRRERElSBXeaYMmoUlg8cJmvjoaZa+dmaa+WNl/ACyp5mi6Pb2Et+ProBErkAZA6KVI9XTrLSZZn5uw5meGbIydiIiqk6+g2YnnngirrnmGiQSVgq/oihYs2YNLrvsMnz/+98v+AKJiIjKVbmUZ3Yn0yw9wBaWAGC5cD/2CiDTfqzTSlii6Qls5MgMCst+Sj1nPZamNQhABYqaaea6XpZnEhFRufIdNPv973+Pb775BgMGDEBbWxvGjRuHXXbZBfX19bj22muLsUYiIqKyJAMPuTLNgjgYNOKZfcvkOvz0NEsPsDHTzB9hN2EHYGX96BF5SknL0Ty9y5I5Ms0YtKgcAqmeZqq1DxYr4N3j8kyZaRZAnz8iIiLJ9/TMPn364IUXXsDTTz+N119/HaZpYv/998fRRx9djPURERGVLRmECEtPs6/e+ArL/7wc+/5kXww9eKizPVtPq66kn5clfP54HnsFUFQdgOmUy8l9pNg8zdrZ06ziWY+rnWVmIpSDAGTQmNMziYgoDHwFzZLJJGpqavDmm2/iyCOPxJFHHlmsdREREZW9jJ5m8U3A2sVQjH4AtJIfDG5euRnCFNi8arMnaCbX4aunGTPNesad8aMAiqYDiAMQJc2syTUlk9MzK5N7eiZUAEZ4BwE4XzYwZkZERAHyVZ6p6zqGDRsGw/A3kp6IiKgaZfQ027gc2PAqlNZVAEqfQSHXk34A262eZulBMwZWfJEN2eXUTKjye8zSlmdmC5QJ4Q3cMdOngniGTyCUmWYcBEBERGHiu6fZ5ZdfjhkzZmDjxo3FWA8REVHFkEEIJ2PCaLf+rVhfPpX6YFD2LEsvvZMHqT0KmjHTzBfrPrczfgAomiZPKOl+ka2nWUZQlUGLipEK1pZgEEBPe5qxPJOIiELAd0+zm266CZ988gkGDx6MYcOGoVevXp7TX3/99YItjoiIqJxllGeacQCAotgZPSXuA5YtKOI+IO3JIAD2NPPHUyYHFYqa+h4zqOmZ8vf0IAUf28rh2e8UK4AWukwzTs8kIqIQ8R00O/HEE6EopWlOS0REVM4yyjMNGTTLHpwo+nrsnmW5DmaZaVY6MuNHUQWguINmwU/PzAiaMWhRMVL7HZy+eqHNNOP0TCIiCgHfQbNZs2YVYRlERESVRx4oZmaaBRQ0S2ZOycwWNPFzXc6/2dPMH+H8B1A0wBU0K+V+ka2nWfpjyaBZ5fBmmgGAWbRMQvd+42sfcp4WqS/phRD80p6IiAKRd0+z1tZWnHvuudhhhx0wYMAATJ06FevXry/m2oiIiMqaDCw5B38BB81k+WWuyYicnlk6TgmaCgCK/AWBTs9kT7OK5840s7LNire/9bQ80/myAdwHiYgoOHkHza666iosWLAAkydPximnnIIlS5bgl7/8ZTHXRkREVNZy9TRT1YAzzbJkF8nt+R5AO6Wnslk3+175YmX8mFbgQtGgKJozzTCo6Zm5epoxi7ByOEEzRdi9FUXxMs0KVJ7p3kZERFRqeZdnLl68GHfccQdOOeUUAMBpp52GQw45BIZhQJMTn4iIiMiR0dMs6PLMRGYmUXpAxEya0CJdv6/Lv02P6Ygn48w088nJNAPgpP0oQKnLM7NlmrE8s3J5grXWluL1NDNzv850ejmRmWlWykAyERGRW96ZZmvXrsVhhx3m/Pvb3/42dF3Hl19+WZSFERERlTsZkMgoz0SIMs3Ss4ryLNF0gmY1esZ1UteEsHtLqXCCZlamWXDTM+X+yvLMyiX3LU95ZgmmZ/q5jfTpmX4vT0REVEh5B80Mw0A0GvVs03UdyWSy4IsiIiKqBBnlmUYHgFSmWakDTdl6VqUHSPLNGEtlmmm+LkeW9OmZgB00CzLTLEd5JgMWlcPJNIOcPWGGbnqmzCpjeSYREYVB3uWZQgicccYZiMVizrb29nacc8456NWrl7Nt8eLFhV0hERFRmQpbeaYcBNBZg255nryuSxjQNz0JNG8LEdmjcAutBvb0TGuKoWZlmqlWIC2wnma5yjPZr65iuAcBwO6hV4pMsx4PAihh9iUREZFb3plmp59+OgYMGIC+ffs6P6eddhoGDx7s2ebHrbfein322Qd9+vRBnz59cPDBB+PRRx91ThdCYNasWRg8eDBqa2sxfvx4rFixwtdtEBERBUUGG9IHASiKPcUyoPJMTwZIenmmn0yzZBs0tRWIb2SmmU8yeGH1MVO90zMD7mnGTLPK5c5wVO0gbbEyXns6CIDlmUREFAZ5Z5rdeeedBb/xIUOG4LrrrsMuu+wCAFi4cCFOPPFEvPHGG9hrr70wd+5c3HjjjViwYAF23XVX/O53v8OECRPw4Ycfor6+vuDrISIiKiQZhMjoaRbwIAB3gCujPDPPnmbW5UzoUas3l7AzVhRV6fKy5OpppsDb0wwidD3N2K+ucljlmdZ+J3uaFSuzsaeZZoqqQFEU+7lS8OURERHlJe9Ms2I4/vjj8Z3vfAe77rordt11V1x77bXo3bs3Xn75ZQghMG/ePMycORNTpkzBqFGjsHDhQrS2tmLRokVBLpuIiCgvGT3Ngg6aZSm/yzY9Mx9WeaYdNEMwPdrKmZPxI4NmsKdn2glopV2HRT5+nJ5ZudzlmTJIG7pMMzmsQFHsTEzug0REFJxAg2ZuhmHgvvvuQ0tLCw4++GCsXLkSjY2NmDhxonOeWCyGcePG4cUXX8x5PR0dHWhubvb8EBERBcHT00yYgLCG54SqPLMngwBk0EyYgOAwAD9S2TRw9TQDWJ5JxZSZaVbEQQBZArJ+LqeoipO5yn2QiIiCEnjQ7J133kHv3r0Ri8Vwzjnn4MEHH8See+6JxsZGAMDAgQM95x84cKBzWjZz5szx9FgbOnRoUddPRESUiwxIKJoCmAlnu6JYQaZSNlgXQhR0EIAVYBHQnMHagg3jfZDBCyj29ExFs5JqRPjKMxmwqBzeTDPr91IMAuhWTzO7PNO9jYiIqNQCD5rttttuePPNN/Hyyy/jl7/8JU4//XS89957zunyzVISQmRsc5sxYwaampqcn7Vr1xZt7URERJ3xlGfapZkAAs8oKmSmmabbk/hgMtPMD/f0TNijDO1yuZKWZ2bJNEsvK2YwtII4+52Aolm/Fy3TzBBA80fA5nf9vTbYy/FkmnF6JhERBSTvQQDFEo1GnUEAo0ePxrJly/C///u/uPTSSwEAjY2NGDRokHP+devWZWSfucViMcRiseIumoiIqAvCTB2Mqlpa0EwBgOKVRWXjPmj1ZID0ZHqmMKFqgKoJGMJkTzMf3Bk/ziAAVQBmcJlm6eWZWkSDmSztfkrF5Z7aqiiwMhuLlWmWNIH2r63bTbTktz53pqUClmcSEVHgAs80SyeEQEdHB4YPH46GhgYsWbLEOS0ej2Pp0qUYO3ZsgCskIiLqmjsYkZlpJop6sJqNu+zSk12UPgggz+mZsjxT1QRUewofM83ylzEIQNGgBND0PNu+ILepEbXk66HiMo1UsLvYGa8iaWT9vfMLpX5VVA4CICKi4AWaafab3/wGkyZNwtChQ7Flyxbcd999ePbZZ/HYY49BURRMnz4ds2fPxsiRIzFy5EjMnj0bdXV1mDp1apDLJiIi6pI7GKFoChBPK88sYgPubHJmmvWwPNPKNAMAk2V8PgiRashu1ckpzjTDUpZnZu1p5so0Sz8PlTmZxOVkmhXvdcg0kq7f8wuaudeiKKnyzFI+J4iIiNwCDZp9/fXX+PGPf4yvvvoKffv2xT777IPHHnsMEyZMAABccsklaGtrw7Rp07Bp0yaMGTMGTzzxBOrr64NcNhERUZc8mWaaChipoJkaQE8zdwaZsEsAFUXp2SAAmbGiWRM0mWmWP095JlQr8ljkcrms68inpxmzfCqGNYDCtEsf7UEARQp2i2Qy6++dXsZVmszpmUREFAaBBs3uuOOOTk9XFAWzZs3CrFmzSrMgIiKiApEBCCdbIuBBAOkBLWEIKLrSs0wzmFZ5pgYraMaMpPwJ2Jlm9vRMqE6mWWA9zTopz+xqEBOVB3dZcNHLM81UAL5bmWYcBEBERCEQup5mRERElUAGn2S2jncQgCh5kCk9g0zedkZPM7/lmbrMnGOmmR/uhuxWT7NUeWbQU1Wd8syo5jpjyZZERZTKcBQlGATg7mmW52uDeykKnEAtM82IiCgoDJoREREVgQxAKJqdnZOeaVbiMrxsmWZAlumZ3RkEYJdnsqdZ/mTmjDU9U7N/YGeglW4d2aZnppdnAgxaVAqrPFPIga0o1SAAM9/yzFyZZtz/iIgoIAyaERERFYETeNCyZZoBQHCDAIDMUrxc5+v0+pyeZuD0TJ+cjB8gVZ4pe0wF3NNMbpODAAAOA6gUnvLMYg8CcPc0y3P/SQ+ayemZzHQkIqKgMGhGRERUBJ2WZwaRaZbInmnWo0EA8E7PZGAlf+6MH8Auz7ROCb6nWZbyTGb6lFaiNYHXb38d695dV9Dr9WaaFTdI2+OeZgozzYiIKHiBDgIgIiKqVE4z9aw9zYDQZJqll2f6yjQTUHUBVeX0TL/cvaWsCEZqemYps2o662nG8szgfP321/hi2Rfo2NKBAaMGFOx63ZlmxZ7i6y7PFPkGzWTZst3LjEEzIiIKGjPNiIiIikAGpZyeZkaHc5qiiZJnmqVnkDkBkvTyzHx7miVS5ZlyeiZ7mvlgT88EYNe3qqkeU0FlmqX3NIswaBaU9s3tAAAjnl+wKV/WvmUPAihyxqtnEIDP8kwZLOMgACIiChqDZkREREXglGeGvKdZt6dnGnZ5piqsmA/Y08yPVKYZYI0JVO39orQBAmEIJ4CX3udO1dRUpg8DoiXV3mQFzfINYufLKs80PT3NilVW7c4ucwfQulwfXEEzuf+VMJBMRETkxvJMIiKiIsirp1kJAxG5epo5Uz5VBcIU/nqaCROqDmd6Jnua5c9dJmeVZqryhNJPz9z8NmC2w4yOca0tNb1QmKXNiiSgo8nKTC10INp5viupnmbF2t/cfczyzTSTa8kImnH/IyKigDDTjIiIqAicg1NZnhnyTDO9Rs96vpzXJ8szdWH1RmJPM1+c3k2q/R9FTcXNSphVIwwBJJsBowNmRxsAV2mxqjiZkgxalJbMNMs3iJ0vmf1l73IARPEyzdzlmabP6Zn2y6YMmnF6JhERBYVBMyIioiJw+kJlK88MYnpmsvNMMz1mB83y7WmWNAEIu6eZAMCeZn64y+SsHUKWZwawXwi5LxgQrgxIRUtNL2QWYWnJnmYFzzSzg1ep8swi9jTrTnmmSGU5Wr/Y2xm0JSKigDBoRkREVASdlWeqqh1kCnAQQPr0TC2mWdvzOEgXpt2s3h4EoNiDAJhp5oNMqFFEKtNMKW65XNZleKYaGhBGKoji6WnGoEXJCCFS5ZmF7mnmZJoJJ9OsWMFud0mm70EAnJ5JREQhwaAZERFRETjN1DOCZqqVPRGSTDOnPNPONMunHMy5LmFC1axsM4BBMz9kTzO4e5oFMggg6V4UTMP0lGcyaFF6yfak8zwsfKZZenlm/qWTvm/LnWnW0+mZHARAREQBYdCMiIioCJzAQ3pPM63WCTKVNGiWlrGSPinRT6ZZ6jxWppmqCs/0ReqaVZ4ps33s8ky7N1wpAwSesjk7W9AJXGiKs/8yaFY6MssMKEJPM095ZqostxjMHmSapfc04/5HRERBYdCMiIioCJzyTNnTzLCDZnpd0XsJdbYeKSPTzMcgAHkeBSYUFVYQULCnmR9WYEykepopqowTBJhpZpdnGlnKM/nYlowcAgCg8JNLZdDMnWmWZ78xv9IHAeQVDOb0TCIiChkGzYiIiIogZ08zvQ6KagVMSpmZlTE9M+nNNPMzCEBmvyiqFfRRdYDlmf7I8kx30Az2IIBS9jTLyDRjeWbg3JlmQGGzzZysMkV3TWstzvPW+/qWX++09PJMDgIgIqKgMWhGRERUBO4JhABc5Zky0ywcgwDk/30NApCZSGoqeCYDLpQfJ2imwulp5kxVLWF5pjfLKLM8U2ZK8rEtHXemGVDYvmZyoqWqy2mtxSvP9JRk5lm+ndHTTAbPGDMjIqKAMGhGRESUQ7I9iaY1Td0KYsgDRKc809XTzMrwKHFPsxzlmXINTqaZj/JMTbf/RnsKHzPNfBAAnP3K7mlmT88s6X7hDpgIwwqaGanABYMWpZeeaVbQCZpCBkQ1KJoVKM+335hfZlpANq9MM5E9aMZMs/BpfKsRK59ZGfQyiIiKjkEzIiKiHN5c+Caeu/Y5NK1u8n1ZT3mmEGnlmSh9T7M8BwHkUwpmJAxAAKomA4NwmshTflKZZsLbYKrE5Zki6Z2eKQzhCfjKoAUzzUqnmJlmqfJMBYoV7S5eppn79c1vppmSFjTj9MzQeeuut/Dufe+ibVNb0EshIioqBs2IiIhyaP2m1fr/+lbfl3VKGHUVEAacSIgszyx1RlHBBwGYTpxH0QQHAfjkmZ4pBwHIpK5STs80MnuaeaZnMtOn5No3e4NmBe1pJgcBaKqTBSu3FZo3gy3P14f0QQAK97+wSrQmrP+3JAJeCRFRcTFoRkRElEOyw8rCMeL+D1qdZuqaksoyA1KDAELS0yy9PDOfaX3CsNavWRexMs3AnmZ+OGVochAA1EAyEIU7SJqtPFPj9MxSyyjPLEKmmaJq8okLYRY+00ykZ5b5zDSTAwAYtA0n4Xqdku+TRESVikEzIiKiHJLtPQiaJV09zWTQTNEANWoHR4LpaeYEx2RPs7TyTKDrzBbrdAFVs7PpWJ7pm3d6phZYeWZ6ppkwUgfD7vJMBi1KJ6M8s4A9zZxMMzWVaVaU560AIPxnmuWansmeeuHi3me68/5IRFROGDQjIiLKweiwDga6Ux7l6Wkmg2ZqFFB0Oz4iSpq9Iw+8nSmZadMzZTAN6Pog2kyagDBlogpU1So1ZDaSD8L6j7UvqMFNz7SDZpoOJ9PMnSWZKuHjY1sKRtxwgvU129QAKHCmmROUUp1BAN7gVmFY+5C8LeSfaeZkYHIQQJi5A7nyfZKIqFIxaEZERJSFEML5Br07mR5OiZumAIZdbqVGAVUPtKeZ7F2WnmmmRlxN37v4e1NBM/k3AgAzzfyQPc0ApMozA9gvZN8pLSogS2yzTc9k0KI02jdbTdW1iIZo7yiAAvc0c8ozXc/3ZBHKM+0SbgDQ9PynwqZnmnH/CydmmhFRNWHQjIiIKAszYTpZDz3paeYpz1SjgKIF2tNMZpSlZ5qpmmplxSHPTDOIVKaZPQiAQbP8ZZueqSjWtpKWZyZlplnqMXQHLjg9s4QSW9Hx0jXAlk8R6xuDFrGzQguaaWZnEeqak2lWjEEA7kwzLYK8B4VkBM04CCCU3Pske5oRUaVj0IyIiCgL94FAocsz1SB7muXINFNUJe+DdCfTTLez1Oy/h4GV/FkB2bSeZnJ6ZhCZZhEAwoAwhCeQykyfEmr9HO2bW4H4RtT0rYEasYPYRepppqjFm57pzqSUmWZ+BgFkZJqVsGSZusZMMyKqJgyaERERZeHu09KdgwKn7DEjaKbZwZESl2fm6GnmHKRqipNp1lWQ0Dpgkj3NVGd6Jnua5U8GFaxEGiXV0wyl62kmTAFhl9DpUVemmau02JmeyaBZ8YkkOloUQJiI9Y3lnfnp6yZk0ExJ9TQTRQh2W/uQKZMokXcPR3kWTs8MNU/QjD3NiKjCMWhGRESUhWzGDXQv08PdTN0TNFMjVmZWSHqadbs8Uw4C0GqtjDOWZ/qSKs+E3RTO7mkmSrdfmIbp7TslDKunWZbyTAZES8BMoH2rCggTNX1rnMzPwvY0kwFRDYpa5PJMIaDKoFmembW5Ms04PTNc3PskM82IqNIxaEZERJRFwcozs/Y0Q2h6mrmzivItB7OCZsLqZabX2pkkxWkoXqmcoJkCuzRTk6eULEBgNWu3S+iigMwWZHlmQMwE2rcoAAwr0yxSxEwzVYWiFy9oZr2uWD37VLuHo6/pmTJYFkDJMnWNPc2IKldHcwef12kYNCMiIsqip+WZWXuaaVZPM0XJ/yCyEIQre6lgmWZwZZrJoFmCH7Ly5i5DUzRAUVKZZiUqz7Qee1emmWl4BwFoihX0BYMWJSGS6NiqAkKgpj6Sej4Wo6eZ5uppVoTXIZnFqGoyHpxfeaaz7ymcnhlm7n2SmWZElSPRmsBTv3kKL934UtBLCRUGzYiIiLLwZJr1oKeZoimA4S7P1FI9fkpVhucKgmX0NHNnmvkuzxRW0EyzA3BJBs3y5fQ0UwWsyJnqZOyVar+wMs1cQTOk9TRzl2cyaJG3ZEcSTWub/Ac/zQTaW6z7u6avXpzpmbJsXC3u9MxUphmccvRuDQJQOAggjNjTjKgytW1sg5EwsLVxa9BLCRUGzYiIiLJwHwj0pKdZZnmmbmcUla48071+mWkmD3qc3muu6Zl5DQIQJlQdgBqFIrORWJ6Zt8zpmaUvz5SZZqoG67EUJsykkbU8k5NR8/f23W/jud89h82rNvu7oMw0AxCrV/MezOHrJpxMM1dPs6JmmtmBYZHnoBAOAigLnJ5JVJnk+w171HoxaEZERJRFTzPNspZnyqCZXa4ElCaDQq5FURRoUXmgbN++fTDqqzwzYQIQVnmmGoEakYE4HjzlyzM9U1Ht8kwrkFbK6Zky282On0AkEtkHATBokbeWb1qs/3/d4utyZjyOeJudadYbRe5pppWop5kcBNDNTDPuf6HEnmZElUl+yWomTWb4ugQaNJszZw4OPPBA1NfXY8CAAfjud7+LDz/80HMeIQRmzZqFwYMHo7a2FuPHj8eKFSsCWjEREVULT0+zbmR6yKBURtBM1Z3eVe7zFZNcv6qrTo+qHg0CcGWRQNGh6rKMjAdPUtumts4/cArrP9b0TCuyUOqyXRnYsCYc2iW2ibhnn1A0Ts/0SwYU3BN489HR3AEAUDUgUiuK0tMMTr861VWeWfjH1grImlAUWZ6ZX6ZZetCMgwDCiZlmRJXJ/XmX2WYpgQbNli5dinPPPRcvv/wylixZgmQyiYkTJ6KlJfXN3Ny5c3HjjTdi/vz5WLZsGRoaGjBhwgRs2bIlwJUTEVGlc3973pPyTEVTskzPtPpHAaXNNFMjqicIIoTo/iAApzxTh6rbwwWSBr+ZBPD5y5/jycuexKpnVuU8j5yeCSA1PVMGU0tZnilMq++UnWlmJuOcntlD8vXCbwZOe5MVNIv1MqGIRHF6msmsMlVNlWeahc8osPYhkRoE0MNMs1I9Jyg/7gNr9jQjqhzu95uCfmFT5vQgb/yxxx7z/PvOO+/EgAEDsHz5chx++OEQQmDevHmYOXMmpkyZAgBYuHAhBg4ciEWLFuHss88OYtlERFQF3FkiPSrP1FQgmVaeaZcrAXYGT6THy+18LYlUqagn08x1IKpoSt4H6db1yUyzCJRIBEACQtjXqRThjygjW77c4vl/NjJoZmWaaQDs6ZkoXYBKDgJQNFfQLK08k9Mz/ZMBBb+ZZsl263UiEhOAGXcyOAvZ08z0DAKQO5wo+PPW2bdUAVW1y47zCP7J4B2nZ4YbyzOJKpNnMm7CQKTYH1DLRKh6mjU1NQEAtttuOwDAypUr0djYiIkTJzrnicViGDduHF588cWs19HR0YHm5mbPDxERkV/uQFl3Dlpz9jST5Zl2w/dSHAzKtWgRzZNp5s78cGea5T0IQIUn08xqJM9vJuX919n9KIR7eqaVaeYEzYzSZG6ksoFEagJqIp4KmmkKy+O6wck08xk0M+PW+VUdVtCsCD3NZLBe1VNl1flOtvR1M3ZQWNWQmgqbx36ds6cZM1hDheWZRJXJU57JTDNHaIJmQghceOGFOPTQQzFq1CgAQGNjIwBg4MCBnvMOHDjQOS3dnDlz0LdvX+dn6NChxV04ERFVJE9PM78HBUY7xLpXgZbPc5RnyjOWZoJmrp5m7h5DiqrkfZDuBFt02D3NGDRzczfSzcXJNAPSepoBEKW5D1PZQK7ARiKR6senZfbAo651N9PMiCcAAJouM80K39PMXZ7pntha6NchK5NVpJX+5nF/OBXLdtBMYaZZGHmyURg0I6oY6ZlmZAlN0Oy8887D22+/jXvvvTfjNPmGKQkhMrZJM2bMQFNTk/Ozdu3aoqyXiIgqm/uAV5g+MzG2roTZ3gS0fQ7VHTTT7PJMBc4wgFJmmql6Wk8z120rmpL3QbqZcA0CUHUoMmhWhIyVcuRkmnVyMJmaXAk7YqW4TivNfegEP1XZrN0uzxSpbB+Wx/nX7UyzhDfTrDg9zWQWoeYJdhf68bUCryZUVThDJoTR9f3hrEPOAWBPs1DyZJp1sJclUaXgIIDsAu1pJv3qV7/Cv/71Lzz33HMYMmSIs72hoQGAlXE2aNAgZ/u6desyss+kWCyGWCxW3AUTEVHFS+/TYiZMJ+umS2YcpqEAZgKquRUwvJlmgBUnESXKNHN6mkVcmUNJ0xPgUlQfPc2SsqcZrJ5mWhSqBpgivwl5lc7JNOsk+JgqQwNS5Zl2cKFEQbNUTzMBVbdu2+hIQH48VFTX9EwGzfLiDrD7bZBu2OWZ6Zlmhfy2P7XfqalEs2Jmmmn+Ms04PbM8uN8jhBAwk6bz/kFE5YuDALILNNNMCIHzzjsPixcvxtNPP43hw4d7Th8+fDgaGhqwZMkSZ1s8HsfSpUsxduzYUi+XiIiqQevnwNrFMNraPZt9laCYCafCTu34Iq08U0n1r8pzolxPZcs0c5dnKqoCRVF89jQTTqYZFN3uicXyTCC/nmZW5oyw9gNF85RnljbTzOpNJwMbRkfcOV3RXJlmDIbmxdMg3Xd5piyjRlF6mgkhnH1L0VzRrCJkvIqkAbl/O/t1PkEzDgIoC+n7JEs0iSoDyzOzCzTT7Nxzz8WiRYvwf//3f6ivr3f6lPXt2xe1tbVQFAXTp0/H7NmzMXLkSIwcORKzZ89GXV0dpk6dGuTSiYioUn35H2DjciQ3HwpgG2eznw8PItkh+21DibuDZnYmtKLbJUtmScqO5Nq1iJaahugaBCC35d3TTA4C0AGoEUCN2BNBTZZnwk+mmQAUkVGeiZJmmlkloopmT2qMpwIbqqYyaOGT+3XC71RBmYml6QIwitDTTDj/gaJpdvktIIqRaWb/LaomnAEX3ck0Y0+zcEp/PzQ6DKBXQIshooLhIIDsAg2a3XrrrQCA8ePHe7bfeeedOOOMMwAAl1xyCdra2jBt2jRs2rQJY8aMwRNPPIH6+voSr5aIiKpC3JrkbLTHPZv9fJNuJlKXzcg0A8KXaWZvy7unmVOeKQBFtyZoqkC2TDMjbqDxrUb037M/or2ihfujQszX9EwF9iAAJRUgKFF/IKuEziqzVSMxAMIuz7QoqpIKsjJokRf3c6en0zML3dPMCdQCUFQNsHsrFiNoZmWaWbu2nNIpt3W9xizTM7n/hQozzYgqEzPNsgs0aJbPh0JFUTBr1izMmjWr+AsiIiJKtlj/cwUPAH/fuHmCZu1rAeEaBABYzfPtIFNJe5q5pme6M83kgakTNMs300yDlWmm6FZPLDMzaLb2xbV45953sPPEnbHn9/cs5J8VWnllmhn29EwZNANc/cNKmGkGE4oqoEZrAbQ6+72iKBwE0A1GwgASW4D4RiR77eLvsnbgoVg9zeTwCcAVNFOtvnaFLr+VTf9VFVD0CKyAevcHAVR7o3kjYYSqZ1j667zfrEoiCicOAsguNNMziYiIQsGwgmZGhywv8n/gKlxBM8XYAAj7gCJLpllJp2dG1FRgzEgF7OTfKA/K8utpJgcB6K7yTJFx8N3eZPWG62jqKNSfE3p5ZZrJ3lIqkOrILuvYSj89U4nWAEiVZ6Zn+rDsNj9mwgRaVgEta5BsXufvsklZRo3i9DRzZ5rpWup1qCjlmXbwVVVSmWZGHq+hMmbGTDPHx//5GI/9+jFsWrkp6KU4mGlGVJk4CCA7Bs2IiIgkIYDEVggzFfCI1luBru6UZ9pVdylO0EyHYjfOL8XBoPxb3OWZwhC5yzPzmp4pBwHYmWYaAGT2NJP3WzUdVMm/tbMPnKbTZ05AfhxTVDsLUJQw00yY1oTDiNVvTwaLGbToHiNhAKZ1H5qJhK9gozMIQPNmmhXqwMWbaaZbQTMZ7C5WeaamOP3y8gma5SrPLEXvx7Da+MlGmIaJptVNJbvNji0d+PK1L3O+F2QEzXxOiiWicGJ5ZnYMmhEREUlmBwATyTggx19Ge3cjaJa0gmZq+rusojv/DyLTzD0IwDTMzEEA3SnPtDPNVM0KwKRfVn4Aq6YPX/I+6OxvTrZZmTiajlR5pjOpsoSZZsKEqgqo0ToAqf1cBlLdQVbqmnxuAACE6auvmTOwo1g9zYQr00zTUkGzYmSayfJMzf2a42N6pgyWyZhZFQdtnczVEn7x8OG/PsTyvyzHl8u/zHp6eiC3mr4UIapkHASQHYNmREREkt3PzEgoVgaOqiBSFwHgs6dZ3AqIqLorzUyNptLOnJ5mmeWMxZBtEIAwUgfKTqZZJL/MltT0TGF1LZeZZll6I1V7plmuXkyyDFKLCido5uwfJerf5PRVU2H3NHNnO6UF8qq8p1S+rOdO94Jmqd6DRexplqp/LGp5prD7lymaapWCwucgACUt07GK978gXkPbN7d7/p+OPc2IKhMzzbJj0IyIiEhKbrX+F7eCZnpMT/X58nHAIux+PmpNn9RG1TU50ulpljuoUkjZBgG4p2f6yTQTQrimZ8Iqz5Q9zSAyy3YCyJIImry/RZYeb5I8yNQjwulpVuryTDNpOBmDsqcZhDfTzD04grpmJAznPoQwfJWtpQKW8PQ0E2ZhglpWOa41fCJVnmkPAih4T7NUSbjzmtOd6ZkKy4OdoFkJD2Dla1iuoK9ci3ycqun1naiSeXqacRCAg0EzIiKqeh3NHfjsyc+QaLZ6xhgJBYAJLaZBi+bXHN/NaYJds21qoydo5pqeWcpMs4gr0yyZgLn+TSejDshvEIAwhRXoc5dnKnrO8sx8+ntVklRQ0ZLtQ6cwRarpexSQNWhO0KxE5ZlO3ylVQI3VysXZ21ge1x1mwlWeCZ+ZZk4ZtTfTzH1aT8jyTGf4hKLZJeRFzjRzAq/5DwLImJ5ZxftfEJlmXd2m3B+jvez2BexpRlQRWJ6ZHYNmRNSlav6wStXh0yWfYsUDK7DqubUAYPc0M6DH9LxLFt2c8sxoHaDXw/5H6gyqbmd4lKanmXsQgMz6QMtqGJ8tBtobfQ0CSJ1mDwKQPc1UWEGzKh8EIAzhyR7M9ncnO5JOCaYegVOWmWp6XqpMM9l3Ck5PM5kl5WQfujITqWtGPOnJNMs7aCYEDPs1RtMBGKmeZkBhsoysQQCmtbvJ8swiDQJwMs00tUeDABi0Tb33lPIA1nndzhEMk+8DkV4Rz/mJqLy5X2eYaZbCoBkRdWrz6s14bPpj+PSJT4NeClHRxLdajfvb1lvlmbKnmV6jpzLNfJVn2oMAIhrQa0drY9byzNIPApABMiSaYCQVINnmqzzTOU2Y1sG9qgOqbvVhypI5V22DANL/zmx/tzwQVVQ4/Z6sDTKrplTTM+WkTECJ2EEzux+XMwiAmT6+mHFXkMxPTzORhGnI4LWVaaaoilOeWJBMM1Nmmgkn00z2NCt0UFSYssxXg6pbA1DyuQ1Oz8xUDplm7GlGVBnc7zXV8rktHwyaEVGnNn26CcmOJNZ/sD7opRAVjTwwaN9sDQKQPc20mJZXyWI6M2EHI3QdqBtqbUwrz1Q1ACh8L6Gs63ENAlA11cpkSrZYwUH74BzIbxCAPE1RTCtLRY0ASsQZBJCrPLNaMhHS77ts96V1gCmgR4QTFAFc5ZklClDJEjpVBdSY7GnmLc90ynkZNMuLEe9I/cNP0MxMQg6XlNMzgfyHc+TDCZopSAXN7PLMQgelspZn9mQQQBXvf0H0hZS3lSsYxkwzosrE8szsGDQjok7JD/z8QESVTGb+dDRZk8KMBABhQItq3co0S01GjAD1u1obY/1SZ1D1ok2ty8YZBCB7miWsjDozCSto5qM8M9meBASgR+3zKHpqGqjIzFiptqBZXplmcQOAsCdnBpdpZjqZZhrU9EEAKoMW3WF2xFP/EGb+GTgiATPpzTSzfu/6OZkvqzzT29NMUUTWsuqeMg1ZEq5BtcszzXzKM0X2TLNq3f+s/od2tm4QmWa5yjMT7GlGVIk4PTM7PegFEFG4Jdqs3kzVcsBL1Unu3x3NVtAsGbcGAeg13etplmy3njd6LAL03RPY/WKgbkjqDHIQQBEOVrNxZ5opigLF3AIBuwzV7HDKM91ZdUJ4s6AkK5BuIhKzD2LViJU5p1rlmbmmZ5pJM+d1VpK8Ms3arZ5mmg7YqT4AUplmKMFEVcCVDaQrUCMxe6O9r9j7hBO04PTMvJiJuPtfPjLNEpmZZkJAi2hIIFGYgxdh/cfpaQalaD3NZP8yRVOdEmRfPc0UATR/DAXWgIpSTBkOI/fjXsoD2HzLM2WmGcsziSoDM82yY9CMiDqVbGOmGVU+J2i2JQ4hUuWZeqx7Pc2cTLOaiJU91Gek9wxOhkfhy6Kyrsf+ECSDYqq5BQZgHaQbrvJM17Q+YQgoemaAK9GWsO6bqL1wOQhAR9byTE9T2YTp3J+Vyk+mmR4V3qCZIsszSz0IQIfiBM1ksIOZPt1hxN2ZZj4GAZhJb6YZBCCSBc00Mw3Tes2R5ZkyaFaU6ZlyEIAORbN7muVRnilfD5UtHwIfPAxl83gAvat2/3O/75Tqc5gQwnnd6rI8s47lmUSVhIMAsmN5JvnW/Hkz4i3xrs9IFYGZZlQN5P5tJhJIdijOIIDu9jRzgmaxaPYzyEwzlD7TDAAUYwsAO9MMAqri7Z/kvkw6K5AuoMtMM0XzZM6lZyQFcdAXpHwyzaxSJgEt4g2aQS1teaaTDaSrUKPeTDMnkKqVts9auTPjaeWZeQ8CsDPNFB2a/ErbjBelp5k19VYDVK1oQTPTlWmmOtMz8x8EgGSTdfnkZvuEgi6vbATx+ulpBJ6l7FK4yvCd8swqeG0nqnRCCA4CyIFBM/KlZV0Llv52KV677bWgl0IlIjPNmHpPlczZv80k2rcqSMZhZ1NpzkFrtzLNcgbNtNL2NJNBs4gKJLZCRZu1TsNanyKsslR3plmuD0tWaaEJPQYry0xRrEwzzS7PdB0YCyG8B31V8AEsfT/J9jcnO6zyTD0KT08zpzyzVJlmCZlppkKN2D3NYGVAppdnliK4WwlkpplmZ17mGzQTht3TTE2VhMOMFzTTzFueqRX1dUgGyNSI5pRn5vM3OOWZsO83EfdsrzZBBM3ct5Pts5/7cXQGAbCnGVHZE4bwlMKzPDOFQTPypXV9q/X/b1oDXgmVCjPNqBo4+7eZQEeL4mRgaVHFKSf08+FBHkDkDJqpkVRmVikHAegq0LLKum2tFgb6AAAU03pNVxTFCZbkOsCV5ZmRmLD6mVlXnHV6ZvoHsGp4HemsPFVy9o+IgPujmDM9s1Q9zeQgAHd5JgAIk+WZ3WTGrffMaJ0JCCPvYIJIxO1Wdoo1QAQAjHi3Ml1z3oZpNf2H7GmmaFBUK0ha6J51shRTUTVXppmPQQB2sEyp8qBZenl7KXQVqHOvg+WZRJUjV09aYtCMfJLfODHrqHq4e5pVayNeqnxG3LCyMEQSHS2qPQgA0KPw39NMCBhx64OHFotkP4/7YLWEmWZaRANaVllZYZF6GKIOAKCi3TlvV5ktnvJMxa4jUyJW0Azeg++MrKsqOLDKp6eZ9R5qZpRnygBVqQYByMCGqmtQZOATAISRml6oMWjmh2EHzWK9rMzLfDPNzIR1OSgq1IgdbC9wplmqyT5SmWYyeF/gfS41CECDEtHt2/eTaWbdH4pIeLZXm6AzzYyOzM9+nkyzOg4CIKoU6Z9XmGmWwqAZ+SK/MWUadvWQmWYAXzypcllBM+tDf8dWBYa922tR4T/Tw0wgmbCDbjU12c+jpnqaleJgUK5d1VVgq51pptfDMKzJdIpoSy2tix5KTnlmVMDq/g/77xEZmWbV+AEs/cA2a6aZHaS1yjNdH8XkIIASlULKZu2KrgKKAkWTazEzp2dWadDCLyfTrFYAZv6DAIz2DusXRYUadQXNCt3TTJj24EzVW55ZpEwzVU9lmnWnPFMGz6r1S7sgpme6X8PSexwB3h6Zesx6D+BxAVH5y+jJykEADgbNyBenWbaROSGNKpPMNAP4TSJVJtOwA1emdXDW0RpDMmF9e67rwn95pkikgm41XfQ0K0JZVDapgxzFyjRTYWeaWUE9FamS+64yW6xAul2eqcjyTJlp5n1vSL/PqiHTLJ/yBiuQIgcBuHqayab7Jep6btrlmaqu2/+31yLMVKaZDJqVYD+tBIa7PNNHpplhZ5ppERWKVsxMM2EFuN2ZZsXoaWZnlSmaBsXev3wNAhAy06zDu73KuF8zzWRpy/mzrUGuA7DeK7SY/+nSRBRO+WTKVysGzcgX94c/vkFWPmEKT6CMjzlVIucbcjvTrL2tBkbCOhDQY8L/IAAzbvVEU5ROyjNdmWYlyKBwepqZzUByixWn0XvBMK0+VrKnGZAKmnU9CMCVaaboViAuffJSNZZn5ptpBmFl67l7mpU608xVQgekJmVCGOxp1k1yuEK0zsrqSrqytTu9XIc9wVZXATUVNCt4T7OMQQDFKRN371uqPQ40r2EScigv4p7/V+v+l89gkWLfZnrg113u77QvSJRXCw9+CUyUKZ/p39WKQTPypauJOlRZ0j8oVcMBL1Uf9xAAAOhoiyFpB820iJk6aM07aJaAkVQAqM4BRQZZnlmCTDOnvEYAWut71s3H+gCK6kzPVEUqaCb/3k57mgm7p5nqyjTTrb/D6c2EYA74gpaRpZHlbzY6DEAIaBGklWeWtqeZDGzI8jl3ppkMoDmDITg9My8yaBarsx7DZEd+QbNUppnmCZoVJ9MMTtAs1YuwsI9vKhtJT/U085Fp5kzPNOP2CQVdXtkI4ouHrm7TXe7vfo8rl8+IjW824rFfP4bVz60OeilEoSJftxX7s0g1fGbLF4Nm5Is7UJZvyQGVr0TaN+Tl8oGIyA9nv5Y9zVqjMJJ20EwzPN+k58WMw4gDULTcQTNFtzI8StDTTCTjEFtXARuXQf3yn9bN124HAE7QzJNp1kUPJVmeqUfdgwBSTeRF0pWdWo09zdLLG7K8blrvpXammXsQgCzPzKNheiE4Ew7t8jnFCZoZmeWZVZrp45cRd2WaAUi2xfPKwDHjdqZZxJtpVtCeZoYJCJlppnpKg/OZbOn7tmBPZvWRaZYxPVNJAqJ6978gStwzgmRp/co85ZnuoFmZ9DXbtHIThBDYtHJT0EshChX5+UUO+DCTpamGKAcMmpEv7jdEBlAqn7ufGcDHPGitG1qxaukqfvNTYKlMMxk005FMWG+PeszsRnmmnWmmpPq9ZJAZHiWYnmk2vgq0rAGMdqiRGLD9wVC32R2AK2iGNufvl42dc2UTy/LMSAypTDOnN1KqTxZQneWZ+TTStd5LRZbpmXbQrNSZZnpaphnMVHkmp2f64pRn1lqPuzCMvLLEZC80LaIBxeppJuxAVkamGWAmC/tFqAyQuQcBdCfTTFHtLxeq9MAtjJlm7qCZoij+J0wHTB7L8Mt/Ii/5+UWv1VPb2MMcAKB3fRaiFE9/qzL5Rom6L6M8k495oD548AN8sewL6DEdQw4aEvRyKob8oK/pSRgA4m0aYNg9zSIGVPuAQJhWgEtm3uRkJqyeZp2VZyp6ampdF8EIIYSTKt8dZnuz9Ut0O6gHXgjoUSixFwG0wUiq1rQ+VQCJJiDWzwn05TqgsMoz7Z5mTqaZkpqQl6juoFk+2XUy0yx9EID8LrNUPc3SM82coJnJ6ZndJfdxmWkmhwHIsudc5NRN1V2eaRS4p5nsM5be08w6scfXn/W2dN3Zv8x8StEzeppZa6vW/S+fHonFvs30L1DcQTPA+qLFiBtl07ZFvrfxMy2RV3qmGWC95nT1/lUNmGlGvnh6mvEbmorH8sxwad1gldC1bWoLeCWVRe7XdX1NKAoglAiEab09arrhv2eLGbemZyqqk7WVwelp1nl55jv3voMl/7MEHVs68v1zMhjt1v6iRGqg6HYPM83V7F+NWmtJNAEA9Bo70yzHa7z1uiCs6Zlq6u9TI5lBs3z6e1Ua+TdHaq0Pndn2GSNu9TSzHo7M8szS9TSzD36dnmby8cxenlmt2T5+yP1fj9jlt8LI6/OSLOssak8zWTKppE/PTAVQCyUVWNGc/UqYXWeMOa+Hdi8z63WSQbNc/y7JbeYqz7SzsMst00wG93gcQ+TlZJrV6M6Xtcw0szBoRr6wPLO6sDwzXDqarMBJojW/xtKUn1SmWcLKDlF0p2ROjySdg1Ygz6CPmUAyYZdn5sw0kxkeotM+P+veXYeOLR1oXtuc99+TsZx4OwBAi6S+OZQld2bCTAXN4psBpIJm2b6FF0LYTexlTzPXdcoD4yQzzQBvT5CM8+Qsz7QDVCUKTuXuaWZmBM2s7SVZVllLNUmHNehBmHkdnMsBGmpUK2JPM1nyCAAqoCipfa7QPc1M2dNMg6LbrxNCdLkPCVPYfdfsv1dBdQfN0nsklmJ6Zhd9GZ1pzPZ7o8xOLpfMLfl8LJfMOKJScU/G7WqSerVh0Ix88QwC4JtNxWOmWXgIIdDRbAfNWhg0KyQnaKYlEOtlWke7igpNt/rqKIrib4KmK9Os0/JMO9Oss4NI58N9D74RNxPWfqNGXFlhsuG8EIAag+oOmsVyZ5oZHYZ1GWFCr0nLNNOzlGfm0RS/0jiZZnW5M82SHVZzcz0taJZK+/EGSIQQePe+d7H2pbUFXWuqp5nu+T+E4QRW5b4CcIJmPkwnaCYzzfILmqUyzfQiTs90l2eml98WbxBAKoPR7HIfsoJmhjNIVlHQ5etkJQtDpllX5ZnllmnGnmZE2bkn4xbyC5tKwKAZ+eL+FolvNpUvPdOsnAOlHz/6MT546IOy/bY62Z503syYaVZY8oO+rnWgpredPaVoVhaQ6Zpoh/w+PAgjbvU062x6pizPhOj0YLggQbMOO2gWzcw0s0+AogkgsRmAqzwzy/NdBtJVTVgNxJVU0Cw1QCC1fwbRjydo6ZlmnsChmQBaP4fRbmeaReHpaeYMAkh7nWr+vBkrn1mJDx78oKBrNV2BDcAdNMvsaZZtXeQlROr5rGmw+v4JM68MHKenWVqmWVF6mqkKZFTK2ecKnGnmDAKIRDyZZqKLvmZW0Mx04sfVXp4ZxumZ7gNrIBU0K5fPiOxpRpSdu/S6kF/YVAIOAiBfOAigumQMAiiTbxHTJTuS+OAh62Czo7kD+/x4nx41Vg+CzDIDgHhLPMCVVB75uqZpcWi9TGBTxOpHFhVWkAPWQUGiNZHXgasZl49PZ9Mz9S6zUMyk6XxYSc/69EOWZ6qu8kx3ySm0qDfTrJOeZnKbHhXWMbeauk69Vg4QyB00K9fXED/SM808HzhX/x1i3XMwWg4FIDIyzXJNz5SB8kIHzIXzATm/8sxqDVzkSxjCydhyMs3a8uxpZr+2FDXTzB00sxUraCb3LUXTXJlmnZejA/a+7840U0WXvR8rWRCvoemBunwGAZRqbYXAnmZE2cnnvhbRCvqFTSVgphn54n5DLJc3R+q+SinPdB9orvnvGry/+P2ya2jtDpox06ywnPJMtQOxXrLkUIXmDpr5KM9MttmPlaLmnjikaFYWCkQXDfftNfbgSwojbq1Hi2aWZ1r/8PY066w/jcw+1WP2BnemmQy2udbt9L7Rqqc3RkammXufaW+EmQREfCucnmbIDJqlDwJwMiMSRkG/9TVlEEVmmjmBVdPJRnRnJVZr4CJfZtK0SgkBaDp8lWeadnmmmh40K2hPMxk0yxw+UfDyTHtfUfUIrLRUWMGvvDLNjFSmmbXwsnvPLpQgp2c6r9vpa3D1PQLKt6eZkajeDEaibJws0gjLM9MxaEa+sDyzusgDZKcZZJl8IEon/w757fqnT3yKz5Z8FuSSfJNDAIDi9DRLtCXwyWOfOBM6q4mcZKjpdk8zexCAHkFGeWY+QTPDzjTTIpq3ibqbqlvTJ4WZM4vM/Rrbs0wz+TdEnW3e8syYPT1zM4DOM83kOiIyaKa6g2ZWwCXZkXQOROT9FemVu79XpXEyzey/2fOB02hDMq4AZoe1z0WQtaeZSOtp5i6VL2QJlNN3KktPM6c8U1GczNyuAh7Vznotse/TaJ01HTXfnmZ2L0Atmj3TrCABZ5El00wrbnmmomtQtIgdN+s60wwC1n2oCHutqOryTOdLHT99NQt0m9He1n6Yc3pmmZdnpv9OVO2YaZYbg2aUNyEEBwFUGXmAXLNNDYDyPeCVmVl1/eqw5/f3BAB8/J+Pg1ySb8XONPv85c/x/oPv45NHPyn4dYedETcAMwFNF4j1hhM0szLN7ABYVDa57/obN6NdZnblyDIDrEyzLg6oC/XB3gmauXqapWeaqaoA4k0AOu9p5pRnxuRku9R1RmpT/bDkZZ2Dr15Rz78rmZNpVpulp5nRZvW7M+PQInZAwN3TzMn6yZ5pBmT2muwJp++U3XPKyTRzlWdaC5ObqzNwkS/rsTasISKR3j4HAchv+HVYze7g6WlWiAxD5zrULCXBZmGzCWSAVdUj1uATu6F/3plmnkEARvUOAkiU/osH53W7PvvrtidoJsyyKs80DdPzXOKxDFFK1kEA7GkGgEEz8sHq1ZH61FIOb47UM/LgrKZvmQfN7OCfXqtjx8N2dLaV07cn7qBZsiNZ8Cl28vrbm9oLer3lwMoOSUKLCsTqY1aAQFGtflOunmbOebu6vg7vZbJS9C7LMwseNMuVaabFrLiN2Q4Y7Z1Oz3TKM6P2e4F7emYkamWTCOEpfwFSGQvVkOaf0dPM/TcnW63JqmYH9Kh8DLL0l0rvaebKNCxkZoRIGwSgZJmeCaSCrJye2TlZnqnqAtB72UEzI68Dczl1VotFUplmhqunWQHLM1Utyz6XLNz7oTAFhMy4063BKopqvd7l1dMMqfJMyGCbEFVZopmR9RVApllGTzNZdv/NE8DbV0DTvZnFYZaeNcdMM6KUrIMAquBzWz4CDZo999xzOP744zF48GAoioKHHnrIc7oQArNmzcLgwYNRW1uL8ePHY8WKFcEsljLeNPlGU/nkgVqsr1WLVQ4fiLKRB/qR2gj0Gt3JoChGmWOxpAezCp1tJq+vkFks5cLKNEtCiwCxbeqsjYpmJXuYqVJLIL80daNdZqd1MmtHdQXNctznnpK8ngTNEvZ6YjFnmyfTTFGh6vZBerwpr0EAkZgMmqUyzaDaww1gOmtPDyCV62uIHxmZIXKfEQIw2u3yTCvTDIAn08yJFHSSadaTUt10ZtoggFyZZvJ3Zpp1zkxYQTNNhxU0i9nPh3x6miVcmWbZepoV4tt+pzwzW6ZZYYNmsi+fommAqtsB9TwzzUzTNQggte5qzDbLyNYtwZd98jZj9fZnv2zlmcKE2rEG6FgPTW3Jer4wSj+WKYc1E5UKyzNzCzRo1tLSgn333Rfz58/PevrcuXNx4403Yv78+Vi2bBkaGhowYcIEbNmypcQrJSDLyGm+0VS89Eyzck1jd/ow1UWgKIpzAF9ODfXdmWZA4QN+8rEu5AF5ubAyzazyzBoZNEP2TLO8yjPj9mVqOgmauaZn5toPC5JpZiZhyKyAXJlmAJRYvfVLfFOnTZ2drM2o4fwdDjViBQlc5WhBZEkELWemmRkHYFrlmUbcqcDLOj2zs/LMYmSayfJMPTUIwB1YlfsLg2adM+JJqx+cLgC9dyrTzEd5phaNoFg9zZy+ZUq2nmaFHDBhApAlfLqdaQYAost9yDo9S3kmqnP/C6IvZJeZZkkTMNqgatbjoeuJkq2tp9Kfi0wAIErhIIDcOvlEX3yTJk3CpEmTsp4mhMC8efMwc+ZMTJkyBQCwcOFCDBw4EIsWLcLZZ59dyqUSsmSalWkAhfJXKZlmMiih2z2Xor2iiG+NI94SD3JZvmQEzQqdadbGTDMtAui9ekHVVZhpPc18DQJwyjMjuc+kaE62VrI9ASGE02xdKkzQrAOGfVE1V6YZADVWD6ARSDRBrxmW8zZT0zNlbyTX3ygDgYnMoFlG1lUFS5+eaRomhCmgGG0AgGQcAAR0LTVlVcpVnlmorEM3d7mbDJbJ4BlMb3kmM83yY8qAuZ1ppkWQ//RMOZEwFvUEzQrZ00z2LVM8AdEiZJoZVhYtACgRq6eZqlkB9S7LM+2eZnCCZiIVNKvC8kx5wFrKEnenrD5HTzMjYdhBM+vfmmZ/fiiD44KM8swyWDNRqTDTLLfQ9jRbuXIlGhsbMXHiRGdbLBbDuHHj8OKLL+a8XEdHB5qbmz0/VBgZb5rMNKtowtWXqNx7mrnLM4HUAXw5lWfKoJk8eC10wK/qM83MBLSIgBLpjVifmN2oXwDCPgj2U55pB830fDLNYB3IZjsQKkgfK6MdiXYFUFREenWSaRbpZd/QFqenWXrDZPc69Ej2TLNIWp825+CrV/X0NHMChXWpgKI8yLR+t+57TWuzT82cnon0oFkRBgEIQ6QmPaYPAkCO8kxOz+yU0WG9TquaSJVn+h4EkD3TrJA9zbKWZxY608wpz9QBVU/t2l30TrOCZqbdA02WZ5qp06pMEMNU8pqemWx3epnJoFk5HBcw04woh2Rr6j2MgwAyhDZo1tjYCAAYOHCgZ/vAgQOd07KZM2cO+vbt6/wMHTq0qOusJvx2proYHUnnA2rZZ5q1ZWaaAYUPPBWLEMIJmvUe2BtAcTPNqu3bfKPDHgSgC8AJmqnQIwAM7/TMfJ4D8rWx00wzVYcWhTNRrrP+Yem/++IEzTRnv7du3vv2r0TtoFliqyfYl/4675Q6xwzn70hdie4ECeT5gigtCkzbVxBvXAHR+jUAb9BMljMBsHqaAdDVVutE1TU9M0d5ZqKlDdiwHNjyScEO8qyMH5lpZvc0i9r7iDC85ZnMNMuLGZcHHAqg1Tol2PkEE2SA2ZNpJpLOU6wgmWZO0Mw95MHa/wqeaSZMKCqgqNYgABmnM5Nd7L8CqemZWl1Vl2cKMzU4IYhBALKnWe7yTOvfmh4v2dp6ij3NiLIwk8A7V8Fc+xggOAggm9AGzaT0cpVsJSxuM2bMQFNTk/Ozdu3aYi+xasg3GnlAVag3GmEKBuDCpmMjki9fCmxdBUVVyr4fUblnmsW3xp2Dhd4NdtCsSD3NhBBV9yHS6WkWAaD1Qu22tQBURGpSmWa+yjNliVask6AZFCiKYmebiawZfoUOmsmgMZCtPNPu5ZbcCkVVnMy6jG/lnemZMtMsfRAAuuxpVrFB2aYVMFrWAe3fALACrc7UyYQJJK0gmWE/1Jqy1b5gtlK5tEyzLRsBoxVo/6Zg2aCeTLNIWk8zYWadnlltQQu/5Lf0WkQF1GhqMEZegwBk70FXphkAVbW2F6SnWZbyTDjTMwvd00xYV63YPc3s/leii6CZLM9UVACRent6ZnUGzdzvN0H2NEu/zYygmVpGQTNmmlGItKxrwYaPNgS9DCDRDCSaYXa02p+HWZ6ZLrRBs4aGBgDIyCpbt25dRvaZWywWQ58+fTw/VBjyQDrWJ/XNUyEOfl7+35fx5GVPllVT9oq39TMkWtuA+EboNXrBA6WlVu6ZZjLLLNor6vQYKVamWfrv1SDV08wqqdr1uF2x89FDMGj3RGp6pp9BAB2uht65KHYgq5PyLfc2I25074DRFTRzZz5llGfKTLOkNQUt1wTNjPJMT6ZZJDUtMG16pnzOCSEqt8QvsRVmUvGU9HqCrenlmbp93yruj2Ly97SgWas9PVckkSzQ89PdrF2xR3kqkVSmmfv7SZmZ1FU/qmpnxmUPRM01GCPPQQAyaBaNenoFapr9hYbZdRP9rjhBM1d5phPYNQqcaQZhlViqmjfTLNH5/iuEnaWmAIj0sZ8e9n5XoS8duaQm7wLRaLt3W5HIHoyAq6dZh/fLDjORPgjA+oxSDl+As2qGwuTVP76Kl258CW0b27o+czHZn/2MJAAzwUEAWYQ2aDZ8+HA0NDRgyZIlzrZ4PI6lS5di7NixAa6sesk3FpmuLczCHPxs+nQTEq0JbP16a9dnptJIbkGyQwHMBCK1EV+laWGUkWlWV16ZZjJoFusbc9ZeyICfEMLbaLzKhgG4e5pB74U+Q/pgz++NtDLN0sszffQ002qinZ9RljNCZL3P07d16xtxs8N6Liu6J2iWnmmWCppZr8O5JmjKNURiMuDj7mmWmgiaaxCAe1vFSbakPnBqqidjz1OeaQfNZE87zyAAu0wyvb+UEzQDkGxpLchyrUwzYZXQabKnWWpYhILU/sbyzPzIoJkW0axMs+4OAlAUJ4tTVZMZ5+murD3N7PJMmXVYCMIwnfJMK9NMdfXF6yJoJjPNFAB6vfV/s7ozzbSOVdA+nQfEm4r++um+fplpJoTw7HtmvMPut2f9W7OHmpTDazszzSgshBBoWdcCIQRaNxTmfb3b7KCZmVScATTMNPMKNGi2detWvPnmm3jzzTcBWM3/33zzTaxZswaKomD69OmYPXs2HnzwQbz77rs444wzUFdXh6lTpwa57Krl9Djok/pQ3dNvaIyE4TwZyyWAURUSW52gmV6jp7JsjK4nX4VRRqZZ7/LMNIv1iTkZO4XMNEv/FrkqM81E0jrA1a3y11RPobRBAHmVZ7p6E3UmSzmjW7I9CRgdQHxz6t9+Ge2I55Fppkbtv9sOmuXKNHOeSxE5ktNdnpl7EECkLuK0VgjrB7AeZ04n7UwzM+l8Q+vJNEvKTDNrmybvOsXV08y+j9KXknAHzVoL8+HatAMbTgkdADUaS/1upAYpyf2l2oIWfhmeTLNoKojcVWa+MGEk7Kbqsq+c/RqkavkFzb5c/iVeufmVTt/XhMgsz5QBtEI2e5Z9y6x9S7Nvx85W7GIQgNPTTAUQsapFFKXKg2bKFutLneTWogemZFaJoiiePpjuL1DM9i0A4GSaaWpbxnnCKtmRtErlN78DJJrLYs1UmZJtqd7RgR8DG2mZZhwEkKGT0V7F99prr+GII45w/n3hhRcCAE4//XQsWLAAl1xyCdra2jBt2jRs2rQJY8aMwRNPPIH6+vqgllzVnAyDughUXYWZtA703G+qfrlfJMolgFEVkluR6FAACERqUlk2gPUhTq0NbZJqVk6mWV1aT7MyKQnuaLKCZjV9a4qSJZceJKu2TLNkR9KTaQYA0OT0ugQghK809byDZoqOSCwBtIqsAbFEWwJo/sDqNbHd/t0OmlmZZlrnmWax3sBWpIJmsRzlmU5PsyyZZooOLZoaBCAMI5U9E9GgRTUkO5KhTPVf8cAKfLX8Kxw28zAnm9o3mWkmktB0GRhzfVNrT8tMim0AtKQyzbL0NHNHzcyk6SlpSxQy0wz2lEIZKNNVQIsBySQUc0tqXcw0y4uTaRbVraCZXZ4JWAGFnBN1zaQVcAWgxuz9T4sCRgsUJKAoitVvMmEggsyy744tHXjrrreQbE/i67e+xtCx2YdgyQxGRcnMNCvoIIBkwr7utH0LAqKr8kx7eiYUYfU0A6DAsGJpldoPMQfnvURLQNUFYCZKlmmmRTUoqpL6vN+RdL5wdIJmMtNMLZ/yzGR7Euj4BqqxGWZbDZLtewS9JKpS8a2p497Aj4FlppkBQCQ4CCCLQI98x48fb/U3SftZsGABAOtbjlmzZuGrr75Ce3s7li5dilGjRgW55KrmfiOVB1Q9ffP2vGBsZdAsNJJ2phkAPWpC1dVUlkgZpN+ncyb+pZVnlss+5840K0bALz1IVk2ZZqZh2mVqSSvzRwbNnAb31kGvv+mZ9mtll+WZWteDAOySPhht3Q6a5dPTTI3ZmWaJrYAQqUwz10GQe2iLrtvrdfc0k5lmwkRy/ScwXrkAaLGG8WhRzdcwhVJrfKMRbZvasHnV5u5fSbIlFfjQrL/RE2yVPc3QFwCsIC3g7Wlmd9aWn4cAez8Qqf0j2VqY3idWppmwblJ1B81qrGUlNzvnTZXWVVfQwi8jraeZqgOK3Y+r0+evSFoBV2Rmmin2t/5A7m/8P3k0NVW1s/c1GRjLlmkm+50VgiwD9WSaOcMkOn/+e8oznUwzM3VaMbWvBz68CWj6oLi3kydnOISagKYDEMX/0sH9WR9A1s/7Zrtdxh+ttc5jfyEgTBH6rBSjw2rHUNPbBESiLAJ9VJk6tnQ4vweeaZZWnqnqKssz05RXuggFymluHdNy9rvxy33gXy5ZP1XByTSzyrAURUkFDcoslV2YqSye9EEAgb9J5ckTNCtCT7P0gE01PRetAwGrTE3TXZlm7rJDu78DkGdPs7h10KDXdJGxpOqpxvnZyjPbEoCZsHv6JLoVNDMTbUjG88g0kz3NYAV35Gt8rgmekagMmrnuJ8UuN000I/nlqzA64kB8k3021VeJa6nJQEOPAunJranAhx008+w3sqeZqLdPsy/nzvpxuu8Lp+l5st3KhHRuxlWq2RPWtESR6jsFO5iqWvutarrKM5lplhczLqftWhMwFSU1abbTg3MzAdOwA65ROxAtS8TNeKeZrq3rW7Hq2VXOvzsNmslMM3dPM13znFYIpsw0U+Hs387AgS7KM9N7mgF2eab1/UJxbVwONK0A1i0t8g3lJ5VpFreC7CXONHP/3/3Zz7CDZmqfHQBYQTP52hX2L93k62mst+j2+ypRIYQr08x6TsvyTPcgI2aaWRg0o7w5GQYxPWfpjl/uF4xyCWBUhcRWJO2HRh4cl+swAM+Bfm15lme2N1kHycXqaZZ+XdVUnimHACiK3YRdHqgqGgA7gGHG85+eaRowknafl1gXQTP39MysgwCsIEuslwDMeLdebxNb7QCLqjn7v3XTadMzI1EnWILk1qw9zeTvqqY6mVTeQQByWmASyThgunpjeALvIfvW0kgYzvtbz4Jm7kwzGTzJkmlm1riyDOENmqmyKXsq0yzRlrDvTPtm2lLfTveEDGyomkhlmml2eSa8mWapCYv5fXhuXd+Kj//zcdm8xhaKEZfvl6nXEjlptrPnrzASVlmMolqXBVLPR/tbfyB7ptmH//rQ87h0nmmWJWimFCHTLJl6rZBjWJ2+eMk8pmfC9GSaWbo5QdiPpB0oTm7p/HwlYiQM+wsdwwqymwnPdMui3GbcmyXrTE93Z5p1WCXiav0QAIAi2somg1+2Y6jpbVpByDL7IpgqR3xLiI6Bk60QwpVpFmGmWToGzShvWTPNelqe2cLyzFDylGfaBwEFesxLTX7rqUU058BDBp6SHcnQlxIA2adnJloSBevvUs3lmVapRhJaRECJ9HIO8KAorkyPRP6lhSIBw56OqNXWdH5eNWI3Cs8szxRCOGV4NfVmt78RT7RY16HXRJxsISAz00zV1NQQhOTWVEmO64DC6WtZq7ku6B4EYPdwApBUBsGQU5jSMxZC9hpSkC9vjLj12MtMM3viYbZMMyOhAWrMVZ7pvj/l75mZZvKkQgXNZG8pd6aZpzzT2Oyc19l38nzJ+ejfH+GD//sAn7/8eUHWWi48mWZ2X8RIjZUl1dm+ZXTIxzTVfNmdaZbr4KX582Z88eoXAIAdD90RQMgyzTT3a46cJNtJ8FC+p5n2IAC9FwDF+t0sQdAsYQfNEiEJmsVT70+abn0h4WwvhqYPYLzzByDenPG67c6UTAXN7N55Riui9peR7kBAGDmZZr2YaUYBEsJTnhl8plkLhGm3UxVpmWZlcJxUCgyaUd6y9TTraS8A94fIavtGOrSE8JRnRiJlnmkmG5fXpjJi9Fo9VUpQBvtdtp5mpmEW7LGo5kEA1uTMhLefmeQKmuW9/5txGPZnn64HAWgZ0yadddl9VwAZNOteppks5YvUedeSkWmmKUAk1dcsW6aZMzmzxvXRwZ1pVj8Sev+9gN47I1mzW6opfrZJkiFSkN6ahmyi680082Qo2tMzkwkN0KLZBwEoqcdFBgiSbVZPs5resjdWoiDBAyfTzNN3SgFUK2imunua2ftLvplmW7+2Sj3aNhWm/1q5MBKuTDO7L2KszgRgeg6Q0pkJe79TUt/up4aR5M40W7V0FYQQGDx6MAbsNQBAnj3N1MzsxsJmmtnZSu7eabKnmZH7+Z/ar+2gmRZzylyB4mZYAQhp0CwBTRdWMqj9nlC019CNy2C0bAbavkgFzdLbsSTbnP1V7WMFaiEMRHtZ7wVh/wLc6DBSr6ciiWR7+D8DUoVZ8w/gzUsQ37zZ2RR8ptnWVEK7nWnGQQBeDJpR3pzyzBo9a7+b7mCmWQiZHdYHCaenmXXQne3bxnIgg2Ke0jRFKZtSAtMwnTXG+sSciVZA4QJ+GZlmZRBILBT3N/mZQTN7n/HT08xMWBlWigot1sWAatkDLEtPM6skLw5VA6K13f9GPG6XZ0bSphx3lWnmvMa7nu+pyZnywFXxZklpMUT2+hlQNxiJdsXKqAKgaXbWVb4lriXmmeLc3deDhN0PxL4qTbUPKu0Pnd5MM8XONLMv65lkaO8zwkwNArB729XU2/e7SBYkO0K4s4EUGexzlWcazU5ZqN+eZm0brL817FknhWYm7LLEaMQJukfrrBLszu4Lo90KqCmqmsrqy6OnmbyfB+w1wPlCpbOMBac80xPMKlGmmS6DZp1kmplW5q2d7mDdB1rM2j2FUfzpmTJYZrRaEzwD5nypo1tPUU2NA6KI5VKJLdaXHfHNqQnA6Z/9OtZZXw6oUah120C2MZBtMcP+mUq+nsZ6y9fXwvSIJMrbpjeARDPi679wNgWfadbqfOlnZbYrzudeZppZGDSjvDnlmQWcnuk5WAn6BYMs9sGfMwhAtz7Ml2ummZMdU+sNYORzgBEG8kBLURVEe0ehKErBBxmkBxarqjzTyTQTqaCR5ATN/GWaJeMKANW5TE6d9DSTJSR6VFjn6XammfX8jdR5+6tlzTRzgmYtnfY0i6hWc3/UDU2Vs9rk5YQQSCSso6j0oFnYXkMKkmmW9GaaadkyzeQggIQKqNEc0zNdv8vyzFbruqN1plWiWaCSIhm8cGcdqbpqZUgpKhRNAPHN9nnyn55pJk2nD2Nn2VWVyIzLfT1il9qqiPWyBo10mmlmT93Uou59oetMM3cWcrS3df5O92E76On0zkORMs2M3FM6OxsEIIcAWOeH1ddNjVm/ixKWZ0I4z+kgmQkTMJNQdbtPZkQAMIr3GprcYgX1RRIarPsi/fO+aPva6r+n1VpTYrU6AHZwGGUQNGu3Xptk5q7R1l78YCyRJFLvq/Hmrc7mwDPNjBanvYSqmlDMjlR1AHuaAWDQjHxwDwIo1PRMd8CimrJbQs2eoJJ0yjOtDxiFCpSWmgxGRLQWoGWts70YDfWLwT0EQJZuOX3NCrR2GSSr3c4aH1915ZlmEpqOTsozO59e52EmrGwjRXWeMzkp9vRMkVmemWyzg2YxYWV2mYluBTOdgGgvb3+1jOmZquLtaVaT2dPMCUCLb6wNfffIuD0tpjn7aUe7dX+qaqqvIBC+D2CFCZq5Jk8BUBUrmJEqSU16M83c5ZmubD339EwZIEhstbJf9KiwynkLlGlmupu126ygGQA1ZsXv4hutdfnINGvbmCrJrLZMM8PJNLNfO9SoHUzoPNPMlGWduisInUdPMxmIi9ZHPV+m5AoCyPJMd3DWKZssYEBKZNm3FCfTrJPnv4CT4aWoqvXcUGNQVOvLhaIGzYTpPI8BeH8PiKd9AGAFz4o5QTPRnOrLaKyz/p/2ed/c+rV9hhrr9UK3PjfE7KBZ2APlsldozA6aCTMRuuxnqmBGq9ObMN7c6mwO9At8IYDEVtcgIwEkmlOZZnx+AGDQjHxwDwIo1PTM9J5mHGcfAvYHxUS7nWmmWR8wwpol0hU5eU7f/BTw/u+dniDOBM2gv93pgpNJUJ/KFCp0lpwMksmgWfVmmuUOmjkZQ11MLhNGPFWe2VWmmao7Pc0y+sq1JwEz7gqUGDC6UUaSaLX2kfSgWUamWXrQLMtrvNVbC9BFo7WhT2bQTFEU5yCro93anzQ93H0RC5lpJodAqGnlmWa8A4CAaQCmqXrLM5F6LJzyTKSmZyZbrOuOxGTWYfcCqOmc8kzdHUCx16LVWNk9HRusv8NHYKV1Q+pAQL5+VQtPphkAqBGrvFoYnQYT5CAANeJ6zegi00wI4c00i7YC7esgTJHzCxV5eW92oZ0dWsjyzGxZjPkMAvBkmkXtmkT7fhBG3oMouiW5FZ4bCEFfM0/7AMD6csdMFjFotiU1yCb5lfX/tPJMs0UGzWrtwSHW63y01lpTmDPNhBBOKXSsTliJ0mZhvoQgyku8yfm1ozn1BZMRN4L7QtHsAGBaGaRq1HqdSW5hplkaBs0ob/JN2p1p1tP+VukH/WHP+qkKTqaZ9fIQ0a0DoEIe8Lasa/EcWBVTsu3/t/ffYZJd5b02fO9Quaq7OndPHmmC0iggCSWESBIiG9uYgwjGL7YPPmDD4fD6OH4EvwabZAyYZBsTTTLZgEAgaZSFwkianHtS51A57bC+P9beu6q6q3u6Z3o0ad3X1WpNddWuXbvWXuG3fs/z2FCdIhS2wK1ATYaW+bvyJyo8HbrvEHf/zd0Ux05tCEdj5UyfU+Y06zqPnWYhwJgrp5lVT87N/BMIYdWkUUIzFhCeaXrVM2fnNPPDM0MREYgrVmHxbc0qeU7LZKzp8SYHiK5Jh1NottOssY+3yhY4ZUJGQRYASK1r+Z7+awPRbJbr6syagM0UzU4oVMcPz8T7zPqMsPaqFDwdW4bsoUcwW1bPrH8vQSEA73s3I4bXXk6x0wzq7p6aFM0W4zQrTTSIZvnqeRX6FDjNQnWnWRCeOY+A6NR8YblFeKbT2unauNEYSYbRD34es7ILalNzbwZ534VuNrQ5zRdEl7IQgCeatSoEMF94phB1p1nIG/OerfDMIDTT40xymnlauhGSovkpcX44VXCrddHMGZUbjjOiDNzShHy+6YtmXnimL5qdwe5Sp+YgvMSTZkQE1/Nsy9WrOIuxMsH/1vLNG6GnbRPf3/RzQp6DVDrNVCGAZpRoplgw/qBihI166M5JLn5m7kid6fmlzgt8p5kjF3+mKTvTpQrJdWoO9/39fTzw4QeeFWehVbagNiEdGhDkEjhZp9nRR45SHC8ytn1sKU5zThqdBD5LndPsvHeaedXJAtHIx1+0CitYtAavmet4Xr6UBTnN/JxmLQoB2BVZMdGMCEJRTzwpLVI0E3XHSSjeLJo1Jej2F7a+02yO6pl2xQYrgxlBCmZ6YJVqws+NVy3L62cYfr6mM9Pq3zgOCTG3S2de/PBM0gDoeAVU/PAGr104bkzWTzAjshoeNBcC0A0v6bkb5A+zy1KEMlNpz2lmYy+BYF4vBNDoBvL+3/DCM6vN4ZkLqZ7pJ6cH6Ww62THjbML1+gY9cJqFiSS8QgDzOHBcTzRrErOO4zTzx4ZQPIRe3gfFQ9LVZpfmfK8gPLOhzekhz2m2hONxIMiaLZxmx62e6f3d8EWzcP2eOJUC7Exn2Zkgmll++gA/pxkgTlF4pvf5Hdvw3CY2FA7MDs8see7TUFxutpieaBaRbfhMdpr5Vak1TV5LM8yS5YhUKBaEtwaxa+D4uSy9ecJpM474m34iDnpIivSN4Zn2Ke57zxKUaKZYEEIIb8cLjMLTGK6cSJ/MQNO4OPEnVmd6qNx5gSXLDrvIiVDILIAQS+Y0K02WsCs21Xw1yNd1KrGLZahNe2FwBAPWyTrNKhl57pXpU/sZqtkG0aw8DEd+SCi6tNUzZ+U0q9jnTai07NeOXz1T07R6JcT5RLOaX7hBb1owtkT3nWYC13abFsR+9UwzDGZEft92aZHuTGFjec0zlGr+bE1OM19Aa1U9c6ZoVpuWwk2L0EyfwGlWktfP0Jsr8J7JTrNW/14Q/qRTawfA0KVwVHfXyfvY9jcjYjGCsMxGpxm6FFmo5zP0c/CYqQ4vD5oIHjsZWjnNgrage+GZfk4zYxFOsxku4vMpRNN3oRpBTrPQwqpn1ppDmOVr589p5h8vkorA8F2Al4zdrc4tmjl+9cz6+/hVfmulpatO6bvJFus0QwCug6aB5odlGtF69cxT7DQTLkwcMrBrLCg8U7jilG72Bps6fnhmSIrmJxsuJYRgcu9k8waZLZ12LnEIp+V75XY2O81cG7csxUQ96m3E+OGZ8TNfNPMd3EZIeMKZkCLkeSTsK04zlgzPrJW1YEPEn3ufNuOI7zQjJqvimgKsfL3isRALKgJ0rqNEM8WCCBY5tQnMY1/GnLhTPn4SA41Tc4JFYrxbCjRn8mB73mAXZOVMz3JvhuymnE4na2NvFJmWSnDKHc2x7xf7WpZFtqYOg3ADt45vjT4Zp5kQoi6aZU6taFaelovjWEcMDn0Lhn9OyNkHnLqcZnDy+QrPFuyqP4mmRXhmPTwKFuaUsst+WN4ChlfNlDvdXh6dxgWMXbbq1TNTPfKxxQolTiXITRhKxJv+1OwAmeE0m6MQgF2yoJaRAnSLIgA+gWhWlNdL15tdV+emaOY5zbQ2wAvPFG59p9YPz3RkbjkjakKo3XtxQ345TSeacqGhj7F80SzRRijq9cPFk3fBBCF0jW3BrDvNGnOaLSg8UwiojFOemCGaneGJwZcS1xMz9EjdJRWJu4CDXZ07F1XgNGtwtC7UaRaJVSG7FUA6zdzaPE4zXzSrv0+iO4KmgVWeX9hbDH5Os2ZB1vT+djynmStviUan2bMRnmnnObY9xMP/mWTXvdEFiWZP/tuT3PX/3tUUkryUuJbrbeoAobR0nC2B02x8+zgPfewhtn1zW/1B32nmRiGUlk7Y3K763M/bNHEdQNPR/fBZ32kWlW3nhEPcnwXsqufgDgNoQY7I82W+82xjV2wOP3D4vBoDjotfObOog2sRToTreYpP1xo4cJp5opmBDM9sGI9ara/ON5RoplgQTlW6zLTSEXQTTCZBnNzixxcrGlV2ldPsxChNlNjz0z0Lvn6VbKWpwlkTdkFWzjQimGFNTlbtwpK5RHwRCJj7HBbJ9u9sZ+f3dzL6zOisv9lTh4C6W2cpnGa1fC0IUzrVopkvLEbbQ5DfD0BIlztVS+00i6QidZv4eRKi6e/km62cZprnNBMzEtnPs8vvJ/Q2jxeaCaAZaDpBbqsmV1epBMKV1TPb+73HTkA0q2qgGYS89l5/64bk854gUs9pVsSM1BPABlUcs6MgHMxoBOIr53xbM+aJZmV5DXzX1UKu34lQGCmc1KLHn6j6C/yTc5qlvGPJxwKnmdcubFuKZmbEhNgy+dpwe/04vmiGCO59uyR/hxIJzJgfmn3yolndaVZvq82imZBOMyHqotl8u81jm+GZv6F0ZLc8hNeXnMk5jpYa1/adZr7gE8IIg67PX1kwcJqFGiruGl7xjoZ21CjY+6JZ2N3vPT9OOObO7zTz7mVNb3CahUPE07LN5YeOLxQVx4rs/P7OeR2EdafZ7LY1X/VMvxCA5lVwlScYAc3LdXYqtRgrx+QRE9DIjRkLCs+c3DuJ67hMH5w+JafUlD4g2usVAjh50Sx7WM4hckcb8rgFollMOs1MAYWDGIZdP5fatCx0o0fqC2rfaRaW7cGxnDNuY8Sn0WlGpFuOvUuUI1Ixm0P3HeLprz3Nvp/vO92ncubQ6DQTLpGkXk+5crrDM4l54ZlCFgJo2FBTxQCUaKZYIHZV5rIxtLxnaZa7NSe1UPHEilA8dNKhcuc7e3+2l90/3s2h+w8d97nCFdz/ofvZ/MHNrV1jvtNMD2F6uYkaq+md7GSo0V3WKKCdDP5EvzA6Y5Lr2lhTsgJUqOci+Zg3YJ2M06xRKFuqzzAXvrAYi4wH4k3YkBP0pQhnFq4I7mMzZgaCx5leDMB13CUR9uSGgBeeOTOnmVF3ekC9AMO8YVZV35VmzvmcgJAUWMywfE3jNbcLsi2b0RBmW5f390Xu1vpOM80Izt2nZUhe4LQTmGaD681rH3ZWVs00O9c05USaie80syryOQbN4ZlLmdMsP5znnvfdw+Off/yEXi+ECASGRK/8/CcjmjluGDRTtie7UHeaeeGZjiuFACNswIV/ABe9F+Kr6sfRdGK+aOb1M3ZZno+ZTGDG5esXHarbgnqy9rqwYUZMOSa3pTBMDYQNdn5Op5ljORz49QF5rvm9uDZUp2T/1LZSuu7OJ5eB47VtPVIvBKBpEEnI6zdX3+FX3WyqnhnplL9rU62dZvkquBYR4Ylmy19ByHeazTGXqodnNty/mkGq2wHhkh8+vmi27xf72PeLfQxuHpzzOb6bTG+qzGp453A80cyVotmsnGanPjwzO2KAEaOU1Y8rmjmWEwiHS7UBOOs9PNFMN4FovwybWoLqmcVx2V81nbdXCMFxImBEMOJpQGDYRwFvHVCbkk4zI9IgsEunmWGU60L5GRo14o/3ZkRAtL/uNFOFAE4JhRF5Dy1EjD9v8J1mJTkmhGPOSedYPmmC+UsE9JDsb6xcU1qSMy0X7elAiWaKBeFUHSgdCaq4GaYAp3pSA43fOYSTZ4A19SzHF4vyx44/MJWny1QyFayyRWm8xcLLyst8HlooSOiNXVwyp1mj4LQU4ZlWyQoWZbMmrrldWBUH9DBm7yXysSVwmjUKZZVM5ZSFIjiWE3y2mHkkeDyke6LZEuxKNQrfoVj9Oz/TnWaPfPIRfvUXvzrpPsOpeC6oEMHkP8B3mrnyWiR6pKgyX8VUp+KJZpEFOM08p5GpexVrG51mnpPIjMcxE1J8cKq1xS0a5xHNWhYC0I3ANaCLUvC438/bWVn0wuxpXTXTJ+g3dD+nWQmEOCXVM33HRGYwc0KvbyzznuyXounJhGe6jtkw6Sw0OM3kMR1HCgFm1IRQG7StRyoCPjrRNvkd+/2MVfJFsxRmzBPNiicvmvmuKH1GeObNf3UzN//V89EingOuOhm0hZnt78iDR9j+ne1s/852KA9TzukIu4IRNkgNSFH4vHKaBTnNPJeYF2IZScrveE6nmeU7zRpFs27528piGMJ7Xv3eqeaqUB4mErchsRY6r5bhmU6N2hzvE4RnNjjN0AxSPYtzmsH8843AadbwPkEhgPmqZ/pOM13Uw1OfpeqZbjlHfsIAM0GloCOquXmf37QBOHmKRLOqXd/UifUFhQBOdgHrz/2sslUf623PaSY8YT8t3cSmkP2+U3Og6olmet2V7odnam6FcNKbV52h97zvNDNDAmL98nqq8MxThp/fcmaey/MaL0VMtSTH1HDMrq9HTtca2GkIz9TCco3vOU9b5dM8X1GimWJBOJnDUMvIPACRbm93pnLiOc2sPLVx6YoKJ8LBQHs8EcC1XXb81w4mdk+c2Pueo/j5NPxdnXmf2yCUtczDYReolXTQQ/WQLuvMDc9sFDBmTVynt8hQ00gXoXZv197PaRZfGqeZU3NOmSvLn5QbIYOQszd4PGRmZGLpJXBm+hNmI2Sgm3rgNDuTQ6Vdx2Vq3xR2xSZzKHNSx3Iq8h4wwib1coYeQU4hTzTrW4Bo5jvNIgtwmsUGADD1PIgZOc08J1EoEcNMeuKFW1vU5F40hmcuxGkG9RBVe0YFTdfBymfkOXVvmPd9/dcFopnpglM+JTnN/D7MKlsn1GaD0ExTJ9YVa3pswQj5+QAcN1QPb3CKdaeZJ4rYtldRdK7wXU0nmnRBuPXwTM9pFkq2EUp4xTpKJ7/hIJzZTjOQ4nC8Ow4R6XCkNjWn08wXWcZ3jCPKo9Kh41SId8WDir/nSyEA4YogbL8xpxl4CfpZgNOs0aFqxIMQRV3Idj4rp5mVk4Ujem6EUDvhGIDAyrUWfFrlNEM3SHY5IASF4ePPIfxxdj6Brd62GvoZ03eazS34CNE6PDOonnkKRbP8cE4KQmYc4UJ5av5qxY3zl1PnNPNyZJpApNcrBHDy4Zm+0wwazj1wmnl9VELe/4YrN+mcquPlNNPAiDY4zbxcqHapLpqdoRvgfg7TwGkW9q6nKgRwSvD7ivJk+bwpLjUvQkDNC8+00gBEYnbdaXaawzNnOs2AlqkBzleUaKZYEPaRzQAY7csgsRYzBDiVE3ea7f93rB1fAStPKBGqhz0dZ6AdfWaU/XftZ8d3d5zY+56DuLYbVFgsjBSO63pqXPDPEs2EC3aR4rQUzeLd3m650+A0O8nJxVKHZzZ9nsbdLCEg8wxWFYh0E2rzQ10yIEQwSNlVe9EJLmfmMTtVec3qRQAiaIUD3qMaoagrXURL4TQr10Mzoe4SOpPDMyvTlWACdrIJmJ2KJ0zGYrP/OCM80w/fmxUG3IBdaVEFby4i3dLRGXbArczOaQaYiSR6LC1zZLm1RfW5TqmEcFm40wzmrqBZncCuCtAMzPa+ed83EM00HTQjqMR0KnKaNX7/J9IW/DEnnAyf+ILPLuEnW6o7zcQcTjNvQTqXE1HTibXJ/qg8LRcafr4rM5Hyqm6CXT75vlMEIXRznEvY6zOrk0F7cWcIHoFoWciTG3UpZ3Vwa8Q6I4RT8rOeL+GZjiVDHAH0wGkm7ztfNJs7p5m8r5tymmlaIFzqmudknJnTzCkTSbgQ7QdNJ9zmhRhn5xDNvPlBk1CqGaR6HHyn2XxzCOGKYFwqjhXnHDvdFm1LN71CAMd1mrnSWeb3v3qkHp55ChPMZ494cwlv46A8KR2yc9E43zhVTppgfAqHIdy+JDnNHMtpTjERiGae08zxNjuS0uloClkMJAjPtPEq7M0QzZxScM+fsaJZkNMMiPZ51avtYGNCsXQIIYK25TruKc//e1ZgFwAX0KjZcnwNRyunP0VRUAggLOcvhjTGyHvFdwgr0UyJZorjY+VwJncCYHRuhEiX3O1yqjjVE5jECAGF/dRKQHVCOs38JIjHcf005q46U6vzPNuUp8rBtbCrdiCgzUXjDuOsRaZTBgSljA6aSaLbc52cIqfZUoRnNgoY5cn6tcAu4FZyOJYGoTZMXzQTNjglQvEQmhcWtVjxaeZ5n6q8ZkERgHhZ5jMzk5BYRTgqwCljl+2Tvg98d5MvlgVOszM4PLOpDbcKMV4EQXhmNDr7j0F4ZrNotiCn2UJymmk6xLy8KnapSai0il7FxHgSQqlgR3wxYqblhfDpIbO5Kh+gaVrQ/pudZq0raNqZY/JeMuOEU5F53zcQzQD0sFygWLkl60MaWTLRLK4TDleaHlsw3oQTI4ZjuzKnmUlTTjOn5uWts737bE4nok40JfBzmlmlGnKVCmayHdOrgmotgdPMtWe7gZrwnWbVqaCtzHQLBPeiXWJiMCSdZkC8zQmcZmdqqNZS41oOCC88c4bTLOINpXM6zawWTjOAsPwOQoYc5xoXVbVcBZyqdJpFe+XT27yQ2FxrYd8v5KA15iTUDJJdLhqCWrE27/dVnqo7RoQQc7rb64UAWuU0m2fxJZDXsNFp9mxUzxSC7DFv7uSF6ZeyAty551PPitOscVPHTHrVM20ZtnmCzOwnZznNbF80k1WbDVdGdshCAFOznWZeeCZOecEbD67jcuj+Q1Syz66Q4pQtmdMsLMNdzbA3d16CHJGKZqrZatMmy6moMDu1f+pZb0MnhZcehlCKalXOOcOR6ulPURSIZlEvJ6t3b1u54D5X4ZlKNFMshMKgzHFlJjBTnRDp8hZwVYQQi1efa9MyUW1Fg9o0oURoweGZfpJap+YcVxw6X5g5EB0vRLMpPHPm7qglX1vMREDTiPfNdp2czILXrtryO7aLYJeo5qonvXtRHK0LGI7l1Aed8pBXBTQKmo4Zj9YFgVoGTdPqDsdF7u48a04zvwhAbEo+kNoA0T5CUQG2FAhP1hHm33Nnk9OssQ03CmgnQrAoicZn/1GfkdPME81KE6U5F2/+YsaMhlr+fRaxZZ5oVmx2mpXleZmJlBR9I96O+CLEEqvghXjGzED0aMQXy4LqmVC/R6x68Q+7YlM4LHPqRdoTzaJYC/y2BMhQxZBXiekU5DRrDMk+KdGs/Djh4X8Fu3QCopnX55oJ6QTynWZNVQ+9CnT+gnQep1k05YIQODWH8vg0INAN0KNtmHHZTpfCGRE4zYzjOM1qdadZY/VM4Yr69XdKTBwyKWfl82JtFhFPXD1fnGau5wjUdNDMGeGZMXmt585p1sJpBoFwmWhrTsEghKA6nQUEkaQBIRnCHU7L37Vc635RCD88s9lpZph4FTSZtxjAzHtsruf6wpjvLpP/790LJ1A9U9MEcAqrZzolsiOy7YaSSdB06Zq05r4WjUKZXbFPSWiVX3XXiCWkaBaSTjxfhD8RZm40BZ/Dz2nmyO/Md5oZRlEWH6g6iMo8TjO7tOB7/tB9h3jm68+w8/s7T/hznAh2ycsVGkZez6hfWOXk5hGK2cxcXyy1aJY9nOXBjzzIY//y2JIe95TiFSIj1E6t4o0N4dIZUz1TFjICPezd01ZehWc2oEQzxfEpHfUcBgk50Q93SueAIxdviw7Xq8gKbFZZA7tIOFxdcHhmoyA0n9vjfGKxotm84ZnepKmYlROJRJ+XS8leGqdZJVMB18YsPoWeewrh2ie9SzSzHQSLuPKQzOdkJjAjpgxBC6Xl37zdnhOtWOM7y+LdcgG7FI65+d4nFh6VD7RJ0Uw3wdA9V8zJ2LlrGewdX4bK2HnsNPMWJdEW4ZlBTjN5jaPpKEbIQLhiznAcP5TOCC9CNAsLcEozwjPleZmpFBhxOckH7GJ2Ycel7labGZrp44dlNoVnhmY7zeyKTeGYbIPJgfRx33eW08wUTU6zpZp8uY7btHA9kRCpWqEGTo2wPkI4akN16sSdZmZS7sZqodlOs6qf00xemzmdZpqOYUI4Jq9R4eg4AKGoDrqJmZDfj98+TobAaWbOcS6NTrMWOc3K0+W6k8AuM3XEoDAlP2882RCqdZ44zZyqJ8Cboi64+06zuLxOczvNPAFzptPM+w6SaTk2lyZKuLaLU3WCfIzhzu6gmES4PS3fp1Bu6UIOnGYzRDOAVI/823y5ymbeY3M9122V08yQn03MF57p5zTTRVN4JhrgnjqnmajmyI1Jh33fFQOge65Je2GiWat/LwWuJ47pkbjn2vX6k8qJj3uznGaT5SA1BzSIZrE4hNpl0nyngnBtXKtSd5r5bhS/gI6wCcflY8frQ6f2yY1Av5DLs4UvjpmxiNxMjUm3j6OcZkvOzBzDSy2aTR+QufYyhzILyud8RhA4zdLUyvI+C0dKZ0z1TNeV56H782ErpwoBNKBEM8XxKR/FsQjEB8KdaDoYmpy0LzqvWVmKZrWyt6snjtYt3fMIAMJtDgWYL6/Q+cTMSex8g4cQYlZ4ZtPE2i7g2FApyo4z0euLZsW66+QkwgIq0xWw8sRSNtGkBdWpk5poCiGCduALA8HxSr7TLF53voTT8veMYgALFp7sEkw8SsUTszrWdsjPdSqdZkIQDQ3JB1IbIOKF4UT8ynonMchOPIw1fQwKBzAjcjg425xms9rwIglEs9jxnWbawa8Sdx4C15pTtPedZkZkMaIZYBebCwGUPdEs2Q6aVq+aWJi/olsjVlG2yzlFM88pcLzwTLtqUxiSITrJZd3Hfd9m0cxPKptf8vDMynRz5doTdprVJgjHhMw7ZWWWwGlmek6zQsMurfzMjuUtSOfMeSef7+c1yx+Ti0vTuy9DSU80q5z85NoXL+Z0mgWi2QR6C9HMv96J3gThcAm7ppEdk4vQeLIYuE5qhUVWfT1LcT3RTDe1QIjy+5BI4jhOs5pfdXOmaCbvt0h4CjNiSsF+ohTkMzPDArOtnmMw1C7HJGFXW/bhc1XPBEh2e0LtPMUA/O/cF9rnem7QthpymvmFAGbmxWs+Py+n2UynmQ5w6kSzwrExHEvDjIbovrgb9LDnNJv7WviigO/iXWrRTLgC1/LC/WMJ0LRgc8etnPicw58DxrvkmFeeKnt9mAA0XNvbTAnpEO31NslLMiVLTfNCuPQGp1kUqWoev+CFT+ZgRp7LaPFZ7RuCXKFebkg/3N0uK9FsqTnVTrNGl+vQE0NLeuxThrf2IJymWpL9YSScP73VM4VodpoBRqQumimnWR0lmimOT+kodk2TVuaIEUykjZAFwjlxp1nVS5DrDtaTslfsOSdUpclSUyjfee80q03DwW9QGpblwFPLZC6T+USzaq6KU3OCfEZOzWnupK0CpWkd9DChWIhQe2un2YmKFJVMBew80aQrF4XViRN3aTlVakO7sMs2mqbRvVEuLoKBujKMVZE5mHwhyA9h8avXLDSXXsDh72Lv/BL29GEA0mvTwCnOaWbniaVqYCQgtgxicoEUMuX3fFI7U/m9Ulh0LULISUdQVfRMd5pZOaiMYVftk3KyNIW/zKTRaebaMPkoyfYiVMbnFs38hN4LdpoNEIr4OerkNXdtF9f2cs0l0wANotnczoeZWAVfNGudg2ze8MzGQgBli+KwvGeSKwaO+77B/QbNTrMl3rGcOQk/YdGsMkk47hKOCbCyWMVFijwznWZ6C6eZZSMEOLb895whrl6uqWjSEzCGMvL5MdkWzbjs5+3Kyecz9MPktLkKAUR6pKDiVtAc2e5aimbdcbqWeX8PSdEmFs8QTobRNA0hxOlLcPwsEuQzNPXA+VUPz5T9wlx9lS+a6TP7DW++pdWmguq9hdGCFN+cshQpvHxmAEaiM0if0eqa16tnNnzn3jmmOisg5nea+UJR53oZuju302z2++i+02yee6s5PNN3moWlJOOeukIA2UE5j2pbFiHRkwDN9Jxmc4iCol4QoW1lG7D0oplTc2QOVsCIyX7Zd4A41RN/L/++7doo21Z5qhzkMxNGUuZlxBP2I731TXKnim2Bq8s+yO/b0LQgRDMc9RyV8yz+q/lqME9zHfeUzuVLkyV+8Z5fsOO/ZPEwxxPHjLgnmsV80ewsyot1luD3Fcl+2XYbx2fXPvnvvbHvGX5y+KSO9azhrT1crQ27Ju+fcCQfrIEdy3n2HV1uFVmcAFyvCIge8TaR7bwqBNCAEs0U8+NUoTJWD88MG2BEwEh4lu1qU0jRgvCdZtoqAEL2AUIR/bhJ2WfuaDbmsjovOfoTGL+P0oEtAPReKifO8znw/EEq1hUj0i4X0k3hbXZBVs7UTOI9cbRQKni80Rlxop1neboMVp5om0ss5UJtivLEwp0zTRz5AYWHPw2VUWKdsSDflAw1EFAakpUzWznNatLWvdBceoAMX5h+mnJel7n4YiGSXs63U+Y0myxCeVgKjG0bvGpq8nuOJiognBN3XAoX8vtkCCsQqu4G6uGZZ6rTTAhBaawE2R1ohd1gFU4qr1mw0PUWJU0EopkF5WMgHBIdLlQn5+x/AqfZQnOaRboxowYIFzsn26VVtoKQUMMXzbxJvl1chGjmudVCnjg8k5bhma0KAZQKFCbk50qsXHbc953pNDNCyMlXuD75Wgp3gf+9+/fhibgOa9kCWFnpNEuE0XDBzi9O5AlEM89pptWrZwb9pmsjHLBr8lrP6TTzRbOUnDjnj8n+0RdNzZRcoAvHOulKxnU30BwCnm5KoR7QLFlBrymxszd2xDsNuld540i4Q4aXhmRIZ5Dg+DwI0XQteb81Fd3wq2dG5RhTzVdbtlE/VHaW2O4VAsDKkOyRfUBhpNBQOVNAtKGabbhD5rx0qi2FC/++axLNYgOgmaQ6CuBWFpTTrG+TfM/ieOsKmsKeLZr5YcDieDnNcKVxyfDzwvlOs6XpN1qROyz73vblcWJdMek0y+mIauv5iZ+PVdM0Oi6QQvFSV9B0ak7gctajso/znWbOSTjN/PvW32isZCq4FbmYd0gFzzPCRiDIGnoZ3CqOpQXPCZxmUBfNvNx984lmvsvMZ772drKMPj1KrVjj6CNHZQ7Ykl9gJ970W4lmS48vIgcb2g2i2Y7v7eDuv72bse1jJ3z8xjVh7mju7Ig+8pxmNSsJhixwEjLymBE92Lx81kM0fTetFsJ15TkYUb8InCoE0IgSzRTzUz4GCGw3Dnqonocl0okRlnkOFh1qU5E7ApboAz1EOFJBKx0IFutzDba+g8p3B53XTjMhILsdgPLYBAjouVRWOipPlecMofQnS4meRJCPq2miZxdk5Uw9JEUoc3b1TDiBPHYeFW9HM5ZyibXrIFzKx/ad0LHIbqc4bUB1gkRfQk50/c9j58EpYlf1ZqdZEJ4pJ4iLCs8sHASnSCWvg5Uj2h4hmpahSKdCNLMnD2INPQaVMSkwdl0r/2DGINRGesAGu0z20AnmBCkdAbeKXfNymbnHoDwSXKvTlpD0ONQKNexSFk1YdCxzoDZ9UnnN/FxTrUWzhuqZhUEAKZpZWYrD062P5zvNIq3dXbPQNMw2uTC2C/KYdqkMwsEMC7SwFEnqotnCJ4aW166P6zRrGZ5ZD8m2shMUpwwwogvLaTazEIDnNGsUE5ZiAubvZHdt6ELTNFzbXXSBmNr4ICAId/SgdV4mBYfaIkM0PTeKMOKe08zEMJCFAEw9qAjo2JAfk+3N769m4YlmMU80K0405OAB9GjCqyRoL37DagaB02yu8EyA+Er5HEvmVmsULYIwr1SJrtW2DNMy4sTTLlpNhpUGicFz534xgCDUO9RwPf2cZp7TzLXdlt+bU/MS54dmiGZmIjhGslte+ybRLO5KR6BPKC3dZ26t5eIrEM30GcJeci3JLgfNylIr1OYMI/XnC53rOgnFQjJtRovFqhsUmWgsBLDA8Ey3RSEAXYZtzlt58yTwc2u1rWwj2h5FM0MIFyrTrUUzXxCIpqPSmcYpcJpZDrg2hglayBfN5HudqGgmhAjEi44LOtBNHSEElQl5v7pzimYlKZrVNFxNnkOTaOZV0AzHZJubVzQbzDT9e75w4JPFf69qvkpluoJd9kQzz2Hmj/snI0IqWjPT0VjJVHCKkwghAmfY6DOjJ3Tsar5KNV9F0zS61svjnxVuM2/tUasmQAsRjgo0TaA5xRMuTHbSOPVNP39epjeKZio8M0CJZor5KR0FwEFa8YOKX5EumYfHrS4ux5VdAiuHEFCrheWuaExAdttxq4fkh/NQy9DXfg8UDlIcf3ZzITybODWHp7/2NEcfOdr6CeVhsDLYNajma+CUSK9OB86puQTFYJFj7iWu7wYxI6TJLkghSgvJiaC/gBYWGnZ9x+EEcxKVxydA2ETbdKKrNgFQGdq/+ANZBaiOUZzSvR34aHN+jrInzLppL9mrN3H3CwH4Oc0WU+Y5s1Web14D4RBNVIh2RIPXL+kuTG435Uc/BnaRUCyEedmfQOfV9b9H+0j3O+CUZ01AF/4eewCw9AGIdEmxYPz+M74QQGm8BFaWaMol2eVIAesEnWau4wYJq+cXzSwoHgIg0ekAguKRwZbHtD1B2Yy2dne1ItQuF712ISN/5+XEyozUw16CHfFFVPmySp5oloy2/Pu8hQCsutOscHQcx5aWfV9sn4+mJPdaWDrNGnKawdLkNWvMqRXrbBDNF0Ft8hgA4f6LILVRhmjWsosUzbwkungTTb96plNC0wUa8rNW8jrFCSlG+PkQZ+M7zWSlQOGH6Sbk59NCSRnOK9yg0MOJ0irv1CziK+T71maLZsH1byuQ7HKJtCfAiEpnrJUF1wqKAZwPFTTdmuc0C88WzQzTCu6LVq47P+fdLKeZpgVus2SnbAvF0SK1bBmciuc0q4dnEk4TjsoQx1q2hYMnEM1muAtT6zFCEEvI17QSMhpF6VhXjORAcs7nBmGgZgun2XxOdQHgSGE4cJqFg2hXYS99OxJCkD0q7+H21Wk0XSPmje3l8dabUr5gH+uMBX3PqQnPtGTFTG8D06/y7KcVWCzVbBXHcuRn7IoR6/DOfSIjjyu8MFDTi/7w2papeznNbHCpPycgCM/0wpBbhbgLAZOPM71X9rn+nG2+cOCTJXMo0/T/Qa7QuLyeQWGVJahGrKgjhAjuh/ZV7XIuUT5KafPfUN5zf7DRPNN1uFB8E0WsK8aK6+UYNfzEWSCaeYUAqtUYaBBOef19Lbv4dDFLhe3NmXynPKBH/HmgKgTQiBLNFPPjiWY2aaBhMRTukgO5U1ncbndF7irYbhohdAh3yF3RzPbjVg8pDB6A7HZ6VhfQa8O4lnNKqhUtJUKIE8rBcei+Qxx+4DDbvrWttTCY3QYgE9UCITNPKB4KcgfMldesOFYEp0pCPEacp8DONYtmVl6GZ+oh4j1xL8Gr1000hGieaDGAyqgMzY319hJbfYX8DCPDQQjCgikelL+mpVstkZoOnBvlyTKUZX4uW0ixd5bTzBu4FlXm2RfNCvI10eg0oXgoGFAW63CZl9F7KOeAcAfRdbdAx5XNf4/0kh6QollhpHBi30d+LwC26IZov1yIjz9MKCpXJ2dqeGZxvAi1LPG0G7i+Sidoy28MfzHiqdlPaMxp5otmA/0AlEaGWzomgoTekYWLZmabPKaVl64GO5+Rj8fCQW4kf5JvFRcuCvntOhRvLZrN6zRzShhhee9nDsnQvERvqjn/2Rzopl532zQ4zTRNCxZaS7Fr6fdd8e543Wm6mLxmTpXatCxwEF5+ObRdJMcjO0ctt4jjeE4zV3iCol89E4HmlNBN+Vknj8iKbcn+5JzFGerhmQJPNQMIqryhR+qVVBdRFKIV9Zxmc4RnQt1p1ko088Mz4xk0Dbo3doBmEkt7Y0Z1ikibVwzgvAjP9EKqWzjNcGvzCoh+iGPLfsPLa5Zol/OdwkiB6pS8JyNJo56rUx6AcNIT5zJTsw7li1noM4TS1Hr5q10et5WQUZqU4c8GRcJHP0uqe+5qm6KFi7Ge02yhTjPvWmhmPUecs/QLyvJkGatURTcgtVzOGeLdfsh367HFn3vGumL1ucepEM1c2xPNPKeZNw74aQUWS/HYMAiXWGcM3dDrgt+EF57piWbBBofnYjTMGtgF7JqGi+znWotm1SDVyizHzNQTiH3/SubphwFYcYMUO05VeKZdsZvSKGQPZetuUE8sMxN+jshzv396Nqnl5UaypmnEOmJSIC0PU87qTD3xQPC87JHsCYkxfp+TGkjRf2U/mq6RPZI9syOQhBvkDqzV5Hge9jc0rVx9E//Zdpo1FDLyv4tgE9nKK6dZA0o0U8xP4DSTk7L6QNoZ5DRblGPAy2dm4Vm+E10Ypgblo4RNrzNplYdjehuFXY+CcEl1OyTSFljZMz6Gfef3dvLzP/v5onbSXMflwK8OANLt07IktxeaWSp5E7x4BuC4ollpvAS1aRIdDvG0C5WxFk6zhvBMTWtynpxs9bvKpJyQR/tXEVt+IRgRyjkXsjsWd6CCvD6FKdmFJaJHg8mfVbawJmW7tdw0QIvqmTkQ7sLLPFenoHwU0ChrlwAQC4+haVrgNluyYgCuBdntVHI6JNYS62mf/ZxoH5GkIJaQ+XEWXbZdiEA0s9xOCHdiJtvAKRKqyO/ijHWajRXBypLocGUbFi6l4WMndCxfNNM00KPziGbCCoTYyMWvwQwLRGWK0ujs6+6HLhuLcJqZ7VI085P8+3nL/JA8qFdNdBZR5csXzcxE61DA1jnN/IIIAjMkX2/lvdxhy7oW/N5BXjPfdeVWwLWWtIJmo2gWhJsvQjQTmW3USgKMKOHuVRDtJZyMgHC9sE0Z3uOXtp8Tv/KU8NxguoYWjgd/Mww52Zw4Iv8+t8uMenhmmwuIQNT1nYaykqpXOGcR+e1aIVoka5+F7zRzcl5eNimUWGUrmNzH41J4XH/7hfRe1suaG7x7qTpRD888D5xmvpDR5NxrCPEOqom2EBDnDM+EoIJmok1+37VijfxRmQsonG6vC0oe4ZS8h2uZ2f2T631/s4o/JC8AdFLpPDi1lkKG766Khw6i5XeRCst5SKvn+iJgY768BVXPFDKnmaaJenimpqH5gtspcJplBjPg1kj1OOixNACxbtmGy3M4VwPRrMFpVs1WlzRZduA0M6k7zfxwwhMRzUpHKT3ySchuJ+H1l3XRTH6HjieIBXN9IyJDfmOywl4po9fDMxtz93nhmZpbqYeZzWznmacpTetY+Sy6ZrH82uWAnK+eiqiR7OGsFGgLg1DLkhnMBI4yv6CKL5q5ljVvu1QsDv/+iLRH0E2deEo6Y0sZnck9YzJfNlIkX/T8lbq7NbUsRTgZDvKmndEhmlYOaaXVqXmVM8Opumh2+pxmDTlZ/X47JtOCUJvC8DZVVSEAJZop5kOIBtHMy6sTrTvN/ApNi8pv5VXOrDly9yqUSkDHVfL/8/eDU5nt+qlOUn3qC1gVgRbpIrn+ahIdDtSmzuhdBcdyOHTfIZyaw+EHDy/4dUOPDzUJMOM7x2ccuAp5mQesFLoJgHh0HIQbJMRuJZoJIeT1qk1LwaHdhco4pfH6c91qgXJOB90M8nRgeL8bchydyILXsRyqmQwA0YELiHbGINxNraThjDwi29tCKRxECCgW5ECZDO/FjJjBoFMelQOn7UrBKXB1mClktyeaBqnj7ux4zj6Sa6nYMjF21BwGIWReM+FSGV2iwTq7A9wa5XIbmIkgfKIJL2SivVdO6Bed16x8TJaQ1yNYTgI0CC27BgAzey8I+R2fiZPI4pB0JsY7dBKrN9QfOwGcSg2EgxESQc6YJvTGBawLoTa0jsuJd0lhpXhw6+xj1nzHyAJzmgFmh1w82OWSDLvzHESNDjHfCWeXFp57xSpJl1I41TqksmX1TE0Hw0uSbHj3heOF4S3rZaEEY4Vm1hdgVn7JrP521Q6EmBMSzYSLfeQ+hAtEuginIqBphLukgFkbH6RWrPHQxx7ioY8/RCU7z3X3wzM90UwP6fX2ZBfQDd9pJvsbP3F4a5qrZwaiWbJe3TUQzQont2nk+uGZxjxOMzMO4U50Qy6a/cWtf50jqQimK8f11NrVXPdn19G2SvbL1CbPL6dZzUva3tJpNn+oqmMd32lmMh2MB5kDUqiMdHbOenogmmVbjAveODur+IMRhcQqUt0y5L3VQrY0UZJ9b0zOSVKxA3NW22wlyOqmbLfzhWcKxwHhNodnQl00c5beAT26dRRci+5VNoTkXDfeLX+Xplrf974oEO+KE06GMUKGzA22hPlNXcsF15KbDp5o5m/u+Lk4F8XEIxSngFqGeFJ+v3WXnC/8e+JcY4hxtFfmLATG9ofmcJp5Y4xTCtKENG2ACxcy25keksdt7y6Q6E1ghAxc2z2hysfHI3MoA5UR4uFDkNslRTPPUeaLZYb3G9c66RyRijp+mgQ/BDcelZuOxYzO5GETKuNBBMiJhGj6Qr0fIj5wtazqPfTE0Emd9ynFy2dGqI1qQd6/kTbvvjmtTrPZ4ZlGske6W90qui0jxFR4phLNFPNRnZClaDUT25EDa6PTzAhxAuGZntPMlRO9cCIMF7wVEqsJh8uQ2UrNE1YCxh+iMC4XrPF1V6P3XEWi04Xq9KIqaFZzVSZ2TTQ/KAQc+xkc/AaUTywh5VxM7p4MwuZGnhpZUJimEIL9v5Q5vnwBbGLnjHPO7ZYhO5FuSrVVMhymrQLFw/M6zaySJXMc1aaJp13iHQYIm/LwsWAhVJ4oIlwwwpGguiYNi7+TcYlUp4vSdWFCqHedDG1MyQpclUNPwbb/D6a2HF88Ey4UDlLOabiRVeiGRiwyCpUJuXAWUBqRu/CWIydEQXimpkHYc27VMsEua2G4MH879kIzSV9OpRQHTScaL0BljGh7BDJbqTz5RZh+etHXZRbTTwFQtleDVt8JbsKrlpbuyYCYnVj3uHguM5IXYle8HFwrbpChX85R8JJ4n3CIphAyZ9r+f5f31xJSOiaF/MSyfuKrpeuvOjV1QiGqTlneJ4ZJEF7ShD5jAZtYA5pGYoV03xQPzHZIBvb26CJEs/Ye0HQcS+AWRnBKntOsQTQLpWRbthYjmnnfn5lItPy77zBrCs+EIBTINMvyfnPkeyZXLl/we/uimWZo6BG/Cm9+yZxmvuslFAsRiofmFc1yx3I89tnHyHmVKBECBv+T2uge6dxqXxaIeeEuGY5YmzjKyJYRHMvBtV1Gtoy0PhEhgvAGR8jvywgZzf2mF55Zq8hrkl6bnvuDeU4zMwKhqFEXzWJ14dOMyXa5mPx2LU/dD6Fr5W5qJL5SmpkaRbOgcmY46C+IyYVLUPGxOlkXis6HQgA1Lzwz3FgIoy6azec0q+eSmVs0ozoRjPFOxRMtu7pnPT3cnvTep4WY5Tt6tBbT/9Q6ulbZYGXJHMzMEoBKkyWoThJvl+0mmc6BnaM4NruCZlAIoNFp5glfvtutJV74pabT1P/6OdiEs7QLSuEKxp4ZBbdG33rL21iDWG8agPLk/AURYp0xGYJ2gjkV58OpVEG4cq49w2kmnEU6o4SA6S2UvJQecZ4Ozh/qIqDjzpjrA0R66LtQfi8Th0ysquwvWoVnYs8hmhUHwSmS8USzjs4hNF0L2vOpCNHMHspCZZyVm2roWg0rM4Zr++5rKYrqkTYZqezaJ12NWOEhXMqD28G1pSgrBHFTrmumJ5dTnNbRauOsfv5q+djB4zi5m44tILON/GFvo2ZA3q9BiObh7CkRYJcELy0M4XRwb/h9NdbpzGk2OzxTD5nQfpn8/5o0fSinmRLNFI0IF/Z/CXZ8VNpIS0fk4/HlDe4JbyANe9Uz3driEmiWfaeZ3GkPJUJyN3HDOwm1pcCpUNv/M3kuIDvIiYcpTOoQW0ZyoA3aLiHRIZMsF48tTOgSQvDopx7l4X96mOEtDa6Uoz+CYz+C8ftg6/vk5y8tzU7FyFMj0onr2pQmSuSPHX9SMLFzgtzRHGbE5Mo/uBKAqf1TzQtMLzST9kspT1Ug3C5dY7ldwQSkOFqcJdKVxmVVyWjSwogmiF54C7oBojwqnW2uTXFKdtbxvvYgL0W9mt7JiWbloUEQLtF2Ey3aIyeafX2QWEu5EJXhj/s+D/u+OL9wVh4Bt0IxI6tIxnvb5QQ7u01OAIVFeboKaNiO55hprObn53+xMiQHkiT7kziWM7et27Ugu1P+f3oTlWwNzJRM1J3fS8wYBCtHpaDBga9ArbXrq5qv1l2UrlVv440INxDeKpZ0vLQWzXoAjXRvGYTVlOx2QXhFAEitD8IwQ6l26JVtwrSOSDPeiYRoZrbB9r+HXR+Hyd/I+2v6mcUfx2p9vxSHpSAaX3kBob5LZNiIlaU0epz8Ti3alC9OGRGz9SJSrtzq/06s9n7J/D/FwweDHBX+ewSOkWjrPGKtMGOhYFFkjzyOlZeTmCAkDzATst061VrrtjMTIbDK8nmhZGvRzBfLmsIzAeJSHDMLj4PjuV41k+TyHhaKf89JAcmz+jdUYjpZ0awxNLPxty+mNbLjuzsYeXqEHd/1RM6jP4Tx+6mVdZnHLF1364R75Hdcmxpn6Kf/KTcpyqMMPT7HuODWgrxjriea6SG9yaGrG95n1QyMsEHb8ra5P1hDO4ymwzI0mLpoChDywnYXk9+u5an7oRjzhWeCFM0MwC4EC/Xg+qc9sdpM1UN7o56Qcw6FZ5YmSjz4kQfnLs4DuJ5opoeaq8d6fwzEhJZOsyCcsYVo1iBC+mO8f19Guma7P0Ntsq+o5WaLqvXqmS2+89QGYu2Czr4sQohZro3SRAmqEzIsXjOJpgQm0whXzHL9B06zpvBMP6fZ3ON7U/ilNltwE/bSimZT+6eoFauEow6dK5y606xXXvNSxp2dczW3h/LgU1IU8MbnU1EMwKl4mzohAlHKiHt9h7AWl2OodBSqE5QyMj9cInIEcnsbzlted0fMCM8EiPaR7JbRCa4IM75bptloVT0TpxwI5U2iWUbOWzOTcgxJdx4DKz9vMYmTJbN/GKwsHcsd2nodmVPZz2HqiWaYSRk1I2zs0tndR50RCAGD36C046cw/TTxjhAUD8oUMprBdOZCQCPVkaXnQtl+jpv+wKcwCDv+gdrTn6F66DFwraD9RFIRujbIe/aMdZsFTrP2FqLZ6XSaeX230RCeGdKhQ+adNiqDgMppBko0UzRy7Kcw+SgU9sGez0JBJlsntiJwcQSFAMwkpiegOaUFhoa5DlQ8B5AtByxfWSfURnjDb4NmYmUmYeIR+Xh+L9QmyU9FIdIldxXMGMlV0g1QPHpoQW89vnWE7J7dkD/A/h8/LDv2kV/B8M/lE5IXAkJ+/m0fgK1/B0M/h9oidkAaEK6QolluF5Hyw1Aekv+e7zVCsO9OGXa56nmrSK9JE+uI4douU/um/CfVQwXbL5WT2HA6EM3i3XF0U8dpUSQhCM1Mu9B+CVrfTTJvTnWK8siEzFcx7eUI623Io9UompkCqlM4pcVPDCvDsj3FutNBDpZYZwwSKyj3/S9Y9nI5SZ5+EsY2z30gL59ZsTQAGiRXeO6XzDa5q2UXZYGESHddNIg1OCnCXmhULYOmaUHlnZaLISsn24mwINyBGxqQC55wO9GkgMzTRKuPAlAuRGTp5gNflt+TcKVYlNlOebrMPX97D5s/uBl7cj9s+XP5c+g7UDxSF3Ty++UxjDjlorzufs60JvQQhDtpH3DALlIcK9YFOacqq4vORUM+MzexLhAvzJgJA7eCFsI0MrI662KdZuVR2PMvUnDXQtKZBXDoPwO30nERLuz7V9jyXnkPNmBXLKrT8p5MrL4IYgPEO00ZKnlY7mSOPjPKxK6GkGbXgaE74Yl3y+M2CE6B0ywyj9Om0W3mfZ7E6nVgRChOWLD1g1IoBDnxrmneMRfuNNMNHcMLu7EP/hx7TIqMjaKZH0ZiVTQprB7PkenW8Nefc4lmczrNlr8a0DDK24KNDsw4CX/BvgB8p5kRNiDkCT4NFTRPdgIWhH90x8G1ibcLcG3KE/kg7BCgMFpgfPsw1DKMP/44hfs/CsN3AlBLvxIi3YGYARDu6AYzQWFSY2LPlByz8nuY2nmwdeiVP+HUTBxHfrYmp5lVwDDs4DnpNenjFFPQ8KdmseqDdadZoi6a+UUB7NLJiWathI2WxFfMcpoFlZhT3jnE+uvPP0OcZkuZJ2nXD3cxtX+Kbd/eNqcr2bW8BXljBcyg/xBE/AT98zjNWuZC9J1mVpZEjzceBKLZwKynh9Np731mt49ANGsVkptaB8Cy9ZPgWrOE4vJ4Tjq0211Y9nI0DVJt0gk/0+3su8ka87v5YuK8Oc08UUwzGpL/g2cHZvFFg47D6NPSZdZ7oYVmhoOQ0FhvB6BRzumIxg0cu4S9/QtYU8cgvyeoshmITy1E+xPFKct7zIjUC8Lo0ZT8X9da3MbD9JMAlMq9EO0n3uHA8M+9jUYoT1sIAY7b4Jb1ifaiadB7oQ1GJGj/LZ1mTrm1OJzdhmtDNjsAoRTpARumnwqcQkvtNLNKFsUjcn3QvqpdFk6qTYJw0Q3Qo75oFq8XVinNcw7lYTnuuicewilqWSbv/TrO0ANgL0E7EUJu8s+xUXtaGL8fxh+gnNPAKRGrPQCTjxPvcGU/ZoQhnKZrpU06uRdN0yhPlecdH4Rt8dTHPsfWf/okojBIYUIHYRMPH22q1L3sapk65VmroilcmHw8WNcel0anmTcGRNr9TfzT6DRzWoRnhgxovwQ0A11Mg11W4ZnAcWZKirOGyjgc/q5cnCTXQepCCHfCzLLic5HbDUM/lf+vh2V1wuKg/Hd8RT3swHeaaZqXSLOMXVhgh10dB1zQI9QqsnNoXKyEOnohsYpaZQ8c+wl0PRcmZJWdQnlVUHUMILH2UuBeSsOjuLYrB+/qlNxNKw9LsSvaDdEBsAvs+8pPIS8XPNNPHWP6p7+ho9cTxFa8FpbdLqvjDf1MCh3lo3D0qBQSB26DgZc25dc4HtMHp6lOjhJijI03V3jmzv2M3B9hwys3zHquEILxHePs+vbDZHc8gWaEWHvj5WiaRvfF3Rx56AjjO8fpuaRHXsPqBGgGtG2kNHkvhNJy5ze/Dw2bRG+C/FCe/LG8XEhaBYj11UWzThfaL5WCQ087xek8pV2/pitUopjxKmf2NiyyfffA1BaM8RJkHZx9x+D693jVNRdGeUSKUtHe+s64LwhV8sCK10i3wuFvw+H/gtQGiC+bfSBPNMvn5Y5lYs0FwEOQ20UsfRs4JRmCEFsWOKVaOs28AWz5c5ez64e7mNg9QXmqLCeR2V1w5L/qbkuA9k1UvIFdj6a9qq/PEE2YYPRQiV0L2s8ht0OGJRYPyu8K2PPwTVilDqxCgQNf/1c23OANUqO/lj/tm+DC/wcyTwEg2jdRnpbttWVOM4DUOsK1R4mHBimJK8kcytBzoQnbPywFqov/T+CMAqA6KcNMs9vBzsuwa30FsFtellhI3vu9NxOKPEYle3hhVUUbOfYTwIW2i2DdH0vhbNsH5HU48kNY8z/mf71wpeg49bj899EfQrQfOmXew9KxY+BUCUUh1LtB7pgP9JI5NkzpyD4mfmPxm4/ciYbFLe9eQWrdRTD+QJDEn6nHZb+46neAGYuSuTDCMok91J1mfUlov4xifhfYQ7Dn09D3Yhi4DcfyRLNFhGcCmD0bcdwQtjOIXW3OuwIQikfAiGPXitKRGR2Q/VL39bMSgQO4tVIg4IWS8+c0m+00WwY9N2NO169duC1R3+RYAL5QLUWzutPMCMv/DxZ8QrQ8/+NRmiiBUyMunoInvkzEtdCn2+XezD2/It7XCaE0gz+ehIl6Oz50f5VLXwKs/B1qgxcDTzWLZqkIdFxJppyHZJV05yS6PcrU6AGGnxhi7YsvaD6RpiS6nlAQ0uubDdmt6EFVTXP+IgAgr8WKV8PQz4nGskDYO3yDaJbwRbM5Fl6uLcfB8jEoHZO/rTykL4PuG4KciL544eeampP4SjRdurt9oa00XgIBCc0LSU+srT/fF3lqk0R6nt2cZo7lMPTYEAfvPkhhpMC177iWnosX7pBsRXGsGAhIVslicPMg6166bvZ7e3mm9KbwzPq1DSdkO5/pNBOug5+qq6XYbiZlXyoskl2OvGecinQFd7QQzdplG6vlZ7ePeUUzMwGxZQxcNMz2x3JMHwhRmiwFeYlKRw8Bgnh/L/S9CI79N72rppjeUWHfnftYft3yoC+p5zRr4RZbiGg2wwmnGaGmvy8FQghGnh4Bt0b/erupCmm0I4ZmhHCdGtXJaaLLPDfqsf+mPFUCUoS0CczCbyB20ympoOkXfTHCDWGq4RS6KR3NTqUCbQscZ6a2YFehandCvI1Eeg9ktxPrHQPhYNcEdlXDwRPNmpxm8v7pW2cxuL3+fk3CWuA0K9XDkH2nmZWH4iDZMQNXTxNOW8TTR2F6C8mB1wFL7zTLHMpAdZx42iV84ctp3/treFL21WZYaygyoUunOc7c1Yizu2Dvv0hXcbhDjvW9Ny9q/otrs/sLn2Hv3VkGNj7B1b/9TbSOTdB1LaQvn5E/9TjYJeniH7tfrlWMBFz83tbz5eOc05xrxPKINBEIR26iLWQtmdsLg98EoFRbDQwTYxuMITf2vUqsRHroXHkMs/QkyYHnkx/KM31wmv4r+mcf0ypw+Juf4ciDU0CYzssuwo5cAPyKZGxQjm+eM77/yn62/udWMocyTf2W/KwWjD8IuV1yfIqtgOSaekqBxSIEHPyqXKNqIVhzB/TcOPfzXUeOyUAhk2BqvzRCxPs6oczJO80qE3J+G+2Btovr9+NCaArPlPeIdMtHIbUBw9wPtUlc64J5DnJ+cFaIZp/97Gf56Ec/yvDwMJdeeimf/OQnufnmm0/3aZ051KZh1z/JXRSQi0QfPSInAh1XQs/zINYnF6blEZmHJNQmn7P/3wEB3TfJRdiufwK8iU18BU5VOlMaB1JpEy8HIU7HY//PnmHo10kue01nkGsnSNCO5zqLDWDVjkBtAkbugqknACjkZQ6nwIq76krM8D3YtSylkVGStV/CxEMt33d6yGDyQBLNCNFzSR9j20Y48FCZq38L6H+JXHiCXBCv/xO5CJraAhMPSoFm6Keys+24UgpneqT+W9Nlp+0LJCt/B7qvZ2TLMBQO0LvRZuCKDrb+okJ2zw5K239K/OLbg3LvdtXmyX99ktHHt0NuN2bI4ZIXTRMf+ThE76Dn4pUceeiIzGvm2lIYBUiuw6oaUtQw4rLSk8jCsZ/Q0R8nP5hh579/g+7/sV+6HFb9HsWROFh5KbC1y1xQ8ZXrYM8WSge3wMoqxak4RPtl5Uwff/FXPophxIEQTn5YOoo2/KkUFebCtWXRgvweKsMyLj7WVx/Yg91Zv/BB3wulky67XbbJS/9y9mBdPEh+QufI0wbokF5/AZhpsDLECz+Aik05p2Pr/cGkrdlplpa/raxMalx7gK6BDJNHYxx9+DDrL98Bw79AxtZqEF8J7RdD/61UDkvxJNrT64WvCqIpAakLqRQjsOp10lU19Zh8Dz1KfqzGkc3bILocrAz7H3JYfd0yIhtfIyc+009Ddits/1Cwi25FNuFY0uHT0mkGsPK3Yfpp0t1TlI4cI3twih73B3UL+N7PwaV/Je/xycfgwH/ICZBPx1VYVbmAMiNm3f0ycBtm5HGwsljHHoONL20dujiT0lBd7Fr5u3Wxdc2bYPcnYexemU+uOilzG7ZfKu89/9hCwMGvy4kaurzm2e1w4EsQ+XNIrKR0SAp8ib72oN3FV6yEx4cp7NnCobueAEdHAM98ez83vukZqceYSei6TgqUI7+UE6WeGxcmmmle2wl3Bo6pZF8SzDhlrsJOb8DM3Aujv0ZMPIHrXWJzsaJZPEI1sQrrgt/F3nsvxEYwu+qTFDNqQnoTtn0M9P1QGYaDX5b93to3B0KIjx/iiWYQirf+fHM6zQBWvBrz0G+Cfyb704v7PJ7TTApInuAz/iBGYSWUNZzBn0LosOw32zZC53NkBb/qpCfU6dBzU92xJYS3mXMYahlKOwZhaoQ4RRCyAmq83aUwpVOaFsTbR7Fzoxx5sg3QuODGCAeeTHNkMM3GjS/HbB+gtk26E5tEs2RYtkkv9+HAS65FP/Rlpo7mGbrvN1I0s8tyg6UyUncjN5ZrDxlSOB75FeT3YlQSgAm6MX8+M59lL4O+FxLd+VPYsQOMWCCUAZhx2W/OEs1ye+Dwd+SYRAthonRYnndsOZgJRE22keM6zSJdaIYsfiGqcmFZmijJJNvRYekyGbit6fkAWDkiSdnG7KqNU3OaF+NLzPDm+3jmK49QY3kg1D71H09xy/tuWZTgO5N9d+5DOBYRc4JqLcWBuw6w9kVrm0UDwPGdZo3hmZqBdA66wbWYKSAKq/5vPdziPDVNVtCsDJNMVwLXbiSho4XbZz093CHDY61iDSFEPdUCIIQvZs3Rp6fWEy0P0bW8xMR4F0OPD7Hupetk4Y0pmQ4jvvYqMGPQtpELrt3JwT0ZCqNRDj9wmDW3rJHv00I08/ObuY4Uq44+fJS2FW2sf8X64Bz9nGUzRb16eObSuTCKo0WKowV0a4yetfV8ZiD7xmg6RHmyRnl8kuiyC+Wid/QeWSwp0k28fRQOfRtS609ReKY/PjWMJXoEw9RwLHDKeWD29z+L8ghUhslPSod6uC2Oufw6mHgYY/i7ROLrqQLlfBQn7m36NOU0k2NL12obIxLFn0W0zmlWd5oF7Ty7HeHCjvv6wQjTdekGNG0LZHeSWi6/1/xwflZbnZdaRgoW4w/JOeK6P24SQLK794NdJL1MQOdzSG/Kwg9kBIMZDTVt1MgckWWcUgvhLrNNzqWELSMhatNyQ/XoDyG5FlIb5WaEl+90LrKPfJN992ZBMxneF2dk1wQDF22B6S1yLdFxFSx/xaxxHJARD/m9UpQq7PMKtDW4aJ0i7P5nuOTPZd8rXLl2MeLSATxz/uZaMPgNOf/sezGs+C25JhFCzuFGflU3TYAUPde+pf75nKo8ZqPQl98P+74AuIiOqym7KyERId7+jMzLF4kS6e6nmq9BpIuuVQLKx+iIP00+ZzP98DH6O3vlOZtx+VsPYe3+L3bdWZHXvv0Sdj46QM+lPRDpJtV9TI53G98NmkakLULn+k4m90wy/MQwF952oTzX0bth5Ndys3gmPc+T83YjKj/nyK/k9e64Qub0aiUWCiHbgGfqQFhw8CuQ3yOP5c99hSsLe00+KtuR5+ja/vMKwo3Tt6mP9LplsJV6YTLXxho/APu2y9eG03Jdmb6sdcNyajJiaviXQZoIGYJzASx/lZxHH4/Gjb9GpxlAxxXoxj4ZYaScZme+aPbtb3+bd7/73Xz2s5/lpptu4gtf+AIve9nL2LFjB6tWrTrdp3f6sXJ1wSzSK4Wdwj7pmhKOTORfHZMLxZFfQmyZXJS4Layw0QFY/XopCK19k1TR0XHDy3AduVhttMKayXZglNJ4FsdyZk0gG9n/y/3s+MF+KBo88s0oyQ1SZW+1WKkZ64EJmW8MQc3pplKOyX7Ac5ppsQES3VGyQ1WKD3yM5AUFZNb05XLgDHfIa1IeZv/jNUgsZ8WLruWC2zYy9sF7GB6eopxeS2zlLbMHOjMBvc+TC7bpLdL1VJuUi/7jceDLMvLz4T1gF+m/yCB8zf+l89JvMLltHyP33skFlV9DxxW4kVU8/m+DjO+aRrdGWHNtlfUvvZBw3JG7IQf+g25zE1id5I4Iak/9C2F7h1zEL39lEJ4UaYtg9lwiO/DhX3DRBo3R+1PkD2vs/LXJZbfZcPg7FHfKBXhioCdYEMbXXgbaVpnnousqSuFuSFKvnAkQX+F9QZ0YA1fDUA3HeVIOEPs+D6t+Tw70jQOza8ldsOE7AxGnkouDFiXaX79vo2m5EAwmmpomC0Ns/aDcQdv+91JcSW2Qnb9r4+SHefJHCRyS9FzSw8A1y2D8lTD4n8TMQbBSlDI6T3zXxipZhJNh4j0Nuy6htPxdOgI7PwrFQ6xYHmby6RjHfvQE67qnZJPouVm630L1iXRlWroNYl1JKaaVDhNbuQnCaSrZCqLnRWilo1A6JAfjruvZ9dFvI8RW+lcMUinoZEZj7N1/O5ddf6W8X4tH5KSs6oUUaiHKzhpghEgqMvd9FU7D6t8j3f9thnYNknn8p9B90Jt0JOV9v/cLchfz6PflaxJr5Hu2XQyJ1dhH5AK4yYkX7iDUtRaODWIf/Ck885DcVbULcrJmF2RfkVglw5oTq+X3duwngICO50BiZf147RdLd8vEw3Ki6ZPfK9v5hW+TYZ1Hv++5CDX5WOdzYPenILdTOrlSGyjtk27F+EBfcJj4yguB33DkGRCuTqR3JY7ew9T0JEf2l1l14wpY8Sp5XxsxGPpvGPw6TDyEc2QYMOZ3hfnhVQ2uvXAqTDQdpZKp8MSdF3DNGy7FOPafOPlpoF3mroosbnj1hV27Bnb4QkjFm8IqzagJRhjHWIu44o/Qxu+TnyW/R94v3ddJocBMQmodVqHsvc6YMxywZfXM4IRSmGtfBtwNQHL57ITj8xGEZ4YMubgAqI5hlAuQD+FMlGGVt6jK7ZQ/Mxn6qRTSIz0weo/sEzxKQ0kQBvHlK2Hjq6BtI/FHfkNh2xilrjWwMcyx+w5gx6dJrOvhkv9zK6P/v3sojhc59kyN1TfXnRD+Du/M/wdYdt069LUvYPtdDzC1fQflo3uJTX1N5sdpJLYcN9eQDyR9GVz61zD4dXTTC99YiNPMx4gSXXMNdISbric0imYN4aJTW2D/v9UnzkZc7sDHVsjfekiK59nt0nkGuHYSMOqhSnOhaeiJPmASUckgXEFpPAfFQbkJs/xVTf2kXPBEwa1gkEE3dVzbpZqvNu/+LyEjv/4RT3z2QYQLsfZJ1rzkRRzZFqYwUmDbN7fxnD98zsIOJORiDs2EaB/lTIWjm5+GzB6ufsMUT/13gtLIWg7fv461L2reeXctL2ytMTxT0+S1d6uEvY8+02nmVOv/NiJzbJJEuqAyTDSex9CrOECkPd5yoe6LZq5VwynXMOP1/s3fN2mZ0wykgD22mWUrdzJxoMrQo3HWvXQd5fEM1KYJRURQaZmOKzBzO9lw/RTbHu5nz0/2sOK6FZhRs8HF2Og0k9fFtQWP/ctjYGUYfqiCdfQxLnlFAi15QZDTbG7RrCQjK1zLC/fyPpuQTkisnFysClcK7uG577eRJw5AZivdKycxI8hxroF4R4TyZJHSWIYOIaRAhkvJ2QhtFxLrdcE9CPv/jbhxE9hlShPHKc7hh9UHAkQFhu+SeXVdB8uKMTaYoPv65+NWZB+uN4pmmibTCZQtnOxRKDpy4YyXEsKtyjHaKsjr03ElTG+hktfY8suVoJukV6dh2dVyw65wgJioUgVKxSRuyFs0N4pmRhhCaQwydF/UweigfNjPTymfU3eahUNFKBygdnQEahdCZht7HogwNdqB2W1yyR3Xw/D9UB4iYexEN3ScmkwpEu8IyzGteFjO0eyinMN0XSvH8Mw2aQzIbKVpY2D7P8h5Q8flAGR2bgUgvW4VmHFSlzwPw9yMY88OgZYbXGXsYoNo5lSkIHfkv+RNk75CRgNMPSG/r8qwnMPk98pxOL4Sem+Rc1XNkCKUEQM9gph4jKe/9hTCNQgvu5Sa1cbWJy26rnMJl5+U64vJR6Rgtezl0H+rnAtNb5HCSbVF+F9smZxjpjfJdDqVYdj1Sei6Rp63lfG+pIicq7VfBp3XyPPa+zm5RgS5Lizsh+WvlBsqfpEodNkX5HbJjblov9wYGb8fDn9PPqX7eumumnhEjs8IiK3A6nsDdu1eiK8gtsqB4lbofA7xngTVfI1EfzuR5ZdC5mnSbfs4XImR2WXDc7bM+ph77o5Sq7WTuvhaHBGnNFniyINHILmWVM8xeX6HvyPbvpVj2eoOJneZDD0xxIXPLUtx0C9UE+6S6zp/LpvfK9tSbpect45trq+NJx6SbTp9ObRtkBFcZkyKtVNPSHENYO1bpZB67MdyjjvxiJxnx1fINup/DwBmitGxSxk7GEE3dS79vUvBHyqcEqGpn8LkLmpVG6Y8ga9ckvPf9OVSkGsUVbM75Trd/3zJC6ULsTIsv9Pdn5RGmFW/2+w881O05PfIz1P1Xt9YCMAXxNs3oZvfAyuHW22Ybwh3YZvp5xhnvGj2iU98gre97W384R/+IQCf/OQn+cUvfsHnPvc5PvzhD5/mszsNWHk50FkZ2dhzu2WHGu6Ci99TnyD4Ewi7KHftxx+UN7AfpqRH5M6lnZfHNGKw7o/qE5Cem6Tyrpk4boMdO1IfSNvX9KBpe8gOjvLAX3yR57wuRqojL29guyh32nuex6Gnwuz45kPSKt3uUrJjQeLypsWK5zqzRC9EehCVcUZ2h9j+m1XS8NMdb6qCmFi+jOzQQYoTNbioEy74f6BtfdPlyg/nGZnYDAnBhbdfRGpZiu6LepnYrXNway+XbJhnV0vT5MI9vUnuyFSnZJiWU5U2baciJ26xftlJ5vfC+P0UHvsqxYNpdAN6n3cbmAn6b3kxk4MOI/sOc8G1U7ijD/HED55ifG8IMyy47o4inVe/QHZuIHM5HfsJEXsrKTNJfiLGxNYMyy4JwYZ3QtsGSvul1TfWFZOuo0g3lI4SiRzjyleXefSHyzh4oJ/kIcH4Y48xfUA6EZNr6yGi8b4u6LyaUiKNuOBFFDM/A9xmp1n7xXDFhyDUjrlnN4QOYPe8ArTvyQXY1vcFCwyMmGxDpWP1wSLUBm0XUzbC0Bkj2p0ODu3vzuaH8kwfmJb5fkJtUjjb+znZXstD0nVoxCF5IbvujZCbTBBeneDKt14pdyZ7b4b0ZcQH7wHtcWoVwdh+AyNq8Nx3PLdJ7A2cZn7opZFg4Oo+tv1ykvy4Q3Y8QfrGN8nvfgZ+TqNoOip35yYeJrLid9G0BxCuoFawiKx9Y/D8qf1TjBxMo7Vt4KIXPEm1FObhn13GoQcnuOClJZmPKbFSOsL2/6scvNObqHiL7zldZj7dN5Je/wjcM0pm/xBScPpD2Ra2f0gK6AWZJ4++F8tBt2GR5YdfNjnxAHPZNbBfYFmDsn858r3m9y0ekpM8gNR66eKaflK+//JXzT7PVa/z8m64UnwyElIQye2Cp/+mPlHRQtI11eUtytb9sQw3rY7B1GMUR2NAmMSKNcGhE8tXQiiFcKrQvoHL/ugllKfL7PivHex8PEzfq15AxPT6sOWvlO1p+knI78WphkFLYLStmPsa+7upDaKZpmk8523P4dFPP8rY9jEe/1Yv1/zR3+Ls+T6wFYxo84JiAfiiyN6f7Q3yAzWKmY2iiW2ZhJa9FDqvhsGvyevY6DAGrAkZChGOzz3M+06zWeGZ/t9XvBjNfAThVEiuWt3yOXN+Hr8QQNiQ99Km90PhAEbHMxDO4LZdAhuulmNXZqv8TsojclIYG5CujtLhIP8YINtH+yWIUJqSk4OOFLFrXw3tUrCJ9yRA0yjlw4i2jQw+NQphhzUvXIema6y+ZTU7/msHg/cOsup5q+rJeGdu3nik16TlPdpxO52rH2XqUIXhH32aC66tyrF22culSGnEIXUhzmNSSAuE7sRKuOT/YvR/Gw4PEhtYEWwULITG0OzGezQUl/2zlc9IIczKys0dhHQsrH693ByYKah0Xy/vw+IguBaifRfUNLT48QVRLd4PTCKqWcrTZUT+ELpmEe3ph94XzHiy54wqH0XL7yISKVMuVamNHSKe7JWLSqcsf2pZKUBWRpED/XK5+eVW5XkWD8vPFWqTP9E+iK+SbUQ4UMsw9sAveOIL2xAurLgywpUvHUPTf0D3ypfywOfGOPbrvfSnf8WyjRU5N9F0uZBMrJHH0yNSHM/vlf2aL4iaSfbf04U7laF7tU3X2ggXXl9h6y8G2f+f/8nqi1+InlouQ2LcGq5X0VKfWY1UD4NbJRLOglOjlqkgpp5Gq40DGm4l7l02Da0hB1gTnntPG3+ARNQmR0MS6RkY8XaMkIZjCWr7/hszPgVWFoERFAia013YcRX0PJ+Bjfez9ZfDZJ+epHD/k7LQinDl/eA7etKXw6FvsXrDQQ4+2U7xaJ79//4EG18URtTKs97HjEfQdBmOGi79hp7VBY7tCHHgF6Blqlz8wp8jjkhnKDPDM71+WEz8hspDD1ArasTahSxgYyal8OAXLWm6bl64Uigpcw9VRuXCUliM3glYGn0bNFj39iANgE+sKwb74NhDu0kmRmgzdqLpJuXQDaCNEVt/C+jDUDxELHMEplKU8wZi7wG0zqvkHDq305unT3lFQzxHW2KN7OsmH5UFNmwY3BJm74MGtbKF+YMfEevwQtyjzSkapDPawtnzVagcx/0RSlMtwsPfTFKsdRJfEefyN18O0Ris+5+w+5+JxafJEKJcjOPEvUXzzPErvhKyGfquWMXooNxsa+k0s3KEh74IpRi1EQee/ismD5nsfSgK6U4uf9Plsg1VfRYVsAAAKAVJREFUr4ZjQ2iHv0HC3EC+3Ethy4+Idz5eDxfzye2UURZmotktlFxXF23ye2DvZ6UwFE6T3TsIQPpS+Z1qkXba1/QwtW88qD7sY3qFVeypfTBqyD5n6vH6vKTzGrm+0A25Nuq+UW5y5vbIc5t+Ws4nB78++/prIQ48bJAdiRDqWs3NH3wtj37qUQojBXY8spIr3/I70kF99CcytcexH8Ox/6bZKewZAlLrZd7B1Pp6FXiAi94NOz4i50lDP/O+j3jdOOGLe0d/EIR5YyRkpM3wLzyB5Z+D82XZ7dD7fNnfjt4Dh74lXzv1uByTfcbubTYTdN8Iq15HeVjOKyNtEYyL/kiKTB1XEO/ezfSBabrWd0ljxtQldISKcP9hMjmB6OlCE2V5fzol8sNFDm6LQcc6Ln3T9dhlm8e/8Ljsw4woyYtuBO6WTjKPgU6NbZNpMtkEpceOyRQ14S6Z8qDz2uZ+JbdHRmBUJ6R4CHJsSa2X52xl5Hjgz3Vnsur3oOcG+f+pdVJULx/1HPEHve8hIcfdzqtxo6vZ/sH7QCuy9sVr5TpLCDkeCodw6VEQKSwrBctuloaB6aelQJd5RgrGPTdJUXX0Hhi7R75HuEvOsTuulGNvdUo6z8bulRFTmWdkX51aBwgYubtpA1J+7ybCTAfh+8H9H+3GSPQARdzMARgqy3bQfolcd55nnNGiWa1W44knnuAv/uIvmh6/7bbbeOih1qF41WqVasOuXS43R4z6WUrx6DCPf/gHzQ8aXXLH4cfPzPPKy8C+UHYCZtLLkeFNqIUABPx0H7Bv1itdRy7GdENvWlylVi/j2t8p8vTPBLkDee77GCQ7Gwfw7Qi2U5gIgXBZf2OVdddXePSeAabkRndTyIS/WLFrDpu/eTHOWIXitA5dXcR6Ylz5+1c2nVfiwsvg8SPs3bKGIxNXgD4EDHnn7FLNVoOcVn2X95FaJhdWF7zkAiZ2TzB4zyDj28dZOG3eTysqIFZA5lKsqcMgbLrXRTBXvQiA/qsG2P7dFUyVVrD5RzXszBClyRJ6MsS1f9BP51WXBpVKAGnT7rgKRn5Jz5qnyY/X2HZXkr17nguRUWA0iHuPd8fl4Lb8lcHLe6+AtWIbB+8+yNZfAcV1aPoh1l1fpe2i+sQw3h0HI0zmaIXNH9iMa7touja7YqM3Yfd3Hw8/XmNs+4vkToeV9bavs96Ph9EjRcy4zEdXmC6A4TYtBJN9ctJfnirzwD8+QCgeqv/debUczKqTcrLrlBEcJD8egUiKK3//SqLtDQvQcAfm+tdirohiVyw0w+Cat19DxwUzdpp90QykELLufxKKdNH34ocZemQvj93TSejxHHBvMIAIIUDUcw1EO6KQvgTSl6IBkfYIlUyFBz/6YJMzrJKVItvKF19L6oWvImWE6Tm6m/Gd4zz4kQebFuiIq6C6AsJprIrcJW1ZObMRTaP9xjeh/dsnKefg3m9fjdY+AUxA+SYp9iIgfSkk+4D7ml7uJ/RtcpoBoUQUEqvYt+8CjhwclvkSzLh0k+gRuZtfy8pJmhgGfggk5cSuay+wl9lc2fxP6zZvYpIDwpBcLXdpjQqwuf489/lSQBEOpSkL2kziq+vieLw3AWl57N7Lehm4egCELOyQO5rjvv/vvubQLLEeimHQQlSrMeg2MTrncS3HBuRE0Qtp9una0MV1f3odj37qUca2jXHPBx7GCK2AzghGNLLwMBMPXxTzK0n1XtZL72X1XUXd1APHzgP/+EC9LxZXQWUgCDfGLkN1DLtWAfRZ320jgdOsVXgm0hliDFyDXaqSWNEibGQBnydwLMQGIDaAviwJBw6zb0uEI/umgCkgCszIByIugMo6Gd7tWlKASqwCPYwQAttIgVGvmgkELqbBzYOMPDVCfjiPETJYeaN0Pq68cSW7f7Sb3NEcmz+wORDBm3JrxkNomoYQIkgsjBFm2QtuZOorm9lzf4Qju5ZJIdAQQN77qffJTQtOTUfvvAjSSTo2LC7nTKNo3iSgptIATB4osfkvv+U9mpD9Wfoi0OabC9QpFjsg7B6nMIFESwwA28kfGuSR//v3ULaId7poa35vlsAByDGjfBQOfYtIJUk5Y/DER7ZghsTs5zbx9ILOHWR4PEBhysB1YOD6y7jyvW9EO/wtGL+PtH4n6zdF2PNglKe/K9jb3rgQbT3fkYf2FqTCoTCVAWDdq66Gq36PlcseY8+DP6Y8mePev/6BLI7jUc7pgDY73Ntzq4aPfR4m2xHAPe99VE7BNL82iby/5+w3/HxAxYMkU3FyhFpWzpTnrxFOhClnqjzyyYeDc5T/NUAz0EJziLeaDmvfSLjrWnrWfYOxPWUe+TffVakTW35Bfe4Y6YLYcvTyMS66ehtP/DDOvntg5GmHck62CT1aX9ybsQjX/nYR29Lo35DFiCToumQZz/y3w/6nNUb3jeFYNqDNdpol+oED7Hkgyp4H44AOwiYUcYmmsmiaASS9TQ5dnqNTRSYMerLlR81PGGDE6XvVH0Dn7E2B9hUJjj4Ko08dYfSpI8TaUoR61lN2ZB8d6+uVm9Wjm4lGjqJpOVzLYfNHd6Gxa+aFBSLejwAOej+A2U9VX0e1HIaojRnLYU8Pkh+V4/PMSsxGagBG9/PY99oJJWRFXg1NfmbNkO1ND0lhx6lSLepUSzqxdcu54T031OdY7RfBmjuItf0XAHsfMKFjUL7HzDDqtW+C4iF6162HH/1afretqmciZLREuIN8xmHzv05TyuoITFY+/xKWXyvzT9F/q9wkmXqcVPIo+SOjPP1Vl3AUMLqlEBBu91KgHPVy0ArQu+RYEF/lhe7bIJ4D2YhXvGwnAihNy3beftm19e/zkiuZ2v8rzLaepo/mF1bZ89N9HLpnj/doCMwOmfcqsRa05k2pOhvAXSMjBoqHPeHWW1N5odCFKQPCaS556yuJd8W54i1X8NBHH+LIQ0fIDGbkPS+ugHKPTE/iVOV3GOuXrv5IZ0MoZBF4avZp2M+DySfk8xKrvcIsmhQga5NQGvZy7AoI9cic0WYc7JfKZPZWVrrX2i+Vjip815cOmU3etZ2SfWP7xVL4LQ7K79CIyfVLtAd4LJhXxrq8TXQv19fq56+mNFFi7YvXyjVL3wtI9QjMzjuxqzabv5JqGouquSoiVaX/in56Lu5BCEHXhi4m90gDQOrKV8KY5eWa6wQjRmT6CTpXTDB5xOWhr6cIdV8g55V6FWjxHbovlm4+KydzgUcH5H0kXiavW2VcGkFq03KtbESkGB5fCUmTprkqz5fff2VcXs9It9yU0XTgKHZ1kNJEiUhbhA2v8MwLmpcCpjhIqO9iSHfihNq5999TaNoxoBusV0qDQmXU+1787yYpXfxtF4Oeo3l+PwDVl8L0U54I/TRNY6vWLudkZkJ+nnAn4mePBX9uvLf1jg3AFrK7d7L5/dsA6FjzFJf/5WvnDUk+FzmjRbOJiQkcx6Gvr6/p8b6+PkZGRlq+5sMf/jAf+MAHno3TOy24ehu5bI+XUyssfyJdMOoACxEIE8gOfWF5yJpe2ZdofqDjSvqedwu3XFbkqR9WGdvrkKuEveSYmhywK2MgHNZco7Hxd5+L1nMD1127ikc//SjZQ1naVtZFKDNmEuuIUZ4uk5tqg+pq9HSYda/ZxLqXrps1iHdeuhG6M9Q0qA2XkZOj2URSETa+amPw795NvaSWpcgP5ckdW2JRVawFywFtjBW33hrEw8e74nRe2MnU/ilyE2FgDXqnzjVvv4buy/taHyu+DC54K/2vOciBnXdSDXdQnQgx83tOr0m3fPnFv30xk3smyR3N0XfDtVx8y6WkOgpyF8Uj2Z/EjJrYFTuoXjRfdTc/PLZWrFErhoDLZXNyK141IAdcF3Tdc5BokKnvGpoRs8nFFu+Oc83br2HosSHGd45jlawZyec9oVKslYJveQSMPGtvu5K+FtdN0zQ6LuhkYtcEV/7+lU2iQ0C0X4ZeGjG5++RNRla/YD1DWyaoFASVwvz3R3p1uunf7avaqWQqstjCDMyIyYZXbYCYnKhe/DsXM/GhCSrZSiCqNZwcUH9s5vu0wmzvI33FDUzvGyWf74cgmW0M7KsADbIpyM7d1v0KVj5+7sBqwaZKD9ADTRFFCWAAnAvkDmvF6487VkBlEfeUuFJO5EJtUIxCsQa0SoLqCZ+G/Ek3hLhF01Hi3XFqxRqb7tgkJ6AaXP6my3nwIw9SyVRaVD1scNZodfG2JWvfIsN0/TxNDXRt6OK5f/pcfvPp39RDjM0YyYEF5JmZQbI/CU/LtnTJ71xC90Wz3T/J/iS5ozkKIzNzryS8Hw/nAqgNgTFGavXcDjH/XmwUnma950A7uaO5BbXFRvw2NXPc8K91NVddQEXFOCDDbcgBuQqN90fb8rYmkdrPF9bYj6y8aWXgYg4nwqy8cSWDmwebqrW1La+PQ5qm0b66ncJIgWXX1kWuZS98MTt/dBjL1rCqy2GkyoybIqDJqdvw795LFyc8xrvjhOIhzKjZNIlNXngxpNbjWHlymbJcNET7gJWwwByjPpqmzfv9B+ey6mI07W5c26U4Ka9tev3yWWJyQPcNgSshNRAiM6ZTyjkyfFS40p2sm7L/NWINOZGKdTeYmfTCPnUpnLpV6UKwC/UwVM0AI0rfDZfxnPe8VubqWnOHzN868SjrX55mbDxEZsQgZ4Xl+wrHC2HLy2MKR56TEZFpLqLd8j3tAsQLdG5YTveLXi5D4wZuZP0bE2z76r0Ui0V5Pm7NEyxCEIqSWDPjmvTcBCO/Rtct2npcchMmxXzS+8yul1OmQmKgc+4voOdGuYGkG3RebTA0VKDtshvmfHrqwnWUnzpAsZSQC1wjKt8r5RJuT2PGjrMh07aBlb/7NsY+82vKCPk9dYZJX9HsxmLlb8PIrxh4XprOvYKpo5CrAgmBFooR629I7m2m6LvmYrmw7L0ZOq9m9dUh3GUH2fatbRTcteAMgzHmhd3XSVx4BfSAFNQMQrEQtXwJyyljWXZ9MSv8zQQAR27u1DLys/vtzBfWOnQ6Ny4jtqx1H7n2FdcRYzvHdrcxdqidMmnKuR7QvPa/Jg2JLrjgLehA21WbyR48Sr446YU8uXKTLtQhBQrNkO3aqci255TkdxPtAw2iXVE2vnojK25YwfBDT7Prqz+mNFEkMdCcIL3zmhvJZgewNLC8j9kScaGch1sjRPo6ueH/vWX2vd57M+2XHoTHtlGtJsALHZ41JobTEE4TAzrXdTK9f7o51NqMQ9f1YBdIrL4V464DODWHnJUDfYTkBf1c9oZN9ecbEVj3h1B6OZ17vs/QrmNUqh1U9GVSAGnq6rvltXJrMkdzQYOCS/NceDXU2up9Q8yhY/2qIJQdoOeayzn4cInkxua2lVx/JTyRpWppVHOe6BjpAdq8veCF9KnePKkJV55zm03PplWsvEluznVe2MmaF67h4N0HyQ81HjsF4jpPeEtACfnD3OubZq6Uv2rAdOMcoVP+CEu2O9IwahNcP3GVPM9KGCoWXquqI1ZDwZI5ipNrIOuLuBtlG3MMmNQ43tqka30Xz/u/z2t6TNM1ei7pYXjLcMsKqkbI4JLflf2ppmlc9vrLeOAfHiC1LIWZSEgxt5FlL2XFq3/D5Jcfo2x0US4koFCa43r5eOkjpqB5bRwGlssfIQBNGgBdvHYx11w3LX+KALPz5F3yO5c0RQ6w8d3glDHDHcT6fk15ujyjXQBcDPZyKAxKQU4PSzGw2AHFuT6fCeJqKfhZOS903ZZjXKwfyo0SUF0XiKajTevtxLprgKdwbEEu2wWRHiKRDeedYAagCd+rfQYyNDTE8uXLeeihh7jhhvrk4O///u/52te+xq5dM3dyWjvNVq5cSTabpa3tOHk7zgLsqh04EZ5t0qvTTYn7GxFCkD2UDZxdAU6NsJmjbf26IJ+F/3yn5jSHzSFzfeSO1jui1LJUs5toxnvmjubqFXoa0HSZFDLWEcOIGLN2b2vFGrkjOU5V8w9FDdrXdDS9r1W2yB7KBu+Z7E/OXRlxBrmjuVl5UEAKMvOJXHbVppKpzCsKlKfLwSLcXzDODNfzEUKQPZxdfFVFj/k+s3C9Y89sQzMwQgYdF3TM+5lr+dqCFoIzaWxPwfH9X96/Q/HQLJHJrtpkDmZatqdEb2JWHp/CaOG4CYONsEHH2rk/ZyMz29Zi0A2djgs6mhblQggyBzPYVXueVzaeQFEuPMOnvo+NpqOzrn+tWMO13Vl9xVJf57mo5qpNAnx6TXrOe2guhCvIHcvRtqJtTreJVbKC0PaFoBs66bXpOfPiCVdQGC2Q7E/O+Z52xaZWOLH7qTBSIN4Tb3IoL7ptzUOrMSl3LBeIcbqp07G2uW27tsv0wWlc2wuBbo8GLmQfq2zhVJ1ZoZSlyVJLYbwR3fTup8bP7AoKIwWSA3Nf57moZCropt7sSmVhbXshxLvjzTks56F4bJTSqHRn64ZO+qJ18xfR8HBtl+kD00GeqxOtmBoghMzZZITBiMhxcG163jacGWzdPx8PTdNIr0k3LXJmtWHXkWKIphFOhue9h+2qTe5IFjRNOpmF52R2bNrXdM05x2r++ILC8Pztab4xqW15G5EFVF2cOd4fr6+ceZ0TPYkF9xuN7Vk3dDou7JjVb+SO5gjFQkQ7okEerNJESTpSTvC7nW++470xaJr8bIcygfs8koqQWp5qnuMtsn9uRDd00mvSTYtVt2ZRODxI6oIL0fTmcMlKpiI3B8pWvRLxPHSs7WheqDcgXJfs3n1YjnR2hWIh2le3n9SYUJ4qUxhtmFeuap93/bBUY4JPq/f075tEX2JW/zx9cHpB1/GEzkXX6Fjb0fTdClcwtX8qGIfONVqNvXNhV71+w20xf27Rh5Sny5gRc/Hr0TOAUDw07wbkzDXwLISQZpRwup5OaYlpW9EWVMD1KR4+TCnjBIWZwokw7asWvzl8ppLL5Whvbz+uVnRGi2a1Wo14PM53v/tdXvva1waPv+td7+Kpp55i8+bN87xastALoVAoFAqFQqFQKBQKhUKhOPdZqFZ0Rpc+CIfDXH311dx1111Nj991113ceOONc7xKoVAoFAqFQqFQKBQKhUKhODnO6JxmAO95z3t485vfzDXXXMMNN9zAF7/4RQ4fPszb3/72031qCoVCoVAoFAqFQqFQKBSKc5QzXjR7/etfz+TkJB/84AcZHh7msssu42c/+xmr50lurFAoFAqFQqFQKBQKhUKhUJwMZ3ROs6VA5TRTKBQKhUKhUCgUCoVCoVD4nBM5zRQKhUKhUCgUCoVCoVAoFIrTgRLNFAqFQqFQKBQKhUKhUCgUihko0UyhUCgUCoVCoVAoFAqFQqGYgRLNFAqFQqFQKBQKhUKhUCgUihko0UyhUCgUCoVCoVAoFAqFQqGYgRLNFAqFQqFQKBQKhUKhUCgUihko0UyhUCgUCoVCoVAoFAqFQqGYgRLNFAqFQqFQKBQKhUKhUCgUihko0UyhUCgUCoVCoVAoFAqFQqGYgRLNFAqFQqFQKBQKhUKhUCgUihmYp/sETjVCCAByudxpPhOFQqFQKBQKhUKhUCgUCsXpxteIfM1oLs550SyfzwOwcuXK03wmCoVCoVAoFAqFQqFQKBSKM4V8Pk97e/ucf9fE8WS1sxzXdRkaGiKVSqFp2uk+nSUhl8uxcuVKjhw5Qltb2+k+HYViTlRbVZztqDasONtRbVhxLqHas+JsR7VhxbnAudKOhRDk83mWLVuGrs+dueycd5rpus6KFStO92mcEtra2s7qRqo4f1BtVXG2o9qw4mxHtWHFuYRqz4qzHdWGFecC50I7ns9h5qMKASgUCoVCoVAoFAqFQqFQKBQzUKKZQqFQKBQKhUKhUCgUCoVCMQMlmp2FRCIR3ve+9xGJRE73qSgU86LaquJsR7VhxdmOasOKcwnVnhVnO6oNK84Fzrd2fM4XAlAoFAqFQqFQKBQKhUKhUCgWi3KaKRQKhUKhUCgUCoVCoVAoFDNQoplCoVAoFAqFQqFQKBQKhUIxAyWaKRQKhUKhUCgUCoVCoVAoFDNQoplCoVAoFAqFQqFQKBQKhUIxAyWaLREf/vCHufbaa0mlUvT29vJbv/Vb7N69u+k5Qgje//73s2zZMmKxGC94wQvYvn1703O++MUv8oIXvIC2tjY0TSOTycx6ryeffJJbb72VdDpNV1cXf/zHf0yhUDjuOW7dupVbbrmFWCzG8uXL+eAHP0hjHYjh4WHuuOMONm7ciK7rvPvd7z6ha6E4szkX2uoDDzzATTfdRFdXF7FYjIsuuoh/+qd/OrELojjrOBfa8L333oumabN+du3adWIXRXFWcS604be+9a0t2/Cll156YhdFcdZyLrRngH/5l3/h4osvJhaLsXHjRr761a8u/mIozkrO9DZcqVR461vfyqZNmzBNk9/6rd+a9Ry1jlMsRTuempriT//0T9m4cSPxeJxVq1bxZ3/2Z2Sz2abjTE9P8+Y3v5n29nba29t585vf3LK9z+Rs1SOUaLZEbN68mXe84x088sgj3HXXXdi2zW233UaxWAye85GPfIRPfOITfOYzn+Gxxx6jv7+fW2+9lXw+HzynVCpx++2381d/9Vct32doaIiXvOQlrFu3jkcffZQ777yT7du389a3vnXe88vlctx6660sW7aMxx57jE9/+tN87GMf4xOf+ETwnGq1Sk9PD3/913/NFVdccXIXRHHGci601UQiwTvf+U7uu+8+du7cyd/8zd/wN3/zN3zxi188uYujOCs4F9qwz+7duxkeHg5+1q9ff2IXRXFWcS604X/+539uartHjhyhs7OT173udSd3cRRnHedCe/7c5z7HX/7lX/L+97+f7du384EPfIB3vOMd/OQnPzm5i6M4KzjT27DjOMRiMf7sz/6Ml7zkJS2fo9ZxiqVox0NDQwwNDfGxj32MrVu38uUvf5k777yTt73tbU3vdccdd/DUU09x5513cuedd/LUU0/x5je/ed7zO6v1CKE4JYyNjQlAbN68WQghhOu6or+/X/zDP/xD8JxKpSLa29vF5z//+Vmvv+eeewQgpqenmx7/whe+IHp7e4XjOMFjW7ZsEYDYu3fvnOfz2c9+VrS3t4tKpRI89uEPf1gsW7ZMuK476/m33HKLeNe73rXQj6s4iznb26rPa1/7WvGmN73puJ9Xce5xNrbhud5TcX5yNrbhmfzgBz8QmqaJwcHBBX1mxbnL2dieb7jhBvHe97636XXvete7xE033bTwD644ZzjT2nAjv//7vy9e85rXzPsctY5TCHHy7djnO9/5jgiHw8KyLCGEEDt27BCAeOSRR4LnPPzwwwIQu3btmvM4Z7MeoZxmpwjfwtjZ2QnAwYMHGRkZ4bbbbgueE4lEuOWWW3jooYcWfNxqtUo4HEbX619dLBYDZMjaXDz88MPccsstRCKR4LGXvvSlDA0NMTg4uOD3V5x7nAttdcuWLTz00EPccsstCz4/xbnD2dyGr7rqKgYGBnjxi1/MPffcs+BzU5xbnM1t2Off//3feclLXsLq1asXfH6Kc5OzsT1Xq1Wi0WjT62KxGL/5zW+wLGvB56g4NzjT2rBCcSIsVTvOZrO0tbVhmiYg+9T29nauu+664DnXX3897e3t8x7nbNYjlGh2ChBC8J73vIfnPe95XHbZZQCMjIwA0NfX1/Tcvr6+4G8L4UUvehEjIyN89KMfpVarMT09HViAh4eH53zdyMhIy/duPDfF+cfZ3lZXrFhBJBLhmmuu4R3veAd/+Id/uODzU5wbnK1teGBggC9+8Yt873vf4/vf/z4bN27kxS9+Mffdd9+Cz09xbnC2tuFGhoeH+fnPf676YMVZ255f+tKX8m//9m888cQTCCF4/PHH+dKXvoRlWUxMTCz4HBVnP2diG1YoFstStePJyUn+7u/+jv/5P/9n8NjIyAi9vb2zntvb2zvv/XA26xFKNDsFvPOd7+SZZ57hm9/85qy/aZrW9G8hxKzH5uPSSy/lK1/5Ch//+MeJx+P09/dzwQUX0NfXh2EYwXOSySTJZJKXvexl8753q8cV5w9ne1u9//77efzxx/n85z/PJz/5yZafQ3Fuc7a24Y0bN/JHf/RHPOc5z+GGG27gs5/9LK94xSv42Mc+tuDzU5wbnK1tuJEvf/nLpNPplsmpFecXZ2t7/tu//Vte9rKXcf311xMKhXjNa14T5Jnyj604PzhT27BCsRiWoh3ncjle8YpXcMkll/C+971v3mPMPM65pkeYp/sEzjX+9E//lB//+Mfcd999rFixIni8v78fkCrqwMBA8PjY2NgsxfV43HHHHdxxxx2Mjo6SSCTQNI1PfOITrF27FoCf/exngZXct/z29/fPUnDHxsaA2Wqz4vzgXGir/nE2bdrE6Ogo73//+3nDG96wqHNUnL2cC224keuvv56vf/3rizo/xdnNudCGhRB86Utf4s1vfjPhcHhR56Y4tzib23MsFuNLX/oSX/jCFxgdHQ3cwKlUiu7u7kWdo+Ls5UxtwwrFYliKdpzP57n99ttJJpP84Ac/IBQKNR1ndHR01vuOj48HxznX9AjlNFsihBC8853v5Pvf/z5333130PH5rF27lv7+fu66667gsVqtxubNm7nxxhtP6D37+vpIJpN8+9vfJhqNcuuttwKwevVq1q1bx7p161i+fDkAN9xwA/fddx+1Wi14/S9/+UuWLVvGmjVrTuj9FWcn52pbFUJQrVZP6PwUZxfnahvesmVL0yRGce5yLrXhzZs3s2/fvlmVtRTnD+dSew6FQqxYsQLDMPjWt77FK1/5yqb8U4pzkzO9DSsUC2Gp2nEul+O2224jHA7z4x//eFa+xxtuuIFsNstvfvOb4LFHH32UbDYbHOec0yOehWID5wV/8id/Itrb28W9994rhoeHg59SqRQ85x/+4R9Ee3u7+P73vy+2bt0q3vCGN4iBgQGRy+WC5wwPD4stW7aIf/3XfxWAuO+++8SWLVvE5ORk8JxPf/rT4oknnhC7d+8Wn/nMZ0QsFhP//M//PO/5ZTIZ0dfXJ97whjeIrVu3iu9///uira1NfOxjH2t63pYtW8SWLVvE1VdfLe644w6xZcsWsX379iW6SoozgXOhrX7mM58RP/7xj8WePXvEnj17xJe+9CXR1tYm/vqv/3oJr5TiTOVcaMP/9E//JH7wgx+IPXv2iG3btom/+Iu/EID43ve+t4RXSnGmci60YZ83velN4rrrrluCq6I4WzkX2vPu3bvF1772NbFnzx7x6KOPite//vWis7NTHDx4cOkulOKM5Uxvw0IIsX37drFlyxbxqle9SrzgBS8I1myNqHXc+c1StONcLieuu+46sWnTJrFv376m49i2HRzn9ttvF5dffrl4+OGHxcMPPyw2bdokXvnKV857fmezHqFEsyUCaPnzH//xH8FzXNcV73vf+0R/f7+IRCLi+c9/vti6dWvTcd73vvcd9zhvfvObRWdnpwiHw+Lyyy8XX/3qVxd0js8884y4+eabRSQSEf39/eL973//rPKurd579erVJ3pZFGcg50Jb/dSnPiUuvfRSEY/HRVtbm7jqqqvEZz/72aYS3opzl3OhDf/jP/6juPDCC0U0GhUdHR3iec97nvjpT396UtdFcfZwLrRhIeQEOBaLiS9+8YsnfC0UZz/nQnvesWOHuPLKK0UsFhNtbW3iNa95jdi1a9dJXRfF2cPZ0IZXr17d8tjH+xxqHXf+sBTt+J577pnzOI2bCJOTk+KNb3yjSKVSIpVKiTe+8Y1ienr6uOd4tuoRmndiCoVCoVAoFAqFQqFQKBQKhcJDBekrFAqFQqFQKBQKhUKhUCgUM1CimUKhUCgUCoVCoVAoFAqFQjEDJZopFAqFQqFQKBQKhUKhUCgUM1CimUKhUCgUCoVCoVAoFAqFQjEDJZopFAqFQqFQKBQKhUKhUCgUM1CimUKhUCgUCoVCoVAoFAqFQjEDJZopFAqFQqFQKBQKhUKhUCgUM1CimUKhUCgUCoVCoVAoFAqFQjEDJZopFAqFQqFQKBQKhUKhUCgUM1CimUKhUCgUCsVZxFvf+lY0TUPTNEKhEH19fdx666186UtfwnXdBR/ny1/+Mul0+tSdqEKhUCgUCsVZjhLNFAqFQqFQKM4ybr/9doaHhxkcHOTnP/85L3zhC3nXu97FK1/5SmzbPt2np1AoFAqFQnFOoEQzhUKhUCgUirOMSCRCf38/y5cv5znPeQ5/9Vd/xY9+9CN+/vOf8+UvfxmAT3ziE2zatIlEIsHKlSv5X//rf1EoFAC49957+YM/+AOy2WzgWnv/+98PQK1W48///M9Zvnw5iUSC6667jnvvvff0fFCFQqFQKBSK04gSzRQKhUKhUCjOAV70ohdxxRVX8P3vfx8AXdf51Kc+xbZt2/jKV77C3XffzZ//+Z8DcOONN/LJT36StrY2hoeHGR4e5r3vfS8Af/AHf8CDDz7It771LZ555hle97rXcfvtt7N3797T9tkUCoVCoVAoTgeaEEKc7pNQKBQKhUKhUCyMt771rWQyGX74wx/O+tv/+B//g2eeeYYdO3bM+tt3v/td/uRP/oSJiQlA5jR797vfTSaTCZ6zf/9+1q9fz9GjR1m2bFnw+Ete8hKe+9zn8qEPfWjJP49CoVAoFArFmYp5uk9AoVAoFAqFQrE0CCHQNA2Ae+65hw996EPs2LGDXC6HbdtUKhWKxSKJRKLl65988kmEEGzYsKHp8Wq1SldX1yk/f4VCoVAoFIozCSWaKRQKhUKhUJwj7Ny5k7Vr13Lo0CFe/vKX8/a3v52/+7u/o7OzkwceeIC3ve1tWJY15+td18UwDJ544gkMw2j6WzKZPNWnr1AoFAqFQnFGoUQzhUKhUCgUinOAu+++m61bt/K///f/5vHHH8e2bT7+8Y+j6zKF7Xe+852m54fDYRzHaXrsqquuwnEcxsbGuPnmm5+1c1coFAqFQqE4E1GimUKhUCgUCsVZRrVaZWRkBMdxGB0d5c477+TDH/4wr3zlK3nLW97C1q1bsW2bT3/607zqVa/iwQcf5POf/3zTMdasWUOhUODXv/41V1xxBfF4nA0bNvDGN76Rt7zlLXz84x/nqquuYmJigrvvvptNmzbx8pe//DR9YoVCoVAoFIpnH1U9U6FQKBQKheIs484772RgYIA1a9Zw++23c8899/CpT32KH/3oRxiGwZVXXsknPvEJ/vEf/5HLLruMb3zjG3z4wx9uOsaNN97I29/+dl7/+tfT09PDRz7yEQD+4z/+g7e85S38n//zf9i4cSOvfvWrefTRR1m5cuXp+KgKhUKhUCgUpw1VPVOhUCgUCoVCoVAoFAqFQqGYgXKaKRQKhUKhUCgUCoVCoVAoFDNQoplCoVAoFAqFQqFQKBQKhUIxAyWaKRQKhUKhUCgUCoVCoVAoFDNQoplCoVAoFAqFQqFQKBQKhUIxAyWaKRQKhUKhUCgUCoVCoVAoFDNQoplCoVAoFAqFQqFQKBQKhUIxAyWaKRQKhUKhUCgUCoVCoVAoFDNQoplCoVAoFAqFQqFQKBQKhUIxAyWaKRQKhUKhUCgUCoVCoVAoFDNQoplCoVAoFAqFQqFQKBQKhUIxAyWaKRQKhUKhUCgUCoVCoVAoFDP4/wOsoEP/vcRkyAAAAABJRU5ErkJggg==", + "text/plain": [ + "
" + ] + }, + "metadata": {}, + "output_type": "display_data" + } + ], + "source": [ + "# Plot datasets\n", + "plt.plot(daily_neon_prect['time'], daily_neon_prect, label=\"NEON\", color=\"orange\", alpha=0.6)\n", + "plt.plot(prism_times,prism_precip_vals, label='PRISM', color='purple', alpha=0.6)\n", + "plt.rcParams[\"figure.figsize\"] = (15,5)\n", + "plt.xlabel('Date')\n", + "plt.ylabel('Precip (mm)')\n", + "plt.title(\"NEON and PRISM Daily Precipitation at {} {}\".format(site, year))\n", + "plt.legend()\n", + "plt.show()" + ] + }, + { + "cell_type": "markdown", + "id": "d04393f4-0b04-4d76-8c7e-6c748edc4d16", + "metadata": {}, + "source": [ + "### Calendar year cumulative precipitation plot" + ] + }, + { + "cell_type": "code", + "execution_count": 94, + "id": "73c6da42-f8c9-4128-a46d-4de9b88020ea", + "metadata": { + "tags": [] + }, + "outputs": [], + "source": [ + "# Sum PRISM precip values over the course of the year\n", + "cumulative_prism_precip_vals=[]\n", + "for index in range(start_index[year][site], start_index[year][site]+365):\n", + " cumulative_val = np.sum(prism_precip_vals.loc[:index])\n", + " cumulative_prism_precip_vals.append(cumulative_val)\n", + "\n", + "# NEON data is in different format\n", + "daily_neon_prect_array = daily_neon_prect.compute()\n", + "cumulative_daily_neon_prect = []\n", + "for index in range(0,365):\n", + " cumulative_val = np.sum(daily_neon_prect_array[:index])\n", + " cumulative_daily_neon_prect.append(cumulative_val)" + ] + }, + { + "cell_type": "code", + "execution_count": 86, + "id": "dd1faf82-5cf9-472f-a970-4420272d3f06", + "metadata": { + "tags": [] + }, + "outputs": [ + { + "data": { + "image/png": "iVBORw0KGgoAAAANSUhEUgAABN8AAAHUCAYAAAAKkI7ZAAAAOXRFWHRTb2Z0d2FyZQBNYXRwbG90bGliIHZlcnNpb24zLjcuMSwgaHR0cHM6Ly9tYXRwbG90bGliLm9yZy/bCgiHAAAACXBIWXMAAA9hAAAPYQGoP6dpAACcNUlEQVR4nOzdeZyNdf/H8dfZZl+Y3TD2fYvsWihrd2gR3VG3ULlTuScUSqFfiPaUurVpQ6koUtEdWuykQpRtEGMss5j9zJzr98cxh2MGM8w4Z8b7+Xhcj+uc6/qe6/qc2Yz3fBeTYRgGIiIiIiIiIiIiUurMni5ARERERERERESkolL4JiIiIiIiIiIiUkYUvomIiIiIiIiIiJQRhW8iIiIiIiIiIiJlROGbiIiIiIiIiIhIGVH4JiIiIiIiIiIiUkYUvomIiIiIiIiIiJQRhW8iIiIiIiIiIiJlROGbiIiIiIiIiIhIGVH4JiIiZWr27NmYTCbXZrVaqVatGoMHD+bvv/92tVuxYoVbO4vFQmRkJL1792bDhg2Frnv33XcTFBTkdsxut/Pf//6XNm3aEBYWRkBAADVq1OCmm25iwYIFrnZ79+513WfixIlF1j1kyBBXG29Ss2ZN7r777vO2K6j9mWeeKXSu4HNy+sd14sSJbh//M7e9e/e6XePYsWOMGzeOxo0bExAQQEhICO3bt+e1117DbrdfdD3nsnv3bh588EHq16+Pv78/AQEBNGnShPHjx7t9TXmjgvd65sezOFatWsXEiRNJSUkpdK5z58507tz5ousrqbvvvtvt68TX15cGDRowYcIEsrOzL3k9xf3+KErB98DpZs6cyezZsy+qpilTprBw4cJCxwt+5q1YseKirl+WzvU1V5SCj+HRo0fdju/atYvatWsTHR3N5s2bXce/+eYbbrzxRiIjI/H19SUuLo5Bgwaxbdu2s147KiqKEydOFDpfs2ZNevXq5Xp+5tdmUVvNmjXP+X4u5vu1KGlpaUyePJnOnTsTExNDUFAQzZo1Y9q0aUV+v9jtdiZNmkTNmjXx9fWlYcOGzJgxo1C7rVu3Mnz4cDp06EBgYOA5v65OnDjBiBEjqFq1Kr6+vtSvX5/p06eTn59fKu9RRESKpvBNREQuiXfffZfVq1ezbNky7r33XubOncs111xDRkaGW7spU6awevVqVqxYwRNPPMGqVavo1KkTf/3113nvcdddd/HQQw9x3XXX8eGHH7Jo0SLGjx+P1Wrl22+/LdQ+ODiY2bNn43A43I6np6czf/58QkJCLu5Ne4FnnnmG48ePF7v9N998w+rVqwttVapUcbXZvn07LVu25L///S8DBw7kq6++Yt68eVx55ZX85z//oVu3bmRmZpZKPWdavHgxzZs3Z/Hixdx3330sXrzY9XjRokVu//muaFatWsWkSZOKDEJmzpzJzJkzL31RgL+/v+vrZOHChbRr146nnnqKQYMGXfJaFixYwBNPPHFBr73nnntYvXq127GyDN+uvPJKVq9ezZVXXnlR1y9L5/qaK67ff/+da665hvz8fH766SdatGgBwKOPPsoNN9yAw+Fg5syZLFu2jAkTJrB+/XquvPJKPv/88yKvd+TIEaZPn37e+z7xxBNF/ixbvXo1w4YNA+CWW2455zVuvPHGQj//Lsa+fft46aWXuPLKK5k1axZffvklt912GxMnTqRXr14YhuHWfvjw4UydOpUHHniAb7/9lltuuYX//Oc/TJkyxa3dhg0bWLhwIWFhYXTp0uWs98/Ly6Nbt258+OGHPPbYYyxevJjevXszduxYHn744VJ5jyIichaGiIhIGXr33XcNwFi/fr3b8SeeeMIAjA8//NAwDMNYvny5ARjz5893a/fee+8ZgPHkk0+6HR80aJARGBjoer579+4i2xXIz893Pd6zZ48BGPfcc48BGEuXLnVr+9Zbbxn+/v7GnXfeaXjbP5U1atQwBg0adN52gNG1a1fDarUaI0eOdDtX1OdkwoQJBmAcOXLknNfNy8szGjdubISGhho7duwodH7evHkGYAwbNuyi6inK7t27jcDAQKNly5ZGSkpKofMOh8P47LPPznkNTyt4r3v27Cnxa5999tkLfm1ZOfP7sMA111xjAMaBAwfO+trMzMyyLK1UNGnSxOjUqdNFXSMwMLBY37PeqKRfc2f+HFm9erVRuXJlo2HDhsb+/ftd7ebMmWMAxv3331/oGunp6UarVq2MgIAAY9euXYWu3bNnTyMwMNA4dOiQ2+tq1Khh3HjjjeetcfXq1YaPj49x7bXXGna7vVjvq7Skp6cb6enphY4XfJx//PFH17EtW7YYJpPJmDJlilvbe++91/D39zeOHTvmOnb6v2/z5883AGP58uWF7jN37lwDKPRz8r777jPMZrOxffv2C31rIiJyHur5JiIiHtG+fXsAEhISztmudevWABw+fPic7Y4dOwZw1h4KZnPhf/IaNGhAx44deeedd9yOv/POO9x6662Ehoae854FNmzYwD//+U9q1qyJv78/NWvW5I477ij03gqGMC1fvpz777+fiIgIwsPDufXWWzl48KBbW7vdzqOPPkpMTAwBAQFcffXVrFu3rlj1nP7+hg4dymuvvXbej3NxLViwgG3btjF27Fjq169f6Pztt99O9+7defvtt0lMTCzVel544QUyMjKYOXNmkZ8bk8nErbfe6np+tiGIZw7RLBj+N2fOHMaMGUOVKlUICgqid+/eHD58mBMnTnDfffcRERFBREQEgwcPJj093fX6gmHMRfWQOtfQ5gLLli3jpptuolq1avj5+VG3bl2GDRvmNnRv4sSJPPLIIwDUqlXLNWyuYGjZ6e/JbrcTFRXFXXfdVeheKSkp+Pv7M3LkSNextLQ0Ro8eTa1atfDx8aFq1arEx8cX6pVaEmd+fxcMCfz8889p2bIlfn5+TJo0CYDExESGDRtGtWrV8PHxoVatWkyaNIm8vDy3a+bk5PDUU0/RqFEj/Pz8CA8P57rrrmPVqlWuNmd+zgs+tx9++CEjR44kJiYGf39/OnXqxC+//OJ2/TOHndasWZOtW7eycuXKQsMUs7OzGTVqFC1atCA0NJSwsDA6dOjAF1984XZNk8lERkYG7733nusaBZ+nsw07/fLLL+nQoQMBAQEEBwfTrVu3Qj3yCmrdunUrd9xxB6GhoURHRzNkyBBSU1PP+/kpja+54tyja9eu1KlThx9//JFq1aq5zk2ePJnKlSvz3HPPFXpdYGAgM2bMIDMzkxdffLHQ+aeffpq8vLzzfl8VJTExkb59+xIZGcknn3yC1Wo9Z/uihp127tyZpk2bsn79eq655hoCAgKoXbs2zzzzTKFe1EW9t8DAwELH27ZtC8D+/ftdxxYuXIhhGAwePNit7eDBg8nKyuKbb75xHSvq37ei/Pzzz5hMJm644Qa347169cLhcLhNzyAiIqVL4ZuIiHjEzp07AYiMjDxnuz179gAUGfScrlGjRlSqVIlJkyYxa9asYs/RM3ToUBYuXEhycjIAO3bsYNWqVQwdOrRYrwdn+NKgQQNeeuklvv32W6ZNm8ahQ4do06ZNobmPwDm8zWazMWfOHKZPn86KFSu488473drce++9PPfcc/zrX//iiy++oG/fvtx6662uOotr4sSJWCyWYg/Fy8/PJy8vz207fS6gZcuWAXDzzTef9Ro333wzeXl5Rf4nvaT1nG7p0qVER0e7gp3S9thjj5GUlMTs2bN5/vnnWbFiBXfccQd9+/YlNDSUuXPn8uijj/LBBx/w2GOPldp9d+3aRYcOHXj99ddZunQpTz75JGvXruXqq692zZ93zz338NBDDwHw+eefu4bPFTVk0Wazceedd/LZZ5+Rlpbmdm7u3LlkZ2e7/kOfmZlJp06deO+99xgxYgRff/01Y8aMYfbs2fTp06fQMLjiKur7e9OmTTzyyCOMGDGCb775hr59+5KYmEjbtm359ttvefLJJ/n6668ZOnQoU6dO5d5773W9Ni8vjxtuuIH/+7//o1evXixYsIDZs2fTsWNH9u3bd956HnvsMXbv3s1bb73FW2+9xcGDB+ncuTO7d+8+62sWLFhA7dq1admypevjXRBO5OTkcPz4cUaPHs3ChQuZO3cuV199Nbfeeivvv/++6xqrV6/G39+ff/zjH65rnGt48Jw5c7jpppsICQlh7ty5vP322yQnJ9O5c2d++umnQu379u1L/fr1+eyzzxg7dixz5swp1vDB0v6aO9Nnn31Gr169aNOmDd9//z0RERGuc4cOHWLr1q10796dgICAIl/foUMHoqKiXD9vTlejRg2GDx/O22+/zZ9//nneWgrY7Xb69evH0aNH+fTTT4mOji72a8+UmJjIwIEDufPOO/nyyy+54YYbGDduHB9++OEFXe/7778HoEmTJq5jW7ZsITIykpiYGLe2zZs3d50vqdzcXMxmMzabze24r68vAL/99luJrykiIsXk6a53IiJSsRUMs1uzZo1ht9uNEydOGIsXLzYiIyON4OBgIzEx0TCMU8NOP/74Y8NutxuZmZnGzz//bDRo0MBo3LixkZyc7Hbdooa7ffXVV0ZERIQBGIARHh5u9OvXz/jyyy/d2hUMO3322WeNEydOGEFBQcarr75qGIZhPPLII0atWrUMh8NhPPDAAxc07DQvL89IT083AgMDjZdffrnQx2L48OFu7adPn24ArmFUf/zxhwEYDz/8sFu7jz76yACKPez0gQceMAzDMB5//HHDbDYbv/76q1sdRQ07LWqrU6eOq13Pnj0NwMjOzj7rvb/++msDMKZNm3bB9RTFz8/PaN++/Xnfe4GzDdHt1KmT21DCgq+93r17u7WLj483AGPEiBFux2+++WYjLCzM9bzg6+ndd98tdC/AmDBhguv5+YadOhwOw263GwkJCQZgfPHFF65z5xoCeOZ7+u233wzAmDVrllu7tm3bGq1atXI9nzp1qmE2mwt97D/99FMDMJYsWVJknQUKvg/tdrtht9uNI0eOGC+//LJhMpmMNm3auNrVqFHDsFgshYYqDxs2zAgKCjISEhLcjj/33HMGYGzdutUwDMN4//33DcB48803z1nPmZ/zgs/tlVdeaTgcDtfxvXv3Gjabzbjnnntcxwq+B05X3GGneXl5ht1uN4YOHWq0bNnS7dzZhp0W1FYwPDA/P9+IjY01mjVr5jaM8MSJE0ZUVJTRsWPHQrVOnz7d7ZrDhw83/Pz83N7r+Vzo11xRTv85Urt2bSMrK6tQmzVr1hiAMXbs2HNeq127doa/v3+hax85csQ4evSoERoaavTt29d1/nzDTocPH24AxhtvvFGs92IYRX+/durUyQCMtWvXurVt3Lix0aNHj2Jfu8Cvv/5q+Pv7G7fccovb8W7duhkNGjQo8jU+Pj7GfffdV+S5cw07femllwoNbzWMU9NAdO/evcT1i4hI8ajnm4iIXBLt27fHZrMRHBxMr169iImJ4euvvy7U++D222/HZrMREBDAVVddRVpaGl999RWVKlU67z3+8Y9/sG/fPhYsWMDo0aNp0qQJCxcupE+fPjz44INFviYoKIh+/frxzjvvkJeXx/vvv8/gwYNLtMppeno6Y8aMoW7dulitVqxWK0FBQWRkZPDHH38Uat+nTx+35wU9GQqG6C1fvhyAgQMHurXr37//eYdJFeXRRx8lLCyMMWPGnLftd999x/r16922oiaLPxfjZG+ps30MS1LPpXTmYg2NGjUCnJOun3n8+PHjbkNPL0ZSUhL//ve/iYuLw2q1YrPZqFGjBkCRXz/F0axZM1q1asW7777rOvbHH3+wbt06hgwZ4jq2ePFimjZtSosWLdx6O/bo0aPYQwwzMjKw2WzYbDYiIyOJj4/nhhtuKDSErXnz5oV6sC5evJjrrruO2NhYt/sXDItbuXIlAF9//TV+fn5utZfEgAED3L4ea9SoQceOHV3faxdi/vz5XHXVVQQFBbk+b2+//fYFf8527NjBwYMHueuuu9yGEQYFBdG3b1/WrFlTaCGTon6WZGdnk5SUdM57lcXX3Jl17d69+4KGhhYwDOOsP0PCw8MZM2YMn332GWvXrj3vtWbPns3MmTMZMmSIa7GFixETE+MaKlqgefPmJR5Ov3fvXnr16kVcXBxvvfVWofPn+nfoQlbiHjhwIGFhYdx3332sXbuWlJQU5s6dyyuvvAIUf/iqiIiUXMl/gxcREbkA77//Po0aNcJqtRIdHX3WudmmTZvG9ddfT2ZmJkuXLmXq1KncfPPNrF271jU05lz8/f25+eabXcMi9+3bxw033MBrr73G/fff7zasp8DQoUO5+uqrmTx5MkeOHClynrBzGTBgAP/73/944oknaNOmDSEhIZhMJv7xj3+QlZVVqH14eLjb84L3VdC2YP66M4cbWa3WQq8tjpCQEMaPH098fPx5w4YrrrjCbYjYmapXrw44hwM3bNiwyDYFQ37j4uIuup4z710wDLkshIWFuT338fE55/Hs7GyCgoIu6p4Oh4Pu3btz8OBBnnjiCZo1a0ZgYCAOh4P27dsX+fVTXEOGDOGBBx5g+/btNGzYkHfffRdfX1/uuOMOV5vDhw+zc+fOQsPQChQ1bPpM/v7+/PDDD4Dza7lGjRpFrhRc1Pf84cOHWbRo0Xnvf+TIEWJjYy84HDjze6ng2K+//npB1/v888/p378//fr145FHHiEmJgar1crrr79eaA7J4jrXvJWxsbE4HA6Sk5Pdhmqe72dJUcrya67Am2++SVhYGNOmTcPhcLitTnr6z5BzSUhIOOvPEID4+HheffVVHn30UVdIW5QNGzZw//3307p161JbEbion8O+vr4l+tglJCRw3XXXYbVa+d///lfo50x4eDibN28u9LqMjAxyc3MLtS+OiIgIvvnmGwYNGuQavh8eHs4LL7zA0KFDqVq1aomvKSIixaPwTURELolGjRq5Fk84l9q1a7vaXXvttfj7+zN+/HhmzJjB6NGjS3zf6tWrc9999xEfH8/WrVuLDN+uuuoqGjRowFNPPUW3bt3O+R++M6WmprJ48WImTJjA2LFjXccL5oS6EAX/sUtMTHT7z1BeXp7rP+gldf/99/Pyyy8zZswY7r///gu6BkC3bt2YNWsWCxcudHu/p1u4cCFWq9VtUYPSqKdHjx7MmDGDNWvWFGveNz8/P3JycgodP3r06DkDxpLy8/MDKHSv4nyutmzZwq+//srs2bMZNGiQ63jBnGkX44477mDkyJHMnj2byZMn88EHH3DzzTdTuXJlV5uIiAj8/f3PGhgV5+NkNpuL9b1dVE+diIgImjdvzuTJk4t8TWxsLOCcO+6nn37C4XBcUAB35uIfBccuJMwG+PDDD6lVqxYff/yx2/sq6uutuApqOXToUKFzBw8exGw2u33uLlRZfs0VMJvNvP3225hMJp599lkcDodrcYUqVarQpEkTli5dSmZmZpHzvq1evZrDhw/Tr1+/s97D39+fiRMnct999/HVV18V2ebIkSPceuutBAUF8dlnnxXrDziXQkJCAp07d8YwDFasWOG2GEWBZs2aMW/ePBITE93C499//x2Apk2bXtC927Rpw7Zt29i7dy8ZGRnUq1ePjRs3As5/c0VEpGyob7GIiHi1Rx99lLp16/LMM89w4sSJs7Y7ceLEWYcBFgyjKviPfFHGjx9P7969GTVqVInqM5lMGIZR6D91b731lttCBSVREFp99NFHbsc/+eSTQitAFpePjw9PP/0069evZ/78+Rd0DYBbbrmFxo0b88wzzxQ52fnHH3/M0qVLueeee4rsbXQx9Tz88MMEBgYyfPjwIld0NAzDbahjzZo1C00g/ueff7Jjx45i3a+4oqOj8fPzK3SvM1e+LEpBcHPm189///vfQm2L06vpdJUrV+bmm2/m/fffZ/HixSQmJhYattmrVy927dpFeHg4rVu3LrQVrO5ZVnr16sWWLVuoU6dOkfcv+J694YYbyM7OLnJF2eKYO3eu2+IRCQkJrFq16pwBMZy9N5PJZMLHx8cteEtMTCzyc17cHlENGjSgatWqzJkzx63WjIwMPvvsM9cKqBerLL/mTlcQwN1zzz08//zzbivsPv744yQnJxf5B5WMjAxGjBhBQEDAeRePGDJkCI0aNWLs2LGFVhrNy8ujX79+HDx4kI8//tjV487T9u3bR+fOncnPz+f77793Dfc900033YTJZOK9995zOz579mz8/f3p2bPnRdVRs2ZNmjRpgs1m4/nnnyc2NvacYaeIiFwc9XwTERGvZrPZmDJlCv379+fll19m/PjxRbbbsWMHPXr04J///CedOnWiSpUqJCcn89VXXzFr1iw6d+5Mx44dz3qfO++8s9CKo8UREhLCtddey7PPPktERAQ1a9Zk5cqVvP3228Wap64ojRo14s477+Sll17CZrPRtWtXtmzZwnPPPVfkcL7iuuOOO3juuef4+uuvz9pm48aNhIaGFjreuHFjQkJCsFgsfPbZZ3Tr1o0OHTowatQoOnToQE5ODosWLWLWrFl06tSJ559/vlTqOV2tWrWYN28et99+Oy1atODBBx+kZcuWAGzbto133nkHwzC45ZZbALjrrru48847GT58OH379iUhIYHp06efd4XdkjKZTNx5552888471KlThyuuuIJ169YxZ86c8762YcOG1KlTh7Fjx2IYBmFhYSxatKjIVR6bNWsGwMsvv8ygQYOw2Ww0aNCA4ODgs15/yJAhfPzxxzz44INUq1aNrl27up2Pj4/ns88+49prr+Xhhx+mefPmOBwO9u3bx9KlSxk1ahTt2rUr4Uek+J566imWLVtGx44dGTFiBA0aNCA7O5u9e/eyZMkS3njjDapVq8Ydd9zBu+++y7///W927NjBddddh8PhYO3atTRq1Ih//vOf57xPUlISt9xyC/feey+pqalMmDABPz8/xo0bd87XFfQ++vjjj6lduzZ+fn40a9aMXr168fnnnzN8+HBuu+029u/fz//93/9RpUoV/vrrr0LXWLFiBYsWLaJKlSoEBwfToEGDQvcym81Mnz6dgQMH0qtXL4YNG0ZOTg7PPvssKSkpPPPMMyX/ABehrL/mTmcymZg1axYmk4kXX3wRwzB48cUXueOOO9i0aRPPPfcce/fuZciQIURHR7Njxw5efPFFdu3axZw5c6hdu/Y5r2+xWJgyZYrre75g/kyARx55hJUrVzJw4EACAgJYs2ZNkdcoq9WTi5KUlMR1113HoUOHePvtt0lKSnKbn69atWquXnBNmjRh6NChTJgwAYvFQps2bVi6dCmzZs3i6aefdht2mpmZyZIlSwBc73PlypUcPXqUwMBA1xyK4Aw+mzVrRpUqVdi3bx/vvPMOa9eu5auvvsLf3/9SfBhERC5PHlroQURELhPFXcmyYOW/+fPnF3m+Xbt2RuXKlY2UlBTDMAqvdpqcnGw8/fTTxvXXX29UrVrV8PHxMQIDA40WLVoYTz/9tJGZmelqe/pqp+dS3NVODxw4YPTt29eoXLmyERwcbPTs2dPYsmVLoZUXz/axOHPVQ8MwjJycHGPUqFFGVFSUa5XP1atXn3UFzzNx2uqip1u6dKlrNcLirnYKGMuWLXO7ztGjR42xY8caDRs2NPz8/IygoCCjbdu2xquvvmrk5uZedD3nsmvXLmP48OFG3bp1DV9fX8Pf399o3LixMXLkSLdVCR0OhzF9+nSjdu3ahp+fn9G6dWvj+++/P+tqp2d+7Z3t83X6qosFUlNTjXvuuceIjo42AgMDjd69ext79+4t1mqn27ZtM7p162YEBwcblStXNvr162fs27ev0GsNwzDGjRtnxMbGGmaz2e1r5sz3VCA/P9+Ii4szAOPxxx8v8uOZnp5ujB8/3mjQoIHh4+NjhIaGGs2aNTMefvhh12rEZ1PUqsNFOddKlEeOHDFGjBhh1KpVy7DZbEZYWJjRqlUr4/HHHzfS09Nd7bKysownn3zSqFevnuHj42OEh4cb119/vbFq1Sq3+xS12ukHH3xgjBgxwoiMjDR8fX2Na665xtiwYYNbHUWtdrp3716je/fuRnBwsAEYNWrUcJ175plnjJo1axq+vr5Go0aNjDfffLPIa2zevNm46qqrjICAAANwfZ6K+r43DMNYuHCh0a5dO8PPz88IDAw0unTpYvz8889F1nr616BhnH813QKl8TVXlLPV5XA4jH//+9+FVg9esmSJ8Y9//MMIDw83bDabUbVqVeOuu+5yrXJbnGsbhmF07NjRANy+xmrUqHHOn2kF27mcbbXTJk2aFGo7aNAgt6+PohR8zs+2nfmxz83NNSZMmGBUr17d8PHxMerXr2+88sorha5b8G9aUduZNd1///2u60VERBh9+/Y1fvvtt3PWLSIiF89kGKf1axcRERERqSBWrFjBddddx/z587nttts8XY6IiIhcpjTnm4iIiIiIiIiISBlR+CYiIiIiIiIiIlJGNOxURERERERERESkjKjnm4iIiIiIiIiISBlR+CYiIiIiIiIiIlJGFL6JiIiIiIiIiIiUEaunCygvHA4HBw8eJDg4GJPJ5OlyRERERERERETEQwzD4MSJE8TGxmI2n7tvm8K3Yjp48CBxcXGeLkNERERERERERLzE/v37qVat2jnbKHwrpuDgYMD5QQ0JCfFwNSIiIiIiIiIi4ilpaWnExcW58qJzUfhWTAVDTUNCQhS+iYiIiIiIiIhIsaYm04ILIiIiIiIiIiIiZUThm4iIiIiIiIiISBlR+CYiIiIiIiIiIlJGNOdbKTIMg7y8PPLz8z1dSoVmsViwWq3FGlctIiIiIiIiIuJJCt9KSW5uLocOHSIzM9PTpVwWAgICqFKlCj4+Pp4uRURERERERETkrBS+lQKHw8GePXuwWCzExsbi4+OjXlllxDAMcnNzOXLkCHv27KFevXqYzRo9LSIiIiIiIiLeSeFbKcjNzcXhcBAXF0dAQICny6nw/P39sdlsJCQkkJubi5+fn6dLEhEREREREREpkroMlSL1wLp09LEWERERERERkfJACYaIiIiIiIiIiEgZUfgmIiIiIiIiIiJSRhS+iYiIiIiIiIiIlBGFb5e5u+++G5PJxDPPPON2fOHCha4VW1esWIHJZCpyS0xMdL3m+PHjxMfHU7NmTXx8fKhSpQqDBw9m3759Jb6niIiIiIiIiEhFoPBN8PPzY9q0aSQnJ5+z3Y4dOzh06JDbFhUVBTiDt/bt2/Pdd98xc+ZMdu7cyccff8yuXbto06YNu3fvvqB7ioiIiIiIiIiUZ1ZPF1AhGQbkZ3rm3pYAKGHvsa5du7Jz506mTp3K9OnTz9ouKiqKSpUqFXnu8ccf5+DBg+zcuZOYmBgAqlevzrfffku9evV44IEH+Prrr0t8TxERERERERFxl5eTx4K7FnB0+1FPl1IibR9qS6t7W3m6jEtO4VtZyM+ET4I8c+/+6WANLNFLLBYLU6ZMYcCAAYwYMYJq1aqV6PUOh4N58+YxcOBAV/BWwN/fn+HDhzN+/HiOHz9OWFhYqdxTRERERERE5HK1efZmts3f5ukySiwjKcPTJXiEwjcB4JZbbqFFixZMmDCBt99+u8g2ZwZkVatWZceOHRw5coSUlBQaNWpU5OsaNWqEYRjs3LmTtm3bluieIiIiIiIiInKKI8/Bz9N+BqDjIx2p072Ohysqvsp1Knu6BI9Q+FYWLAHOHmieuvcFmjZtGtdffz2jRo0q8vyPP/5IcHCw67nVWrwvH8MwAIpcTOF89xQRERERERGRU7Z8vIWUPSkERATQeWJnbAE2T5ck56HwrSyYTCUe+ukNrr32Wnr06MFjjz3G3XffXeh8rVq1ipzzLTIykkqVKrFtW9FdXrdv347JZKJOncJp/PnuKSIiIiIiIiJOhsPgp6k/AdD+4fYK3soJrXYqbp555hkWLVrEqlWriv0as9lM//79mTNnDomJiW7nsrKymDlzJj169HDN91Ya9xQRERERERG53OxYtIMjW4/gG+JLm+FtPF2OFJN6vombZs2aMXDgQGbMmFHoXFJSEtnZ2W7HwsPDsdlsTJ48mf/9739069aN6dOn07RpU/bs2cP48eOx2+289tprF3RPEREREREREU8xDIN1M9bx11d/uaZU8qQjW48A0OaBNvhV8vNwNVJcCt+kkP/7v//jk08+KXS8QYMGhY6tXr2a9u3bExERwZo1a3jqqacYNmwYhw4dIjw8nJ49e/Lhhx9SvXr1C7qniIiIiIiIiCc48h18df9XbHpzk6dLcWMLtNE+vr2ny5ASMBneEN2WA2lpaYSGhpKamkpISIjbuezsbPbs2UOtWrXw81PyfCnoYy4iIiIiIiJlxZ5lZ8GdC/jj8z8wmU10mtDJa1bqrNKyCpGNIz1dxmXvXDnRmdTzTURERERERETKREpCCgdWH+DgxoMk/ZZEXnaep0s6p7zsPNIOpJGemI7hMLD4WOg7ty+Nbm3k6dKkHFP4JiIiIiIiIiIXxXAY5OfmA5Cfm8+ORTvY9OYmElYmeLiyCxcYHUjfuX2pdV0tT5ci5ZxHw7cffviBZ599lo0bN3Lo0CEWLFjAzTffDIDdbmf8+PEsWbKE3bt3ExoaSteuXXnmmWeIjY11XSMnJ4fRo0czd+5csrKy6NKlCzNnzqRatWquNsnJyYwYMYIvv/wSgD59+jBjxgwqVap0Kd+uiIiIiIiIiFczDIPDvx5mx6IdHFx/EMNx7pmqclJzSN2fyom/T+DIcxQ6bzKbqNKqCrGtY6lyZRWvXyTAbDMTUjWEkLgQAiMDMZlNni5JKgCPhm8ZGRlcccUVDB48mL59+7qdy8zMZNOmTTzxxBNcccUVJCcnEx8fT58+fdiwYYOrXXx8PIsWLWLevHmEh4czatQoevXqxcaNG7FYLAAMGDCAAwcO8M033wBw3333cdddd7Fo0aJL92ZFREREREREvIhhGOz4Ygeb3tpEdko2edl5pB9K58TBExd97dDqobQc2pIWg1sQGhdaCtWKlF9es+CCyWRy6/lWlPXr19O2bVsSEhKoXr06qampREZG8sEHH3D77bcDcPDgQeLi4liyZAk9evTgjz/+oHHjxqxZs4Z27doBsGbNGjp06MD27duLXMGzKFpwwbvoYy4iIiIiIqXJcBhkHMkg43AGjvzCPbgqmvRD6ax8aiV/r/270Dmrv5U63epQq2stfAJ9znkdW6CN0LhQQuJC8A3xxWRy9hTzCfZxPRapiCrsggupqamYTCbXcNGNGzdit9vp3r27q01sbCxNmzZl1apV9OjRg9WrVxMaGuoK3gDat29PaGgoq1atOmv4lpOTQ05Ojut5Wlpa2bwpERERERERKSThhwSWPLCEzGOZZX4vw2GQdSyryGGTFZ0twEbbEW2p2rYqVj8rPkE+xLaOxeZv83RpIhVGuQnfsrOzGTt2LAMGDHAliomJifj4+FC5svtyv9HR0SQmJrraREVFFbpeVFSUq01Rpk6dyqRJk0rxHYiIiIiIiEhxpP2dxid9PyHzaNkHb25MEBARgMXHcmnv6wFmi5n6vetz7fhrCYoJ8nQ5IhVauQjf7HY7//znP3E4HMycOfO87Q3DcOveWlRX1zPbnGncuHGMHDnS9TwtLY24uLgSVi4iIiIiIiIl4chz8PmAz8k8mkn0FdHc9O5Nl2TS+4CIAIKigzBbzWV+LxG5vHh9+Ga32+nfvz979uzh+++/dxtHGxMTQ25uLsnJyW6935KSkujYsaOrzeHDhwtd98iRI0RHR5/1vr6+vvj6+pbiOxEREREREZGiOPIdOOzOIZ8r/28lCT8k4BPsQ7/5/QivF+7h6kRELo5Xh28Fwdtff/3F8uXLCQ93/6HbqlUrbDYby5Yto3///gAcOnSILVu2MH36dAA6dOhAamoq69ato23btgCsXbuW1NRUV0AnIiIiIiIihWUlZ5GXlVcm186355PwQwLbP9/Ozm92kpftfp/eb/ZW8CYiFYJHw7f09HR27tzper5nzx42b95MWFgYsbGx3HbbbWzatInFixeTn5/vmqMtLCwMHx8fQkNDGTp0KKNGjSI8PJywsDBGjx5Ns2bN6Nq1KwCNGjWiZ8+e3Hvvvfz3v/8F4L777qNXr17FXum0Irv77rt57733ALBarcTFxXHrrbcyadIkjhw5Qq1atVxtQ0JCaNSoEY8//ji9e/d2HZ89ezbx8fGkpKQAkJ+fz/Tp03nvvfdISEjA39+f+vXrM2zYMAYPHux232HDhvHGG2+41TR8+HBef/11Bg0axOzZs8v2AyAiIiIiIm7ycvLYvnA7m2ZtYs/3ey75/U1mE1eNvYqmtze95PcWESkLHg3fNmzYwHXXXed6XjDH2qBBg5g4cSJffvklAC1atHB73fLly+ncuTMAL774Ilarlf79+5OVlUWXLl2YPXs2FsupCTI/+ugjRowY4VoVtU+fPrz66qtl+M7Kl549e/Luu+9it9v58ccfueeee8jIyGDMmDEAfPfddzRp0oSUlBRmzpxJ37592bRpE02bFv2P4cSJE5k1axavvvoqrVu3Ji0tjQ0bNpCcnOzWLi4ujnnz5vHiiy/i7+8POBfWmDt3LtWrVy/bNy0iIiIicpnJt+fz8/SfObThUKFzhmGQnZxN+uF00g6kYc+wu86ZLGU331pko0ga3tqQRrc0onJt51RCZqsZW4BW2hSRisOj4Vvnzp0xDOOs5891roCfnx8zZsxgxowZZ20TFhbGhx9+eEE1XgjDMLBn2s/fsAzYAmznXEiiKL6+vsTExAAwYMAAli9fzsKFC13hW3h4ODExMcTExDB58mRmzJjB8uXLzxq+LVq0iOHDh9OvXz/XsSuuuKJQuyuvvJLdu3fz+eefM3DgQAA+//xz4uLiqF27doneg4iIiIiInF3GkQzm95tPwsqEYrUPrhpMy6EtaTmkJZVqVCrb4kREKjivnvOtvLJn2pkaNNUj9x6XPg6fQJ+Luoa/vz92e+Hw0G638+abbwJgs539L1ExMTF8//33DB8+nMjIyHPea/Dgwbz77ruu8O2dd95hyJAhrFix4sLfgIiIiIiIuBz+7TBz+8wlNSEVn2Afrn3iWvxC/Qq18w31JSg6iMDoQMLrhWvVTxGRUqLwTdysW7eOOXPm0KVLF9exjh07YjabycrKwuFwULNmTdcCF0V54YUXuO2224iJiaFJkyZ07NiRm266iRtuuKFQ27vuuotx48axd+9eTCYTP//8M/PmzVP4JiIiIiJSCvJy8vjoho84cfAEletU5o4v7yCy8bn/QC4iIqVL4VsZsAXYGJc+zmP3LqnFixcTFBREXl4edrudm266iRkzZpCZmQnAxx9/TMOGDfnzzz+Jj4/njTfeICws7KzXa9y4MVu2bGHjxo389NNP/PDDD/Tu3Zu7776bt956y61tREQEN954I++99x6GYXDjjTcSERFR4vcgIiIiIiKFbf1kKycOniC4ajD3rrsX/zB/T5ckInLZUfhWBkwm00UP/byUrrvuOl5//XVsNhuxsbGuIaV79+4FnAsj1KtXj3r16hEUFETfvn3Ztm0bUVFRZ72m2WymTZs2tGnThocffpgPP/yQu+66i8cff9xtBVWAIUOG8OCDDwLw2muvlc2bFBERERG5DK2bsQ6ANsPbKHgTEfEQDeIXAgMDqVu3LjVq1DjnXG4AnTp1omnTpkyePLlE92jcuDEAGRkZhc717NmT3NxccnNz6dGjR4muKyIiIiIiRTuw9gAH1x/E4mPhynuv9HQ5IiKXLfV8kxIbNWoU/fr149FHH6Vq1aqFzt92221cddVVdOzYkZiYGPbs2cO4ceOoX78+DRs2LNTeYrHwxx9/uB6LiIiIiMjFK+j11vSfTQmMDPRwNSIily/1fJMS69WrFzVr1jxr77cePXqwaNEievfuTf369Rk0aBANGzZk6dKlWK1F570hISGEhISUZdkiIiIiIpeN9MR0tn6yFYC2D7X1cDUiIpc3k2EYhqeLKA/S0tIIDQ0lNTW1UEiUnZ3Nnj17qFWrFn5+hZfsltKnj7mIiIiIiJNhGKTtT2P/6v0c/+s4hmFwaOMhdnyxg2rtqzF09VBPlygiUuGcKyc6k4adioiIiIiIlFN/fvUnX/37K9IOpBV5Xr3eREQ8T+GbiIiIiIhIOZR1PIuFgxaSdSwLk8VETIsYoptHY7Y5ZxeqVKMSTW5v4uEqRURE4ZuIiIiIiEg5tGLiCrKOZRHVNIqha4biE+jj6ZJERKQIWnBBRERERESknEnaksT6mesB6PFSDwVvIiJeTOFbKdLaFZeOPtYiIiIicrkyDINv4r/ByDdoeEtDanep7emSRETkHDTstBTYbDYAMjMz8ff393A1l4fMzEzg1MdeRERERKQiMRwGWz/ZypqX1pCdku1+Lt/g+M7jWHwtdH++u4cqFBGR4lL4VgosFguVKlUiKSkJgICAAEwmk4erqpgMwyAzM5OkpCQqVaqExWLxdEkiIiIiIi552Xk48h3uB4sYtFFoJIcBuRm5ZCdnk7w7mZVPreTg+oPnvNfVY6+mcq3KF1mxiIiUNYVvpSQmJgbAFcBJ2apUqZLrYy4iIiIi4g1WTFzBykkrS+16PkE+dHy0IzU71yx0zuZvo8qVVUrtXiIiUnYUvpUSk8lElSpViIqKwm63e7qcCs1ms6nHm4iIiIh4lWN/HuPHyT9e3EVM4F/ZH7/KftTtWZdrn7iWoOig0ilQREQ8RuFbKbNYLAqGREREREQuM0tHL8WR56DeP+rRb36/szc8x+w0Vl8rJrOmrxERqWgUvomIiIiIiFyE3d/t5s9Ff2K2mun+fHdsAVoUTERETjF7ugAREREREZHyypHv4NuR3wLQenhrIhpGeLgiERHxNur5JiIiIiIiFVZGUgY/TP6Bvd/vxZHvwHAYYJxcbfSM/YWcc+Q5yEnLwa+yH50ndPb02xURES+k8E1ERERERMqd5D3JZKdkY+Q7gzFHvsP1uMDelXtZNX0Vuem5ZV5Pl6ld8A/zL/P7iIhI+aPwTUREREREyo3Dvx/mu0e/Y+c3O4v9mtjWsVw97mpnOGYCk8nkXNjg5OMz9+c6hwlMZpPbMVugjdC40DJ81yIiUp4pfBMREREREa9lGAYpe1P4e+3f/LXkL37/6HcMh4HZaiYwKhCTxRmWmS1m5+OToRiAXyU/2se3p0n/JlpFVEREPEbhm4iIiIiIXLCDGw8y/7b5ZKdku44ZhuHe6Mynp58/1znAyDfIy85zO9b4tsZ0mdqFsLphF1y3iIjIpaLwTURERERELtjWj7eSsjelTO9htpmJaRFD1XZVaTagGXEd4sr0fiIiIqVJ4ZuIiIiIiFywI1uPAND5qc40vb2p+8nTRnqaTKaznjvf+eAqwVj99F8XEREpn/QvmIiIiIiIXLAj25zhW81ONQmvH+7hakRERLyP2dMFiIiIiIhI+ZSbnusachrZJNKzxYiIiHgphW8iIiIiInJBjm4/CkBgVCAB4QEerkZERMQ7KXwTEREREZELkrQ1CVCvNxERkXNR+CYiIiIiIhekYL63yMYK30RERM5G4ZuIiIiIiFyQgpVO1fNNRETk7BS+iYiIiIjIBVHPNxERkfNT+CYiIiIiIiWWm5FLyp4UAKKaRHm2GBERES+m8E1EREREREqsYKXTgMgAAiK00qmIiMjZKHwTEREREZESK5jvTb3eREREzk3hm4iIiIiIlFjBfG8RjSM8XImIiIh3U/gmIiIiIiIlpp5vIiIixaPwTURERERESkwrnYqIiBSPwjcRERERESkRe6ad5D3JAEQ2UfgmIiJyLlZPFyAiIiIiIp6Xb88nZW8KeVl52LPs7vtMu/Nxdh6GwyDjcAYYEBARQGBkoKdLFxER8WoK30RERERELnOGYfBmmzc5/OvhEr0uqqnmexMRETkfhW8iIiIiIpe5w78ddgZvJgiMCsTmb8Pqby1yb7KYADBbzbR9sK2HKxcREfF+Ct9ERERERC5zO7/eCUD9XvW548s7PFyNiIhIxeLRBRd++OEHevfuTWxsLCaTiYULF7qdNwyDiRMnEhsbi7+/P507d2br1q1ubXJycnjooYeIiIggMDCQPn36cODAAbc2ycnJ3HXXXYSGhhIaGspdd91FSkpKGb87EREREZHyYec3zvCtbs+6Hq5ERESk4vFo+JaRkcEVV1zBq6++WuT56dOn88ILL/Dqq6+yfv16YmJi6NatGydOnHC1iY+PZ8GCBcybN4+ffvqJ9PR0evXqRX5+vqvNgAED2Lx5M9988w3ffPMNmzdv5q677irz9yciIiIi4u1y0nLY//N+QOGbiIhIWTAZhmF4uggAk8nEggULuPnmmwFnr7fY2Fji4+MZM2YM4OzlFh0dzbRp0xg2bBipqalERkbywQcfcPvttwNw8OBB4uLiWLJkCT169OCPP/6gcePGrFmzhnbt2gGwZs0aOnTowPbt22nQoEGx6ktLSyM0NJTU1FRCQkJK/wMgIiIiIuIBfyz4g09u/YTw+uE8uONBT5cjIiJSLpQkJ/Joz7dz2bNnD4mJiXTv3t11zNfXl06dOrFq1SoANm7ciN1ud2sTGxtL06ZNXW1Wr15NaGioK3gDaN++PaGhoa42RcnJySEtLc1tExERERGpaAqGnNbpWcfDlYiIiFRMXhu+JSYmAhAdHe12PDo62nUuMTERHx8fKleufM42UVGFl0CPiopytSnK1KlTXXPEhYaGEhcXd1HvR0RERETE2xiG4Vpsod4N9TxcjYiISMXkteFbAZPJ5PbcMIxCx850Zpui2p/vOuPGjSM1NdW17d+/v4SVi4iIiIh4t6N/HCVtfxpWPys1OtXwdDkiIiIVkteGbzExMQCFeqclJSW5esPFxMSQm5tLcnLyOdscPny40PWPHDlSqFfd6Xx9fQkJCXHbREREREQqkr++/guAGp1qYPO3ebgaERGRisnq6QLOplatWsTExLBs2TJatmwJQG5uLitXrmTatGkAtGrVCpvNxrJly+jfvz8Ahw4dYsuWLUyfPh2ADh06kJqayrp162jbti0Aa9euJTU1lY4dO3rgnYmIiIiIlL2krUn8Pud3UnankLovlfTD6XDGUmsZSRkA1L1Bq5yKiIiUFY+Gb+np6ezcudP1fM+ePWzevJmwsDCqV69OfHw8U6ZMoV69etSrV48pU6YQEBDAgAEDAAgNDWXo0KGMGjWK8PBwwsLCGD16NM2aNaNr164ANGrUiJ49e3Lvvffy3//+F4D77ruPXr16FXulUxERERERb+PId+DIcxQ6nrInhZVPrWTLvC2FwraiWHwsNLypYRlUKCIiIuDh8G3Dhg1cd911rucjR44EYNCgQcyePZtHH32UrKwshg8fTnJyMu3atWPp0qUEBwe7XvPiiy9itVrp378/WVlZdOnShdmzZ2OxWFxtPvroI0aMGOFaFbVPnz68+uqrl+hdioiIiIhcvPzcfH794Ff2/biPxF8SObLtSJHh2+ka3tyQuKvjqFSjEkFVgjBbCs86E1IthJBqmmJFRESkrJgMwyjG38MkLS2N0NBQUlNTNf+biIiIiFxSO7/ZyTfx33Bsx7Fita/fqz6dn+pMlZZVyrgyERGRy1NJciKvnfNNRERERORyZxgGXwz+gl/f+xWAwKhAWg1rRZVWVYhpEYN/Zf9CrzFbzdgCtHiCiIiIt1D4JiIiIiLipZK2JPHre79ispho9592dHqyE36hfp4uS0REREpA4ZuIiIiIiJdK3JwIQFyHOHo838PD1YiIiMiFKDzjqoiIiIiIeIWC8C2mZYyHKxEREZELpfBNRERERMRLJf5yMnxrofBNRESkvFL4JiIiIiLihQzDUM83ERGRCkDhm4iIiIiIF0rbn0Z2cjZmq5nIxpGeLkdEREQukMI3EREREREvdOiXQwBENo7E6qt10kRERMorhW8iIiIiIl5IQ05FREQqBoVvIiIiIiJe6PDmw4AWWxARESnvFL6JiIiIiHihgmGn6vkmIiJSvil8ExERERHxMlnJWaQmpAIQc4XCNxERkfJM4ZuIiIiIiJc5/KtzyGmlmpXwq+Tn4WpERETkYih8ExERERHxMhpyKiIiUnEofBMRERER8TJabEFERKTisHq6ABERERGRy8mJgyf4c/GfOPIcZ22T8EMCoPBNRESkIlD4JiIiIiJyiexftZ95N80j82hmsdpr2KmIiEj5p/BNREREROQS2DJvCwvvXkh+Tj4RDSOIahp1zvbVOlYjNC70ElUnIiIiZUXhm4iIiIhIGXLkOVg+YTk/TfkJgAZ9GnDrnFvxCfTxcGUiIiJyKSh8ExEREREpIykJKXw+4HP2r9oPQPuR7ek2vRtmi9Y9ExERuVwofBMRERERKQU5aTlsnr2ZrR9vJTcjF4Dk3cnknsjFN8SX3m/2pkn/Jh6uUkRERC41hW8iIiIiIhfBkedg2ZhlbJq1idz03ELnq7arSt+5falcq7IHqhMRERFPU/gmIiIiInIRNs7ayJoX1gAQ0SiCNsPbEF4/HABbgI1q7athtmqYqYiIyOVK4ZuIiIiIyEX45Z1fAOg0sROdnuyEyWTycEUiIiLiTfQnOBERERGRC3T498Mc2ngIs81M2wfaKngTERGRQhS+iYiIiIhcoM2zNwNQv1d9AiICPFuMiIiIeCWFbyIiIiIiFyDfns/vH/4OQIvBLTxbjIiIiHgthW8iIiIiIhdg59c7yUjKIDA6kLo963q6HBEREfFSCt9ERERERC7A5nc3A9D8zuZYbBbPFiMiIiJeS+GbiIiIiEgJZSRl8OfiPwENORUREZFzU/gmIiIiIlJCq55fhSPPQdV2VYlqEuXpckRERMSLKXwTERERESmBjKQM1r+6HoBrx1/r4WpERETE2yl8ExEREREpgZ+f/Rl7pp3YNrHUu7Gep8sRERERL6fwTURERESkmNIPp7P+NWevt84TO2MymTxckYiIiHg7q6cLEBERERHxBobDIO3vNDDO3ubn6T+Tl5VH1XZVqXtD3UtXnIiIiJRbCt9ERERE5LJ37M9jzO8/n8O/Hi5We/V6ExERkeJS+CYiIiIil7Vtn23ji8FfkHsiF5PFhMVmOWf7Bn0aUKdHnUtUnYiISDmVcxxSt4DDfupYUG0IquW5mjxE4ZuIiIiIXLZWv7CapaOWAlD9murc9vFtBFcJ9nBVIiIi5VTWIfjtSUj6AU78Wfh886eh6eOXvi4PU/gmIiIiIpeljCMZLH9iOQDtR7an6zNdz9vrTURERM4iIwH+1wXSd506FlgLbEGnnvtFXfq6vIDCNxERERG5LK15cQ32TDuxrWPp/lx3zeEmIiJyodL+hO+7QOYBZ+DWegZEtAffcE9X5hUUvomIiIjIZSfreBbrXl0HwLVPXKvgTUREKj7DAflZkJcBeZnOfX7mqef5GWBPh9xksKeA/QQ4ciA/5+Q++9Rjt+M5ztAt7wSENITrv4OAqp5+t15F4ZuIiIiIXHbWzlhL7olcoptHU793fU+XIyIiUjKGAQe+gLRtJ4O0TGeQVhCu5aZA7jFnkJaXfvJ8VtnWVLkFXPftZTu09FwUvomIiIjIZSUnLYe1L60F4Jrx16jXm4iIlC/ZR2HtUPj7ywu/hsUfrIFgCQBrwGmPg8CnsnOzBYPFD8y+YPEtel/w2BIAYVeCWTFTUfRREREREbnM5WXn4chzlPl9HPkOso5lkXEkg8yjmWQeySTjSAbZKdkXfW3DYXDi7xMk70omJSGF/Nz8s7bNz80nJzWHiIYRNLq10UXfW0REpEzkZ0NuKthP2zIPwK+PQ9ZBMPtA9dvBp5IzQLP4nwrTbJWc860VhGinB20WfzCZPf3uLisK30REREQuU/ZMO0seWsKvs3/FcBieLueSu+7/rsNs0X8+RESkFDnyT86ddgLsac593olTz8/2uCBcOz1sc+Se/T4hDeGquc6hnuL1vDp8y8vLY+LEiXz00UckJiZSpUoV7r77bsaPH4/Z7PxFyTAMJk2axKxZs0hOTqZdu3a89tprNGnSxHWdnJwcRo8ezdy5c8nKyqJLly7MnDmTatWqeeqtiYiIiHjU0e1Hmd9vPklbki7pfa3+VgIjAwmIDHDuIwLwq+yHyXzxQz8DowMJqxNGpVqVsAXYztnWN9iX0OqhF31PERGpAAwDHPbT5kw7fX/ycW4q5BxxbtlHTj3OTXWGaHnpzsUK8jNLuTgT2ELAFgo+oc59RAdoNsHZm03KBa8O36ZNm8Ybb7zBe++9R5MmTdiwYQODBw8mNDSU//znPwBMnz6dF154gdmzZ1O/fn2efvppunXrxo4dOwgODgYgPj6eRYsWMW/ePMLDwxk1ahS9evVi48aNWCwWT75FERERkUvmyB9HSPghgf0/7eePBX9gz7ATFBPErR/dSrUOZf9HSZPJhNXPq3/9FBGRiiA/17nQQO5x55Zz3Pk85wik74K0PyFjz2kLEWQ6VwItTSaLMzSzBjuHfZ7rsS3YGaoVbAUhm08l5xxsGiJa7pkMw/DaMQa9evUiOjqat99+23Wsb9++BAQE8MEHH2AYBrGxscTHxzNmzBjA2cstOjqaadOmMWzYMFJTU4mMjOSDDz7g9ttvB+DgwYPExcWxZMkSevToUaxa0tLSCA0NJTU1lZCQkNJ/syIiIiJlwDAM9q7Yyw9P/cDeFXvdztW8riZ95/QlKCbIM8WJiIiURG4yHF4JJ/48LVQ7fipoK3iel37h9zCZ3edGcy1IEAS+keAX6dwXPPapfDJIC3K2KdgsfqAFfSq0kuREXv2nx6uvvpo33niDP//8k/r16/Prr7/y008/8dJLLwGwZ88eEhMT6d69u+s1vr6+dOrUiVWrVjFs2DA2btyI3W53axMbG0vTpk1ZtWrVWcO3nJwccnJyXM/T0tLK5k2KiIiIXCTDYfBN/Dck/V54CGnW8SwO/3YYALPNTI1ra1D96upUv6Y6NTvX1JxnIiLiHQzj5AIDx+DETmfAlpFwMlhLgbQdkPwLUNz+QyZnzzGfsJOrd4aBbxgE1oKQBhBUx3ne4u8etJltCs2k1Hl1+DZmzBhSU1Np2LAhFouF/Px8Jk+ezB133AFAYmIiANHR0W6vi46OJiEhwdXGx8eHypUrF2pT8PqiTJ06lUmTJpXm2xEREREpE3+v+5t1M9ad9bzF18KV917JVY9eRWic5jkTEZGLZDggL+O0Lb3w45xjkJME2UnOUM1wgJHvHOKZl35yIYLT9nnpzvPnE9IAwtqAb8SpQM0n7FTIVvDcFgpmTTMl3sGrw7ePP/6YDz/8kDlz5tCkSRM2b95MfHw8sbGxDBo0yNXOdEYqbRhGoWNnOl+bcePGMXLkSNfztLQ04uLiLvCdiIiIiJSdfT/vAyCuYxzt/tPO7ZzJbKL61dU1tFRERJy9y/IyTs2FlpUIWYcgO/FkCJbhXKkz78ztjHAtP6vsajRZTvZOq+/c+4Y7e6j5x0LkNRAQW3b3FikjXh2+PfLII4wdO5Z//vOfADRr1oyEhASmTp3KoEGDiImJAXCthFogKSnJ1RsuJiaG3NxckpOT3Xq/JSUl0bFjx7Pe29fXF19f37J4WyIiIiKlav/P+wFocHMDmvRvcp7WIiJSbhkO57xm2YecoVnWoZMrbqY4t7x0Zy+z/KzT9llgTzs5fDMZjLxSLMjkXHHTGnhyrrPT9j5h4BflnBvNGuCcS81kOTmHWpBzkQFr0Mm50oJPHbMEqMeaVDheHb5lZmZiNrvPQ2KxWHA4nKuQ1KpVi5iYGJYtW0bLli0ByM3NZeXKlUybNg2AVq1aYbPZWLZsGf379wfg0KFDbNmyhenTp1/CdyMiIiJS+gzDcIVvcR3VS19ExCs58iDnKGQfdg7DLNjnnTijV1mGc/VNR45zy88BR67zcV6G83UO+8XXY7Y5h2j6xTh7lPnHOIdpWgJOC9PODNWKCNgs/pofTaQYvDp86927N5MnT6Z69eo0adKEX375hRdeeIEhQ4YAzuGm8fHxTJkyhXr16lGvXj2mTJlCQEAAAwYMACA0NJShQ4cyatQowsPDCQsLY/To0TRr1oyuXbt68u2JiIiIXLTkXclkJGVg8bEQ20pDcURELhnDgB2vwP7PToZluc5gzJFb+LH9BMVfKKAYfCPAv4ozPPOLcgZptkrOXmQW/5Obn3Mz+4Et5LT50Co7QzaFZiKXjFeHbzNmzOCJJ55g+PDhJCUlERsby7Bhw3jyySddbR599FGysrIYPnw4ycnJtGvXjqVLlxIcHOxq8+KLL2K1Wunfvz9ZWVl06dKF2bNnY7GoK6uIiIiUbwXzvcW2jsXq59W/2omIVBz5ObD2Xtj7QQleZHKGZn7RzsDML8rZ2+zM3mWWgJPBmS+YfcHs43xsCTj52miw+JTZWxOR0mcyDKMU4/eKKy0tjdDQUFJTUwkJCfF0OSIiIiIALLpvEZve3ETHRzrSbXo3T5cjIlIx2dPgxF+Ql+Xs5bblKUj6wTmHWfP/g9CmJ0MyHzDZnI/Np+1toc7gTXOZiVQYJcmJ9OdRERERkXJs/6qT871dpfneRERcDMN9wYGCLS8L8jNPPc9NObnyZ7KzN5uR5xwuauQ552nLOwHJm53B25lsIXD1fKjS/VK/OxEpZxS+iYiIiJRTWclZHNl6BIC4DgrfRKSCceQ750sz7M5ALOcYHF0FST9C6pbTFiOwn2qXn3MqWCttfjHO1TjNPuBfFa58Hio1Lf37iEiFU6LwzTAMVq5cyY8//sjevXvJzMwkMjKSli1b0rVrV+Li9EufiIiIyKVyYPUBAMLqhREYFejhakRELlDKVlgzCNJ3n7ZIgZ1SW6DAZHEuQGANOG0xgpObLRR8w08uQuAPZiuYTm5mq3POtdAmEHYl+EWWTj0ictkpVviWlZXFiy++yMyZMzl27BhXXHEFVatWxd/fn507d7Jw4ULuvfdeunfvzpNPPkn79u3Lum4RERGRy17BYgvVr6ru4UpERC5Q+m5Y3g2yDp2/rdkHwlpB1LUQ3haswe7zqpltzrCsIFizntybbWX/PkREzqFY4Vv9+vVp164db7zxBj169MBmK/zDKyEhgTlz5nD77bczfvx47r333lIvVkRERERO2f+z5nsTkXIs82/4Xxdn8BbaFDp+5Fzts1CgVrCIgRYrEJHyqVirnW7ZsoWmTYs3lj03N5eEhATq1at30cV5E612KiIiIt4iNyOXda+uY8WTK8jPzWf4tuFENtJwKBEpR45vhFUDIW0HBNWFbj+Cf4ynqxIRKbZSX+20uMEbgI+PT4UL3kRERES8xdb5W/n6wa/JSMoAoHbX2kQ0iPBwVSIixWA4nIsm/D4R/nodMCCgGnT5TsGbiFRoF7TaaXZ2Nr/99htJSUk4HA63c3369CmVwkRERETEXW56LgvuWkB+Tj6Va1em08RONBvQDJPZ5OnSREQKMww4+BVsnQLJmwuvQFpzILR8TsGbiFR4JQ7fvvnmG/71r39x9OjRQudMJhP5+fmlUpiIiIiIuNv93W7yc/KpVKsSD2x/AItN8x+JiJdK/A42j3UOLz1TaBNo9QrEXH/p6xIR8YASh28PPvgg/fr148knnyQ6OrosahIRERGRIvz51Z8A1O9VX8GbiHgnhx1+fRz+eNb53BoI9R6AOkPAp7LzuSUATOqxKyKXjxKHb0lJSYwcOVLBm4iIiMglZBgGf331FwD1btT8uiLiQYbDuVJpzhHIOQr21FPHd7wMR1c7n9e7H5o9BX6al1JELm8lDt9uu+02VqxYQZ06dcqiHhEREREpQuIviaQfSscWYKNmp5qeLkdEyitHHmQdAkcO5OcUvT/zWH6287E9FY5vgmPrwZ5y9nvYQqH9OxB36yV7WyIi3qzE4durr75Kv379+PHHH2nWrBk2m83t/IgRI0qtOBERERFxKhhyWrtbbax+F7Rmlohc7lJ+h5V9IGPvxV/LbAPfKPANd4ZtJrPzuH8sXDEZgmpd/D1ERCqIEv/mNmfOHL799lv8/f1ZsWIFptPG6ptMJoVvIiIiImVAQ05F5KIkfg8/3gL2NDBZwOIPFl8wn9ws59r7OfeWAKjUDMLbQqWmzgBORETOq8Th2/jx43nqqacYO3YsZrO5LGoSERERkdNkHMng73V/A1DvHwrfRCo0R/6poZ8Ou3Mz8k49dtjBOLnPz3bfHNmQnwV5Gc4tP8d5zfxM+Gum8zWR18C1C8E3zKNvU0TkclLi8C03N5fbb79dwZuIiIjIJbLz651gQEyLGEKqhni6HBEpjox9cOgbyM8FI999yz0G6bshfQ/kHncGZvkngzOHvexqqt4POrwPFr+yu4eIiBRS4vBt0KBBfPzxxzz22GNlUY+IiIhIuZaXncf3478naUtSqV3z6PajgIacipQbfy+BVXc4h3heLJPFObzTZHPuCzaTzRminb6ZT+6tQWANdA4V5eQ0QaGNoc7QU3OziYjIJVPi8C0/P5/p06fz7bff0rx580ILLrzwwgulVpyIiIhIeWIYBl8M+YItc7eUyfUb3tKwTK4rIqXEcMC26fDrY4ABlZpDSANngHb6ZguFoNrOzTcSrP4n52A7LUAz+5wM2Uznva2IiHi3Eodvv//+Oy1btgRgyxb3XyxN+odBRERELmM//N8PbJm7BbPVTLdnu+Ef7l9q165UoxKxrWJL7XoilxV7GhzbcHIetVznXGiO3CKen+ecI8c5jNRxRvv8LOfw0dzjzgAOoO4waPUKWHw8+95FRMTjShy+LV++vCzqEBERESl30v5O48i2IwAc2XaEFRNWAHDj6zdy5T1XerAyEXFx2OG76yB506W5nzUQWj4P9YZdmvuJiIjXK3H4JiIiInK5s2fa+XHqj6yavor83Hy3c+1HtlfwJuJNtk51Bm/WQAhpeHI4p+/JvY9zXrRCj89yzOJzlvO+4BsOvhHOvdl2/rpEROSyUeLwLTs7mxkzZrB8+XKSkpJwOBxu5zdtukR/URIRERHxgIQfE1hw1wJSE1IBCKsXhs3f+R/t2t1q03VaV0+WJyKnS/kdtj7tfNz2Tah5h2frERGRy1KJw7chQ4awbNkybrvtNtq2bat53kREROSy8sXgL0hNSCW0eig9XuxBw1sa6vchEW/kyIM1g53DTqvdBDX+6emKRETkMlXi8O2rr75iyZIlXHXVVWVRj4iIiIjXysvOI3lXMgBD1wwluEqwhysSuYzk58DWyZB10LnogWE/uejBmfuTmz0N0neDrRK0eV2rhoqIiMeUOHyrWrUqwcH6RVNEREQuPykJKQDYAm0ExQR5thiRy83ud2DL/5X8da1fAf8qpV+PiIhIMZU4fHv++ecZM2YMb7zxBjVq1CiLmkRERES8UsreFAAq16qsoaYil9reOc593G0Q0Q5MNufCBmaf0/anbRYf8I2ESk09W7eIiFz2Shy+tW7dmuzsbGrXrk1AQAA2m/tKPsePHy+14kRERES8ScqeFAAq1azk0TpELjsZ++DIT4AJWr0IAdU8XZGIiEixlTh8u+OOO/j777+ZMmUK0dHR+quviIiIXDaS9zjne6tUq5JnCxG53CTMc+6jOil4ExGRcqfE4duqVatYvXo1V1xxRVnUIyIiIuK1UvemAgrfRC65giGnNe/wbB0iIiIXwFzSFzRs2JCsrKyyqEVERETEq7l6vmnYqcilk7oNUn51zusW19fT1YiIiJRYicO3Z555hlGjRrFixQqOHTtGWlqa2yYiIiJSUZ2+4IKIXCJ75zr3VXqCb7hnaxEREbkAJR522rNnTwC6dOnidtwwDEwmE/n5+aVTmYiIiIgXyU3PJfNIJqCebyKlxn4CMg+AkQeOPHDYnY+Nk48deZBwcshpDQ05FRGR8qnE4dvy5cvLog4RERERr1bQ682vkh9+lfw8W4yIt3LkQepWyDkG9hRnuObIPbnZTz3OPABHV0PK74Bx/utaAqBan7KuXkREpEyUOHzr1KlTWdQhIiIi4tUKwjf1ehM5g2FA0grniqT7F0DOkZK93lYJLD5gsjrndXPbW8HsA7WHgDWwLKoXEREpc8UK3/bt20f16tWLfdG///6bqlWrXnBRIiIiIt7GtdiCVjoVcbfnfVhz96nntlAIqObc24LB7OsM0Mw+J0M2G/hUhoh2ENEB/Kt4rHQREZFLoVjhW5s2bejTpw/33nsvbdu2LbJNamoqn3zyCS+//DLDhg3joYceKtVCRURERDzJ1fNN4ZuIuwMLnPsqPaDhKIju7Oy5JiIiIkAxw7c//viDKVOm0LNnT2w2G61btyY2NhY/Pz+Sk5PZtm0bW7dupXXr1jz77LPccMMNZV23iIiIyCWVsicF0LBTETeOPDh8ck7o5k9DeGvP1iMiIuKFzMVpFBYWxnPPPcfBgwd5/fXXqV+/PkePHuWvv/4CYODAgWzcuJGff/5ZwZuIiIhUSAU93yrXquzZQkS8ybF1YE8DnzCo3NLT1YiIiHilEi244Ofnx6233sqtt95aVvWIiIiIeCX1fBMpQuIy5z6mC5gtnq1FRETESxWr55uIiIjI5Sw7JZvslGxA4ZuIG1f41s2zdYiIiHgxhW8iIiIi51Ew5DQgIgCfIB/PFiPiLexpcHSN87HCNxERkbNS+CYiIiJyHsl7kgGtdCri5vAKMPIhqC4E1fR0NSIiIl5L4ZuIiIjIeWixBZEiFAw5raJebyIiIuei8E1ERETkPAoWWwitGerZQkS8ieZ7ExERKZYSrXZaYMeOHcyYMYM//vgDk8lEw4YNeeihh2jQoEFp1yciIiLicer5JpedlN8hZSsYec7NccY+LwPSdoDJDNHXebpaERERr1binm+ffvopTZs2ZePGjVxxxRU0b96cTZs20bRpU+bPn1/qBf7999/ceeedhIeHExAQQIsWLdi4caPrvGEYTJw4kdjYWPz9/encuTNbt251u0ZOTg4PPfQQERERBAYG0qdPHw4cOFDqtYqIiEjFc+LQCfYu3wtARMMIzxYjUtZyjsPae2FJc1h1B6y+C9YMhnX3wvr7YeNDsOlh+G28s314O/Cp5NGSRUREvF2Je749+uijjBs3jqeeesrt+IQJExgzZgz9+vUrteKSk5O56qqruO666/j666+Jiopi165dVKpUydVm+vTpvPDCC8yePZv69evz9NNP061bN3bs2EFwcDAA8fHxLFq0iHnz5hEeHs6oUaPo1asXGzduxGKxlFq9IiIiUvF8P/57ctNzqdquKjU61fB0OSJlw2GHPR/A5rGQc8R5LKIjWAPBZAWz1X1vsoLFD+r927N1i4iIlAMmwzCMkrwgICCA3377jbp167od/+uvv7jiiivIzMwsteLGjh3Lzz//zI8//ljkecMwiI2NJT4+njFjxgDOXm7R0dFMmzaNYcOGkZqaSmRkJB988AG33347AAcPHiQuLo4lS5bQo0ePYtWSlpZGaGgoqamphISElM4bFBEREa926JdDzGo1CwwYsmoIcR3iPF2SyIXLywJHzsmho/ZT+4Nfw7bpkLnP2S60CbR5A6Ku9my9IiIiXqwkOVGJh5127ty5yDDsp59+4pprrinp5c7pyy+/pHXr1vTr14+oqChatmzJm2++6Tq/Z88eEhMT6d69u+uYr68vnTp1YtWqVQBs3LgRu93u1iY2NpamTZu62hQlJyeHtLQ0t01EREQuH4ZhsHTkUjCg6T+bKniT8uv4L7C8J3wSAJ9Whs8jYUEsfFEdvqwDGx50Bm9+0dDyOei5ScGbiIhIKSrxsNM+ffowZswYNm7cSPv27QFYs2YN8+fPZ9KkSXz55ZdubS/G7t27ef311xk5ciSPPfYY69atY8SIEfj6+vKvf/2LxMREAKKjo91eFx0dTUJCAgCJiYn4+PhQuXLlQm0KXl+UqVOnMmnSpIuqX0RERMqn9MPp/PLOL+xdsRern5Uuz3TxdEkiJZd9FDaOgIS5hc+ZzGCyOYeRBlSD+iOg9mCw+l/6OkVERCq4Eodvw4cPB2DmzJnMnDmzyHMAJpOJ/Pz8iyrO4XDQunVrpkyZAkDLli3ZunUrr7/+Ov/617/c7nU6wzAKHTvT+dqMGzeOkSNHup6npaURF6e/eIuIiFQ0x/46xndjvsOeaQcg82gmhzYecp1vP7I9lWpU8lB1IhdhwwOw7xPABDUHQNMJEFjj5LxtJR4AIyIiIheoxOGbw+EoizqKVKVKFRo3bux2rFGjRnz22WcAxMTEAM7ebVWqVHG1SUpKcvWGi4mJITc3l+TkZLfeb0lJSXTs2PGs9/b19cXX17fU3ouIiIh4p68f+ppd3+4qdDy2dSyNbmtEh5EdPFCVyEVK3w37P3U+7roCoq71aDkiIiKXsxKHb5fSVVddxY4dO9yO/fnnn9So4VxprFatWsTExLBs2TJatmwJQG5uLitXrmTatGkAtGrVCpvNxrJly+jfvz8Ahw4dYsuWLUyfPv0SvhsRERHxNvtX72fXt7swWUz847V/YPO3YfG1UOOaGgTHBnu6PJELt/0lMBxQpaeCNxEREQ8rVvj2yiuvcN999+Hn58crr7xyzrYjRowolcIAHn74YTp27MiUKVPo378/69atY9asWcyaNQtwDjeNj49nypQp1KtXj3r16jFlyhQCAgIYMGAAAKGhoQwdOpRRo0YRHh5OWFgYo0ePplmzZnTt2rXUahUREZHyZ8WEFQBcMegKWg9r7dliREpLznHY9bbzcaPRnq1FREREMBmGYZyvUa1atdiwYQPh4eHUqlXr7Bczmdi9e3epFrh48WLGjRvHX3/9Ra1atRg5ciT33nuv67xhGEyaNIn//ve/JCcn065dO1577TWaNm3qapOdnc0jjzzCnDlzyMrKokuXLsycObNEc7iVZAlZERER8X77ft7Hu1e/i9lq5sE/H6Ryrcrnf5FIebBlMvw2Hiq3cK5cep65kEVERKTkSpITFSt8E4VvIiIiFc0H3T5g93e7aXlPS/q8eXErtItcMobhHE6Kw7l3Pc53Ps7Pga+vgOzD0OFDqDXQ0xWLiIhUSCXJibx6zjcRERGRM6XuS2X3d7sxHM6/H544dILEXxJJ/CWRjCMZxbuIAfZMO2armWsf13xY4sXs6fBdJ0jZfDJoK6aAalCjf5mVJSIiIsVX4vDttttuo3Xr1owdO9bt+LPPPsu6deuYP39+qRUnIiIicrq/vv6LT2//lNwTuaVyvTYPtqFSzUqlci2RMrFtGiRvKtlrzDZo/rRzLyIiIh5X4mGnkZGRfP/99zRr1szt+O+//07Xrl05fPhwqRboLTTsVERExHMMw2DNS2tYNnoZhsMgqlmUKzTzC/UjpmUMVa6sQmj1UCjm9FZmq5mQaiGYNB+WeKuM/bC4PuRnQ4f3IaYbmCxgMjs3Tu4LjrmeF5wXERGRslKmw07T09Px8fEpdNxms5GWllbSy4mIiMhlIicth1/f/5X0w+mFzjnsDpJ3JXN0+1GS9yRj5Lv/bdAwDPJz8gFoeU9LbnztRiw+lktSt4jH/DrOGbxFXQs179TCCSIiIuVUicO3pk2b8vHHH/Pkk0+6HZ83bx6NGzcutcJERETEM/Jy8nDYSzC31HnYs+xsnLWR1c+vJjs5+4KvY7aZ6Ta9G+3+00691aTiO7oO9n4EmODKFxS8iYiIlGMlDt+eeOIJ+vbty65du7j++usB+N///sfcuXM135uIiEg5t/2L7cy/bT6OvNIL304X0TCCWl1qFRoaajKbqFSjEhENIwirG4bFt3CvNr9KfviF+pVJXSLOVUTznT3NcpOdW14GGHnOzZF3ckXRgsdnHDv9ucMOjlxw5DhXH3V7fPJ5weMzzxsnr5Gd6Kyr1r8grJVnPzYiIiJyUUocvvXp04eFCxcyZcoUPv30U/z9/WnevDnfffcdnTp1KosaRURE5BKwZ9n5ZsQ3ZRK8RTSM4NonrqXJ7U0wWzQXlZyHPQ12vAJHVzsDLRwnQ66TmyO/8DEj37ka6AUdcwAlmgb50rCFwBWTPV2FiIiIXKQSh28AN954IzfeeGNp1yIiIiIetPbltaTuSyWkWgj//vXfWP0u6NeEIln9rRoqKufmyIfsw5AwD7ZNgZxjnqvFbAOfymANcj42WcBkdW7mk3uT5bTHBcctp85ZfMHsC2afEj62nVpAIbguBFT13MdBRERESsUF/VadkpLCp59+yu7duxk9ejRhYWFs2rSJ6OhoqlbVLwgiIiLlTUZSBj9O+RGA66dcj3+Yv4crkgrDMCDld+f8ZYlLncM6C3qZGSf3+dmQddA55LJASAOo9yD4hJ4Moyynrex52oYZzGc8L3hsLuLY2a5TcMziC5YAzbEmIiIipabE4dtvv/1G165dCQ0NZe/evdxzzz2EhYWxYMECEhISeP/998uiThERESlDKyauIPdELlVaVaH5wOaeLkcqiuMbYc0QSPmteO1NFgiuB40ecc51Zi693pciIiIinlLi32hGjhzJ3XffzfTp0wkODnYdv+GGGxgwYECpFiciIiJlI3V/KovuXUTy7mQAknc5992f747JrB4/UgoOfgM/3eZctMDsA1V7QfX+4F/lZAPTqb3ZCv5VnecUuImIiEgFU+LfbtavX89///vfQserVq1KYmJiqRQlIiIiZSc3I5d5feaRuNn93+1GfRtRs1NNzxQlFcvu92DtPc5hpDFd4aqPwTfM01WJiIiIeESJwzc/Pz/S0tIKHd+xYweRkZGlUpSIiIiUDcNhsOCuBSRuTiQwKpBbPrwFW4ANs8VMTMsYT5cnFUHST7DmbufjmgOh3Ttg8fFoSSIiIiKeVOLw7aabbuKpp57ik08+AcBkMrFv3z7Gjh1L3759S71AERERKT3fP/E92xdsx+Jj4fYFtxPXMc7TJUlF89dM57767dDhfedCBiIiIiKXsRL/NvTcc89x5MgRoqKiyMrKolOnTtStW5fg4GAmT55cFjWKiIhIKTi64yg/TfkJgN5v9lbwJqUv5zjs/9z5uPEjCt5EREREuICebyEhIfz00098//33bNq0CYfDwZVXXknXrl3Loj4REREpJbu/2w1AzetqcsW/rvBwNVIh7f0IHDlQ6QqofKWnqxERERHxCiUK3/Ly8vDz82Pz5s1cf/31XH/99WVVl4iIiJSyhBUJANS6vpaHK5EKyTBg11vOx3XuAZNWzRURERGBEg47tVqt1KhRg/z8/LKqR0RERMqAYRgk/OAM32p0quHhaqRCOr4RUn4Dsy/UGujpakRERES8Rokn4hg/fjzjxo3j+PHjZVGPiIiIlIGj24+SkZSB1c9K1bZVPV2OVEQFvd7i+oJPZc/WIiIiIuJFSjzn2yuvvMLOnTuJjY2lRo0aBAYGup3ftGlTqRUnIiIipSNhpbPXW7X21bD6lviff7mcOfIgNxlyjkHusZP748796ccOfu1sX/cez9YrIiIi4mVK/Nv3TTfdhElzeIiIiJQrBeGbhpwKACd2wvaXwJ4CRv6pzZHnXDAh5/ipUM2eWvzrhjSEqE5lVbWIiIhIuVTi8G3ixIllUIaIiIiUFcMw2LtyL6DwTYDkX+H7bpBzpGSvs1UC33DwCXPufcPBJ/y0x2EQ3RlMJZ7VRERERKRCK3b4lpmZySOPPMLChQux2+107dqVV155hYiIiLKsT0RERC7S8Z3HST+UjsXHQrX21TxdjnjS0TWw/AZnj7fKLaHmnWCyODdzwd7nVMBWEK75VAazhiuLiIiIXIhi/xY1YcIEZs+ezcCBA/Hz82Pu3Lncf//9zJ8/vyzrExERkYtUMOS0atuq2PxtHq5GLon03c4ebpkHIHP/yf0BOL4B8rMg8iro9BX4hHq6UhEREZEKr9jh2+eff87bb7/NP//5TwDuvPNOrrrqKvLz87FYLGVWoIiIiFwc13xvnTXk9LKQ9id81QgMR9HnY7rBtQvAGlj0eREREREpVcUO3/bv388111zjet62bVusVisHDx4kLi6uTIoTERGRi3P6fG81O9X0aC1yiRxe7gzefCMh6loIqAYBcc59YE0Ib6N52UREREQuoWKHb/n5+fj4+Li/2GolLy+v1IsSERGR0vHn4j9J25/mnO+tg+Z7uywkb3Lu6wyBFs94thYRERERKX74ZhgGd999N76+vq5j2dnZ/Pvf/yYw8NSwhc8//7x0KxQREZELkpuey5IHlgDQ7j/t8An0Oc8rpEI4vtG5D2vl2TpEREREBChB+DZo0KBCx+68885SLUZERERKz/dPfE/a/jQq1axEpwmdPF2OXAr5uZDyu/OxwjcRERERr1Ds8O3dd98tyzpERESkFB3ceJB1r6wD4MbXb1Svt8tF6lZw5IKtEgTW8nQ1IiIiIkIJwjcRERHxfvZMO7/P+Z0fJ/+I4TBo+s+m1O1Z19NlyaVSMN9b2JVgMnm2FhEREREBFL6JiIiUazsW7WDjGxtx5DvAgIMbDpJ1PAuAoCpB9Hixh4crlEtK872JiIiIeB2FbyIiIuXUgTUH+OTWT3DkOdyOV6pZiTYPtqHlkJb4V/b3UHXiEQXhW+UrPVuHiIiIiLgofBMRESmHMo9lMr//fBx5Dur3qk/j/o0BCIoJotb1tTBbzB6uUC45hx2Sf3U+Vs83EREREa+h8E1ERKScMRwGC/+1kLT9aYTVC+PWj27FN8TX02WJp6X+AY4csIVAcB1PVyMiIiIiJ+nP4iIiIuXM2lfW8teSv7D6Wek3v5+CN3EqWGyhcksw6Vc8EREREW+h38xERETKmY2znPN6dXu2GzFXxHi4GvEaWmxBRERExCspfBMRESlHUvelcvSPo5gsJprf2dzT5Yg3OX6y55vCNxERERGvovBNRESkHNn57U4AqrWrhl8lPw9XI14jLxOSNzsfa6VTEREREa+i8E1ERKQc2fXNLgDq9NSE+gI48mDnLFhUD/IzwScMQup7uioREREROY1WOxURESkn8u357P5uNwB1e9T1cDXicbnJ8L8ukPyL83lgTWg7S4stiIiIiHgZhW8iIiLlxN9r/yYnLQf/MH+qtKri6XLEk/Jz4ce+zuDNJwyaTYC6w8CilW9FREREvI3CNxERkXKiYL63Ot3rYLaod9NlyzBg3b1weDlYg6HLcqisxTdEREREvJXCNxERkXLCNd9bD833dllw5MPxjZB1ELITIeco2NPgxF9wYCGYLHD1fAVvIiIiIl5O4ZuIiEg5kHEkg4MbDwIK3y4LOcdgxT/g2Lqzt2kzE2J7XLqaREREROSClKsxK1OnTsVkMhEfH+86ZhgGEydOJDY2Fn9/fzp37szWrVvdXpeTk8NDDz1EREQEgYGB9OnThwMHDlzi6kVEREomJy2H1S+uZuX/rWTpqKVgQHTzaIKrBHu6NClLWYfgu07O4M0aBOHtoNpNUOceaDgKmk2Czt9A3fs8XamIiIiIFEO56fm2fv16Zs2aRfPm7kMrpk+fzgsvvMDs2bOpX78+Tz/9NN26dWPHjh0EBzv/cxIfH8+iRYuYN28e4eHhjBo1il69erFx40YsFosn3o6IiMh5/Tj1R35+5me3Y3V6qtdbuebIA0cuGPlg5EFuqnPV0tO3bdMgfSf4V4Hrv4PQxp6uWkREREQuQrkI39LT0xk4cCBvvvkmTz/9tOu4YRi89NJLPP7449x6660AvPfee0RHRzNnzhyGDRtGamoqb7/9Nh988AFdu3YF4MMPPyQuLo7vvvuOHj00XENERLzT9gXbAajfuz7BscH4BPtw1SNXebgqKZbUbZD8K6Tvdt8y9wPG+V8fWBO6/A+Capd1pSIiIiJSxspF+PbAAw9w44030rVrV7fwbc+ePSQmJtK9e3fXMV9fXzp16sSqVasYNmwYGzduxG63u7WJjY2ladOmrFq16qzhW05ODjk5Oa7naWlpZfDOREREinZ0x1GO7TiG2Wbm1g9vxTfE19MlyfnkJkPCx7DrLedCCcVh8QOfys7NVsm5D6wBTR6DgKplWq6IiIiIXBpeH77NmzePTZs2sX79+kLnEhMTAYiOjnY7Hh0dTUJCgquNj48PlStXLtSm4PVFmTp1KpMmTbrY8kVERC7Iji93AFDruloK3rxFXhZkH3LOyZZ18OT+EKTtgJSTvdwKmH2cc7UF14HA2s4ebEG1Iaimcx43k9W5WqnFx2NvR0REREQuDa8O3/bv389//vMfli5dip+f31nbmUwmt+eGYRQ6dqbztRk3bhwjR450PU9LSyMuLq6YlYuIiFycHV84w7f6fep7uJIKLi8Tco46t+wjJx8nnQrWTg/Z7Cnnv15oU6gzFGreCX4RZV6+iIiIiHg/rw7fNm7cSFJSEq1atXIdy8/P54cffuDVV19lxw7nf0wSExOpUqWKq01SUpKrN1xMTAy5ubkkJye79X5LSkqiY8eOZ723r68vvr7qaSAiIpdexpEM9q/aD0CDPg08XI2XctidixXYUyA35dTe9TjV/VjeCcjLcG75mScfp0N+dsnua/F3LoTgH+vc+1Vx9mar3AIqXQG+YaX4JkVERESkIvDq8K1Lly78/vvvbscGDx5Mw4YNGTNmDLVr1yYmJoZly5bRsmVLAHJzc1m5ciXTpk0DoFWrVthsNpYtW0b//v0BOHToEFu2bGH69OmX9g2JiIgUw5+L/wQDYlrGEBoX6ulyPM8w4M8ZzrnUco47Q7W8jNK7vtkHfCPAN9K594t0hmr+VdyDNv9YsIXAeXrXi4iIiIiczqvDt+DgYJo2bep2LDAwkPDwcNfx+Ph4pkyZQr169ahXrx5TpkwhICCAAQMGABAaGsrQoUMZNWoU4eHhhIWFMXr0aJo1a+Za/VRERMSbFAw5bXCTer2RlwXr7oO9HxZ93hoEPpVOLlZw2t71OBRsoc7QzBro3CyBpx77hp+cg02BmoiIiIiUDa8O34rj0UcfJSsri+HDh5OcnEy7du1YunQpwcHBrjYvvvgiVquV/v37k5WVRZcuXZg9ezYWi8WDlYuIiBRmz7Kza+kuQENOyTwAP9wCxzc4FydoMQ2irzsVrNlCwFzuf5URERERkQrOZBiG4ekiyoO0tDRCQ0NJTU0lJCTE0+WIiEgFtemtTSy6dxEhcSHEJ8SfdwGhCuvg17D6Lsg55uyddvWnEN3Z01WJiIiIiAAly4n052IREREvse2zbSz+92IAWgxucXkGb448+O0J2PaM83nlK+GaTyGolmfrEhERERG5QArfRERESlHmsUwMR8k7le9dvpfPB36OkW/Q/K7mdHqyUxlUVw5sf/5U8Fb/QWj5HFi0+riIiIiIlF8K30REREqBI8/B/P7z2b5g+0Vdp9nAZtz07k2YLeZSqqwcMQzY/Z7zccvnoNEoz9YjIiIiIlIKFL6JiIiUgqWjl15U8GYym2g5tCU3zrzx8gzeAFK3QtofYPaBOvd4uhoRERERkVKh8E1EROQibX5vM2tfXgtA/8/70/Dmhhd0nctyjrfT7Zvv3FfpAT6hnq1FRERERKSUKHwTEREphvzcfHYs2kHW8SwcdgeOPAf59nzsmXZ+nPwjANc+eS2Nbmnk4UrLKcOAfZ84H1fv79laRERERERKkcI3ERGR83DkOZh38zx2fr3zrG3q965P5wmdL11RFU3qVkjb7hxyWrW3p6sRERERESk1Ct9ERETOY+nopez8eidWfyt1utfBbDVjsVkwW82YbWZCa4TSYWQHTObLfNjoxSjo9Valp4acioiIiEiFovBNRETkHNa/vt41n9st799C49sae7iiCsgwTs33Vr2fZ2sRERERESlll+lyaiIiIuf39/q/+fqhrwG4fvL1Ct7KSvIvJ4ec+kK1Pp6uRkRERESkVCl8ExEROYvtC7Zj5BvU712fq8dd7elyKqZ9n8L3XZ2PY28AW4hn6xERERERKWUadioiInIWSVuSAKjTow4mk+ZzK1WZB+G3x2H3bOfzsNbQ6mWPliQiIiIiUhYUvomIiJxFQfgW1TTKw5WUc448sKdBXjpkJ8HO/8Ke98GRC5igyThoNhHMNk9XKiIiIiJS6hS+iYiIFCE3I5eUPSkARDVR+FYihuHs0XZwMaT+Aek7wWEv3C7yKrhiKkRdc8lLFBERERG5VBS+iYiIFOHItiMABEYHEhAR4OFqyhHDgN+egK2TC58z+4I10Bm2NXrEGb6JiIiIiFRwCt9ERESKoCGnF+DM4K3RaIjuAqGNwD9Ww0pFRERE5LKk8E1ERKQICt8uwO+TTgVvV74EDf/j0XJERERERLyB2dMFiIiIeKMjW53DTiObRHq4knLiyCrYMsn5WMGbiIiIiIiLwjcREZEiqOdbCTjyYP39zse1Byt4ExERERE5jcI3ERGRM2SnZHPi7xOAVjotlh2vQMpv4BMGLaZ7uhoREREREa+i8E1EROQMSVudvd5C4kLwDfH1cDVeLvMA/D7B+bjldPCL8Gw9IiIiIiJeRuGbiIjIGTTktJgMAzY8CHnpENHROeRURERERETcKHwTERE5g8K3YvpzBhz4Asw2aPM6mPRrhYiIiIjImfRbsoiIyBkKVjpV+HYOR1bDplHOxy2fh8rNPVuPiIiIiIiXUvgmIiJyhoKeb5FNIj1ciZfKPgo/9wcjD6r3h/oPeroiERERERGvpfBNRETkNBlJGWQeyQQTRDZS+FaIIx9WDXQutBDSANq9BSaTp6sSEREREfFaCt9EREROU9DrLaxOGLYAm4er8UJbJ0PiUrD4w9Wfgi3Y0xWJiIiIiHg1hW8iIiKnObjxIADRzaM9XIkXOrQMfp/ofNzmDajU1KPliIiIiIiUB1ZPFyAiIuJNDqw+AEDV9lU9XMkl5MiHnKOQlw75mZCXeXKfBflZYOSDww6b4gED6twLtf/l6apFRERERMoFhW8iIiInGYbhCt/iOsR5uJoy4MiHXbPg+EbIOnRqy0kCw1G8a1RuCa1fKds6RUREREQqEIVvIiIiJ6XuSyU9MR2z1UyVVlU8XU7psp+An++Ag1+dpYEJrEFg9QdLAFgDnHuLH5gsYDKDXxVoMcV5TEREREREikXhm4iIyEkFvd5iWsZg869Aiy2k74EfboKU353BWcOREFgL/Kuc2nyjwGzxdKUiIiIiIhWOwjcREZGT9q/eD0C1DtU8XMkFOv4LHP4fZOyDzH2QkeB8nHvced4vBjp9CeFtPFuniIiIiMhlROGbiIjISQU936q1L2fhW8pW+O0JOLDg7G3C28PVn0BgBZzLTkRERETEiyl8ExERAexZdhJ/SQTK2WIL21+CTSMBAzBB1d4Q2hgCq0NAdQisAQFx4BPq4UJFRERERC5PCt9ERESAQ5sO4chzEBQTRGiNchJUOezw+0TAgGo3QfPJUKmJp6sSEREREZHTKHwTERHhtCGnHaphMpk8XE0xJa0Eeyr4RsLVn2nBBBERERERL2T2dAEiIiLeoFzO93bgC+e+am8FbyIiIiIiXkrhm4iIXPYMwyh/K50axqnwrdrNHi1FRERERETOTuGbiIhc9lITUkk/lI7Zaia2daynyyme5M2QuR8sARDT1dPViIiIiIjIWSh8ExGRy97KSSsB55BTm7/Nw9UUU0Gvtyrdwerv2VpEREREROSsFL6JiMhlbc/yPWyevRlM0HV6OepB9nfBkNObPFuHiIiIiIick8I3ERG5bOVl57F42GIAWv+7NXEd4jxcUTFlJDiHnZrMENvL09WIiIiIiMg5WD1dgIiISFnJOZFDdnI2WclZ5GXnFTq/Zd4Wjv91nKAqQXSZ2sUDFV6gA1869xFXgV+EZ2sREREREZFzUvgmIiIVimEY/LXkL1Y8uYJDmw4V6zU3vHIDfqF+ZVxZKcnPgb9mOh9ryKmIiIiIiNfz6mGnU6dOpU2bNgQHBxMVFcXNN9/Mjh073NoYhsHEiROJjY3F39+fzp07s3XrVrc2OTk5PPTQQ0RERBAYGEifPn04cODApXwrIiJyCSRtSeKdq95hbq+5ruDN4mMhMDqQSjUrUalW4a3tQ21p1LeRhysvga1TIG07+EVDnSGerkZERERERM7Dq3u+rVy5kgceeIA2bdqQl5fH448/Tvfu3dm2bRuBgYEATJ8+nRdeeIHZs2dTv359nn76abp168aOHTsIDg4GID4+nkWLFjFv3jzCw8MZNWoUvXr1YuPGjVgsFk++RRERKSWGw2B+v/kc3X4Uq5+VNg+2oePojgRGBWIymTxdXulI2Qrbpjoft54BPpU9W4+IiIiIiJyXyTAMw9NFFNeRI0eIiopi5cqVXHvttRiGQWxsLPHx8YwZMwZw9nKLjo5m2rRpDBs2jNTUVCIjI/nggw+4/fbbATh48CBxcXEsWbKEHj16FOveaWlphIaGkpqaSkhISJm9RxERuTC7lu7iwx4f4hPswwPbHiCkWgX7WW04YNk1cHQVVO0N134BFSVUFBEREREpZ0qSE3n1sNMzpaamAhAWFgbAnj17SExMpHv37q42vr6+dOrUiVWrVgGwceNG7Ha7W5vY2FiaNm3qalOUnJwc0tLS3DYREfFe62asA6DF4BYVL3gD2PmmM3izBkHr1xS8iYiIiIiUE+UmfDMMg5EjR3L11VfTtGlTABITEwGIjo52axsdHe06l5iYiI+PD5UrVz5rm6JMnTqV0NBQ1xYXF1eab0dERErR8V3H+fOrPwFo+0BbD1dTBvIy4PcJzsdXTIZA/ZskIiIiIlJelJvw7cEHH+S3335j7ty5hc6dOZePYRjnnd/nfG3GjRtHamqqa9u/f/+FFS4iImVu/WvrwYC6PesSXj/c0+WUvh0zIPswBNWGuv/2dDUiIiIiIlIC5SJ8e+ihh/jyyy9Zvnw51apVcx2PiYkBKNSDLSkpydUbLiYmhtzcXJKTk8/apii+vr6EhIS4bSIi4n1y03P55Z1fAGj7UAXs9ZabAtumOR83mwQWH4+WIyIiIiIiJePV4ZthGDz44IN8/vnnfP/999SqVcvtfK1atYiJiWHZsmWuY7m5uaxcuZKOHTsC0KpVK2w2m1ubQ4cOsWXLFlcbEREpv3555xdyUnMIqxtG3Z51PV1O6fvjObCnQGgTqHGHp6sREREREZESsnq6gHN54IEHmDNnDl988QXBwcGuHm6hoaH4+/tjMpmIj49nypQp1KtXj3r16jFlyhQCAgIYMGCAq+3QoUMZNWoU4eHhhIWFMXr0aJo1a0bXrl09+fZEROQi/T7nd5aOWgo4e72ZzOV4EQJHPuQedw4vzTkC9hNgT4MdLznPN38azBaPligiIiIiIiXn1eHb66+/DkDnzp3djr/77rvcfffdADz66KNkZWUxfPhwkpOTadeuHUuXLiU4ONjV/sUXX8RqtdK/f3+ysrLo0qULs2fPxmLRf2JERMqr9a+vZ8kDS8CA5nc2p83wNp4uqfgMBxxdDfs+g9StkL4bMvaCkVd0+7A2UO2mS1qiiIiIiIiUDpNhGIaniygP0tLSCA0NJTU1VfO/iYh42C/v/MKXQ78EoM0DbbjhlRu8u9fbvvmQ9AM47JCfBYeXQ+ZZFvLxDQffSLCFgDUIfCpD0yehcvNLW7OIiIiIiJxVSXIir+75JiIicqb0xHS+ffhbAK4acxVdpnY57wrXHpW8GX66HTjjb13WYKh2M0R3hqA6zpVM/auAWf80i4iIiIhUJPoNX0REypWlo5eSk5ZDbOtYrp98vXcHbwC/jAEMiLwaYrqD2QYhDaBKT7D6e7o6EREREREpYwrfRESk3Njz/R5+/+h3MMGNr9+I2eLVi3bDoWWQuNQZuHV4z9m7TURERERELisK30RE5JJz5DlIP5zOiYMnsGfYi/UawzD4avhXALQZ3obY1rFlWeLFMxyweYzzcb3hCt5ERERERC5TCt9ERKTMGIbB7mW7+emZnzi44eDJg2DPtGM4Lmy9n8DoQK5/+vpSrLKM7J0Lyb84F05oMt7T1YiIiIiIiIcofBMRKYeykrPY8PoGMo9lerqUc9r34z4Orj9Y5DmTxURwlWB8Q3yLfT2Lj4Xrp1yPXyW/0iqxbKRug19GOR83HgN+EZ6tR0REREREPEbhm4hIOZObnstHPT/i73V/e7qUYrH6W2l1XytaDm2Jzd8GgC3QRmBUoPfP2XYhkjfD990g5yhUagYN4j1dkYiIiIiIeJDCNxGRciQ/N59P+n7C3+v+xj/Mn5b3tPTq1T79w/1pMagFgVGBni6l9BgOZ7CWnQR56Se3DLCnQ+5x+O1JsKdA5Svh+qVgDfB0xSIiIiIi4kEK30REyphhGBz+7TCJmxPhwqY5c/lz0Z/sWroLW4CNAUsGUK1dtdIpUiAjAbIOgf0E5J2A7MPO51mJzn32oZP7w2Dkn/taER2g8xLwqXRJShcREREREe+l8E1EpIycOHSC1S+sZvvn20nenVxq1zVbzfT/vL+Ct5IwHGBPdfZQy8t07vMznUFb0g9wYCGk/VGCC5rANxyswWALAkugc28NhOD60PQJsAWX1bsREREREZFyROGbiEgZyDmRw/vXv8/R7UcBsPpZqdahGla/i/uxa7FZaH1/a+r2qFsaZZYvjjzIPOAc0mlPd/ZOy0s/9+Ocoyd7tB0Ah/3c1zdZISDuZIgWDH6R4FcF/E9ufjGnPY4Cs+2SvG0RERERESnfFL6JiJQywzD4YvAXHN1+lODYYHq+0pO6PeviE+jj6dI8z5F3ao60vExn77PT967hnA5n0HZiJ5z4y7nP2AtG3sXd32R19k6zBjh7q1kDIKQRVLsJYm/QMFERERERESl1Ct9ERErZ6udX88dnf2C2men3aT/iOsR5uqRLJy8Tkn6E4xvg+EZI33VqDrW8dMjPvrjrm33BNwysQc7NFnzux7ZKEFjDuflFg+X/27vz6Kjq+//jr8kkM0yWmSyQBAIGFEUKEXEpq+ICiIhL+zseKojFYxetu19//tx6QP0ecUHcUWmLaLVV+xWrVuErLVtVRMEoMSCLBQWTEAhJJmSZycx8fn/cJCQkQCAZMjN5Ps65587cuctn7nmbw7z83M+HABQAAADA8UX4BgCdxISMvn71a/3z//1TkjTp6UmxH7wF/dajnZXfSDv+Iu182wrZjqRFD7TEhrXL2t7IlS0lD5RSTpZSGtau3pItLnzfBwAAAAA6GeEbALTBX+1XffURxghrpmxLmT668yP9uPZHSdKwXw7TWdefFa7mda6gz3rEs+YHq5eaCVjjo/n2Nsz2WSwFa61tIb/kL5Pq9kh1pdb4awdLPEHqNUZKP1PyDJESPFZPtKaeaSn0QAMAAADQbRC+AYh5oWBI+X/K16bFmxQKhA69o5HqKupU8X2Fastqj+lajmSHxt47VqPvHC2bzXaMLT5OSv4pfXWP9YhoR9jsVo+0nEul/ldLPUdJkf7dAQAAAOA4IXwDENOK1hfpgxs+UNEXRWG9jt1hV960PF3w8AVK6Z0S1mt1iAlJZV9I3zwoFX14YLvdZc306UiX4uKtQM2RfmB2z/hk65FQu8Pa3iNTcmZaM4I60ngUFAAAAAAOgfANQMTbtnSbti7ZqtINpSotLJW/yt/uYwN11uyYTrdTY+8ZK0+u57D7O5IdSs1NlSfXox6eHh1qd8So3S2VrpSK/9cK3Op2W9tt8dIpN0qD72oYS43eagAAAADQ2QjfAES0dS+u0wc3fNChc+RNy9OEuRMiu0fasQjVW+Ox1fwo1e5qWP8o1ZZIgWprqflB8n7b8rj4ZCnnMilvtuQ+uUuaDgAAAADdBeEbgIi18X826oPfWcFb3rQ8nTjxRGXlZSmxZ2K7z5GQmHBU+3e5UEDa/x+pcqNUWyT5yqwJDnxl1gQIzd/XV7b/vKnDpKzzpZxLpF7nMuEBAAAAABwnhG8AItL25du1ePpiyUhn/vZMXfLCJZE/gcHRCAWkPf+WfnhbqiyU6r1WmFazSwr52n+euATJ1Udy5UiJfa21q3fDzKJJ1vhsPUdKzozwfRcAAAAAwCERvgGIOLsLduuNK95Q0B/U4P8zWJOfnxw9wVuoXvJXNCzlUn3D2l8h+fYceDR072fW+7bYXZJ7sJSUa4VmzgzJkdH2a2dPJjsAAAAAgAhG+AYgolQVV+kvl/xF/iq/csfl6uev/1xx9ggMl3a9K33z39bjnyYomYDVcy1Q3f5zONKlfj+TMs+XnOlSgtvqtZbUn0ANAAAAAGIE4RuAiOGv9uuNy96Qd6dXGYMyNHXxVMU7I+zPVG2JtO5maef/HH6/BLeUkCo50iRH4zpdSmx4PDTlFKnXGOuxUQAAAABAzIqwX7UAYl0oENKG1zZo29JtMiEjSQr6gqrdV6uK7yvk3elVYs9ETftgmlzpri5ubTPVP0hbnpO2vWSNz2azS4PvkvpebvVSs8VbgZsjzVrH8ecVAAAAAED4BuA48Vf79d1H32n5fcu1d9PeQ+6XkJigqX+fqvST0o9j69QwAcInUtVmyV/ZMFZbhfUoaW2JVLrSerxUktLPlEb8SUobdnzbCAAAAACIOoRvAA6rfHu5Vvx+hfYU7pExxuqtZiQTMjLmoNdtCAVCqtlTI/9+f9M2V7pLZ990tpIykyRJ9gS7XOkuuTJcyhyaqaReSR1vuDFSbbFUvV2q3y8Fa6RAzYF1qE4yIWvxbpKKPrQmRjicrAukU2+X+kxmTDYAAAAAQLsQvgExqL62XoHaQIfOEQqE9MULX+iTRz5RoK5j52rk9Dh19o1na8xdY9TD06NTzinJCtNK/ilVFkrebw8s9d6jbGCGlDHqwDhtCZ4D654jpdShnddmAAAAAEC3QPgGxJj//PM/en3y6wrVhzrtnAMuGKARt41QvDNetjibZJNscTbZbLYD723W+mC2OJsSeyYqOStZjhSHtd+xMkYK1lmPgvrLpdofpe/fkn54s+2gzRYnJZ5ghWfxSVJ8omRPbFj3sMZtk01y9pT6XCL1HCXF2Y+9fQAAAAAAHITwDYgh9TX1ev/X73da8JbaP1XjHx2vn1z5k46FZpIVnFUWSnWlkn+fFZ75yw+89jWsA1VWwNa4hJq/9h/6/Em5Uq9zJPepB5aUgZLd2bF2AwAAAADQAYRvQAxZ9eAqVeyokLufWzcU3CBHsqND52vs3dZhgRrp46lS0T86fi5Jkq3h0dB0KXOsNOCXUua5jMMGAAAAAIg4hG9AjNhdsFtrnlgjSZr8/OTOHVOtI/wV0qpLpT0fS3EOqzdaY3DmSDvodbqUkCLZXdZjoY1LXI+W7+OTCNoAAAAAAFGB8A2IAfU19frHb/6hUCCkwT8frEGXDjr+jQgFrUdIfXukuj3W2rdH2vqSVPG1Ne7aeR9IvcYc/7YBAAAAANBFCN+AKGBCRr4qX6vtgdqA8hfm67OnPlPNnho5Uhya9MykTr64kYK1DeOzVUj1FQ3jrwWkkE/a96VUulIqW2ttb0uPLOn8/5XShnVu2wAAAAAAiHCEb0AEC/iscO3jOR/Lu7ON2TybSe2fqsnPT5Y7x330FwoFrfBs19+l8q+tgK152Baqb/+5HGmSs5fUo5e1TuwnnXq7lDzg6NsFAAAAAECUI3wDukCwPqiiL4pUVVSl/SX7VbuvVkF/UKFASMH6hrU/qK0fbD1i6JZ1WpZG/9/RGnrlQMWZ/VLVNqm+Sqr3HlgCja/3S6be6rUWrJN8e61HQyu/sWYhPRybXXKkSgmp1phscfHWtpRTpMxx1pJykhSX0Gn3CQAAAACAaEf4BhxHoUBIG17foNUPrlb5f8rbdUxKll1jr3fr9EsDstf/IFX/YIVm9VVSfZXstgorWHv7KHqntSXBI+VMkbIusHqsOVIbljQrcItPkjpj5lMAAAAAALoRwjegA0KBkEq+KtGOVTu085Od8lU2H5fNSCG/FPRZY6MFfarY5Vf5LivA6pHsV6+++5Ts9sqV7JU9Pii7PaQ4e1Bx9pDs9pA8GZXKG12geEdA2tzORsUnSwnutpf4ZGvGUVu8tXZmWEFbUj+p5yh6rQEAAAAA0MkI3wBZIdqeTXv04+c/Wj3STOt96mvqVV1abS27q1Rdul81e+tkQkdzJZtcyTUaM+UTnT3hczl6HNRbLT7lQI+zhFQpPlPSeEk2KSFFSsq1lh6ZVk+1FsFaSkO4Zj/GuwAAAAAAADob4RvCqra8VoVvFaq2rFaSZExDqtW4Oui9JPmr/SrfVq6yrWWqKqo6Dq00qq/2K1B3VClaE2dinXIHfa/cwd/LnX7w+Gy2hiAtTXKmy56UphPH9ZQz87eSa7bkSD8QtCW4rXHUAAAAAABAzOCXPo6aMUZ1FXVtfGBNJFBfU6/afbX6+pWvlb8wX/XVHRyL7Dhx9PCpz4Ai9eq7R3H2YKvP4xMCSvJUK8ndsKQZJWW7lZSdobjkHCnxXMmVIyXmHFj3yCJQAwAAAACgGyMVwFHZv3u/3vzZm9q1Zle7j8nMy1TOiJym97bmg/Y3f9mw3e6wK+2kNGWcnCF3P7fi7HHtb6C/UqookCoLpeodUs1OqeZHa9w1BRvGYPO3OsyekqHUHLviEpxSvEty9jz04siQXFlWTzUAAAAAAIDDIHxDu+37bp9em/jaEWfpTEhMULwrXn1H9NXI20dqwIUDWgZunS1QI21/Vdo63wremktsWJqLc0qpeVLa6VKvc6Ss86SkE8LXPgAAAAAA0G0RvnVTVcVVqthe0eZnoUBIdRV1qt1XK1+VTyZkFAqE9Oljn6q6tFppJ6Zp+pLpSjsxrdWxNrvt6IO2ulLpx/etEM0EpFCg5fpw24J1UvESyd8sEEweKGWcLaUOlZJPkpJPtCYisNmt2TwT+/EoKAAAAAAAOC5IILqpTW9v0pKblxz1cdmnZ2v6kulKzk7ueCMCtdLmp6TCOVKggxMrJJ8onXKLNOBqyZnR8bYBAAAAAAB0gm4Vvs2fP1+PP/64iouLNWTIED311FM655xzurpZXcLpcSrtpNY91yTJFmeTK80lV7pLTrdTtjibZJPc/dw6975z5XQ7O3Zx3z7pPy9bwVtNw9hxqadJ7sFWjzRb/IF189eH2uY+Vep9sRRn71i7AAAAAAAAOlm3Cd/efPNN3XbbbZo/f77GjBmjl156SRdffLE2btyoE07ofuN9DZsxTMNmDAvfBUJBqfZHqWqbVL1d8u2V/BVS9ffSrnesx0Ul6xHQYXOk/ldJtqOYWAEAAAAAACAK2IwxpqsbcTyMGDFCZ5xxhl544YWmbYMHD9YVV1yhOXPmHPF4r9crj8ejyspKud3dYJbLUMAaR823t2EpO/DaX2Z9Vl8lBfYftG54Hag+/PnTTpdO/p3U/2prdlEAAAAAAIAocTQ5Ubfo+eb3+7V+/XrdfffdLbZPnDhRn376aZvH+Hw++Xy+pvderzesbTzudvxF2viIFbKF6ptNYlAvBX1SfUXHrxGXICUNsMZjc2VLCR7JkSZlT5B6jpLCOQMqAAAAAABABOgW4dvevXsVDAaVlZXVYntWVpZKSkraPGbOnDl64IEHjkfzuoZvn1RRcOT9HGmSI0Ny9rQmMnD2tBZHmpSQYs0impAixTd73bjdkcE4bAAAAAAAoFvrFuFbI9tBPa2MMa22Nbrnnnt0xx13NL33er3q169fWNt3XPW9TPKcKtkSmk1ekNCwdkjOdMmRbn0GAAAAAACAY9ItkpWePXvKbre36uVWWlraqjdcI6fTKaezg7N6RrKkE6wFAAAAAAAAYdMtppd0OBw688wztWzZshbbly1bptGjR3dRqwAAAAAAABDrukXPN0m64447NGPGDJ111lkaNWqUFixYoB9++EHXX399VzcNAAAAAAAAMarbhG9Tp05VWVmZHnzwQRUXF2vo0KH68MMPlZub29VNAwAAAAAAQIyyGWNMVzciGni9Xnk8HlVWVsrtdnd1cwAAAAAAANBFjiYn6hZjvgEAAAAAAABdgfANAAAAAAAACBPCNwAAAAAAACBMCN8AAAAAAACAMCF8AwAAAAAAAMKE8A0AAAAAAAAIE8I3AAAAAAAAIEwI3wAAAAAAAIAwIXwDAAAAAAAAwoTwDQAAAAAAAAiT+K5uQLQwxkiSvF5vF7cEAAAAAAAAXakxH2rMiw6H8K2dqqqqJEn9+vXr4pYAAAAAAAAgElRVVcnj8Rx2H5tpT0QHhUIhFRUVKSUlRTabraub0ym8Xq/69eunnTt3yu12d3VzgEOiVhHtqGFEO2oYsYR6RrSjhhHtYqWGjTGqqqpSnz59FBd3+FHd6PnWTnFxcerbt29XNyMs3G53VBc8ug9qFdGOGka0o4YRS6hnRDtqGNEuFmr4SD3eGjHhAgAAAAAAABAmhG8AAAAAAABAmBC+dWNOp1OzZs2S0+ns6qYAh0WtItpRw4h21DBiCfWMaEcNI9p1xxpmwgUAAAAAAAAgTOj5BgAAAAAAAIQJ4RsAAAAAAAAQJoRvAAAAAAAAQJgQvgEAAAAAAABhQvgWYebMmaOzzz5bKSkpyszM1BVXXKHNmze32McYo9mzZ6tPnz5yuVw677zzVFhY2GKfBQsW6LzzzpPb7ZbNZlNFRUWra3355ZeaMGGCUlNTlZGRod/85jfav3//EdtYUFCgcePGyeVyKScnRw8++KCaz9tRXFysadOmadCgQYqLi9Ntt912TPcCkS0WavXjjz/WmDFjlJGRIZfLpVNPPVVPPvnksd0QRJ1YqOGVK1fKZrO1Wr799ttjuymIKrFQwzNnzmyzhocMGXJsNwVRKxbqWZKef/55DR48WC6XS4MGDdKrr7569DcDUSnSa7iurk4zZ85UXl6e4uPjdcUVV7Tah99x3Vtn1PC+fft08803a9CgQUpMTNQJJ5ygW265RZWVlS3OU15erhkzZsjj8cjj8WjGjBlt1vrBojmLIHyLMKtWrdKNN96ozz77TMuWLVMgENDEiRNVXV3dtM9jjz2mefPm6bnnntMXX3yh7OxsTZgwQVVVVU371NTUaNKkSbr33nvbvE5RUZHGjx+vgQMHau3atVq6dKkKCws1c+bMw7bP6/VqwoQJ6tOnj7744gs9++yzmjt3rubNm9e0j8/nU69evXTfffdp2LBhHbshiFixUKtJSUm66aabtHr1am3atEn333+/7r//fi1YsKBjNwdRIRZquNHmzZtVXFzctJx88snHdlMQVWKhhp9++ukWtbtz506lp6fryiuv7NjNQdSJhXp+4YUXdM8992j27NkqLCzUAw88oBtvvFHvv/9+x24OokKk13AwGJTL5dItt9yi8ePHt7kPv+O6t86o4aKiIhUVFWnu3LkqKCjQokWLtHTpUl133XUtrjVt2jR99dVXWrp0qZYuXaqvvvpKM2bMOGz7oj6LMIhopaWlRpJZtWqVMcaYUChksrOzzSOPPNK0T11dnfF4PObFF19sdfyKFSuMJFNeXt5i+0svvWQyMzNNMBhs2pafn28kma1btx6yPfPnzzcej8fU1dU1bZszZ47p06ePCYVCrfYfN26cufXWW9v7dRHFor1WG/3sZz8zV1999RG/L2JPNNbwoa6J7ikaa/hg77zzjrHZbGbHjh3t+s6IXdFYz6NGjTJ33nlni+NuvfVWM2bMmPZ/ccSMSKvh5n75y1+ayy+//LD78DsOHa3hRm+99ZZxOBymvr7eGGPMxo0bjSTz2WefNe2zZs0aI8l8++23hzxPtGcR9HyLcI3dM9PT0yVJ27dvV0lJiSZOnNi0j9Pp1Lhx4/Tpp5+2+7w+n08Oh0NxcQdKwOVySbIexTuUNWvWaNy4cXI6nU3bLrroIhUVFWnHjh3tvj5iTyzUan5+vj799FONGzeu3e1D7IjmGh4+fLh69+6tCy+8UCtWrGh32xBbormGG/3pT3/S+PHjlZub2+72ITZFYz37fD716NGjxXEul0uff/656uvr291GxIZIq2HgaHVWDVdWVsrtdis+Pl6S9ffU4/FoxIgRTfuMHDlSHo/nsOeJ9iyC8C2CGWN0xx13aOzYsRo6dKgkqaSkRJKUlZXVYt+srKymz9rjggsuUElJiR5//HH5/X6Vl5c3dW0uLi4+5HElJSVtXrt529D9RHut9u3bV06nU2eddZZuvPFG/epXv2p3+xAborWGe/furQULFujtt9/W4sWLNWjQIF144YVavXp1u9uH2BCtNdxccXGxlixZwt9gRG09X3TRRfrjH/+o9evXyxijdevWaeHChaqvr9fevXvb3UZEv0isYeBodFYNl5WV6aGHHtJvf/vbpm0lJSXKzMxstW9mZuZh/1uI9iyC8C2C3XTTTdqwYYP++te/tvrMZrO1eG+MabXtcIYMGaJXXnlFTzzxhBITE5Wdna0TTzxRWVlZstvtTfskJycrOTlZF1988WGv3dZ2dB/RXqv//ve/tW7dOr344ot66qmn2vweiG3RWsODBg3Sr3/9a51xxhkaNWqU5s+fr0suuURz585td/sQG6K1hptbtGiRUlNT2xwEHN1LtNbz73//e1188cUaOXKkEhISdPnllzeNw9V4bnQPkVrDQHt1Rg17vV5dcskl+slPfqJZs2Yd9hwHnycWs4j4rm4A2nbzzTfrvffe0+rVq9W3b9+m7dnZ2ZKsZLd3795N20tLS1ulwEcybdo0TZs2Tbt371ZSUpJsNpvmzZunAQMGSJI+/PDDpi7yjV2Zs7OzW6XKpaWlklon4OgeYqFWG8+Tl5en3bt3a/bs2brqqquOqo2IXrFQw82NHDlSr7322lG1D9EtFmrYGKOFCxdqxowZcjgcR9U2xJZormeXy6WFCxfqpZde0u7du5t6J6ekpKhnz55H1UZEr0itYaC9OqOGq6qqNGnSJCUnJ+udd95RQkJCi/Ps3r271XX37NnTdJ5YzCLo+RZhjDG66aabtHjxYi1fvrzpD2ijAQMGKDs7W8uWLWva5vf7tWrVKo0ePfqYrpmVlaXk5GS9+eab6tGjhyZMmCBJys3N1cCBAzVw4EDl5ORIkkaNGqXVq1fL7/c3Hf/RRx+pT58+6t+//zFdH9EpVmvVGCOfz3dM7UN0idUazs/Pb/EPIsSuWKrhVatWadu2ba1mQ0P3EUv1nJCQoL59+8put+uNN97QlClTWozPhdgU6TUMHEln1bDX69XEiRPlcDj03nvvtRoLc9SoUaqsrNTnn3/etG3t2rWqrKxsOk9MZhHHYVIHHIUbbrjBeDwes3LlSlNcXNy01NTUNO3zyCOPGI/HYxYvXmwKCgrMVVddZXr37m28Xm/TPsXFxSY/P9/84Q9/MJLM6tWrTX5+vikrK2va59lnnzXr1683mzdvNs8995xxuVzm6aefPmz7KioqTFZWlrnqqqtMQUGBWbx4sXG73Wbu3Lkt9svPzzf5+fnmzDPPNNOmTTP5+fmmsLCwk+4SIkEs1Opzzz1n3nvvPbNlyxazZcsWs3DhQuN2u819993XiXcKkSoWavjJJ58077zzjtmyZYv55ptvzN13320kmbfffrsT7xQiVSzUcKOrr77ajBgxohPuCqJVLNTz5s2bzZ///GezZcsWs3btWjN16lSTnp5utm/f3nk3ChEr0mvYGGMKCwtNfn6+ufTSS815553X9JutOX7HdV+dUcNer9eMGDHC5OXlmW3btrU4TyAQaDrPpEmTzGmnnWbWrFlj1qxZY/Ly8syUKVMO275ozyII3yKMpDaXl19+uWmfUChkZs2aZbKzs43T6TTnnnuuKSgoaHGeWbNmHfE8M2bMMOnp6cbhcJjTTjvNvPrqq+1q44YNG8w555xjnE6nyc7ONrNnz241tW9b187NzT3W24IIFAu1+swzz5ghQ4aYxMRE43a7zfDhw838+fNbTN2O2BULNfzoo4+ak046yfTo0cOkpaWZsWPHmg8++KBD9wXRIxZq2BjrH9Mul8ssWLDgmO8Fol8s1PPGjRvN6aefblwul3G73ebyyy833377bYfuC6JHNNRwbm5um+c+0vfgd1z30Bk1vGLFikOep/n/iCgrKzPTp083KSkpJiUlxUyfPt2Ul5cfsY3RnEXYjGkYoQ4AAAAAAABAp2LwAQAAAAAAACBMCN8AAAAAAACAMCF8AwAAAAAAAMKE8A0AAAAAAAAIE8I3AAAAAAAAIEwI3wAAAAAAAIAwIXwDAAAAAAAAwoTwDQAAAAAAAAgTwjcAAAAAAAAgTAjfAAAAuqGZM2fKZrPJZrMpISFBWVlZmjBhghYuXKhQKNTu8yxatEipqanhaygAAECUI3wDAADopiZNmqTi4mLt2LFDS5Ys0fnnn69bb71VU6ZMUSAQ6OrmAQAAxATCNwAAgG7K6XQqOztbOTk5OuOMM3Tvvffq3Xff1ZIlS7Ro0SJJ0rx585SXl6ekpCT169dPv/vd77R//35J0sqVK3XttdeqsrKyqRfd7NmzJUl+v1933XWXcnJylJSUpBEjRmjlypVd80UBAAC6EOEbAAAAmlxwwQUaNmyYFi9eLEmKi4vTM888o2+++UavvPKKli9frrvuukuSNHr0aD311FNyu90qLi5WcXGx7rzzTknStddeq08++URvvPGGNmzYoCuvvFKTJk3S1q1bu+y7AQAAdAWbMcZ0dSMAAABwfM2cOVMVFRX6+9//3uqzX/ziF9qwYYM2btzY6rO//e1vuuGGG7R3715J1phvt912myoqKpr2+e6773TyySdr165d6tOnT9P28ePH66c//akefvjhTv8+AAAAkSq+qxsAAACAyGKMkc1mkyStWLFCDz/8sDZu3Civ16tAIKC6ujpVV1crKSmpzeO//PJLGWN0yimntNju8/mUkZER9vYDAABEEsI3AAAAtLBp0yYNGDBA33//vSZPnqzrr79eDz30kNLT0/Xxxx/ruuuuU319/SGPD4VCstvtWr9+vex2e4vPkpOTw918AACAiEL4BgAAgCbLly9XQUGBbr/9dq1bt06BQEBPPPGE4uKsoYLfeuutFvs7HA4Fg8EW24YPH65gMKjS0lKdc845x63tAAAAkYjwDQAAoJvy+XwqKSlRMBjU7t27tXTpUs2ZM0dTpkzRNddco4KCAgUCAT377LO69NJL9cknn+jFF19scY7+/ftr//79+te//qVhw4YpMTFRp5xyiqZPn65rrrlGTzzxhIYPH669e/dq+fLlysvL0+TJk7voGwMAABx/zHYKAADQTS1dulS9e/dW//79NWnSJK1YsULPPPOM3n33Xdntdp1++umaN2+eHn30UQ0dOlSvv/665syZ0+Ico0eP1vXXX6+pU6eqV69eeuyxxyRJL7/8sq655hr913/9lwYNGqTLLrtMa9euVb9+/briqwIAAHQZZjsFAAAAAAAAwoSebwAAAAAAAECYEL4BAAAAAAAAYUL4BgAAAAAAAIQJ4RsAAAAAAAAQJoRvAAAAAAAAQJgQvgEAAAAAAABhQvgGAAAAAAAAhAnhGwAAAAAAABAmhG8AAAAAAABAmBC+AQAAAAAAAGFC+AYAAAAAAACEyf8H+7i2nZLuckIAAAAASUVORK5CYII=", + "text/plain": [ + "
" + ] + }, + "metadata": {}, + "output_type": "display_data" + } + ], + "source": [ + "# Plot cumulative precipitation\n", + "plt.plot(daily_neon_prect['time'], cumulative_daily_neon_prect, label=\"NEON\", color=\"orange\", alpha=1)\n", + "plt.plot(prism_times, cumulative_prism_precip_vals, label='PRISM', color='purple', alpha=1)\n", + "plt.rcParams[\"figure.figsize\"] = (15,5)\n", + "plt.xlabel('Date')\n", + "plt.ylabel('Precip (mm)')\n", + "plt.title(\"PRISM and NEON Cumulative Precipitation at {} in {}\".format(site, year))\n", + "plt.legend()\n", + "plt.show()" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "12c21fb5-90cb-4146-be9c-05bddf220b2d", + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 [CTSM] (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.11.4" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/_sources/notebooks/ProjectExamples/Plot_flux_climatology.ipynb b/_sources/notebooks/ProjectExamples/Plot_flux_climatology.ipynb new file mode 100644 index 0000000..edf8160 --- /dev/null +++ b/_sources/notebooks/ProjectExamples/Plot_flux_climatology.ipynb @@ -0,0 +1,626 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "a1542d31-3794-4108-8544-2becd146ba72", + "metadata": { + "tags": [] + }, + "source": [ + "# Create Climatology Plots for NEON sites\n", + "\n", + "This notebook creates an annual climatology of observed and simulated fluxes. \n", + "\n", + "Examples can be seen in Fig 3 of the [NCAR-NEON system overview paper](https://doi.org/10.5194/egusphere-2023-271). \n", + "\n", + "##### Author: Negin Sobhani negins@ucar.edu [@negin513](https://github.com/negin513)\n", + "- Modified by: Will Wieder (wwieder@ucar.edu ; [@wwieder](https://github.com/wwieder)) and Teagan King (tking@ucar.edu ; [@TeaganKing](https://github.com/teaganking))\n", + "##### Last revised: 2023-05-31\n", + " \n", + "
\n", + " \"Tree\n", + "
\n", + " Mean daily flux climatology at the NEON Treehaven site (TREE) in Wisconsin.\n", + "
\n", + "
\n", + "\n", + "_______\n", + "\n", + "This notebook includes scripts for:\n", + "\n", + "1. Reading evaluation (NEON) and model (CTSM) data for all neon sites\n", + "2. Making climatology figures, including time-series with standard deviation as shaded regions \n", + "\n", + "This code works more efficiently using dask. \n", + "- Using 16 dask workers it will take ~45 minutes to create plots for all NEON sites.\n", + "- The code below does not use dask, but works well enough for individual sites, although it can overload memory, especially if you save your plots to disk.\n", + "- It will take over 1.5 minutes just to read in the model data, which has 365 files / year" + ] + }, + { + "cell_type": "markdown", + "id": "10ab2a31-cbf5-4178-88a4-dc35d7707136", + "metadata": {}, + "source": [ + "# Imports:" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "68ce59c2-2769-431d-b565-880c82cf34f1", + "metadata": {}, + "outputs": [], + "source": [ + "import os\n", + "import time\n", + "import datetime\n", + "\n", + "import numpy as np\n", + "import pandas as pd\n", + "import xarray as xr\n", + "\n", + "from glob import glob\n", + "from os.path import join\n", + "\n", + "import matplotlib\n", + "import matplotlib.pyplot as plt\n", + "import matplotlib.dates as mdates\n", + "\n", + "import calendar\n", + "import tqdm\n", + "import cftime\n", + "\n", + "from neon_utils import download_eval_files\n", + "from neon_utils import fix_time_h1" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "d75ba391-9350-4daf-8550-38af54eb26df", + "metadata": {}, + "outputs": [], + "source": [ + "print('xarray '+xr.__version__) # was working with 2023.5.0" + ] + }, + { + "cell_type": "markdown", + "id": "c3fa2e7d-b590-4cac-b2de-4acff9309f72", + "metadata": {}, + "source": [ + "## User defined options\n", + "Modify the directory structures below for your own cases." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "feecdae6-4df7-466e-9693-e7b28179fcd2", + "metadata": {}, + "outputs": [], + "source": [ + "neon_sites = ['ABBY'] # list of the sites you want to plot\n", + "case = '.transient' # this should be the rest of your case name for each neon_site \n", + " # (e.g. \"site.transient\" or \"site.experiment.transient\")\n", + "save_switch = True # set to false to save time and memory.\n", + "years = [\"2018\",\"2019\",\"2020\",\"2021\"]" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "183e2011-73ec-451d-8ecc-edfe3b9e6ac5", + "metadata": {}, + "outputs": [], + "source": [ + "# Make the figures directory if it's not already there\n", + "plot_dir = '~/scratch/NEON_cases/figures'\n", + "plot_dir = os.path.realpath(os.path.expanduser(plot_dir))\n", + "if not os.path.isdir(plot_dir):\n", + " print (\"figures directory does not exist... creating it now!\")\n", + " os.makedirs(plot_dir, exist_ok=True)\n", + "else:\n", + " print(\"figures directory already exists\")" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "c27b7001-8e43-481c-a0a2-4dbce71d87ff", + "metadata": {}, + "outputs": [], + "source": [ + "# Make the eval_files directory if it's not already there\n", + "eval_dir = '~/scratch/NEON_cases/eval_files'\n", + "eval_dir = os.path.realpath(os.path.expanduser(eval_dir))\n", + "if not os.path.isdir(eval_dir):\n", + " print (\"eval directory does not exist... creating it now!\")\n", + " os.makedirs(eval_dir, exist_ok=True)\n", + "else:\n", + " print(\"eval directory already exists\")" + ] + }, + { + "cell_type": "markdown", + "id": "0dd59976-8014-4821-9623-20d230173100", + "metadata": {}, + "source": [ + "### Download NEON Evaluation data" + ] + }, + { + "cell_type": "markdown", + "id": "8016ab40-52a9-4b4a-8146-e7529672a545", + "metadata": {}, + "source": [ + "
\n", + "Note This is slow and only has to be done once (assuming NEON eval files have not been updated).\n", + "
" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "e4c927c3-5519-4284-939c-db58e777aa6e", + "metadata": { + "tags": [] + }, + "outputs": [], + "source": [ + "for neon_site in neon_sites:\n", + " site_dir = eval_dir+'/'+neon_site\n", + " site_dir = os.path.realpath(os.path.expanduser(site_dir))\n", + " if not os.path.isdir(site_dir):\n", + " download_eval_files(neon_site,eval_dir)\n", + " else:\n", + " print(site_dir +\" exists\")" + ] + }, + { + "cell_type": "markdown", + "id": "90ec7dbb-609d-4033-905b-00ab54bd9db4", + "metadata": {}, + "source": [ + "-----\n", + "## Define Useful Functions and Objects" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "4ce9d25f-ffcd-45c8-988b-63a7ea60d83e", + "metadata": {}, + "outputs": [], + "source": [ + "def shaded_tseries( df_daily, df_daily_std, var, ax, color1= '#e28743',color2='#1d657e'):\n", + " \n", + " plot_var = var.obs_var\n", + " sim_var = var.sim_var\n", + " plot_var_desc = var.long_name\n", + " plot_var_unit = var.unit\n", + " \n", + " ax.plot ( df_daily.time, df_daily[sim_var], marker = 'o' , linestyle ='dashed', color = color2, label=\"CTSM\", alpha = 0.9)\n", + " ax.plot ( df_daily.time, df_daily[plot_var], marker = 'o' , color = color1,label=\"NEON\", alpha = 0.9)\n", + " \n", + " ax.fill_between(df_daily.time, \n", + " df_daily[plot_var]-df_daily_std[plot_var], \n", + " df_daily[plot_var]+df_daily_std[plot_var] ,alpha=0.15, color = color1)\n", + " ax.fill_between(df_daily.time, \n", + " df_daily[sim_var]-df_daily_std[sim_var], \n", + " df_daily[sim_var]+df_daily_std[sim_var] ,alpha=0.15, color = color2)\n", + "\n", + " ax.set_xlabel('Time', fontsize=17)\n", + " ax.set_ylabel(plot_var_desc+\" [\"+plot_var_unit+\"]\", fontsize=17)\n", + " ax.margins(x=0.02)\n", + "\n", + " \n", + " \n", + "def climatology_tseries_allvars_fig3 (fig, df_daily, df_daily_std, all_vars, plot_dir, color1= '#e28743',color2='#1d657e' , save_switch=False):\n", + " panel_labels = [\"(a)\", \"(b)\", \"(c)\", \"(d)\", \"(e)\"]\n", + "\n", + " axes = fig.subplots(nrows=5, ncols=1)\n", + " axe = axes.ravel()\n", + "\n", + " for index, var in enumerate(all_vars):\n", + " ax = axe[index]\n", + " \n", + " shaded_tseries ( df_daily, df_daily_std, var, ax,color1,color2)\n", + " \n", + " ax.text(.025,0.90,panel_labels[index],\n", + " horizontalalignment='left',\n", + " transform=ax.transAxes, fontweight='bold',fontsize=19)\n", + "\n", + "\n", + " # Set the locator for boxplots\n", + " locator = mdates.MonthLocator() # every month\n", + " \n", + " # Specify the format - %b gives us Jan, Feb...\n", + " fmt = mdates.DateFormatter('%b') \n", + "\n", + " if index == 0:\n", + " ax.text(.5,1.03,'NEON site : '+neon_site + ' [2018-2021]',\n", + " horizontalalignment='center',\n", + " transform=ax.transAxes, fontweight='bold',fontsize=19)\n", + " ax.legend(fontsize = 17)\n", + "\n", + "\n", + " ax.tick_params(axis='both', which='both', labelsize=17,width=1,length=7)\n", + " ax.tick_params(axis='x',direction=\"in\", length = 7)\n", + " ax.yaxis.set_ticks_position('both')\n", + " ax.tick_params(axis='y',direction=\"out\", length = 7)\n", + " \n", + " X=ax.xaxis\n", + " X.set_major_locator(locator)\n", + " X.set_major_formatter(fmt)\n", + " \n", + " ax.get_yaxis().set_label_coords(-0.05,0.5)\n", + "\n", + " if index == 5:\n", + " X = plt.gca().xaxis\n", + " X.set_major_locator(locator)\n", + " X.set_major_formatter(fmt)\n", + "\n", + " ax.set_xlabel('Month', fontsize=17)\n", + " fig.subplots_adjust(wspace=0, hspace=0)\n", + "\n", + " if save_switch:\n", + " \n", + " plot_name = neon_site+'_'+'climatology_tseries'+'_'+'allvars.png'\n", + " plot_dir1 = os.path.join(plot_dir, 'climatology_tseries_final', 'png')\n", + " if not os.path.isdir(plot_dir1):\n", + " os.makedirs(plot_dir1, exist_ok=True) \n", + " \n", + " print ('Saving '+ os.path.join(plot_dir1,plot_name))\n", + " plt.savefig (os.path.join(plot_dir1,plot_name), dpi=600,bbox_inches='tight') \n", + " \n", + " \n", + " plot_name = neon_site+'_'+'climatology_tseries'+'_'+'allvars.pdf'\n", + " plot_dir2 = os.path.join(plot_dir, 'climatology_tseries_final', 'pdf')\n", + " if not os.path.isdir(plot_dir2):\n", + " os.makedirs(plot_dir2, exist_ok=True) \n", + "\n", + " \n", + " print ('Saving '+ os.path.join(plot_dir2,plot_name))\n", + " plt.savefig (os.path.join(plot_dir2,plot_name), dpi=600,bbox_inches='tight', format = 'pdf') \n", + " else:\n", + " plt.show()\n", + " " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "167472fe-4915-4790-bc9e-c17fa6bc0e85", + "metadata": {}, + "outputs": [], + "source": [ + "class PlotVariable ():\n", + " def __init__(self, short_name, long_name, unit):\n", + " self.short_name = short_name\n", + " self.long_name = long_name\n", + " self.unit = unit\n", + " self.obs_var = short_name\n", + " self.sim_var = 'sim_'+short_name\n" + ] + }, + { + "cell_type": "markdown", + "id": "de6fa84e-b33a-44a1-aed3-c4c44e9d81c1", + "metadata": {}, + "source": [ + "## Define variables to create plots\n", + "\n", + "Create a list of variables for the plots. " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "c51ea8d8-6d00-49a9-9594-83d52410ed95", + "metadata": {}, + "outputs": [], + "source": [ + "all_vars= [] \n", + "failed_sites = [] \n", + "\n", + "plot_var = 'Rnet'\n", + "sim_var = 'sim_'+plot_var\n", + "plot_var_desc = \"Net Radiation\"\n", + "plot_var_unit= \"W m⁻²\"\n", + "this_var = PlotVariable(plot_var, plot_var_desc, plot_var_unit)\n", + "all_vars.append(this_var)\n", + "\n", + "plot_var = 'FSH'\n", + "sim_var = 'sim_'+plot_var\n", + "plot_var_desc = 'Sensible Heat Flux'\n", + "plot_var_unit= \"W m⁻²\"\n", + "this_var = PlotVariable(plot_var, plot_var_desc, plot_var_unit)\n", + "all_vars.append(this_var)\n", + "\n", + "plot_var = 'EFLX_LH_TOT'\n", + "sim_var = 'sim_'+plot_var\n", + "plot_var_desc = \"Latent Heat Flux\"\n", + "plot_var_unit= \"W m⁻²\"\n", + "this_var = PlotVariable(plot_var, plot_var_desc, plot_var_unit)\n", + "all_vars.append(this_var)\n", + "\n", + "plot_var = 'GPP'\n", + "sim_var = 'sim_'+plot_var\n", + "plot_var_desc = \"Gross Primary Production\"\n", + "plot_var_unit= \"gC m⁻² day⁻¹\"\n", + "this_var = PlotVariable(plot_var, plot_var_desc, plot_var_unit)\n", + "all_vars.append(this_var)\n", + "\n", + "plot_var = 'NEE'\n", + "sim_var = 'sim_'+plot_var\n", + "plot_var_desc = \"Net Ecosystem Exchange\"\n", + "plot_var_unit= \"gC m⁻² day⁻¹\"\n", + "this_var = PlotVariable(plot_var, plot_var_desc, plot_var_unit)\n", + "all_vars.append(this_var)" + ] + }, + { + "cell_type": "markdown", + "id": "fbe596ba-3fd7-46f1-b1ca-e3ab79709354", + "metadata": {}, + "source": [ + "---------------------------\n", + "## Make Climatology Figure" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "c913bb51-ab6d-4f78-8a10-2792dd5575aa", + "metadata": {}, + "outputs": [], + "source": [ + "# Read only these variables from the whole netcdf files\n", + "def preprocess (ds):\n", + " variables = ['FCEV', 'FCTR', 'FGEV','FSH','GPP','FSA','FIRA','AR','HR','ELAI']\n", + "\n", + " ds_new= ds[variables]\n", + " return ds_new" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "d206a7cf-895b-4269-9008-e2c644e9a932", + "metadata": {}, + "outputs": [], + "source": [ + "# Set some defaults for our figures\n", + "plt.rcParams[\"font.weight\"] = \"bold\"\n", + "plt.rcParams[\"axes.labelweight\"] = \"bold\"\n", + "font = {'weight' : 'bold',\n", + " 'size' : 15} \n", + "matplotlib.rc('font', **font)" + ] + }, + { + "cell_type": "markdown", + "id": "0dd6342a-689f-4385-90e8-4a96f6e30056", + "metadata": {}, + "source": [ + "Loop through the list of sites and make plots for all of them.\n", + "If you want to save your plots change `save_switch = True`. " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "543a4bc6-9bac-4485-a9bf-063bf93a80b2", + "metadata": {}, + "outputs": [], + "source": [ + "for neon_site in neon_sites:\n", + " try: \n", + " start_site = time.time()\n", + "\n", + " print ('---------------------------')\n", + " print (\"Making plots for \"+neon_site)\n", + " sim_files =[]\n", + " for year in years:\n", + " sim_path = \"~/scratch/NEON_cases/archive/\"+neon_site+case+\"/lnd/hist/\"\n", + " sim_path = os.path.realpath(os.path.expanduser(sim_path))\n", + " sim_files.extend(sorted(glob(join(sim_path,neon_site+case+\".clm2.h1.\"+year+\"*.nc\"))))\n", + "\n", + " print(sim_path)\n", + " print(\"All simulation files for all years: [\", len(sim_files), \"files]\")\n", + " start = time.time()\n", + "\n", + " ds_ctsm = xr.open_mfdataset(sim_files, decode_times=True, combine='by_coords',\n", + " parallel=True,preprocess=preprocess)\n", + " ds_ctsm = fix_time_h1(ds_ctsm)\n", + "\n", + " end = time.time()\n", + " print(\"Reading all simulation files took:\", end-start, \"s.\")\n", + "\n", + " eval_files = []\n", + " for year in years:\n", + " eval_files.extend(sorted(glob(join(site_dir,neon_site+\"_eval_\"+year+\"*.nc\"))))\n", + "\n", + " print(site_dir)\n", + " print (\"All evaluation files for all years: [\", len(eval_files), \"files]\")\n", + "\n", + " start = time.time()\n", + "\n", + " ds_eval = xr.open_mfdataset(eval_files, decode_times=True, combine='by_coords')\n", + "\n", + " end = time.time()\n", + " print(\"Reading all observation files took:\", end-start, \"s.\")\n", + "\n", + " print (\"Processing data...\")\n", + " # Convert CTSM data to a Pandas Dataframe for easier handling:\n", + " ctsm_vars = ['FCEV', 'FCTR', 'FGEV','FSH','GPP','FSA','FIRA','AR','HR','ELAI']\n", + "\n", + " df_ctsm = pd.DataFrame({'time':ds_ctsm.time})\n", + " df_ctsm['time'] = pd.to_datetime(df_ctsm['time'],format= '%Y-%m-%d %H:%M:%S' )\n", + "\n", + " for var in tqdm.tqdm(ctsm_vars):\n", + " sim_var_name = \"sim_\"+var\n", + " field = np.ravel ( ds_ctsm[var]) \n", + " df_ctsm[sim_var_name]=field\n", + " # Shift simulation data by one\n", + " df_ctsm[sim_var_name]=df_ctsm[sim_var_name].shift(-1).values\n", + "\n", + " # Convert NEON data to a Pandas Dataframe for easier handling:\n", + " eval_vars = ['NEE','FSH','EFLX_LH_TOT','GPP','Rnet']\n", + "\n", + " df_all = pd.DataFrame({'time':ds_eval.time})\n", + "\n", + " for var in eval_vars:\n", + " field = np.ravel (ds_eval[var])\n", + " df_all[var]=field\n", + " \n", + " # Merge two pandas dataframe on time\n", + " df_all=df_all.merge(df_ctsm.set_index('time'), on='time', how='left')\n", + "\n", + " clm_var = 'sim_EFLX_LH_TOT'\n", + " # Latent Heat Flux:\n", + " # EFLX_LH_TOT = FCEV + FCTR +FGEV\n", + " df_all [clm_var] = df_all['sim_FCEV']+ df_all['sim_FCTR']+ df_all['sim_FGEV']\n", + "\n", + " clm_var = 'sim_Rnet'\n", + " # Net Radiation:\n", + " # Rnet = FSA-FIRA\n", + " df_all [clm_var] = df_all ['sim_FSA']-df_all['sim_FIRA']\n", + "\n", + " clm_var = 'sim_NEE'\n", + " # Net Ecosystem Exchange\n", + " # NEE = GPP - (AR+HR)\n", + " # The signs are opposite so we calculated negative NEE\n", + " df_all [clm_var] = -(df_all ['sim_GPP']-(df_all['sim_AR']+df_all['sim_HR']))\n", + "\n", + " # Convert NEE units from umolm-2s-1 to gC/m2/s\n", + " df_all ['NEE']= df_all ['NEE']*(12.01/1000000)\n", + " df_all ['GPP']= df_all ['GPP']*(12.01/1000000)\n", + " \n", + " # Convert gC/m2/s to gC/m2/day\n", + " df_all ['NEE']= df_all['NEE']*60*60*24\n", + " df_all ['sim_NEE']= df_all['sim_NEE']*60*60*24\n", + "\n", + " df_all ['GPP']= df_all['GPP']*60*60*24\n", + " df_all ['sim_GPP']= df_all['sim_GPP']*60*60*24\n", + "\n", + " # Extract year, month, day, hour information from time\n", + " df_all['year'] = df_all['time'].dt.year\n", + " df_all['month'] = df_all['time'].dt.month\n", + " df_all['day'] = df_all['time'].dt.day\n", + " df_all['hour'] = df_all['time'].dt.hour\n", + "\n", + " # Calculate daily average for every day \n", + " df_daily_allyears = df_all.groupby(['year','month','day']).mean().reset_index()\n", + " df_daily_allyears['time']=pd.to_datetime(df_daily_allyears[[\"year\",\"month\", \"day\"]])\n", + " \n", + " # Calculate average of daily averages for all years\n", + " df_daily = df_daily_allyears.groupby(['month','day']).mean().reset_index()\n", + " df_daily['year']='2020'\n", + " df_daily['time']=pd.to_datetime(df_daily[[\"year\",\"month\", \"day\"]])\n", + " \n", + " # Calculate Standard Deviation of daily averages over years\n", + " df_daily_std = df_daily_allyears.groupby(['month','day']).std().reset_index()\n", + " df_daily_std['time'] = df_daily['time']\n", + "\n", + " df_daily['site']=neon_site\n", + "\n", + " print (\"Making climatology plots...\")\n", + " color1 = '#e28743'\n", + " color2 = '#1d657e'\n", + "\n", + " #========================================================================\n", + " fig = plt.figure(num=None, figsize=(27, 37), facecolor='w', edgecolor='k')\n", + " climatology_tseries_allvars_fig3( fig, df_daily, df_daily_std, all_vars, plot_dir, color1,color2, save_switch)\n", + " \n", + " end_site = time.time()\n", + " print(\"Making these plots for \"+neon_site+\" took : \", end_site-start_site, \"s.\")\n", + "\n", + " except Exception as e: \n", + " print (e)\n", + " print ('THIS SITE FAILED:', neon_site)\n", + " failed_sites.append(neon_site)\n", + " pass\n", + "\n", + "print (\"Making plots for \", len(failed_sites), \"sites failed : \")\n", + "print (*failed_sites, sep=\" \\n\")" + ] + }, + { + "cell_type": "markdown", + "id": "cd34a7c4-7f02-46c3-aa24-9ceb2d81fb82", + "metadata": {}, + "source": [ + "#### This code takes some time to run (over 1.5 minutes just to read in the daily model data!)\n", + "It's a good idea to confirm that you're opening the number of files you're expecting. This should include:\n", + "- Daily simulation data from CLM for n years +\n", + "- Monthly evaluation files from NEON for n years\n", + "\n", + "---\n", + "\n", + "**After your plot comes up, what do you see?** \n", + "- How does the CLM simulation look compared to the NEON observations?\n", + "- If net radiation doesn't look good, it suggests there's an issue with energy balance and albedo.\n", + "- If sensible and latent heat fluxes are off, what could this suggest?\n", + "- Does the timing and magnitude of GPP fluxes seem sensible in the both model AND observations?\n", + "- What about the timing and magnitude of NEE? Remember, in CLM we're making steady state assumptions about the long-term net C flux. Does this assumption necessarily hold in real world ecosystems?\n", + "\n", + "**Where can I even start looking for clues?**\n", + "- Does the simulated LAI at your site look reasonable?\n", + " - This can be done with monthly (h0) files, but daily (h1) may be more instructive.\n", + "- How does the forcing data look? \n", + " - Specifically, try looking at precipitation (from NEON input data), or the sum of RAIN and SNOW (from model history files)." + ] + }, + { + "cell_type": "markdown", + "id": "1e397596-9bbb-4863-a480-0a5ac2527dc0", + "metadata": {}, + "source": [ + "
\n", + "Congratualtions: \n", + " \n", + "You've done the easy part!\n", + "\n", + "Diagnosing sources of potential biases is both an art and a science. \n", + "\n", + "Please ask for help if you're going to dive into this, and also let us know what you find!\n", + "\n", + "
" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "dd25b86a-175c-4b4c-86ba-21aef66b1dc1", + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.9.12" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/_sources/notebooks/ProjectExamples/QuickPlot_CTSM-FATESsp.ipynb b/_sources/notebooks/ProjectExamples/QuickPlot_CTSM-FATESsp.ipynb new file mode 100644 index 0000000..84c3030 --- /dev/null +++ b/_sources/notebooks/ProjectExamples/QuickPlot_CTSM-FATESsp.ipynb @@ -0,0 +1,556 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "51f96e25-587b-4108-a7d9-34666f7a50e6", + "metadata": {}, + "source": [ + "# Quick plots - CTSM-FATESsp\n", + "## Quickly look at various output from FATESsp\n", + "\n", + "This tutorial is an introduction to [xarray](https://docs.xarray.dev/en/stable/user-guide/terminology.html) and [matplotlib](https://matplotlib.org/stable/index.html). There is plenty more information to be found at the documentation for these libraries.\n", + "\n", + "This tutorial can be be run either on data from cases that you ran earlier, or can be run on pre-staged data.\n", + "\n", + "In this tutorial you will find steps and instructions to:\n", + "\n", + "1. Load python libraries\n", + "2. Locate history files\n", + "3. Read in history files\n", + "4. Make plots for variables including soil moisture and GPP\n", + "\n", + "------" + ] + }, + { + "cell_type": "markdown", + "id": "7edf783f-9442-4a1b-ab7c-e9455be3ac5b", + "metadata": { + "tags": [] + }, + "source": [ + "## 1. Load Datasets" + ] + }, + { + "cell_type": "markdown", + "id": "33b035fb-f248-4e16-aeca-21b89815fe20", + "metadata": { + "tags": [] + }, + "source": [ + "### 1.1 Load Python Libraries\n", + "We always start by loading in the libraries we're going to use for the script. There are more libraries being loaded here than we'll likely use, but this list is a good one to get started for most of your plotting needs.\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "87882ecf-c37c-4b01-bfb4-24e56d671777", + "metadata": {}, + "outputs": [], + "source": [ + "import os\n", + "import time\n", + "import datetime\n", + "\n", + "import numpy as np\n", + "import pandas as pd\n", + "import xarray as xr\n", + "\n", + "from glob import glob\n", + "from os.path import join\n", + "\n", + "import matplotlib\n", + "import matplotlib.pyplot as plt\n", + "import matplotlib.dates as mdates\n", + "\n", + "from neon_utils import fix_time_h1" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "d3039504-ae5d-4653-acac-44a402cef436", + "metadata": {}, + "outputs": [], + "source": [ + "# It's helpful to document the version of some tools that are quickly changing\n", + "print('xarray '+xr.__version__) # was working with 2023.5.0" + ] + }, + { + "cell_type": "markdown", + "id": "1db2ec48-9370-422a-a4e4-893bc39906e2", + "metadata": {}, + "source": [ + "## 1.2 Point to history files \n", + "\n", + "### 1.2.1 Where are my simulation results?\n", + "After your simulations finish, history files are all saved in your `/scratch/NEON_cases/archive/` directory.\n", + "\n", + "We can print the cases we have to look at using bash magic, `%%bash` or `!` which turns the python cell block below into a bash cell. " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "acf88bc1-a2ab-4ae5-bfcb-232cc5d6ad82", + "metadata": {}, + "outputs": [], + "source": [ + "%%bash\n", + "ls ~/scratch/NEON_cases/archive/" + ] + }, + { + "cell_type": "markdown", + "id": "7caf652c-e127-4cb8-89cb-a4423b29f2b4", + "metadata": {}, + "source": [ + "
\n", + "Note you can accomplish the same thing with the following.\n", + "\n", + "> `!ls ~/scratch/NEON_cases/archive/`\n", + " \n", + "
\n", + "\n", + "\n", + "
\n", + "Note if you prefer to look at example data instead of your own data, you can read in data located at `/scratch/data/NEONv2/hist`. We'll go over this in the next section.\n", + "\n", + "
\n", + "\n", + "---\n", + "\n", + "### 1.2.2 Point to the directory with history files \n", + "**We'll set the following:**\n", + "- site to look at\n", + "- path to our archive directory\n", + "- directory with input data (where history files are found) \n", + "\n", + "By doing this more generally, it makes the script easier to modify for different sites." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "44e3bee8-fa6b-4c37-ae55-f62151640598", + "metadata": {}, + "outputs": [], + "source": [ + "neon_site = 'STEI' # NEON site we're going to look at\n", + "\n", + "# If you would like to look at your own data, set the path to your archive directory\n", + "archive = '~/scratch/NEON_cases/archive' # Path to archive directory\n", + "\n", + "# If you would like to look at example data, set the path to this archive directory\n", + "#archive = '/scratch/wwieder/NEON_cases/archive' #TODO: COMMENT OUT!\n", + "\n", + "# This expands the shortcut we used above\n", + "archive = os.path.realpath(os.path.expanduser(archive)) \n", + "\n", + "# Identify path to the data folder\n", + "data_folder = archive+'/'+neon_site+'_FATESsp_test/lnd/hist'\n", + "data_folder" + ] + }, + { + "cell_type": "markdown", + "id": "70d25741-5010-496f-b61a-f15e1c135989", + "metadata": {}, + "source": [ + "**Is this the path for input data, `data_folder`, correct?** \n", + "\n", + "*HINT:* You can check in the terminal window or using bash magic.\n", + "\n", + "---\n", + "\n", + "### 1.2.3 Create some functions we'll use when opening the data\n", + "1. `preprocess` will limit the number of variables we're reading in. This is an xarray feature that helps save time (and memory resources).\n", + "2. `fix_time_h1` corrects annoying features related to how CTSM history files handle time and is provided as part of `neon_utils.py`.\n", + "\n", + "*Don't worry too much about the details of these functions right now.*\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "7f2a23fe-7273-4370-8f2c-fe3dfad5029e", + "metadata": {}, + "outputs": [], + "source": [ + "# Read only these variables from the netcdf files\n", + "def preprocess_some (ds):\n", + " variables = ['FCEV', 'FCTR', 'FGEV','FSH','GPP','FSA','FIRA','AR','HR','ELAI']\n", + " ds_new= ds[variables].isel(lndgrid=0)\n", + " return ds_new\n", + "\n", + "# Read all these variables from the netcdf files\n", + "def preprocess_all (ds):\n", + " ds_new= ds.isel(lndgrid=0)\n", + " return ds_new" + ] + }, + { + "cell_type": "markdown", + "id": "3919e8c9-4c08-485f-9e01-8c42f6b5ddad", + "metadata": {}, + "source": [ + "Now we have created the functions needed to manipulate our datasets.\n", + "\n", + "---\n", + "\n", + "### 1.2.4 List all the files we're going to open\n", + "The the 30-minute, high frequency history output (**'h1' files**) are written out every day in for NEON cases. \n", + "\n", + "To open all of these files we're going to need to know their names. This can be done if we:\n", + "- Create an empty list `[]` of simulation files that is\n", + "- `.extend`ed with a \n", + "- `sorted` list of files generted with the \n", + "- `glob` function in python of the \n", + "- `*h1*`files in our `data_folder` " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "617ea958-499e-4dda-92da-8e531b152fe0", + "metadata": {}, + "outputs": [], + "source": [ + "# This list gives you control over the years of data to read in\n", + "# We're just going to look at one year of data\n", + "years = [\"2019\"] \n", + "\n", + "# Create an empty list of all the file names to extend\n", + "sim_files = []\n", + "for year in years:\n", + " sim_files.extend(sorted(glob(join(data_folder,\"*h1.\"+year+\"*.nc\"))))" + ] + }, + { + "cell_type": "markdown", + "id": "8919fcde-de2e-43d3-a9a5-7439b6d592e1", + "metadata": {}, + "source": [ + "How many files are you going have to read in? What is the last day of the simulation you'll be looking at?" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "c591bd39-6875-4d8f-acb9-67943cef8418", + "metadata": {}, + "outputs": [], + "source": [ + "print(\"Total number of simulation files: \", len(sim_files), \"files\")\n", + "print(\"Last simulation file:\", sim_files[-1])" + ] + }, + { + "cell_type": "markdown", + "id": "4d280416-00b4-431d-944a-bb2ca7b4cceb", + "metadata": {}, + "source": [ + "---\n", + "\n", + "### 1.2.5 Read in the data\n", + "`xr.open_mfdataset` will open all of these data files and concatinate them into a single **xarray dataset**.\n", + "\n", + "We are going to also going use or `preprocess` and `fix_time` functions in this step." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "aee5a387-f155-4fe8-a6e8-bfe2f95a2f35", + "metadata": {}, + "outputs": [], + "source": [ + "start = time.time()\n", + "print (\"Reading in data for \"+neon_site)\n", + "\n", + "# Just reading *some* of the data here, could use preprocess_all instead.\n", + "ds_ctsm = xr.open_mfdataset(sim_files, decode_times=True, combine='by_coords',\n", + " preprocess=preprocess_all)\n", + "ds_ctsm = fix_time_h1(ds_ctsm)\n", + "\n", + "end = time.time()\n", + "print(\"Reading all simulation files took:\", end-start, \"s.\")\n" + ] + }, + { + "cell_type": "markdown", + "id": "bbad64f5-88ef-402b-8fdd-3610fde4766d", + "metadata": {}, + "source": [ + "### Print the dataset you're working with ds_ctsm" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "7cda5d25-ce4b-419c-8dd5-e44f248e7604", + "metadata": {}, + "outputs": [], + "source": [ + "ds_ctsm" + ] + }, + { + "cell_type": "markdown", + "id": "ed2dde75-b0eb-4aa3-998d-9858c2c9ad75", + "metadata": {}, + "source": [ + "#### Take a quick look at the dataset.\n", + "- What are your coodinate variables?\n", + "- How long is the time dimensions?\n", + "- What variables do we have to look at?\n", + "- What are the long names of some of these variables? (HINT: try `ds_ctsm.FATES_GPP`)\n", + "- What other metadata are associated with this dataset? \n", + "\n", + "---\n", + "Let's start plotting!\n", + "#### What do GPP fluxes look like in this FATES_SP run?" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "c2d24312-72a1-466f-9489-cc969a550e28", + "metadata": {}, + "outputs": [], + "source": [ + "ds_ctsm.FATES_GPP.plot(); " + ] + }, + { + "cell_type": "markdown", + "id": "f14e87a9-f617-4f4e-bc54-e59198cc23d8", + "metadata": {}, + "source": [ + "Let's repeat this, but look at daily mean fluxes" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "327d0322-5b47-41d6-838a-7d0d2a8cc408", + "metadata": {}, + "outputs": [], + "source": [ + "# Convert from kgC/m2/s to daily flux (gC/m2/d)\n", + "spd = 24 * 60 * 60\n", + "((ds_ctsm.FATES_GPP.resample(time='D').mean())*spd*1e3).plot()\n", + "plt.ylabel('GPP (gC/m2/d)');" + ] + }, + { + "cell_type": "markdown", + "id": "ff79b808-d0b8-4061-9f73-3e1879116011", + "metadata": {}, + "source": [ + "#### The `FATES_GPP` variable actually includes several PFTs on the surface dataset. \n", + "This is different from how single point *\"Big Leaf\"* CLM simulations are done by default, which only have a single PFT on the surface data.\n", + "\n", + "We can look at each of the PFTs from our FATES-SP run below." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "414f49f9-86f1-4401-8208-609f73fe5971", + "metadata": {}, + "outputs": [], + "source": [ + "temp = ((ds_ctsm.FATES_GPP_PF.resample(time='D').mean())*spd*1e3)\n", + "temp.plot(hue='fates_levpft') \n", + "plt.ylabel('FATES GPP (gC/m2/d)') ;" + ] + }, + { + "cell_type": "markdown", + "id": "8eb333ec-3c77-4681-a135-b3cf1f733999", + "metadata": {}, + "source": [ + "You can find out what PFTs this corresponds to with the following commnads\n", + "\n", + "```\n", + "cat ~/scratch/NEON_cases/STEI_FATESsp_test/run/lnd_in | grep fates_paramfile\n", + "ncdump -v fates_pftname \n", + "```\n", + "\n", + "For the STEI site, it looks like FATES PFTs # 2, 6, & 11.\n", + "You'll have to go to the FATES github \n", + "This corresponds to:\n", + "- needleleaf_evergreen_extratrop_tree\n", + "- broadleaf_colddecid_extratrop_tree\n", + "- cool_c3_grass\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "fff0b9d5-16ad-4010-b432-23d53cadd17d", + "metadata": {}, + "outputs": [], + "source": [ + "temp.sel(fates_levpft=[2,6,11]).plot(hue='fates_levpft') \n", + "plt.ylabel('FATES GPP (gC/m2/d)');" + ] + }, + { + "cell_type": "markdown", + "id": "4cfaa9c3-7ae6-43b2-acd7-72d0c2e9af6c", + "metadata": {}, + "source": [ + "This raises questions about why the GPP for certain PFTs is so much lower? \n", + "Units are per m2, so it's not that the grass makes up a smaller fraction of the total grid area.\n", + "- Per unit leaf area, is the photosynthetic capacity of grasses lower?\n", + " - A number of parameter control photosynthetic capacity but vcmax is one important place to start\n", + " - HINT to get started try\n", + " >cat ~/scratch/NEON_cases/STEI_FATESsp_test/run/lnd_in | grep fates_paramfile\n", + " \n", + " >ncdump -v fates_leaf_vcmax25top ``\n", + "\n", + "- Does this have to do with canopy scaling? That is, does the grass PFT just have a lower LAI?\n", + " - You can look at this by printing the LAI for each corresponding PFT on the CLM surface dataset.\n", + " - HINT to get started try:\n", + " > cat ~/scratch/NEON_cases/STEI_FATESsp_test/run/lnd_in | grep fsurdat\n", + " \n", + " > ncdump -v MONTHLY_LAI,PCT_NAT_PFT ``\n", + " \n", + "Note: the CLM PFT indexes are different from what FATES uses.\n", + "\n", + "Moreover, LAI on the surface dataset is kind of hard to interpret, as they are monthly values dimensioned [time x PFT]. \n", + "\n", + "
\n", + "CHALLENGE \n", + " \n", + "Can you write a few lines of code to open the surface dataset and plot the monthly PFT values for the PFTs represented in your FATES-SP case?\n", + " \n", + "
\n", + "\n", + "It's also helpful to look at the simulated energy budget.\n", + "- Does net radiation, sensible heat flux, and latent heat flux seem OK?\n", + "- How do we compare fluxes from multiple PFTs to flux tower measurements that integrate fluxes across their entire footprint?\n", + "- We have information on the gridcell weighted mean fluxes on our h1 files, but can you write out these fluxes at a PFT level?\n", + "- Would it be helpful to have a results from a *Big Leaf* CLM simulation to compare to? \n", + "\n", + "There's a lot to start looking into here! As you can see, this quickly gets complicated to investigate. " + ] + }, + { + "cell_type": "markdown", + "id": "9d8f5cfe-d449-4518-9007-c27e451898d6", + "metadata": {}, + "source": [ + "#### Make a contour plot of soil moisture over time with depth on the y axis" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "878ee93c-086d-467d-b701-60d399235308", + "metadata": {}, + "outputs": [], + "source": [ + "ds_ctsm.H2OSOI.plot(robust=True, y='levsoi')\n", + "plt.gca().invert_yaxis();\n", + "plt.title(neon_site);" + ] + }, + { + "cell_type": "markdown", + "id": "bc12258b-d735-4498-86a5-36244053e14b", + "metadata": {}, + "source": [ + "### This example plots: \n", + "- vertical profiles of soil moisture \n", + "- for one time step\n", + "- over the top 4m of soil \n", + "- with depth on the y axis, and reversed so deeper soil levels are at the bottom" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "c8990cb0-3a57-425c-a9fa-80f02a9e2d02", + "metadata": {}, + "outputs": [], + "source": [ + "ds_ctsm.H2OSOI.isel(time=(181*48)).plot(y='levsoi',marker='o',ylim=(0,4))\n", + "plt.gca().invert_yaxis() \n", + "plt.suptitle(neon_site);" + ] + }, + { + "cell_type": "markdown", + "id": "7df902a6-0cda-4588-9437-6b3ae8f23d8e", + "metadata": {}, + "source": [ + "It seems odd that surface soil layers are wetter than deeper ones.\n", + "\n", + "### This example plots a time series of soil moisture \n", + "- for a single soil level" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "d8e0fa84-458d-4df1-aae2-8fbb38b118ce", + "metadata": {}, + "outputs": [], + "source": [ + "ds_ctsm.H2OSOI.isel(levsoi=4).plot();" + ] + }, + { + "cell_type": "markdown", + "id": "8b6a0edb-015a-4fc1-bc07-aaeca72c8438", + "metadata": {}, + "source": [ + "
\n", + "Congratulations: \n", + " \n", + "You've quickly looked at some of the monthly output from CLM-FATESsp run.\n", + "\n", + "What other sites or variables would you like to look at?\n", + "\n", + "Give it a shot, you can make lots of plots quickly with all this data!\n", + " \n", + "
\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "2d2c2fb4-3b0d-4502-beb9-b069ad70fc0a", + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.9.12" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/_sources/notebooks/ProjectExamples/QuickPlot_CTSM_h0.ipynb b/_sources/notebooks/ProjectExamples/QuickPlot_CTSM_h0.ipynb new file mode 100644 index 0000000..df198de --- /dev/null +++ b/_sources/notebooks/ProjectExamples/QuickPlot_CTSM_h0.ipynb @@ -0,0 +1,477 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "51f96e25-587b-4108-a7d9-34666f7a50e6", + "metadata": {}, + "source": [ + "# Quick plots - CTSM - Monthly \n", + "## Simple way to quickly look at monthly history files (*h0*). \n", + "\n", + "This tutorial is an introduction to [xarray](https://docs.xarray.dev/en/stable/user-guide/terminology.html) and [matplotlib](https://matplotlib.org/stable/index.html). There is plenty more information to be found at the documentation for these libraries.\n", + "\n", + "This tutorial can be be run either on data from cases that you ran earlier, or can be run on pre-staged data.\n", + "\n", + "In this tutorial you will find steps and instructions to:\n", + "\n", + "1. Load python libraries needed for plotting\n", + "2. Locate monthly history files\n", + "3. Load datasets with xarray\n", + "4. Plot the data\n", + "------" + ] + }, + { + "cell_type": "markdown", + "id": "7edf783f-9442-4a1b-ab7c-e9455be3ac5b", + "metadata": { + "tags": [] + }, + "source": [ + "# 1. Load Datasets\n", + "\n", + "## 1.1 Load Python Libraries\n", + "We always start by loading in the libraries we're going to use for the script. There are more libraries being loaded here than we'll likely use, but this list is a good one to get started for most of your plotting needs.\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "87882ecf-c37c-4b01-bfb4-24e56d671777", + "metadata": {}, + "outputs": [], + "source": [ + "import os\n", + "import time\n", + "import datetime\n", + "\n", + "import numpy as np\n", + "import pandas as pd\n", + "import xarray as xr\n", + "\n", + "from glob import glob\n", + "from os.path import join\n", + "\n", + "import matplotlib\n", + "import matplotlib.pyplot as plt\n", + "import matplotlib.dates as mdates\n", + "\n", + "from neon_utils import fix_time_h0" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "d3039504-ae5d-4653-acac-44a402cef436", + "metadata": {}, + "outputs": [], + "source": [ + "# It's helpful to document the version of some tools that are quickly changing\n", + "print('xarray '+xr.__version__) # was working with 2023.5.0" + ] + }, + { + "cell_type": "markdown", + "id": "1db2ec48-9370-422a-a4e4-893bc39906e2", + "metadata": {}, + "source": [ + "## 1.2 Point to history files \n", + "\n", + "### 1.2.1 Where are my simulation results?\n", + "After your simulations finish, history files are all saved in your `/scratch/NEON_cases/archive/` directory\n", + "\n", + "We can print the cases we have to look at using bash magic, `%%bash` or `!` which turns the python cell block below into a bash cell. " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "acf88bc1-a2ab-4ae5-bfcb-232cc5d6ad82", + "metadata": {}, + "outputs": [], + "source": [ + "%%bash\n", + "ls ~/scratch/NEON_cases/archive/" + ] + }, + { + "cell_type": "markdown", + "id": "7caf652c-e127-4cb8-89cb-a4423b29f2b4", + "metadata": {}, + "source": [ + "
\n", + "Note you can accomplish the same thing with the following.\n", + "\n", + "> `!ls ~/scratch/NEON_cases/archive/`\n", + " \n", + "
\n", + "\n", + "
\n", + "Note if you prefer to look at example data instead of your own data, you can read in data located at `/scratch/data/NEONv2/hist`. We'll go over this in the next section.\n", + "\n", + "
\n", + "\n", + "---\n", + "\n", + "### 1.2.2 Point to the data folder with history files \n", + "**We'll set the following:**\n", + "- site to look at\n", + "- path to our archive directory\n", + "- directory with input data (where history files are found)\n", + "\n", + "\n", + "By doing this more generally, it makes the script easier to modify for different sites." + ] + }, + { + "cell_type": "markdown", + "id": "a673c3d7-6ba5-4f60-9ff6-72370648c1ee", + "metadata": {}, + "source": [ + "
\n", + "Note you can accomplish the same thing with the following.\n", + "\n", + "> `!ls ~/scratch/NEON_cases/archive/`\n", + " \n", + "
\n", + "\n", + "---\n", + "\n", + "### 1.2.2 Point to the data folder with history files \n", + "**We'll set the following:**\n", + "- site to look at\n", + "- path to our archive directory\n", + "- directory with input data (where history files are found) \n", + "\n", + "By doing this more generally, it makes the script easier to modify for different sites." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "44e3bee8-fa6b-4c37-ae55-f62151640598", + "metadata": {}, + "outputs": [], + "source": [ + "neon_site = 'ABBY' # NEON site we're going to look at\n", + "archive = '~/scratch/NEON_cases/archive' # Path to archive directory\n", + "\n", + "# If you prefer to look at example data, you can uncomment the following line\n", + "# archive = '~/../../scratch/data/NEONv2/hist'\n", + "\n", + "# This unpacks the and expands the shortcut, '~', we used above\n", + "archive = os.path.realpath(os.path.expanduser(archive)) \n", + "\n", + "# Create a path to the data folder\n", + "data_folder = archive+'/'+neon_site+'.transient/lnd/hist'\n", + "\n", + "data_folder" + ] + }, + { + "cell_type": "markdown", + "id": "70d25741-5010-496f-b61a-f15e1c135989", + "metadata": {}, + "source": [ + "**Is this path for input data, `data_folder`, correct?** \n", + "\n", + "*HINT:* You can check in the terminal window or use bash magic (`%%bash`) and then list the contents of `data_folder` with `ls` in the same cell.\n", + "\n", + "---" + ] + }, + { + "cell_type": "markdown", + "id": "dea12afa-a949-4743-9f69-436da46ecd31", + "metadata": {}, + "source": [ + "### 1.2.3 Create some functions we'll use when opening the data\n", + "1. `preprocess` will limit the number of variables we're reading in. This is an xarray feature that helps save time (and memory resources).\n", + "2. `fix_time` corrects annoying features related to how CTSM history files handle time and is provided in `neon_utils.py`.\n", + "\n", + "*Don't worry too much about the details of these functions right now*." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "7f2a23fe-7273-4370-8f2c-fe3dfad5029e", + "metadata": {}, + "outputs": [], + "source": [ + "# Read all variables from the netcdf files\n", + "# This just drops an unused coordinate variable (lndgrid) from the dataset\n", + "def preprocess_all (ds):\n", + " ds_new= ds.isel(lndgrid=0) \n", + " return ds_new\n", + "\n", + "# Read some of the variables from the netcdf files, \n", + "# This will make things faster, but requires you to list the variables you want to look at\n", + "def preprocess_some (ds):\n", + " variables = ['H2OSOI', 'TSOI']\n", + " ds_new= ds[variables].isel(lndgrid=0)\n", + " return ds_new" + ] + }, + { + "cell_type": "markdown", + "id": "3919e8c9-4c08-485f-9e01-8c42f6b5ddad", + "metadata": {}, + "source": [ + "Now we have created the functions needed to manipulate our datasets.\n", + "\n", + "---\n", + "\n", + "### 1.2.4 List all the files we're going to open\n", + "The monthly history output (**'h0' files**) are written out for NEON cases. \n", + "\n", + "To open all of these files we're going to need to know their names. This can be done if we:\n", + "- Create an empty list `[]` of simulation files that is\n", + "- `.extend`ed with a \n", + "- `sorted` list of files generated with the \n", + "- `glob` function in python of the \n", + "- `*h0*`files in our `data_folder` \n", + "\n", + "You'll notice that **all of this gets combined in a single line of code** that runs through a \n", + "- `for` loop over defined simulation years (written as a list of strings)\n", + "\n", + "
\n", + "Note If you're new to python it's dense, but efficient. I actually borrowed a bunch this code from a colleague, Negin Sobhani, who's good at python! Sharing code is really helpful. \n", + "
\n", + "\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "617ea958-499e-4dda-92da-8e531b152fe0", + "metadata": {}, + "outputs": [], + "source": [ + "# Create an empty list of all the file names to extend\n", + "sim_files = []\n", + "\n", + "# If you want to choose a few particular years, you can use this loop\n", + "# years = [\"2021\", \"2022\"]\n", + "# for year in years:\n", + "# sim_files.extend(sorted(glob(join(data_folder,\"*h0.\"+year+\"*.nc\"))))\n", + "\n", + "sim_files.extend(sorted(glob(join(data_folder,\"*h0.*.nc\"))))" + ] + }, + { + "cell_type": "markdown", + "id": "50be9689-f985-413a-bb30-4c49e257a204", + "metadata": {}, + "source": [ + "How many files are you going have to read in? What is the last day of the simulation you'll be looking at?" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "e76ac53d-9f1e-4479-b471-7ca2eccab8a2", + "metadata": {}, + "outputs": [], + "source": [ + "print(\"Total number of simulation files: \", len(sim_files), \"files\")\n", + "print(\"Last simulation file:\", sim_files[-1])" + ] + }, + { + "cell_type": "markdown", + "id": "4d280416-00b4-431d-944a-bb2ca7b4cceb", + "metadata": {}, + "source": [ + "---\n", + "\n", + "### 1.2.5 Read in the data\n", + "`xr.open_mfdataset` will open all of these data files and concatenate them into a single **xarray dataset**.\n", + "\n", + "We are also going to use the `preprocess` and `fix_time` functions in this step." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "aee5a387-f155-4fe8-a6e8-bfe2f95a2f35", + "metadata": {}, + "outputs": [], + "source": [ + "start = time.time()\n", + "print (\"Reading in data for \"+neon_site)\n", + "\n", + "# Just reading *some* of the data here, could use preprocess_all instead.\n", + "ds_ctsm = xr.open_mfdataset(sim_files, decode_times=True, combine='by_coords',\n", + " preprocess=preprocess_some)\n", + "ds_ctsm = fix_time_h0(ds_ctsm)\n", + "\n", + "end = time.time()\n", + "print(\"Reading all simulation files took:\", end-start, \"s.\")\n" + ] + }, + { + "cell_type": "markdown", + "id": "bbad64f5-88ef-402b-8fdd-3610fde4766d", + "metadata": {}, + "source": [ + "### Print the dataset you're working with ds_ctsm" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "7cda5d25-ce4b-419c-8dd5-e44f248e7604", + "metadata": {}, + "outputs": [], + "source": [ + "ds_ctsm" + ] + }, + { + "cell_type": "markdown", + "id": "b2be98dc-b543-419c-a2cf-653adfc0b536", + "metadata": {}, + "source": [ + "#### Take a quick look at the dataset.\n", + "- What are your coodinate variables?\n", + "- How long is the time dimensions?\n", + "- What variables do we have to look at?\n", + "- What are the long names of some of these variables? (HINT: try `ds_ctsm.TSOI`)\n", + "- What are other metadata are associated with this dataset? \n", + "\n", + "---" + ] + }, + { + "cell_type": "markdown", + "id": "1d081822-98b6-41e9-a364-0471a35b71d3", + "metadata": {}, + "source": [ + "### Let's start plotting!\n", + "\n", + "### Make a contour plot of soil moisture over time with depth on the y-axis" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "878ee93c-086d-467d-b701-60d399235308", + "metadata": {}, + "outputs": [], + "source": [ + "# Plot H2OSOI\n", + "ds_ctsm.H2OSOI.plot(robust=True, y='levsoi')\n", + "# Invert the y-axis\n", + "plt.gca().invert_yaxis()\n", + "# Add the title\n", + "plt.title(neon_site)\n", + "# Show plot\n", + "plt.show()" + ] + }, + { + "cell_type": "markdown", + "id": "bc12258b-d735-4498-86a5-36244053e14b", + "metadata": {}, + "source": [ + "### Plot vertical profiles of soil moisture \n", + "This example is looking at one month of data over the top 2m of soil. Depth is on the y axis, and the plot is reversed so deeper soil levels are at the bottom." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "c8990cb0-3a57-425c-a9fa-80f02a9e2d02", + "metadata": {}, + "outputs": [], + "source": [ + "# Plot H20SOI at time 5; marker determines style of points\n", + "ds_ctsm.H2OSOI.isel(time=5).plot(y='levsoi',marker='o',ylim=(0,2))\n", + "# Invert y-axis\n", + "plt.gca().invert_yaxis()\n", + "# Add suptitle above plot title with time slice\n", + "plt.suptitle(neon_site)\n", + "# Show plot\n", + "plt.show()" + ] + }, + { + "cell_type": "markdown", + "id": "cfc54627-1614-428f-b418-8379dd1ef0ee", + "metadata": {}, + "source": [ + "It seems odd that surface soil layers are wetter than deeper ones." + ] + }, + { + "cell_type": "markdown", + "id": "7df902a6-0cda-4588-9437-6b3ae8f23d8e", + "metadata": {}, + "source": [ + "### Plot a time series of soil moisture for a single soil level" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "d8e0fa84-458d-4df1-aae2-8fbb38b118ce", + "metadata": {}, + "outputs": [], + "source": [ + "# Plot H2OSOI at soil level 4 with dot markers at each point\n", + "ds_ctsm.H2OSOI.isel(levsoi=4).plot(marker='o')\n", + "# Show plot\n", + "plt.show()" + ] + }, + { + "cell_type": "markdown", + "id": "8b6a0edb-015a-4fc1-bc07-aaeca72c8438", + "metadata": {}, + "source": [ + "#### \n", + "\n", + "
\n", + "Congratualtions: \n", + " \n", + "You've now looked at some of the monthly output from CLM.\n", + "\n", + "What other sites or variables would you like to look at?\n", + "\n", + "Give it a shot, you can make lots of plots with all this data!\n", + " \n", + "
\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "2d2c2fb4-3b0d-4502-beb9-b069ad70fc0a", + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.9.12" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/_sources/notebooks/ProjectExamples/QuickPlot_CTSM_spinup.ipynb b/_sources/notebooks/ProjectExamples/QuickPlot_CTSM_spinup.ipynb new file mode 100644 index 0000000..a2c9411 --- /dev/null +++ b/_sources/notebooks/ProjectExamples/QuickPlot_CTSM_spinup.ipynb @@ -0,0 +1,397 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "51f96e25-587b-4108-a7d9-34666f7a50e6", + "metadata": {}, + "source": [ + "# Quick plots - CTSM - Spinup \n", + "## This notebook provides a method to check if spinup simulations have reached steady state. \n", + "\n", + "In this tutorial you will find steps and instructions to:\n", + "\n", + "1. Load python libraries\n", + "2. Locate history files\n", + "3. Read in preprocesed data\n", + "4. Plot total ecosystem C over time\n", + "5. Determine if spinup simulations have reached steady state\n", + "\n", + "------" + ] + }, + { + "cell_type": "markdown", + "id": "7edf783f-9442-4a1b-ab7c-e9455be3ac5b", + "metadata": {}, + "source": [ + "# 1. Load Datasets\n", + "\n", + "## 1.1 Load Python Libraries" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "87882ecf-c37c-4b01-bfb4-24e56d671777", + "metadata": {}, + "outputs": [], + "source": [ + "import os\n", + "import time\n", + "import datetime\n", + "\n", + "import numpy as np\n", + "import nc_time_axis\n", + "import pandas as pd\n", + "import xarray as xr\n", + "\n", + "from glob import glob\n", + "from os.path import join\n", + "\n", + "import matplotlib\n", + "import matplotlib.pyplot as plt\n", + "import matplotlib.dates as mdates\n", + "\n", + "from neon_utils import fix_time_h0" + ] + }, + { + "cell_type": "markdown", + "id": "295e5476-c8b3-4a4d-ba7a-566def668673", + "metadata": { + "jupyter": { + "outputs_hidden": true + }, + "tags": [] + }, + "source": [ + "
\n", + "Note: If you are having difficulties importing `nc_time_axis`, run the following line once, then comment it out and restart the kernel by clicking on Kernel --> Restart Kernel in the top left panel in order to ensure the package is installed. \n", + " \n", + "> `pip install nc-time-axis`\n", + "\n", + "
\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "d3039504-ae5d-4653-acac-44a402cef436", + "metadata": {}, + "outputs": [], + "source": [ + "print('xarray '+xr.__version__) # was working with 2023.5.0" + ] + }, + { + "cell_type": "markdown", + "id": "00d6e2bc-d747-41ee-a560-38bc3366fc8d", + "metadata": { + "tags": [] + }, + "source": [ + "## 1.2 Locate and read in history files " + ] + }, + { + "cell_type": "markdown", + "id": "1db2ec48-9370-422a-a4e4-893bc39906e2", + "metadata": { + "tags": [] + }, + "source": [ + "### 1.2.1 Where are my simulation results?\n", + "After your simulations finish, history files are all saved in your `/scratch/NEON_cases/archive/` directory\n", + "\n", + "We can print the cases available to look at using bash magic, `%%bash` or `!` which turns the python cell block below into a bash cell. " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "acf88bc1-a2ab-4ae5-bfcb-232cc5d6ad82", + "metadata": {}, + "outputs": [], + "source": [ + "%%bash\n", + "ls ~/scratch/NEON_cases/archive/" + ] + }, + { + "cell_type": "markdown", + "id": "7caf652c-e127-4cb8-89cb-a4423b29f2b4", + "metadata": {}, + "source": [ + "
\n", + "Note you can accomplish the same thing with the following code:\n", + "\n", + "> `!ls ~/scratch/NEON_cases/archive/`\n", + " \n", + "
\n", + "\n", + "---" + ] + }, + { + "cell_type": "markdown", + "id": "472907c6-e236-4358-934a-df62fda235c9", + "metadata": { + "tags": [] + }, + "source": [ + "### 1.2.2 Point to the directory with history files \n", + "**We'll set the following:**\n", + "- site and experiment to look at\n", + "- path to our archive directory\n", + "- directory with input data (where history files are found) \n", + "\n", + "By doing this more generally, it makes the script easier to modify for different sites." + ] + }, + { + "cell_type": "markdown", + "id": "dd3302b7-e809-4dc6-aaab-ea1ad2d3aafe", + "metadata": {}, + "source": [ + "
\n", + "Note You can use data that you generated in other tutorials, or you can look at the example data. If you'd like to use example data, please uncomment the example archive directory line below.\n", + "
" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "44e3bee8-fa6b-4c37-ae55-f62151640598", + "metadata": {}, + "outputs": [], + "source": [ + "neon_site = 'WOOD' # NEON site we're going to look at\n", + "experiment = '.BTRAN.ad' # Can set to ad, postad, or transient\n", + "\n", + "# If you would like to look at your own data, set the path to your archive directory\n", + "archive = '~/scratch/NEON_cases/archive'\n", + "\n", + "# If you would like to look at example data, set the path to this archive directory:\n", + "# archive = '/scratch/wwieder/NEON_cases/archive'\n", + "\n", + "# This expands the shortcut '~' used above\n", + "archive = os.path.realpath(os.path.expanduser(archive)) \n", + "\n", + "# Create a path to the data folder\n", + "data_folder = archive+'/'+neon_site+experiment+'/lnd/hist'\n", + "data_folder" + ] + }, + { + "cell_type": "markdown", + "id": "892d909c-8412-4b7b-93c2-94067adfad48", + "metadata": {}, + "source": [ + "**Is this the path for input data, `data_folder`, correct?** \n", + "\n", + "*HINT:* You can check in the terminal window or using bash magic.\n", + "\n", + "---" + ] + }, + { + "cell_type": "markdown", + "id": "70d25741-5010-496f-b61a-f15e1c135989", + "metadata": { + "tags": [] + }, + "source": [ + "### 1.2.3 Create some functions we'll use when opening the data\n", + "`preprocess_all` will limit the number of coordinate variables we're reading in. This is an xarray feature that helps save time (and memory resources)." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "7f2a23fe-7273-4370-8f2c-fe3dfad5029e", + "metadata": {}, + "outputs": [], + "source": [ + "# Define function to preprocess all variables from the netcdf files\n", + "# This just drops an unused coordinate variable (lndgrid) from the dataset\n", + "def preprocess_all (ds):\n", + " ds_new= ds.isel(lndgrid=0) \n", + " return ds_new" + ] + }, + { + "cell_type": "markdown", + "id": "3919e8c9-4c08-485f-9e01-8c42f6b5ddad", + "metadata": {}, + "source": [ + "Now we have created the functions needed to manipulate our datasets\n", + "\n", + "---" + ] + }, + { + "cell_type": "markdown", + "id": "adcff485-79f9-4b32-af43-ed07ea189b2b", + "metadata": { + "tags": [] + }, + "source": [ + "### 1.2.4 List all the files we're going to open\n", + "The the monthly history output (**'h0' files**) are written out for NEON cases. \n", + "\n", + "To open all of these files we're going to need to know their names. This can be done if we:\n", + "- Create an empty list `[]` of simulation files that is\n", + "- `.extend`ed with a \n", + "- `sorted` list of files generted with the \n", + "- `glob` function in python of the \n", + "- `*h0*`files in our `data_folder` " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "617ea958-499e-4dda-92da-8e531b152fe0", + "metadata": {}, + "outputs": [], + "source": [ + "# Create an empty list of all the file names to extend\n", + "sim_files = []\n", + "sim_files.extend(sorted(glob(join(data_folder,\"*h0.*.nc\"))))\n", + "\n", + "print(\"All simulation files for all years: [\", len(sim_files), \"files]\")\n", + "print(sim_files[-1])" + ] + }, + { + "cell_type": "markdown", + "id": "566f28f0-8a9b-4e04-9a1c-3052c70175bb", + "metadata": {}, + "source": [ + "---" + ] + }, + { + "cell_type": "markdown", + "id": "4d280416-00b4-431d-944a-bb2ca7b4cceb", + "metadata": { + "tags": [] + }, + "source": [ + "### 1.2.5 Read in the data" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "aee5a387-f155-4fe8-a6e8-bfe2f95a2f35", + "metadata": {}, + "outputs": [], + "source": [ + "start = time.time()\n", + "print (\"Reading in data for \"+neon_site)\n", + "\n", + "ds_ctsm = xr.open_mfdataset(sim_files, decode_times=True, combine='by_coords',\n", + " preprocess=preprocess_all)\n", + "\n", + "end = time.time()\n", + "print(\"Reading all simulation files took:\", end-start, \"s.\")" + ] + }, + { + "cell_type": "markdown", + "id": "bbad64f5-88ef-402b-8fdd-3610fde4766d", + "metadata": {}, + "source": [ + "### 1.2.6 Print the dataset you're working with" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "7cda5d25-ce4b-419c-8dd5-e44f248e7604", + "metadata": {}, + "outputs": [], + "source": [ + "ds_ctsm" + ] + }, + { + "cell_type": "markdown", + "id": "10b5969d-f298-4c6f-a554-cfa4993602e2", + "metadata": {}, + "source": [ + "---" + ] + }, + { + "cell_type": "markdown", + "id": "b2be98dc-b543-419c-a2cf-653adfc0b536", + "metadata": { + "tags": [] + }, + "source": [ + "## 1.3 Plot total ecosystem C over time\n", + "We can visually check to see if the simulation achieved steady-state." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "878ee93c-086d-467d-b701-60d399235308", + "metadata": {}, + "outputs": [], + "source": [ + "ds_ctsm.TOTECOSYSC.plot()\n", + "plt.title(neon_site+experiment) ;" + ] + }, + { + "cell_type": "markdown", + "id": "7df902a6-0cda-4588-9437-6b3ae8f23d8e", + "metadata": {}, + "source": [ + "**LOOK**\n", + "- Does the model seem to have achieved steady state?\n", + "- Why are there periodic oscillations in the total ecosystem C pools?\n", + "\n", + "
\n", + "Congratulations: \n", + " \n", + "You've quickly looked at total ecosystem carbon stocks to check for steady state. \n", + " \n", + "Are there other variables would you like to look at?\n", + " \n", + "
\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "2d2c2fb4-3b0d-4502-beb9-b069ad70fc0a", + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.11.3" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/_sources/notebooks/ProjectExamples/QuickPlot_experimentComparison.ipynb b/_sources/notebooks/ProjectExamples/QuickPlot_experimentComparison.ipynb new file mode 100644 index 0000000..be9bcbb --- /dev/null +++ b/_sources/notebooks/ProjectExamples/QuickPlot_experimentComparison.ipynb @@ -0,0 +1,455 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "51f96e25-587b-4108-a7d9-34666f7a50e6", + "metadata": {}, + "source": [ + "# Quick plots - Comparision\n", + "## Simple way to quickly look at 30 minute history files (*h1*) to \n", + "\n", + "This tutorial is an introduction to [xarray](https://docs.xarray.dev/en/stable/user-guide/terminology.html) and [matplotlib](https://matplotlib.org/stable/index.html). There is plenty more information to be found at the documentation for these libraries.\n", + "\n", + "This tutorial can be be run either on data from cases that you ran earlier, or can be run on pre-staged data.\n", + "\n", + "In this tutorial you will find steps and instructions to:\n", + "\n", + "1. Load python libraries needed for plotting\n", + "2. Locate h1 history files for control and experimental cases\n", + "3. Load datasets with xarray\n", + "4. Plot the data\n", + "------" + ] + }, + { + "cell_type": "markdown", + "id": "7edf783f-9442-4a1b-ab7c-e9455be3ac5b", + "metadata": { + "tags": [] + }, + "source": [ + "# 1. Load Datasets\n", + "\n", + "## 1.1 Load Python Libraries\n", + "We always start by loading in the libraries we're going to use for the script. There are more libraries being loaded here than we'll likely use, but this list is a good one to get started for most of your plotting needs.\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "87882ecf-c37c-4b01-bfb4-24e56d671777", + "metadata": {}, + "outputs": [], + "source": [ + "import os\n", + "import time\n", + "import datetime\n", + "\n", + "import numpy as np\n", + "import pandas as pd\n", + "import xarray as xr\n", + "\n", + "from glob import glob\n", + "from os.path import join\n", + "\n", + "import matplotlib\n", + "import matplotlib.pyplot as plt\n", + "import matplotlib.dates as mdates\n", + "\n", + "from neon_utils import fix_time_h1" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "d3039504-ae5d-4653-acac-44a402cef436", + "metadata": {}, + "outputs": [], + "source": [ + "# It's helpful to document the version of some tools that are quickly changing\n", + "print('xarray '+xr.__version__) # was working with 2023.5.0" + ] + }, + { + "cell_type": "markdown", + "id": "1db2ec48-9370-422a-a4e4-893bc39906e2", + "metadata": {}, + "source": [ + "## 1.2 Point to history files \n", + "\n", + "### 1.2.1 Where are my simulation results?\n", + "After your simulations finish, history files are all saved in your `/scratch/NEON_cases/archive/` directory\n", + "\n", + "We can print the cases we have to look at using bash magic, `%%bash` or `!` which turns the python cell block below into a bash cell. " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "acf88bc1-a2ab-4ae5-bfcb-232cc5d6ad82", + "metadata": {}, + "outputs": [], + "source": [ + "%%bash\n", + "ls ~/scratch/NEON_cases/archive/" + ] + }, + { + "cell_type": "markdown", + "id": "7caf652c-e127-4cb8-89cb-a4423b29f2b4", + "metadata": {}, + "source": [ + "
\n", + "Note you can accomplish the same thing with the following.\n", + "\n", + "> `!ls ~/scratch/NEON_cases/archive/`\n", + " \n", + "
\n", + "\n", + "
\n", + "Note if you prefer to look at example data instead of your own data, you can read in data located at `/scratch/data/NEONv2/hist`. We'll go over this in the next section.\n", + "\n", + "
\n", + "\n", + "---\n", + "\n", + "### 1.2.2 Point to the data folder with history files \n", + "**We'll set the following:**\n", + "- site to look at\n", + "- path to our archive directory\n", + "- directory with input data (where history files are found)\n", + "\n", + "\n", + "By doing this more generally, it makes the script easier to modify for different sites." + ] + }, + { + "cell_type": "markdown", + "id": "a673c3d7-6ba5-4f60-9ff6-72370648c1ee", + "metadata": {}, + "source": [ + "
\n", + "Note you can accomplish the same thing with the following.\n", + "\n", + "> `!ls ~/scratch/NEON_cases/archive/`\n", + " \n", + "
\n", + "\n", + "---\n", + "\n", + "### 1.2.2 Point to the data folder with history files \n", + "**We'll set the following:**\n", + "- site to look at\n", + "- path to our archive directory\n", + "- directory with input data (where history files are found) \n", + "\n", + "By doing this more generally, it makes the script easier to modify for different sites." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "44e3bee8-fa6b-4c37-ae55-f62151640598", + "metadata": {}, + "outputs": [], + "source": [ + "neon_site = 'HARV' # NEON site we're going to look at\n", + "experiment = 'foliarCN-30'\n", + "archive = '~/scratch/NEON_cases/archive' # Path to archive directory\n", + "\n", + "# If you prefer to look at example data, you can uncomment the following line\n", + "# archive = '~/../../scratch/data/NEONv2/hist'\n", + "\n", + "# This unpacks the and expands the shortcut, '~', we used above\n", + "archive = os.path.realpath(os.path.expanduser(archive)) \n", + "\n", + "# Create a path to the data folder directories\n", + "control_dir = archive+'/'+neon_site+'.transient/lnd/hist'\n", + "experiment_dir = archive+'/'+neon_site+'.'+experiment+'.transient/lnd/hist'\n", + "\n", + "control_dir" + ] + }, + { + "cell_type": "markdown", + "id": "70d25741-5010-496f-b61a-f15e1c135989", + "metadata": {}, + "source": [ + "**Is this path for input data, `control_dir`, correct?** \n", + "\n", + "*HINT:* You can check in the terminal window or use bash magic (`%%bash`) and then list the contents of `control_dir` with `ls` in the same cell.\n", + "\n", + "---" + ] + }, + { + "cell_type": "markdown", + "id": "dea12afa-a949-4743-9f69-436da46ecd31", + "metadata": {}, + "source": [ + "### 1.2.3 Create some functions we'll use when opening the data\n", + "1. `preprocess` will limit the number of variables we're reading in. This is an xarray feature that helps save time (and memory resources).\n", + "2. `fix_time` corrects annoying features related to how CTSM history files handle time and is provided in `neon_utils.py`.\n", + "\n", + "*Don't worry too much about the details of these functions right now*." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "7f2a23fe-7273-4370-8f2c-fe3dfad5029e", + "metadata": {}, + "outputs": [], + "source": [ + "# Read all variables from the netcdf files\n", + "# This just drops an unused coordinate variable (lndgrid) from the dataset\n", + "def preprocess_all (ds):\n", + " ds_new= ds.isel(lndgrid=0) \n", + " return ds_new\n", + "\n", + "# Read some of the variables from the netcdf files, \n", + "# This will make things faster, but requires you to list the variables you want to look at\n", + "def preprocess_some (ds):\n", + " variables = ['GPP']\n", + " ds_new= ds[variables].isel(lndgrid=0)\n", + " return ds_new" + ] + }, + { + "cell_type": "markdown", + "id": "3919e8c9-4c08-485f-9e01-8c42f6b5ddad", + "metadata": {}, + "source": [ + "Now we have created the functions needed to manipulate our datasets.\n", + "\n", + "---\n", + "\n", + "### 1.2.4 List all the files we're going to open\n", + "The monthly history output (**'h1' files**) are written out for NEON cases. \n", + "\n", + "To open all of these files we're going to need to know their names. This can be done if we:\n", + "- Create an empty list `[]` of simulation files that is\n", + "- `.extend`ed with a \n", + "- `sorted` list of files generated with the \n", + "- `glob` function in python of the \n", + "- `*h0*`files in our `data_folder` \n", + "\n", + "You'll notice that **all of this gets combined in a single line of code** that runs through a \n", + "- `for` loop over defined simulation years (written as a list of strings)\n", + "\n", + "
\n", + "Note If you're new to python it's dense, but efficient. I actually borrowed a bunch this code from a colleague, Negin Sobhani, who's good at python! Sharing code is really helpful. \n", + "
\n", + "\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "617ea958-499e-4dda-92da-8e531b152fe0", + "metadata": {}, + "outputs": [], + "source": [ + "# Create an empty list of all the file names to extend\n", + "control_files = []\n", + "experiment_files = []\n", + "\n", + "# If you want to choose a few particular years, you can use this loop. \n", + "# You can modify the list of years you're looking at.\n", + "years = [\"2021\"]\n", + "for year in years:\n", + " control_files.extend(sorted(glob(join(control_dir,\"*h1.\"+year+\"*.nc\"))))\n", + " experiment_files.extend(sorted(glob(join(experiment_dir,\"*h1.\"+year+\"*.nc\"))))\n", + "\n" + ] + }, + { + "cell_type": "markdown", + "id": "50be9689-f985-413a-bb30-4c49e257a204", + "metadata": {}, + "source": [ + "How many files are you going have to read in? What is the last day of the simulation you'll be looking at?" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "e76ac53d-9f1e-4479-b471-7ca2eccab8a2", + "metadata": {}, + "outputs": [], + "source": [ + "print(\"Total number of simulation files: \", len(control_files), \"files\")\n", + "print(\"Last simulation file:\", control_files[-1])" + ] + }, + { + "cell_type": "markdown", + "id": "4d280416-00b4-431d-944a-bb2ca7b4cceb", + "metadata": {}, + "source": [ + "---\n", + "\n", + "### 1.2.5 Read in the data\n", + "`xr.open_mfdataset` will open all of these data files and concatenate them into a single **xarray dataset**.\n", + "\n", + "We are also going to use the `preprocess` and `fix_time` functions in this step." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "aee5a387-f155-4fe8-a6e8-bfe2f95a2f35", + "metadata": {}, + "outputs": [], + "source": [ + "start = time.time()\n", + "print (\"Reading in data for \"+neon_site)\n", + "\n", + "# Just reading *some* of the data here, could use preprocess_some instead.\n", + "# start with the control case\n", + "ds_control = xr.open_mfdataset(control_files, decode_times=True, combine='by_coords',\n", + " preprocess=preprocess_all)\n", + "ds_control = fix_time_h1(ds_control)\n", + "\n", + "# repeat for the experimental case\n", + "print (\"Reading in data for \"+neon_site+\".\"+experiment)\n", + "ds_experiment = xr.open_mfdataset(experiment_files, decode_times=True, combine='by_coords',\n", + " preprocess=preprocess_all)\n", + "ds_experiment = fix_time_h1(ds_experiment)\n", + "\n", + "end = time.time()\n", + "print(\"Reading all simulation files took:\", end-start, \"s.\")\n" + ] + }, + { + "cell_type": "markdown", + "id": "bbad64f5-88ef-402b-8fdd-3610fde4766d", + "metadata": {}, + "source": [ + "Note, merging the datasets above could be helpful...\n", + "\n", + "### Print the dataset you're working with" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "7cda5d25-ce4b-419c-8dd5-e44f248e7604", + "metadata": {}, + "outputs": [], + "source": [ + "# sum up components of ET fluxes\n", + "ds_control['ET'] = ds_control.FCEV + ds_control.FCTR + ds_control.FGEV\n", + "ds_control['ET'].attrs['long_name'] = \"Evapotranspiration flux\"\n", + "ds_control['ET'].attrs['units'] = ds_control.FCEV.attrs['units']\n", + "\n", + "ds_experiment['ET'] = ds_experiment.FCEV + ds_experiment.FCTR + ds_experiment.FGEV\n", + "ds_experiment['ET'].attrs['long_name'] = \"Evapotranspiration flux\"\n", + "ds_experiment['ET'].attrs['units'] = ds_experiment.FCEV.attrs['units']\n", + "ds_experiment" + ] + }, + { + "cell_type": "markdown", + "id": "b2be98dc-b543-419c-a2cf-653adfc0b536", + "metadata": {}, + "source": [ + "#### Take a quick look at the dataset.\n", + "- What are your coodinate variables?\n", + "- How long is the time dimensions?\n", + "- What variables do we have to look at?\n", + "- What are the long names of some of these variables? (HINT: try `ds_ctsm.TSOI`)\n", + "- What are other metadata are associated with this dataset? \n", + "\n", + "---" + ] + }, + { + "cell_type": "markdown", + "id": "1d081822-98b6-41e9-a364-0471a35b71d3", + "metadata": {}, + "source": [ + "### Let's start plotting!\n", + "\n", + "### Time series of daily GPP fluxes\n", + "**Note** this isn't the most efficient yway of calculating daily means for a full dataset, but it works." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "878ee93c-086d-467d-b701-60d399235308", + "metadata": {}, + "outputs": [], + "source": [ + "var = ['GPP','ELAI','FSH','ET']\n", + "\n", + "fig, axes = plt.subplots(nrows=2, ncols=2, figsize=[12,8],sharex=True)\n", + "\n", + "for v in range(len(var)):\n", + " plt.subplot(2,2,(v+1))\n", + " \n", + " ds_control[var[v]].resample(time='D').mean().plot(label='control')\n", + " ds_experiment[var[v]].resample(time='D').mean().plot(label=experiment)\n", + " if v==0:\n", + " plt.legend()\n", + " plt.title(neon_site)\n", + " if v<2: \n", + " plt.xlabel(None)\n", + "\n", + "# Show plot\n", + "plt.show() ;" + ] + }, + { + "cell_type": "markdown", + "id": "8b6a0edb-015a-4fc1-bc07-aaeca72c8438", + "metadata": {}, + "source": [ + "---\n", + "**You also may want to look at:** \n", + "- ecosystem C pools (h0 files), \n", + "- the sum of annual flxues, \n", + "- more years of data, \n", + "- NEON observations, or \n", + "- additional variables\n", + "\n", + "\n", + "
\n", + "Congratualtions: \n", + "You've compared a control and experimental case!\n", + " \n", + "
" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "2d2c2fb4-3b0d-4502-beb9-b069ad70fc0a", + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "NPL 2023a", + "language": "python", + "name": "npl-2023a" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.9.15" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/_sources/notebooks/ProjectExamples/customizeCase_HistoryVariables.ipynb b/_sources/notebooks/ProjectExamples/customizeCase_HistoryVariables.ipynb new file mode 100644 index 0000000..8ae3a5b --- /dev/null +++ b/_sources/notebooks/ProjectExamples/customizeCase_HistoryVariables.ipynb @@ -0,0 +1,231 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "metadata": { + "tags": [] + }, + "source": [ + "# Customize your case: Additional History Fields\n", + "## *Customizing your case by adding additional history fields*\n", + "\n", + "**This is an optional tutorial** that provides an example for how to add history fields to your model output.\n", + "
\n", + "\n", + "---\n", + "## In this tutorial\n", + "\n", + "1. Add history fields to a case you've already run\n", + "\n", + "---\n", + "### First let's start with a bit of background on history files.\n", + "\n", + "Namelist let you controls aspects of your simulation, including the variables that are written out on different history files. By default the `h0` files have monthly averages of a bunch of different model output. The [CLM user's guide](https://escomp.github.io/ctsm-docs/versions/master/html/users_guide/setting-up-and-running-a-case/customizing-the-clm-namelist.html) has additional information adding and removing fields on history files, setting up history files with different temporal frequency and more.\n", + "\n", + "Let's see what we have on hisory files by default. You can look at one of these with the following commands.\n", + "\n", + "The `neon_site` you define should be for a site and case that you've already run.\n", + "- For the introductory example this was KONZ" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "export neon_site='KONZ' # the site you want to run\n", + "ls ~/scratch/NEON_cases/archive/$neon_site.transient/lnd/hist | head -5" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### What data are on the default, `h0` history files?\n", + "\n", + "Let's look at what's on the file using `ncdump -h`, which prints the header information on a netcdf file.\n", + "- **NOTE** the file name below may need to be adjusted for the time range of your simulation.\n", + "- **HINT** If you want to see the whole h0 history file get rid of the `| head -150` part of the command below. (Just know there's a lot of information on the `h0` files).\n", + "- You can also do this on the command line of a terminal window if it's helpful." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "ncdump -h ~/scratch/NEON_cases/archive/$neon_site.transient/lnd/hist/$neon_site.transient.clm2.h0.2018-01.nc | head -150" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### What data are on the `h1`, high frequncy (30 minute, daily resolution) history files?" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "ncdump -h ~/scratch/NEON_cases/archive/$neon_site.transient/lnd/hist/$neon_site.transient.clm2.h1.2018-01-01*.nc | tail -230" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### `h1` output is also defined in the `user_nl_clm` file for your case.\n", + "- **NOTE** this file gets copied several times with the run_neon.py script, which is kind of confusing. \n", + "- If lines are duplicated, the model only uses the last one in the `user_nl_clm` file" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/scratch/NEON_cases/$neon_site.transient\n", + "cat user_nl_clm" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "\n", + "THINK: What are additional variables you may want to look at with a higher temporal frequency?\n", + "\n", + "
\n", + "\n", + "\n", + "You can find a full list of history fields on [table 1.2.5 of the CTSM user's guide](https://escomp.github.io/ctsm-docs/versions/master/html/users_guide/setting-up-and-running-a-case/master_list_nofates.html).\n", + "\n", + "Assiming you don't want to get rid of any of the existing `h1` data, but add a few more fields you can just add them below.\n", + " \n", + "The example below adds runoff and vegetation temperature (`QRUNOFF` and `TV`).\n", + "You can also do this by directly opening and modifying the user_nl_clm file in your case directory.\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "echo \"hist_fincl2 = 'QRUNOFF','TV',\n", + " 'AR','ELAI','FCEV','FCTR','FGEV','FIRA','FSA','FSH','GPP','H2OSOI',\n", + " 'HR','SNOW_DEPTH','TBOT','TSOI','SOILC_vr','FV','NET_NMIN_vr'\" >> user_nl_clm\n", + " " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# Check that it worked\n", + "cat user_nl_clm | tail -3" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "**NOTE** not all variables listed in table 1.2.5 of the user's guide can easily be written out to history fields. After submitting your case, check the lnd.log in your case/run directory if your case fails to see if there's an issue with the history variables you're requesting.\n", + "\n", + "### Now resubmit your case" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./case.submit" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Now our case is submitted! Check that your experimental case is running " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "qstat -u $USER" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "tail ~/scratch/NEON_cases/$neon_site.transient/CaseStatus" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "Congratulations! \n", + " \n", + "You've added additional variables to you CLM history files.\n", + "\n", + "
\n" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "If you're developing this tutorial:\n", + "Before saving and pushing this code to github go to `Kernel` and `Restart kernel and clear all outputs...`" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Bash", + "language": "bash", + "name": "bash" + }, + "language_info": { + "codemirror_mode": "shell", + "file_extension": ".sh", + "mimetype": "text/x-sh", + "name": "bash" + } + }, + "nbformat": 4, + "nbformat_minor": 4 +} diff --git a/_sources/notebooks/ProjectExamples/customizeCase_PRISM.ipynb b/_sources/notebooks/ProjectExamples/customizeCase_PRISM.ipynb new file mode 100644 index 0000000..ec44893 --- /dev/null +++ b/_sources/notebooks/ProjectExamples/customizeCase_PRISM.ipynb @@ -0,0 +1,433 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "metadata": { + "tags": [] + }, + "source": [ + "# Customize your case: PRISM precipitation\n", + "We set up a special way to run_neon with PRISM precipitation data.\n", + "\n", + "**This is an optional tutorial** it's a little bit more advanced, but it will help you think about how to modify the model configuration to run new sites or model experiments. \n", + "\n", + "The `run_neon` script we used in the [introductory tutorial 1b](1b_NEON_Simulation_Intro.ipynb) created and ran a base case as well as a `.transient` case. Here we'll also be adding an experimental `.PRISM.transient` case that reads in an alternative precipitation dataset from PRISM. \n", + "\n", + "---\n", + "\n", + "## In this tutorial\n", + "\n", + "The tutorial has several components. Below you will find steps to: \n", + "1. Set up and run a simulation\n", + "\n", + "*Extra credit* \n", + "\n", + "2. Create another clone for an experiment you're hoping to do." + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "\n", + "NOTICE: If you're running this notebook through the NCAR JupyterHub login, you need to be on a Cheyenne login node (NOT Casper). \n", + "\n", + "
\n", + "\n", + "***\n", + "\n", + "#### Set up your environment\n", + "It is important in order to have all the tools and packages you need to run simulations." + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + " \n", + "TIP: If you're running on Cheyenne, you may need to uncomment the the following two lines of code. This will set up your conda environment correctly.\n", + "\n", + "This is not required if your running CESM-Lab in the cloud.\n", + "\n", + "
" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#module purge\n", + "#module load conda ncarenv" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "

1. Create a new case

\n", + "\n", + "## 1.1 Navigate to your source code" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/CTSM/tools/site_and_regional" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 1.2 Create a new case with `run_neon.py`\n", + "\n", + "\n", + "The following code will:\n", + "- create a new case\n", + "- make a few modifications\n", + "- submit the simulation\n", + "\n", + "**REMEMBER** PRISM cases can only be run for NEON sites in the lower 48 states (HI, AK, and PR won't work)" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# Change the 4-character NEON site below.\n", + "\n", + "export neon_site='KONZ' # This should likely be a site you've already run.\n", + "export experiment='PRISM'" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# then run_neon\n", + "./run_neon.py --neon-sites $neon_site \\\n", + " --output-root ~/scratch/NEON_cases \\\n", + " --experiment $experiment \\\n", + " --setup-only \\\n", + " --overwrite \\\n", + " --prism" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Since this doesn't always render correctly on websites, here the code from above\n", + "\n", + "```\n", + "./run_neon.py --neon-sites $neon_site \\\n", + " --output-root ~/scratch/NEON_cases \\\n", + " --experiment $experiment \\\n", + " --setup-only \\\n", + " --overwrite \\\n", + " --prism\n", + "```\n", + "Two new flags are being used here:\n", + "- `--experiment` adds an additional string to our case name\n", + "- `--setup-only` creates the case without running it\n", + "- `--overwrite` will let you overwrite an existing case. \n", + "- `--prism` configures the case to use PRISM precipitation data " + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "----\n", + "# 2. Introduction to controling case configuration\n", + "\n", + "## 2.1 Setup and Build\n", + "First, we'll setup and build our case manually\n", + "\n", + "NOTE: As before, this takes some time" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/scratch/NEON_cases/${neon_site}.${experiment}.transient\n", + "./case.setup\n", + "qcmd -- ./case.build" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 2.2 What's different with my case?\n", + "XML files are used to control how cases are configured \n", + "\n", + "Before digging in too we can start to see how our PRISM.transient case is different." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "diff ../${neon_site}.transient/env_run.xml ../${neon_site}.PRISM.transient/env_run.xml" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# These are the datm.streams for the PRISM.transient case, we'll just look at the end of the file\n", + "cat CaseDocs/datm.streams.xml | tail -26" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "\n", + "**What are the differences between these two cases** based on their `env_run.xml` and `datm.streams.xml` files?\n", + "\n", + "Where does the KONZ.transient case get it's precipitation data from?\n", + "\n", + "These .xml changes set up high-level control over how your simulation is run. What are some of the specifics related to the land model? We can see this by looking at our `lnd_in` file.\n", + "\n", + "---\n", + "\n", + "## 2.2 `lnd_in` \n", + "\n", + "**What are the differences between these two cases**, based on their `lnd_in` files?\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cat CaseDocs/lnd_in | grep finidat" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "This is not an initial conditions file from a PRISM simulation. We'll have to change this.\n", + "\n", + "\n", + "
\n", + "REMEMBER:\n", + " \n", + "- The lnd_in file provides a high level summary of all the name list chagnes and files that are being used by CLM. \n", + "- It can be found in the CaseDocs directory, or in your run directory. \n", + "- You cannot directly modifiy the lnd_in file, instead users can modify user_nl_clm.\n", + "\n", + "
\n", + "\n", + "**Initial conditions dataset:** `finidat`\n", + " - These are initial conditions files that we created by spinning up the model. \n", + " - Spin up requires starting the model from bare ground conditions (we call it a *coldstart*).\n", + " - Spin up takes a few hundred years of simulations so that ecosystem carbon and nitrogen pools acheive steady state conditions (e.g. average net ecosystem exchange equals zero). \n", + " - Since this takes a long time, we provide initial conditions for you to start from.\n", + " - **This also means that if you change model parameterizations, input data, or anything else you ahve to spin up the model again!** \n", + "\n", + "---\n", + "\n", + "The `lnd_in` files are controlled by `user_nl_clm`. We have to modify our user_nl_clm to point to the right initial conditions data" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 2.3 Submit the case" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "echo \"finidat='/scratch/data/NEONv2/PRISM.restart/$neon_site.postad.clm2.r.0318-01-01-00000.nc'\" >> user_nl_clm\n", + "\n", + "#Then check it worked as intended\n", + "./preview_namelists\n", + "\n", + "cat CaseDocs/lnd_in | grep finidat" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./case.submit" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# Check to see taht your case is running \n", + "qstat -u $USER" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cat CaseStatus | tail -10" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# 3. Create an experimental clone:\n", + "\n", + "

This step is optional, but provides helpful information that you may use in your own workflow

\n", + "\n", + "So far, everything we've done has been *out of the box* looking at different NEON sites, but without changing anything in the underlying model code. You may want to do model experiments where you alter the vegetation growing at a site, modify some of the model parameters, modify namelist settings, change the input data, or even alter model code. We'll get into how do make these changes later, but for now we'll get a test case set up.\n", + "\n", + "Since we're already run an out of the box case for KONZ, we can create a paired experimental case at the same site.\n", + "\n", + "
\n", + "RECOMMENDATION: use a short, descriptive name for your experiment, it will help you down the road.\n", + "
\n", + "\n", + "\n", + "This example below just builds on what you've already been doing:" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# Change the 4-character NEON site below.\n", + "cd ~/CTSM/tools/site_and_regional\n", + "export new_case='CPER' # the new site you want to run\n", + "\n", + "# then run_neon\n", + "./run_neon.py --neon-sites $new_case \\\n", + " --output-root ~/scratch/NEON_cases/ \\\n", + " --base-case ~/scratch/NEON_cases/$neon_site.$experiment.transient \\\n", + " --experiment $experiment \\\n", + " --setup-only \\\n", + " --overwrite \\\n", + " --prism" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "\n", + "WARNING: Because we're also using the `--base-case` flag, we won't have to rebuild our experimental case. This may not be advisable if you're modifying model code.\n", + "\n", + "
\n", + "\n", + "At this point your experimental case has been created. \n", + "- What is the case name?\n", + "- Can you navigate to your case directory?\n", + "- Are there any differences between this experimental case and the base case you already ran?\n", + "- Can you find the datm input data for your case?\n", + "- Is the model going to use an initial conditions file?\n", + "- Where is the surface dataset that's being used?\n", + "- Can you find the parameter file for your case?\n", + "\n", + "---\n", + "\n", + "Now we'll point to the correct restart file and submit the case" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/scratch/NEON_cases/$new_case.$experiment.transient\n", + "echo \"finidat='/scratch/data/NEONv2/PRISM.restart/$new_case.postad.clm2.r.0318-01-01-00000.nc'\" >> user_nl_clm\n", + "\n", + "#Then check it worked as intended\n", + "./preview_namelists\n", + "\n", + "cat CaseDocs/lnd_in | grep finidat" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cat CaseDocs/lnd_in | grep finidat\n", + "./case.submit" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "\n", + "
\n", + "Congratulations! \n", + " \n", + "You've created and run an experimental case that uses PRISM precipitation data instead of NEON precipitation\n", + " .\n", + "
\n", + "\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Bash", + "language": "bash", + "name": "bash" + }, + "language_info": { + "codemirror_mode": "shell", + "file_extension": ".sh", + "mimetype": "text/x-sh", + "name": "bash" + } + }, + "nbformat": 4, + "nbformat_minor": 4 +} diff --git a/_sources/notebooks/ProjectExamples/customizeCase_modelFeatures.ipynb b/_sources/notebooks/ProjectExamples/customizeCase_modelFeatures.ipynb new file mode 100644 index 0000000..4fee464 --- /dev/null +++ b/_sources/notebooks/ProjectExamples/customizeCase_modelFeatures.ipynb @@ -0,0 +1,448 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "metadata": { + "tags": [] + }, + "source": [ + "# Customize your case: Controling model features\n", + "## *Customizing your case with namelist changes*\n", + "\n", + "**This is an optional tutorial** that provides some additional guidance for creating an experimental clone for a NEON case and making namelist changes. If results from this preliminary experiment look promising, you should also consider spinning up the model. These examples are in the [customizeCase_spinupExample notebook](./customizeCase_spinupExample.ipynb)\n", + "\n", + "We're going to move kind of quickly through some material that's already covered in the tutorial on [cloning a NEON case](./Clone_Case.ipynb). The cloned case that you created in the Clone_Case tutorial will be used as the control simulation for this model experiment. **If you have tried cloning a case you need to do that now.**\n", + "\n", + "\n", + "---\n", + "## In this tutorial\n", + "\n", + "1. Create an experimental clone for a NEON site that you've already run.\n", + "2. Make a namelist change in user_nl_clm.\n", + "3. Submit the case. \n", + "\n", + "---\n", + "### First let's start with a bit of background.\n", + "CLM has different features that can be turned on or off with namelist changes. Some of these features represent alternative hypotheses about how different aspects of how the land works. The different options have alternative model structure and parameterizations for particular processes that are controlled with namelist flags. These include:\n", + "- FATES vs. 'BigLeaf' vegetation\n", + "- Medlyn vs. Ball-Berry stomatal conductance\n", + "- CENTURY vs. MIMICS soil biogeochemistry \n", + "- Different soil moisture stress formulations (below)\n", + "- and lots more\n", + "\n", + "You can find out more about [namelists in the CTSM user's guide](https://escomp.github.io/ctsm-docs/versions/master/html/users_guide/setting-up-and-running-a-case/customizing-the-clm-namelist.html)\n", + "\n", + "*Why would you want to use this?*\n", + "\n", + "We noticed that soil moisture profiles in CLM have an odd feature where soil moisture is higher in surface soils than in the sub surface. Why would this happen?\n", + "![moisture plot](../../images/WOOD_H2OSOI.png)\n", + "\n", + "Plant hydraulic stress (or **PHS**) was introduced in CLM5. You can [learn more about PHS in this paper](https://doi.org/10.1029/2018MS001500), where Daniel Kennedy and co-authors mentioned hydraulic redistribution of soil water by plant roots. This happens in the real world too and is a pretty neat feature of PHS. Could hydraulic redistribution also be keeping surface soils in CLM too wet? To address this question we'll do a simple model experiment where we turn off PHS. This will revert back to the **BTRAN** formulation of soil moisture stress that was used in previous versions of CLM. \n", + "\n", + "We can turn of PHS with a simple namelist modification, but since this will change answers in the model, we also need to spin up the model again to generate new initial conditions with PHS off. " + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "\n", + "NOTICE: If you're running this notebook through the NCAR JupyterHub login, you need to be on a Cheyenne login node (NOT Casper). \n", + "\n", + "
\n", + "\n", + "---\n", + "\n", + "### Set up environment\n", + "It is important in order to have all the tools and packages you need to run simulations. \n", + "\n", + "*The code below **is not** needed in the cloud*.\n", + "\n", + "
\n", + " \n", + "TIP: If you're running on Cheyenne, you may need to uncomment the the following two lines of code. This will set up your conda environment correctly.\n", + "\n", + "This is not required if your running CESM-Lab in the cloud.\n", + "\n", + "
" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#module purge\n", + "#module load conda ncarenv" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# 1. Create a new case.\n", + "Because we're going to modify namelist options that will change answers in CLM we have to run this case through an accelerated decompostion (AD) and postAD spinup. This will generate new initial conditions for our experimental case, but it also takes a long time. First we'll just do a simple sensitivity test to see if model results are sensitive to the representaton of plant water stress.\n", + "\n", + "## 1.1 Check that you've run a control case." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "export neon_site='WOOD' # the site you want to run\n", + "ls ~/scratch/NEON_cases/$neon_site.transient" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "If the code block above says *\"No such file or directory\"* you need to go back and create a control case for your neon_site using [clone_case](Clone_Case.ipynb).\n", + "\n", + "If you have run a control case, which includes flies like: \n", + "- case.build, case.setup, and case.submit; \n", + "- env_build.xml, env_batch.xml, and env_run.xml; and \n", + "- user_nl_clm, user_nl_datm, and user_nl_datm_streams \n", + "\n", + "Then you can move on to the next step\n", + "\n", + "## 1.2 Navigate to your source code" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/CTSM/tools/site_and_regional" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 1.3 Create an experimental clone\n", + "\n", + "In our experimental case we'll be using the BTRAN formulation of soil moisture stress. \n", + "\n", + "
\n", + "\n", + "HINT: It's helpful to have descriptive experiment names. \n", + "\n", + "
" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "export experiment='BTRAN' # the experimental name of your case" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Since we're creating an experimental case that will change answers in the model we should run a full AD and postAD spinup, but for now we just want to run a quick sensitivity experiment with a new parameter file.\n", + "\n", + "\n", + "Then run_neon with the following flags:\n", + "- `--experiment $experiment` \n", + "- `--setup-only` \n", + "\n", + "To make things faster, we'll also use the experimental control case as our 'base_case'.\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./run_neon.py --neon-sites $neon_site \\\n", + " --output-root ~/scratch/NEON_cases \\\n", + " --base-case ~/scratch/NEON_cases/$neon_site.transient \\\n", + " --experiment $experiment \\\n", + " --overwrite \\\n", + " --setup-only \n", + " \n", + "echo '----Your experimental clone has been created----'" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# 2 Customizing your case: Namelist changes\n", + "The configuration of CLM can be customized via namelist modifications. \n", + "\n", + "These changes made using namelist files like `user_nl_clm`\n", + "\n", + "## 2.1 Move to the case directory for your experimental clone" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/scratch/NEON_cases/$neon_site.$experiment.transient" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 2.2 Getting familiar with namelist files\n", + "`user_nl_` files are created in the case directory after setting up your case with `./case.setup`\n", + " - Note: This was already done for us since we cloned a case with run_neon\n", + " \n", + "#### Take a look!\n", + " - What other user `user_nl_` files do you already have in this case directory?\n", + " - What kind of information is already included in a `user_nl_clm` file?\n", + "\n", + "We can explore these files on the comand line using an editor, by opening them directly in jupyter hub, or by simply printing the contents of the files to the screen here." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": { + "tags": [] + }, + "outputs": [], + "source": [ + "ls user_nl_*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": { + "tags": [] + }, + "outputs": [], + "source": [ + "cat user_nl_clm | tail -18" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "The compset that you created your case with sets up initial, or default namelist options. These can be found in `CaseDocs/lnd_in`\n", + "\n", + "\n", + "
\n", + "Important: Don’t modify the lnd_in namelist file directly. Instead, make changes in user_nl_clm.\n", + "
\n", + "\n", + "## 2.3 Looking deeper at namelist options \n", + "All CLM namelist options are defined in the `lnd_in` file\n", + "\n", + "We can explore this file on the comand line using an editor, by opening it directly in jupyter hub, or by simply printing the contents of the files to the screen here. \n", + "- **NOTE:** This file is huge, so we'll just look at the first 65 lines" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cat CaseDocs/lnd_in | head -60" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "There's a lot to dig into here! So we'll just stick with a few highlights.\n", + "\n", + "#### Take a look\n", + "**See what printed to in the cell above and answer the following questions**\n", + "- `finidat`: What initial conditions file are you using? \n", + "- `fsurdat`: What surface dataset are you using?\n", + "- `paramfile`: What parameter file are you using?\n", + "- `spinup_state`: What is your spinup state?\n", + "- `use_hydrstress`: Are you using plant hydraulic stress?\n", + "\n", + "Does this make sense? Answers are in the hidden cell below.\n" + ] + }, + { + "cell_type": "markdown", + "metadata": { + "tags": [] + }, + "source": [ + "- `finidat = '.../initdata/WOOD.2022-11-11.clm2.r.0318-01-01-00000.nc '` This is your initial condition file\n", + "- `fsurdat = \".../surfdata_1x1_NEON_WOOD_hist_78pfts_CMIP6_simyr2000_c230111.nc\"` This the surface dataset that's been modified for our NEON site.\n", + "- `paramfile = '.../ctsm51_params.c211112.nc'` is the default parameter file for CTSM5.1 \n", + "- `spinup_state = 0`, which is used for normal mode\n", + "- `use_hydrstress = .true.`, because plant hydraulic stress is on by default in CTSM5.1 \n" + ] + }, + { + "cell_type": "markdown", + "metadata": { + "tags": [] + }, + "source": [ + "***\n", + "\n", + "- Additional information about customizing CTSM's configurations, including namelist modifications, are available in the [CTSM users guide](https://escomp.github.io/ctsm-docs/versions/master/html/users_guide/setting-up-and-running-a-case/customizing-the-clm-configuration.html?highlight=namelist)\n", + "Namelist changes can also be used to modify variables on history file output. Simple modification of history file output DOES NOT require spinning up the model.\n", + "- A list of all the [CTSM history fields are available here](https://escomp.github.io/ctsm-docs/versions/master/html/users_guide/setting-up-and-running-a-case/master_list_nofates.html)\n", + "- A list of all the [CTSM-FATES history fields are available here](https://escomp.github.io/ctsm-docs/versions/master/html/users_guide/setting-up-and-running-a-case/master_list_fates.html)\n", + "\n", + "## 2.3 Turn off plant hydraulic stress\n", + "\n", + "For this experiment we're going turn plant hydraulic stress off. We can change user_nl_clm using an editor, by opening it directly in jupyter hub, or with the following comand." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "echo \"use_hydrstress = .false.\" >> user_nl_clm" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Let make sure this worked. We can: \n", + "- preview namelists;\n", + "- check the `lnd_in` file." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "## now make sure it worked \n", + "./preview_namelists" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cat CaseDocs/lnd_in | grep hydrstress" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "We've turned off PHS in simulation \n", + "\n", + "## 2.4 Start the simulation\n", + "Since we made a clone and only made namelist changes we don't have to rebuild our case, so now we're ready to submit the case." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./case.submit" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "qstat -u $USER" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "tail ~/scratch/NEON_cases/$neon_site.$experiment.transient/CaseStatus" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "Congratulations! \n", + " \n", + "You've created and run a full spinup for an experimental case of CLM at the NEON tower you selected!\n", + " \n", + "Now we need to see how the simulations are different.\n", + "
\n", + "\n" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "If you're developing this tutorial:\n", + "Before saving and pushing this code to github go to `Kernel` and `Restart kernel and clear all outputs...`" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Bash", + "language": "bash", + "name": "bash" + }, + "language_info": { + "codemirror_mode": "shell", + "file_extension": ".sh", + "mimetype": "text/x-sh", + "name": "bash" + } + }, + "nbformat": 4, + "nbformat_minor": 4 +} diff --git a/_sources/notebooks/ProjectExamples/customizeCase_parameterModifications.ipynb b/_sources/notebooks/ProjectExamples/customizeCase_parameterModifications.ipynb new file mode 100644 index 0000000..c59ab6f --- /dev/null +++ b/_sources/notebooks/ProjectExamples/customizeCase_parameterModifications.ipynb @@ -0,0 +1,438 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "metadata": { + "tags": [] + }, + "source": [ + "# Customize your case: Parameter modifications\n", + "## *Customizing your case by changing model parameters*\n", + "\n", + "**This is an optional tutorial** that provides some additional guidance for creating an experimental clone for a NEON case and testing parameter sensitivities in the model. Once you settle on a new parameter set you want to use, you should also spinning up the model. These examples are in the [customizeCase_spinupExample notebook](./customizeCase_spinupExample.ipynb)\n", + "\n", + "We're going to move kind of quickly through some material that's already covered in the tutorial on [cloning a NEON case](./Clone_Case.ipynb). The cloned case that you created in the Clone_Case tutorial will be used as the control simulation for this model experiment. **If you have tried cloning a case you need to do that now.**\n", + "\n", + "Additionally, this tutorial assumes that you've modified the CLM parameter file. We provided an example notebook for [modifying parameters](./modifyParameterFile.ipynb). **This should be done before running the rest of this notebook.**\n", + "
\n", + "\n", + "---\n", + "## In this tutorial\n", + "\n", + "1. Create an experimental clone for a NEON site that you've already run.\n", + "2. Point to a modified parameter file in user_nl_clm.\n", + "3. Submit the case. \n", + "\n", + "---\n", + "### First let's start with a bit of background.\n", + "\n", + "Parameter files are read into CLM. We provide a default parameter file for your cases, but this can be modified by pointing to a new parameter file in user_nl_clm. \n", + "\n", + "Since changing parameters in the model will change answers, we also need to spin up the model to generate new initial conditions files." + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "\n", + "NOTICE: If you're running this notebook through the NCAR JupyterHub login, you need to be on a Cheyenne login node (NOT Casper). \n", + "\n", + "
\n", + "\n", + "### Set up your environment\n", + "It is important in order to have all the tools and packages you need to run simulations. " + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + " \n", + "TIP: If you're running on Cheyenne, you may need to uncomment the the following two lines of code. This will set up your conda environment correctly.\n", + "\n", + "This is not required if your running CESM-Lab in the cloud.\n", + "\n", + "
" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#module purge\n", + "#module load conda ncarenv" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# 1. Create an experimental clone.\n", + "This tutorial assumes that you've already run a control case for the NEON site you're interested in. \n", + "\n", + "## 1.1 Check that you've run a control case." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "export neon_site='HARV' # the site you want to run\n", + "ls ~/scratch/NEON_cases/$neon_site.transient" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "If the code block above says *\"No such file or directory\"* you need to go back and create a control case for your neon_site using [clone_case](Clone_Case.ipynb).\n", + "\n", + "If you have run a control case, which includes flies like: \n", + "- case.build, case.setup, and case.submit; \n", + "- env_build.xml, env_batch.xml, and env_run.xml; and \n", + "- user_nl_clm, user_nl_datm, and user_nl_datm_streams \n", + "\n", + "Then you can move on to the next step\n", + "\n", + "## 1.2 Navigate to your source code" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/CTSM/tools/site_and_regional" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 1.3 Create an experimental clone\n", + "\n", + "In our experimental case we'll changing the foliar C:N ratio for a temperate deciduous tree. \n", + "\n", + "
\n", + "\n", + "HINT: It's helpful to have descriptive experiment names. \n", + "\n", + "
\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "export experiment='foliarCN-30' # this is name of your experimenal case " + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Since we're creating an experimental case that will change answers in the model we should run a full AD and postAD spinup, but for now we just want to run a quick sensitivity experiment with a new parameter file.\n", + "\n", + "\n", + "Then run_neon with the following flags:\n", + "- `--experiment $experiment` \n", + "- `--setup-only` \n", + "\n", + "To make things faster, we'll also use the experimental control case as our 'base_case'." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./run_neon.py --neon-sites $neon_site \\\n", + " --output-root ~/scratch/NEON_cases \\\n", + " --base-case ~/scratch/NEON_cases/$neon_site.transient \\\n", + " --experiment $experiment \\\n", + " --overwrite \\\n", + " --setup-only \n", + " \n", + "echo '----Your experimental clone has been created----'" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# 2 Customizing your case: Namelist changes\n", + "The configuration of CLM can be customized via namelist modifications. \n", + "\n", + "These changes made using namelist files like `user_nl_clm`\n", + "\n", + "## 2.1 Move to the case directory for your experimental clone" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/scratch/NEON_cases/$neon_site.$experiment.transient" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 2.2 Getting familiar with namelist files\n", + "`user_nl_` files are created in the case directory after setting up your case with `./case.setup`\n", + " - Note: This was already done for us since we cloned a case with run_neon\n", + " \n", + "#### Take a look!\n", + " - What other user `user_nl_` files do you already have in this case directory?\n", + " - What kind of information is already included in a `user_nl_clm` file?\n", + "\n", + "We can explore these files on the comand line using an editor, by opening them directly in jupyter hub, or by simply printing the contents of the files to the screen here." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": { + "tags": [] + }, + "outputs": [], + "source": [ + "ls user_nl_*" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": { + "tags": [] + }, + "outputs": [], + "source": [ + "cat user_nl_clm | tail -18" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "The compset that you created your case with sets up initial, or default namelist options. These can be found in `CaseDocs/lnd_in`\n", + "\n", + "\n", + "
\n", + "Important: Don’t modify the lnd_in namelist file directly. Instead, make changes in user_nl_clm.\n", + "
\n", + "\n", + "## 2.3 Looking deeper at namelist options \n", + "All CLM namelist options are defined in the `lnd_in` file\n", + "\n", + "We can explore this file on the comand line using an editor, by opening it directly in jupyter hub, or by simply printing the contents of the files to the screen here. \n", + "- **NOTE:** This file is huge, so we'll just look at the first 65 lines" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cat CaseDocs/lnd_in | head -40" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "There's a lot to dig into here! So we'll just stick with a few highlights.\n", + "\n", + "#### Take a look\n", + "**See what printed to in the cell above and answer the following questions**\n", + "- `finidat`: What initial conditions file are you using? \n", + "- `fsurdat`: What surface dataset are you using?\n", + "- `paramfile`: What parameter file are you using?\n", + "\n", + "Does this make sense? Answers are in the hidden cell below.\n" + ] + }, + { + "cell_type": "markdown", + "metadata": { + "tags": [] + }, + "source": [ + "- `finidat = '.../HARV.2022-11-11.clm2.r.0318-01-01-00000.nc'` This is for a control case, not one with modified parameters! That's OK for now, but it's good to be aware of where your initial conditions are coming from.\n", + "- `fsurdat = \".../surfdata_1x1_NEON_HARV_hist_78pfts_CMIP6_simyr2000_c230111.nc\"` This the surface dataset that's been modified for our NEON site.\n", + "- `paramfile = '.../ctsm51_params.c211112.nc'` is the default parameter file for CTSM5.1 " + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "***\n", + "\n", + "- Additional information about customizing CTSM's configurations, including namelist modifications, are available in the [CTSM users guide](https://escomp.github.io/ctsm-docs/versions/master/html/users_guide/setting-up-and-running-a-case/customizing-the-clm-configuration.html?highlight=namelist)\n", + "Namelist changes can also be used to modify variables on history file output. Simple modification of history file output DOES NOT require spinning up the model.\n", + "- A list of all the [CTSM history fields are available here](https://escomp.github.io/ctsm-docs/versions/master/html/users_guide/setting-up-and-running-a-case/master_list_nofates.html)\n", + "- A list of all the [CTSM-FATES history fields are available here](https://escomp.github.io/ctsm-docs/versions/master/html/users_guide/setting-up-and-running-a-case/master_list_fates.html)\n", + "\n", + "## 2.4 Point to your modified parameter file\n", + "\n", + "For this experiment we're changing the foliar C:N ratio for temperate deciduous forests. Do do this we have to point to our modified parameter file. We can change user_nl_clm using an editor, by opening it directly in jupyter hub, or with the following command." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# This is the path to the modified parameter file you created\n", + "\n", + "# If you're running on cheyenne, uncomment the line below\n", + "#echo \"paramfile = '/glade/scratch/$USER/NEON_cases/modified_inputs/ctsm51_params.c211112_tdf_leafcn30.nc'\" >> user_nl_clm\n", + "\n", + "# If you're running with CESM-Lab in the cloud, uncomment the line below\n", + "echo \"paramfile = '/scratch/$USER/NEON_cases/modified_inputs/ctsm51_params.c211112_tdf_leafcn30.nc'\" >> user_nl_clm" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Let make sure this worked. We can: \n", + "- preview namelists;\n", + "- check the `lnd_in` file." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./preview_namelists" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cat CaseDocs/lnd_in | grep paramfile" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "We've changes ethe parameter file that's being used for our simulation.\n", + "\n", + "# 3 Sumbit the run\n", + "We already build the model, and when making namelist or .xml changes we don't have to rebuild our case, so now we're ready to submit our simulation." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./case.submit" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Now our case is submitted! Check that your experimental case is running " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "qstat -u $USER" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "tail ~/scratch/NEON_cases/$neon_site.$experiment.transient/CaseStatus" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "Congratulations! \n", + " \n", + "You've created an experimental clone of CLM at the NEON tower you selected!\n", + " \n", + "Now we need to see how the simulations are different.\n", + "
\n", + "\n", + "**Assuming you see differences between your experimental and control cases, you may want to consider spinning up the experimental case [Spinup Example notebook](./customizeCase_spinupExample.ipynb).**" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "If you're developing this tutorial:\n", + "Before saving and pushing this code to github go to `Kernel` and `Restart kernel and clear all outputs...`" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Bash", + "language": "bash", + "name": "bash" + }, + "language_info": { + "codemirror_mode": "shell", + "file_extension": ".sh", + "mimetype": "text/x-sh", + "name": "bash" + } + }, + "nbformat": 4, + "nbformat_minor": 4 +} diff --git a/_sources/notebooks/ProjectExamples/customizeCase_spinupExample.ipynb b/_sources/notebooks/ProjectExamples/customizeCase_spinupExample.ipynb new file mode 100644 index 0000000..6a684fc --- /dev/null +++ b/_sources/notebooks/ProjectExamples/customizeCase_spinupExample.ipynb @@ -0,0 +1,834 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "metadata": { + "tags": [] + }, + "source": [ + "# Customize your case: Spinning up the model\n", + "\n", + "**This is an optional tutorial** that provides some additional guidance for spinning up CTSM at NEON sites.\n", + "\n", + "This tutorial assumes that you've already done a quick sensitivity test that your [parameter modifications](./customizeCase_parameterModifications.ipynb), [namelist changes](customizeCase_modelFeatures.ipynb), or other code modifications changes answers is quick, transient simulations. It may be helpful to refer back to these tutorials if you have questions or want more information about creating an experimental case.\n", + "\n", + "---\n", + "### In this tutorial you will use run_neon to: \n", + "\n", + "1. Start an accelerated decomposition (ad) spinup from cold start.\n", + "2. Continue a postAD run,\n", + "3. Do a transient simulation \n", + "\n", + "---\n", + "\n", + "Spinup, or model initialization from a cold start, actually takes a little bit of time. Let's briefly cover what spinup means.\n", + "\n", + "# Background on spinup\n", + "\n", + "We make make steady state assumptions about *initial* state of ecosystem properties like temperature\n", + "water, snow, ice, carbon & nitrogen. This is the *equilibrium* state of the model, given the forcing\n", + "data. In model experiments we make modifications to namelist settings, the parameter files, surface dataset, or underlying model code we also need to generate new initial conditions. \n", + "\n", + "In runs with active biogoechemistry, like these NEON simulations, this means we need to get the ecosystem carbon and nigrogen pools with long turnover times into steady state. The turnover and decomposition of these slow pools is mathamatically accelerated in our AD (accelerated decomposition) case. This means we:\n", + "- Accelerate turnover of wood, litter and soil pools.\n", + "- Accelerate advection and diffusion terms too\n", + "- In CLM5 and CTSM5.1 this is calculated as a function of latitude so that spinup is more accelerated in high latitude regions.\n", + "\n", + "Spinning up CTSM consists of 3 parts that includes:\n", + "1. ad, for accelerated decomposition, \n", + "2. postAD, which occurs after ad spinup, and\n", + "3. transient.\n", + "\n", + "More information about spinup is available in the [CLM user's guide](https://escomp.github.io/ctsm-docs/versions/master/html/users_guide/running-special-cases/Spinning-up-the-biogeochemistry-BGC-spinup.html?highlight=spinup). Briefly: \n", + "\n", + "- During ad and postAD spinup, we just cycle over several years of input data. For most NEON sites we cycle over four years of data from 2018-2021. This also is the same time period we have data for running transient simulations, but as the NEON record gets longer, so too will these transient simulations.\n", + "- During ad and postAD spinup we hold other inputs constant (e.g., atmospheric CO2 concentrations, N deposition, etc.). For transient runs these inputs also change over time.\n", + "- During ad spinup we accelerated the turnover of *slow* pools of C and N that normally have a long residence time in ecosystems (wood and soils).\n", + "- During postAD runs we take away this accelerated decomposition and let the ecosystem settle into its equilibrium, or steady-state under 'normal conditions'. \n", + "- Finally, transient runs are used to compare with observations, and include high frequency output that we can compare with flux tower measurements.\n", + "\n", + "
\n", + "\n", + "NOTE: for runs without active biogeochemistry (called satelite shenology, or SP simulations), we still need to equilibrate the model. This is much faster and doesn't require accelerated decomposition.\n", + "\n", + "
" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "For most temperate systems < 200 years of AD simulations seems adequate, but in colder ecosystems (like NEON sites in Alaska) this can take much longer because cold temperatures slow the turnover of soil organic matter. We have this set up already in the usermod directories that are used to configure your NEON case with `run_neon`. We can look to see if total ecosystem carbon pools (the sum of all vegetation, litter and soil C stocks) look to be equilibrated after 200 years.\n", + "\n", + "![ad_spinup](../../images/WOOD.BTRAN.ad_spin.png)\n", + "\n", + "#### LOOK\n", + "- Does the model seem to have achieved steady state?\n", + "- Why are there periodic oscillations in the total ecosystem C pools?\n", + "\n", + "This plot was generated using the [QuickPlot_CTSM_spinup](QuickPlot_CTSM_spinup.ipynb) notebook, which you can modify for your own site or simulation.\n", + "\n", + "After your AD simulation is finished, we have to take the model out of AD mode. We call these postAD simulations. \n", + "\n", + "Have a look to see if 100 years is enough to get pools to steady state? \n", + "\n", + "![postad](../../images/WOOD.BTRAN.postad.png)\n", + "\n", + "#### LOOK\n", + "- In postad simulations ecosystem carbon and nitrogen are much larger than in the ad case. \n", + "- Does the model seem to have achieved steady state?\n", + "\n", + "---\n", + "\n", + "## Let's get started!" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "\n", + "NOTICE: If you're running this notebook through the NCAR JupyterHub login, you need to be on a Cheyenne login node (NOT Casper). \n", + "\n", + "
\n", + "\n", + "---\n", + "\n", + "### Set up environment\n", + "It is important in order to have all the tools and packages you need to run simulations. \n", + "\n", + "
\n", + " \n", + "TIP: If you're running on Cheyenne, you may need to uncomment the the following two lines of code. This will set up your conda environment correctly.\n", + "\n", + "This is not required if your running CESM-Lab in the cloud.\n", + "\n", + "
" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "#module purge\n", + "#module load conda ncarenv" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# 1. Create a new ad case.\n", + "Because we're going to modify namelist options that will change answers in CLM we have to run this case through an accelerated decompostion (AD) and postAD spinup. This will generate new initial conditions for our experimental case, but it also takes a long time. \n", + "\n", + "## 1.1 Check that you've run a control case." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "export neon_site='HARV' # the site you want to run\n", + "ls ~/scratch/NEON_cases/$neon_site.transient" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "If the code block above says *\"No such file or directory\"* you need to go back and create a control case for your neon_site using [clone_case](Clone_Case.ipynb).\n", + "\n", + "If you have run a control case, which includes flies like: \n", + "- case.build, case.setup, and case.submit; \n", + "- env_build.xml, env_batch.xml, and env_run.xml; and \n", + "- user_nl_clm, user_nl_datm, and user_nl_datm_streams \n", + "\n", + "Then you can move on to the next step\n", + "\n", + "## 1.2 Navigate to your source code" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/CTSM/tools/site_and_regional" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 1.3 Create an experimental clone\n", + "\n", + "In our experimental case we'll changing the foliar C:N ratio for a temperate deciduous tree. \n", + "\n", + "
\n", + "\n", + "HINT: It's helpful to have descriptive experiment names. \n", + "\n", + "
" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "export experiment='foliarCN-30' # this is name of your experimenal case " + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Since we're creating an experimental case that will change answers in the model we should run a full AD and postAD spinup. The same run_neon script makes this simple.\n", + "\n", + "\n", + "Then run_neon with the following flags:\n", + "- `--experiment $experiment` \n", + "- `--run-type ad`\n", + "- `--setup-only` \n", + "\n", + "**NOTE** Don't worry about build warnings from the list below, we'll build the model later." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./run_neon.py --neon-sites $neon_site \\\n", + " --output-root ~/scratch/NEON_cases \\\n", + " --experiment $experiment \\\n", + " --run-type ad \\\n", + " --overwrite \\\n", + " --setup-only \n", + " \n", + "echo '----Your experiment.ad case has been created----'" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 1.4 Customizing your case: Namelist changes\n", + "The configuration of CLM can be customized via namelist modifications. \n", + "\n", + "These changes made using namelist files like `user_nl_clm`\n", + "\n", + "### 1.4.1 Move to the case directory for your experimental clone" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/scratch/NEON_cases/$neon_site.$experiment.ad" + ] + }, + { + "cell_type": "markdown", + "metadata": { + "tags": [] + }, + "source": [ + "### 1.4.2 Customize your case\n", + "\n", + "For this experiment we're changing the foliar C:N ratio for temperate deciduous forests. Do do this we have to point to our modified parameter file. We can change user_nl_clm using an editor, by opening it directly in jupyter hub, or with the following command." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": { + "tags": [] + }, + "outputs": [], + "source": [ + "# This is the path to the modified parameter file you created\n", + "\n", + "# If you're running on cheyenne, uncomment the line below\n", + "#echo \"paramfile = '/glade/scratch/$USER/NEON_cases/modified_inputs/ctsm51_params.c211112_tdf_leafcn30.nc'\" >> user_nl_clm\n", + "\n", + "# If you're running with CESM-Lab in the cloud, uncomment the line below\n", + "echo \"paramfile = '/scratch/$USER/NEON_cases/modified_inputs/ctsm51_params.c211112_tdf_leafcn30.nc'\" >> user_nl_clm" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "Let make sure this worked. We can: \n", + "- preview namelists;\n", + "- check the `lnd_in` file." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./preview_namelists" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cat CaseDocs/lnd_in | head -50" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "There's a lot to dig into here! So we'll just stick with a few highlights.\n", + "\n", + "#### Take a look\n", + "**See what printed to in the cell above and answer the following questions**\n", + "- `finidat`: What initial conditions file are you using? \n", + "- `fsurdat`: What surface dataset are you using?\n", + "- `paramfile`: What parameter file are you using?\n", + "- `spinup_state`: What is your spinup state?\n", + "\n", + "Does this make sense? Answers are in the hidden cell below.\n" + ] + }, + { + "cell_type": "markdown", + "metadata": { + "tags": [] + }, + "source": [ + "- `finidat = ' '` None! we're starting from a coldstart.\n", + "- `fsurdat = \".../surfdata_1x1_NEON_HARV_hist_78pfts_CMIP6_simyr2000_c230111.nc\"` This the surface dataset that's been modified for our NEON site.\n", + "- `paramfile = '.../ctsm51_params.c211112_tdf_leafcn30.nc'` is our modified parameter file\n", + "- `spinup_state = 2`, which is used for ad mode" + ] + }, + { + "cell_type": "markdown", + "metadata": { + "tags": [] + }, + "source": [ + "***\n", + "\n", + "- Additional information about customizing CTSM's configurations, including namelist modifications, are available in the [CTSM users guide](https://escomp.github.io/ctsm-docs/versions/master/html/users_guide/setting-up-and-running-a-case/customizing-the-clm-configuration.html?highlight=namelist)\n", + "Namelist changes can also be used to modify variables on history file output. Simple modification of history file output DOES NOT require spinning up the model.\n", + "- A list of all the [CTSM history fields are available here](https://escomp.github.io/ctsm-docs/versions/master/html/users_guide/setting-up-and-running-a-case/master_list_nofates.html)\n", + "- A list of all the [CTSM-FATES history fields are available here](https://escomp.github.io/ctsm-docs/versions/master/html/users_guide/setting-up-and-running-a-case/master_list_fates.html)\n" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### 1.5 setup, build, and submit the case" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./case.setup" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "qcmd -- ./case.build" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "If you get a notice that `MODEL BUILD HAS FINISHED SUCCESSFULLY`, submit your case." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./case.submit" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "STOP! \n", + " \n", + "Running an AD spinup for 200 model years will take a few hours of wall clock time. \n", + "\n", + "Don't move on with this tutorial until after the AD simulation is completed.\n", + " \n", + "\n", + "
\n", + "\n", + "After your simulation is finised you can check results with the [QuickPlot_CTSM_spinup notebook](QuickPlot_CTSM_spinup.ipynb).\n", + "\n", + "---\n" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "# 2 postAD simulations\n", + "After the model has reached steady-state we have to take it out of AD mode, which requires another ~100 years of simulations. We also have to create and build a new base case for postAD runs.\n", + "\n", + "### 2.1 Be sure your AD case is finished.\n", + "**HINT** If the cell below fails, you may need to set environmental variables for `$neon_site` and `$experiment` again." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cat ~/scratch/NEON_cases/$neon_site.$experiment.ad/CaseStatus | tail -10" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "The last line of your AD CaseStatus file should read `... st_archive success ...`\n", + "\n", + "**If this isn't true, your case may still be running, or it may have failed**\n", + "\n", + "- You can use `qstat -u $USER`, also\n", + "- Look an the `lnd.log.*` and `cesm.log.*` files in your case/run directory (`~/scratch/NEON_cases/$neon_site.$experiment.ad/run`) \n", + "\n", + "#### IF YOUR AD RUN IS COMPLETED, YOU CAN MOVE ON\n", + "\n", + "## 2.2 Navigate to your source code" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/CTSM/tools/site_and_regional" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 2.3 Create a postAD experimental case\n", + "\n", + "Now we're using a different `--run-type` that's appropriate for the case.\n", + "\n", + "As before, you'll get warning related to the the model build. This is OK, we'll built our case later." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./run_neon.py --neon-sites $neon_site \\\n", + " --output-root ~/scratch/NEON_cases \\\n", + " --experiment $experiment \\\n", + " --run-type postad \\\n", + " --overwrite \\\n", + " --setup-only \n", + "\n", + "echo '----Your experiment.postad case has been created----'" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 2.4 Customize your case\n", + "This should follow namelist, xml, or other changes you made in the ad run, section 1.4, above" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/scratch/NEON_cases/$neon_site.$experiment.postad" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# This is the path to the modified parameter file you created\n", + "\n", + "# If you're running on cheyenne, uncomment the line below\n", + "#echo \"paramfile = '/glade/scratch/$USER/NEON_cases/modified_inputs/ctsm51_params.c211112_tdf_leafcn30.nc'\" >> user_nl_clm\n", + "\n", + "# If you're running with CESM-Lab in the cloud, uncomment the line below\n", + "echo \"paramfile = '/scratch/$USER/NEON_cases/modified_inputs/ctsm51_params.c211112_tdf_leafcn30.nc'\" >> user_nl_clm" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./preview_namelists" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "**Stop and check!**\n", + "- How are the `lnd_in` files different in our ad and postad cases?" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "diff CaseDocs/lnd_in ../$neon_site.$experiment.ad/CaseDocs/lnd_in" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "the postad case has: \n", + "- `finidat = 'HARV.foliarCN-30.ad...'` initial conditions\n", + "- `spinup_state = 0` meaning we're out of ad mode now\n", + "- different builds\n", + "\n", + "\n", + "### 2.5 setup, build, and submit the case" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./case.setup" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "qcmd -- ./case.build" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./case.submit" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "STOP! \n", + " \n", + "Running an postAD run for 100 model years will also take about an hour of wall clock time. \n", + "\n", + "Don't move on with this tutorial until after the post simulation is completed.\n", + " \n", + "\n", + "
\n", + "\n", + "After your simulation is finised you can check postAD results with the [QuickPlot_CTSM_spinup notebook](QuickPlot_CTSM_spinup.ipynb).\n", + "\n", + "---\n", + "\n", + "# 3 Transient simulation\n", + "Now we're finally ready to go ahead with the transient simulation\n", + "\n", + "## 3.1 Be sure your postAD case is finished.\n", + "**HINT** If the cell below fails, you may need to set environmental variables for `$neon_site` and `$experiment` again." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cat ~/scratch/NEON_cases/$neon_site.$experiment.postad/CaseStatus | tail -10" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "The last line of your postad CaseStatus file should read `... st_archive success ...`\n", + "\n", + "**If this isn't true, your case may still be running, or it may have failed**\n", + "\n", + "- You can use `qstat -u $USER`, also\n", + "- Look an the `lnd.log.*` and `cesm.log.*` files in your case/run directory (`~/scratch/NEON_cases/$neon_site.$experiment.postad/run`) " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "#### IF YOUR POSTAD RUN IS COMPLETED, YOU CAN MOVE ON\n", + "\n", + "## 3.2 Navigate to your source code" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/CTSM/tools/site_and_regional" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 3.3 Create a transient experimental case\n", + "\n", + "Now we're using:\n", + "- `--run-type transient` that's appropriate for the case and \n", + "- `--run-from-postad` that will grab initial conditions from our postAD experimental case.\n", + "\n", + "To avoid confusion, we won't run this from a base_case, athough it does mean we have to build the transient case again." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./run_neon.py --neon-sites $neon_site \\\n", + " --output-root ~/scratch/NEON_cases \\\n", + " --experiment $experiment \\\n", + " --run-type transient \\\n", + " --overwrite \\\n", + " --setup-only \\\n", + " --run-from-postad" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "## 3.4 Customize your case\n", + "This should follow namelist, xml, or other changes you made in the ad run, sections 1.4 and 2.4, above" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "cd ~/scratch/NEON_cases/$neon_site.$experiment.transient" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "# This is the path to the modified parameter file you created\n", + "\n", + "# If you're running on cheyenne, uncomment the line below\n", + "#echo \"paramfile = '/glade/scratch/$USER/NEON_cases/modified_inputs/ctsm51_params.c211112_tdf_leafcn30.nc'\" >> user_nl_clm\n", + "\n", + "# If you're running with CESM-Lab in the cloud, uncomment the line below\n", + "echo \"paramfile = '/scratch/$USER/NEON_cases/modified_inputs/ctsm51_params.c211112_tdf_leafcn30.nc'\" >> user_nl_clmcd ~/scratch/NEON_cases/$new_case.$experiment.transient\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./preview_namelists" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "**Stop and check!**\n", + "- How are the `lnd_in` files different in our postAD and transient cases?\n", + "- Do these differences make sense?" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "diff CaseDocs/lnd_in ../$neon_site.$experiment.postad/CaseDocs/lnd_in" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "#### Double check\n", + "It's a good idea to make sure cases have expected differences. \n", + "\n", + "See if this is true for our control and experimental transient cases.\n", + "\n", + "- How are the `lnd_in` files different in our control and experimental cases?\n", + "- Do these differences make sense?" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "diff CaseDocs/lnd_in ../$neon_site.transient/CaseDocs/lnd_in" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "### 3.5 setup, build, and submit the case" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./case.setup" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "qcmd -- ./case.build" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [ + "./case.submit" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "
\n", + "Congratulations! \n", + " \n", + "You've created and run a full spinup for an experimental case of CLM at the NEON tower you selected!\n", + " \n", + "Now we need to see how the simulations are different.\n", + "
\n", + "\n" + ] + }, + { + "cell_type": "markdown", + "metadata": {}, + "source": [ + "If you're developing this tutorial:\n", + "Before saving and pushing this code to github go to `Kernel` and `Restart kernel and clear all outputs...`" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [] + }, + { + "cell_type": "code", + "execution_count": null, + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Bash", + "language": "bash", + "name": "bash" + }, + "language_info": { + "codemirror_mode": "shell", + "file_extension": ".sh", + "mimetype": "text/x-sh", + "name": "bash" + } + }, + "nbformat": 4, + "nbformat_minor": 4 +} diff --git a/_sources/notebooks/ProjectExamples/modifyParameterFile.ipynb b/_sources/notebooks/ProjectExamples/modifyParameterFile.ipynb new file mode 100644 index 0000000..03db644 --- /dev/null +++ b/_sources/notebooks/ProjectExamples/modifyParameterFile.ipynb @@ -0,0 +1,274 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "febd337f-52eb-44f3-aa20-b41ee0881a14", + "metadata": {}, + "source": [ + "# Modify Parameter File\n", + "\n", + "- This notebook is designed to open the default CLM parameter file and modify one or several fields. \n", + "- It's easier to run if you've made a local copy of the parameter file somewhere in your working directory.\n", + "- You can find the parameter file by looking at your `lnd_in` file from a case directory on the command line.\n", + " > e.g. `cat ~/scratch/NEON_cases/KONZ.transient/run/lnd_in | grep paramfile`\n", + "- Then I created a copy of this parameter file here (~/scratch/NEON_cases/modified_inputs/.)\n", + " > on Cheyenne: `cp /glade/p/cesmdata/cseg/inputdata/lnd/clm2/paramdata/ctsm51_params.c211112.nc ~/scratch/NEON_cases/modified_inputs/.`\n", + " \n", + "**In cloud we can make a local copy to work with** *NOTE* since this is a python notebook our bash commands will look a little different." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "cb79aaae-1b36-4e28-b30c-8dd4040e2a40", + "metadata": {}, + "outputs": [], + "source": [ + "# This python cell uses some bash magic (!) to move files into your scratch directory\n", + "# You can also do this on the command line of a terminal window (without the ! before each command)\n", + "\n", + "! mkdir /scratch/${USER}/NEON_cases/modified_inputs/ # Directory to save the file\n", + "! cp /scratch/inputdata/lnd/clm2/paramdata/ctsm51_params.c211112.nc /scratch/${USER}/NEON_cases/modified_inputs/." + ] + }, + { + "cell_type": "markdown", + "id": "4b52316f-598c-447d-b4b2-0f2c86dcc3ff", + "metadata": {}, + "source": [ + "This tutorial has 3 parts:\n", + "1. Open the parameter file\n", + "2. Modify a global parameter\n", + "3. Modify a pft specific parameter\n", + "\n", + "Created by Will Wieder Nov 2021\n", + "Modified for NEON example May 2023" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "a7fd46ee", + "metadata": {}, + "outputs": [], + "source": [ + "# load libraries\n", + "import xarray as xr\n", + "import pandas as pd\n", + "import os\n", + "import netCDF4\n", + "import numpy as np" + ] + }, + { + "cell_type": "markdown", + "id": "64d35274-3aac-4223-acb2-9e9560df0290", + "metadata": {}, + "source": [ + "## 1. Open the parameter file\n", + "As mentioned above, I've alreay copied the file to a local directory." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "94f9f43a", + "metadata": {}, + "outputs": [], + "source": [ + "pathin = '~/scratch/NEON_cases/modified_inputs/'\n", + "basefile = pathin + 'ctsm51_params.c211112.nc'\n", + "p = xr.open_dataset(basefile,decode_times=False) \n", + "p.var" + ] + }, + { + "cell_type": "markdown", + "id": "3f37291c-051a-4823-981d-32dfa7b9cb4f", + "metadata": {}, + "source": [ + "### CLM has > 400 parameters!\n", + "It's too much for us to go over here. Hopefully between the [user's guide and tech note](https://escomp.github.io/ctsm-docs/versions/master/html/index.html) in combination with the [model code](https://escomp.github.html) you can find what you need to regarding parameters.\n", + "\n", + "For now, we'll just look at how to change a few parameters as an example.\n", + "\n", + "You'll notice some parameters are dimensioned by plant functional type (pft) while others are global. The global parameters are easier to modify, so we'll to that first.\n", + "\n", + "## 2. Changing global parameters\n", + "For example, the parameter `rf_cwdl2` is used in the soil biogeogeochemistry code.\n", + "- Can you find out what the default values for this parameter is?\n", + "- Can you understand what it controls in the model?\n", + "- Can you find where it's used in the model code?" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "8b6200c4", + "metadata": {}, + "outputs": [], + "source": [ + "p.rf_cwdl2" + ] + }, + { + "cell_type": "markdown", + "id": "3fb55a32-6d03-40a4-a02a-75be4ba7c4a0", + "metadata": {}, + "source": [ + "Let's imagine that you studied wood decomposition at a NEON site and have found that a 75% of wood decomposition is respired to the atmosphere. We can create a new parameter file, change the values for `rf_cwdl2`, and save the new file." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "685cee30-63da-4602-89ac-9354a9d72633", + "metadata": {}, + "outputs": [], + "source": [ + "p2 = p.copy(deep=True) # create a copy of the parameter file to modify\n", + "p2['rf_cwdl2'].values = 0.75 # change the values of our parameter\n", + "p2.rf_cwdl2 # check that it worked as intended" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "d831173c-d887-49ba-8a58-05177b175dcb", + "metadata": {}, + "outputs": [], + "source": [ + "# now save the file\n", + "p2.to_netcdf(pathin + 'ctsm51_params.c211112_high_rf_CWD.nc')" + ] + }, + { + "cell_type": "markdown", + "id": "909c983b-bcb9-43d8-8ae7-34b1f69461dc", + "metadata": {}, + "source": [ + "You'll notice this is a non-standard way to modify parameter files in CTSM. It's really just designed for quick experiments:\n", + "- I like to make the name descriptive so I remember what I changed.\n", + "- One disadvantage here is that we didn't append the attribues of the .nc file to record this change.\n", + "- There are lots of other more efficient ways to do this for parameter perturbation experiments, that we'll eventually cover in future tutorials.\n", + "\n", + "## 3. Modify a pft specific parameter\n", + "For this example, let's assume you looked at leaf traits that were measured at for your favorite NEON site and realized that the values being used in CLM in global simulations are not representative of local site conditions. Here we can do this for temperate deciduous forests at Steigerwald (STEI). \n", + "\n", + "
\n", + "\n", + "HINT: It's a good idea to check what PFT is actually on the surface dataset for the site you're running.\n", + "\n", + "
\n", + "\n", + "Let's see how PFTs are named in the parameter file, this will help us change values for particular PFTs more accurately" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "ca1c0875-1b8e-4307-9bc6-c8a25b7a8373", + "metadata": {}, + "outputs": [], + "source": [ + "p.pftname.values[0:16]" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "2566f2c8-128f-4014-bdb0-d466a1a5b5ba", + "metadata": {}, + "outputs": [], + "source": [ + "# now we'll create an index for this PFT and print the foliar C:N ratio that's used in CLM" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "8625bc0e", + "metadata": {}, + "outputs": [], + "source": [ + "mypft = 'broadleaf_deciduous_temperate_tree'\n", + "ix = np.array([mypft in str(n) for n in p.pftname.values]) #index vector for mypft\n", + "param = 'leafcn'\n", + "m = p[param].values\n", + "print(m[ix])" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "b4bf84b5", + "metadata": {}, + "outputs": [], + "source": [ + "# Now we can change this value with something that's hypothetically been observed.\n", + "new_leafcn = 30\n", + "p3 = p.copy(deep=True)\n", + "p3[param].values[ix]= new_leafcn\n", + "p3[param][0:16]" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "7b30ae43-b2e2-4532-b80c-4530886066ba", + "metadata": {}, + "outputs": [], + "source": [ + "# now save the file\n", + "p3.to_netcdf(pathin + 'ctsm51_params.c211112_tdf_leafcn30.nc')" + ] + }, + { + "cell_type": "markdown", + "id": "6e59bda4-2a62-4c3f-9b59-d48a855128cb", + "metadata": {}, + "source": [ + "---\n", + "\n", + "
\n", + "Congratulations: \n", + " \n", + "You can now modify parameter files! \n", + "Remember, to run with one of these you'll have to spin up the model first.\n", + "\n", + "
\n", + "\n", + "You can see an example of running an experimental case with one of these parameter files in the `customizeCase_parameterModifications` notebook." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "4d323df8-6da8-4a8c-82ce-e351678037ce", + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.9.12" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/_sources/notebooks/ProjectExamples/modifySurfdataFile.ipynb b/_sources/notebooks/ProjectExamples/modifySurfdataFile.ipynb new file mode 100644 index 0000000..8ae3d3c --- /dev/null +++ b/_sources/notebooks/ProjectExamples/modifySurfdataFile.ipynb @@ -0,0 +1,258 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "12b3b107-e777-4d51-97bb-25958ae7763e", + "metadata": {}, + "source": [ + "# Modify Surfacedataset File\n", + "- This notebook is designed to open and modify one or several fields on a NEON surface dataset. \n", + "- It's easier to run if you've made a local copy of the surface dataset somewhere in your working directory.\n", + "- You can find the surface dataset by looking at your `lnd_in` file from a case directory on the command line.\n", + " > e.g. `cat ~/scratch/NEON_cases/KONZ.transient/run/lnd_in | grep fsurdat`\n", + "- Then I created a copy of this parameter file here (~/scratch/NEON_cases/modified_inputs/.)\n", + " > on Cheyenne: `cp /glade/p/cesmdata/cseg/inputdata/lnd/clm2/surfdata_map/NEON/surfdata_1x1_NEON_KONZ_hist_78pfts_CMIP6_simyr2000_c230601.nc \n", + "~/scratch/NEON_cases/modified_inputs.`\n", + "\n", + "The most common thing you may want to change on the surface dataset is the plant functional type for a site, or the leaf area index (if you're running an satelite phenology (SP) case.\n", + "\n", + "- You can see what the default pft is using the following code on the command line\n", + "\n", + "> on Cheyenne: `ncdump -v PCT_NAT_PFT /glade/p/cesmdata/cseg/inputdata/lnd/clm2/surfdata_map/NEON/surfdata_1x1_NEON_KONZ_hist_78pfts_CMIP6_simyr2000_c230601.nc`\n", + "\n", + "**In cloud we can make a local copy to work with** *NOTE* since this is a python notebook our bash commands will look a little different." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "dc132977-4caf-459e-9f88-5ab7fad6a51c", + "metadata": {}, + "outputs": [], + "source": [ + "! cat ~/scratch/NEON_cases/KONZ.transient/run/lnd_in | grep fsurdat" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "b5f393f2-88d8-4616-b1cd-3e7fcc83c49a", + "metadata": {}, + "outputs": [], + "source": [ + "! mkdir /scratch/${USER}/NEON_cases/modified_inputs/ # Directory to save the file\n", + "! cp /scratch/inputdata/lnd/clm2/surfdata_map/NEON/surfdata_1x1_NEON_KONZ_hist_78pfts_CMIP6_simyr2000_c230601.nc /scratch/${USER}/NEON_cases/modified_inputs/." + ] + }, + { + "cell_type": "markdown", + "id": "6c0680fe-ea38-4615-bf60-b7e41d35abb5", + "metadata": {}, + "source": [ + "This tutorial has 3 parts:\n", + "1. Open the surface dataset\n", + "2. Change the dominant plant functional type (PFT).\n", + "3. Modify leaf area index (LAI) for the dominant PFT (for SP cases only).\n", + "\n", + "Created by Will Wieder May 2023" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "a7fd46ee", + "metadata": {}, + "outputs": [], + "source": [ + "# load libraries\n", + "import xarray as xr\n", + "import pandas as pd\n", + "import os\n", + "import netCDF4\n", + "import numpy as np" + ] + }, + { + "cell_type": "markdown", + "id": "64d35274-3aac-4223-acb2-9e9560df0290", + "metadata": {}, + "source": [ + "## 1. Open the surface dataset\n", + "As mentioned above, I've alreay copied the file to a local directory." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "94f9f43a", + "metadata": {}, + "outputs": [], + "source": [ + "pathin = '~/scratch/NEON_cases/modified_inputs/'\n", + "basefile = pathin + 'surfdata_1x1_NEON_KONZ_hist_78pfts_CMIP6_simyr2000_c230601.nc'\n", + "s = xr.open_dataset(basefile,decode_times=False) \n", + "s.var" + ] + }, + { + "cell_type": "markdown", + "id": "3f37291c-051a-4823-981d-32dfa7b9cb4f", + "metadata": {}, + "source": [ + "## Lots of data goes into the surface dataset.\n", + "\n", + "It's too much for us to go over here. Hopefully between the [user's guide and tech note](https://escomp.github.io/ctsm-docs/versions/master/html/index.html) find what you need to regarding surface data.\n", + "\n", + "In the NEON cases we set a dominant PFT for each site and modified soil properties to reflect NEON megapit measurements.\n", + "The real ecosystems at NEON sites, however, have multiple plant functional types represented in the tower footprint or region. For example, mixed deciduous and evergreen forests, grassland - forest savannahs, mixed grasslands and woody shrublands, or a mix of C3 and C4 grasses. Users can set the PFT mixtures to reflect local conditions, although this makes it difficult to understand individual PFT's contributions to the gridcell weighted fluxes we typically look at.\n", + "\n", + "For now, we'll just look at how to change the single dominant PFT at a site.\n", + "\n", + "\n", + "## 2. Changing the dominant PFT\n", + "For example, the surface datset `PCT_NAT_PFT` defines the percent plant functional type on the natural vegetated landunit.\n", + "- What is the dominant PFT index at KONZ?\n", + "- What PFT does this correspond to in the model?" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "8b6200c4", + "metadata": {}, + "outputs": [], + "source": [ + "s.PCT_NAT_PFT" + ] + }, + { + "cell_type": "markdown", + "id": "3fb55a32-6d03-40a4-a02a-75be4ba7c4a0", + "metadata": {}, + "source": [ + "Let's imagine that you studied plant composition at the KONZ site and found a there are a number of C3 and C4 grasses in the tower footprint. We can modify the surface dataset to see what a C3 grass (pft 13) simulation looks like at KONZ.\n", + "\n", + "To do thsi, we'll create a new surface data file, change values for `PCT_NAT_PFT`, and save the new file." + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "685cee30-63da-4602-89ac-9354a9d72633", + "metadata": {}, + "outputs": [], + "source": [ + "s2 = s.copy(deep=True) # create a copy of the surface dataset to modify\n", + "s2['PCT_NAT_PFT'][[13]] = 100. # set C3 grasses to 100\n", + "s2['PCT_NAT_PFT'][[14]] = 0. # set C4 grasses to 0\n", + "s2['PCT_NAT_PFT'].values # check that it worked as intended" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "d831173c-d887-49ba-8a58-05177b175dcb", + "metadata": {}, + "outputs": [], + "source": [ + "# now save the file\n", + "s2.to_netcdf(pathin + 'surfdata_1x1_NEON_KONZ_hist_78pfts_CMIP6_simyr2000_c230601_C3grass.nc')" + ] + }, + { + "cell_type": "markdown", + "id": "909c983b-bcb9-43d8-8ae7-34b1f69461dc", + "metadata": {}, + "source": [ + "You'll notice this is a non-standard way to modify surface dataset in in CTSM. It's really just designed for quick experiments:\n", + "- I like to make the name descriptive so I remember what I changed.\n", + "\n", + "## 3. Modify LAI for a PFT (SP simulations only)\n", + "For this example, let's assume you derived a climatology of LAI from NEON or remote sensing data products. This would be a huge help, because the values being used in CLM in global simulations are likely not representative of local conditions at NEON sites. \n", + "\n", + "
\n", + "\n", + "HINT: It's a good idea to check what PFT is actually on the surface dataset for the site you're running.\n", + "\n", + "
\n", + "\n", + "Let's see what LAI looks like " + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "5c414a1e-9d1e-4c57-b330-b0a05738d3fb", + "metadata": {}, + "outputs": [], + "source": [ + "s2.PCT_NAT_PFT.isel(natpft=slice(1,15))" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "1748fd8d-de04-468f-bc56-b9355639a970", + "metadata": {}, + "outputs": [], + "source": [ + "# This is a hacky way to look at the LAI timeseries and identify the dominant PFT at a site\n", + "NATPFT = s2.PCT_NAT_PFT.isel(natpft=slice(1,15)).rename({\"natpft\":'lsmpft'})\n", + "(s2.MONTHLY_LAI.isel(lsmpft=slice(1,15))*NATPFT/100).plot(hue='lsmpft') ;" + ] + }, + { + "cell_type": "markdown", + "id": "00c122d4-ce58-4ec7-8115-6e7fefc2e132", + "metadata": {}, + "source": [ + "If you want to modify the LAI of your PFT we can discuss different ways to do this, but it would be really helpful to have NEON data that can help inform this." + ] + }, + { + "cell_type": "markdown", + "id": "6e59bda4-2a62-4c3f-9b59-d48a855128cb", + "metadata": {}, + "source": [ + "---\n", + "\n", + "
\n", + "Congratulations: \n", + " \n", + "You can now modify parameter files! \n", + "Remember, to run with one of these you'll have to spin up the model first.\n", + "\n", + "
\n" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "f008a109-ea90-4b27-8d47-844364ead6c6", + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.9.12" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/_sphinx_design_static/design-style.4045f2051d55cab465a707391d5b2007.min.css b/_sphinx_design_static/design-style.4045f2051d55cab465a707391d5b2007.min.css new file mode 100644 index 0000000..3225661 --- /dev/null +++ b/_sphinx_design_static/design-style.4045f2051d55cab465a707391d5b2007.min.css @@ -0,0 +1 @@ +.sd-bg-primary{background-color:var(--sd-color-primary) !important}.sd-bg-text-primary{color:var(--sd-color-primary-text) !important}button.sd-bg-primary:focus,button.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}a.sd-bg-primary:focus,a.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}.sd-bg-secondary{background-color:var(--sd-color-secondary) !important}.sd-bg-text-secondary{color:var(--sd-color-secondary-text) !important}button.sd-bg-secondary:focus,button.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}a.sd-bg-secondary:focus,a.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}.sd-bg-success{background-color:var(--sd-color-success) !important}.sd-bg-text-success{color:var(--sd-color-success-text) !important}button.sd-bg-success:focus,button.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}a.sd-bg-success:focus,a.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}.sd-bg-info{background-color:var(--sd-color-info) !important}.sd-bg-text-info{color:var(--sd-color-info-text) !important}button.sd-bg-info:focus,button.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}a.sd-bg-info:focus,a.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}.sd-bg-warning{background-color:var(--sd-color-warning) !important}.sd-bg-text-warning{color:var(--sd-color-warning-text) !important}button.sd-bg-warning:focus,button.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}a.sd-bg-warning:focus,a.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}.sd-bg-danger{background-color:var(--sd-color-danger) !important}.sd-bg-text-danger{color:var(--sd-color-danger-text) !important}button.sd-bg-danger:focus,button.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}a.sd-bg-danger:focus,a.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}.sd-bg-light{background-color:var(--sd-color-light) !important}.sd-bg-text-light{color:var(--sd-color-light-text) !important}button.sd-bg-light:focus,button.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}a.sd-bg-light:focus,a.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}.sd-bg-muted{background-color:var(--sd-color-muted) !important}.sd-bg-text-muted{color:var(--sd-color-muted-text) !important}button.sd-bg-muted:focus,button.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}a.sd-bg-muted:focus,a.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}.sd-bg-dark{background-color:var(--sd-color-dark) !important}.sd-bg-text-dark{color:var(--sd-color-dark-text) !important}button.sd-bg-dark:focus,button.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}a.sd-bg-dark:focus,a.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}.sd-bg-black{background-color:var(--sd-color-black) !important}.sd-bg-text-black{color:var(--sd-color-black-text) !important}button.sd-bg-black:focus,button.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}a.sd-bg-black:focus,a.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}.sd-bg-white{background-color:var(--sd-color-white) !important}.sd-bg-text-white{color:var(--sd-color-white-text) !important}button.sd-bg-white:focus,button.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}a.sd-bg-white:focus,a.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}.sd-text-primary,.sd-text-primary>p{color:var(--sd-color-primary) !important}a.sd-text-primary:focus,a.sd-text-primary:hover{color:var(--sd-color-primary-highlight) !important}.sd-text-secondary,.sd-text-secondary>p{color:var(--sd-color-secondary) !important}a.sd-text-secondary:focus,a.sd-text-secondary:hover{color:var(--sd-color-secondary-highlight) !important}.sd-text-success,.sd-text-success>p{color:var(--sd-color-success) !important}a.sd-text-success:focus,a.sd-text-success:hover{color:var(--sd-color-success-highlight) !important}.sd-text-info,.sd-text-info>p{color:var(--sd-color-info) !important}a.sd-text-info:focus,a.sd-text-info:hover{color:var(--sd-color-info-highlight) !important}.sd-text-warning,.sd-text-warning>p{color:var(--sd-color-warning) !important}a.sd-text-warning:focus,a.sd-text-warning:hover{color:var(--sd-color-warning-highlight) !important}.sd-text-danger,.sd-text-danger>p{color:var(--sd-color-danger) !important}a.sd-text-danger:focus,a.sd-text-danger:hover{color:var(--sd-color-danger-highlight) !important}.sd-text-light,.sd-text-light>p{color:var(--sd-color-light) !important}a.sd-text-light:focus,a.sd-text-light:hover{color:var(--sd-color-light-highlight) !important}.sd-text-muted,.sd-text-muted>p{color:var(--sd-color-muted) !important}a.sd-text-muted:focus,a.sd-text-muted:hover{color:var(--sd-color-muted-highlight) !important}.sd-text-dark,.sd-text-dark>p{color:var(--sd-color-dark) !important}a.sd-text-dark:focus,a.sd-text-dark:hover{color:var(--sd-color-dark-highlight) !important}.sd-text-black,.sd-text-black>p{color:var(--sd-color-black) !important}a.sd-text-black:focus,a.sd-text-black:hover{color:var(--sd-color-black-highlight) !important}.sd-text-white,.sd-text-white>p{color:var(--sd-color-white) !important}a.sd-text-white:focus,a.sd-text-white:hover{color:var(--sd-color-white-highlight) !important}.sd-outline-primary{border-color:var(--sd-color-primary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-primary:focus,a.sd-outline-primary:hover{border-color:var(--sd-color-primary-highlight) !important}.sd-outline-secondary{border-color:var(--sd-color-secondary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-secondary:focus,a.sd-outline-secondary:hover{border-color:var(--sd-color-secondary-highlight) !important}.sd-outline-success{border-color:var(--sd-color-success) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-success:focus,a.sd-outline-success:hover{border-color:var(--sd-color-success-highlight) !important}.sd-outline-info{border-color:var(--sd-color-info) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-info:focus,a.sd-outline-info:hover{border-color:var(--sd-color-info-highlight) !important}.sd-outline-warning{border-color:var(--sd-color-warning) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-warning:focus,a.sd-outline-warning:hover{border-color:var(--sd-color-warning-highlight) !important}.sd-outline-danger{border-color:var(--sd-color-danger) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-danger:focus,a.sd-outline-danger:hover{border-color:var(--sd-color-danger-highlight) !important}.sd-outline-light{border-color:var(--sd-color-light) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-light:focus,a.sd-outline-light:hover{border-color:var(--sd-color-light-highlight) !important}.sd-outline-muted{border-color:var(--sd-color-muted) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-muted:focus,a.sd-outline-muted:hover{border-color:var(--sd-color-muted-highlight) !important}.sd-outline-dark{border-color:var(--sd-color-dark) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-dark:focus,a.sd-outline-dark:hover{border-color:var(--sd-color-dark-highlight) !important}.sd-outline-black{border-color:var(--sd-color-black) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-black:focus,a.sd-outline-black:hover{border-color:var(--sd-color-black-highlight) !important}.sd-outline-white{border-color:var(--sd-color-white) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-white:focus,a.sd-outline-white:hover{border-color:var(--sd-color-white-highlight) !important}.sd-bg-transparent{background-color:transparent !important}.sd-outline-transparent{border-color:transparent !important}.sd-text-transparent{color:transparent !important}.sd-p-0{padding:0 !important}.sd-pt-0,.sd-py-0{padding-top:0 !important}.sd-pr-0,.sd-px-0{padding-right:0 !important}.sd-pb-0,.sd-py-0{padding-bottom:0 !important}.sd-pl-0,.sd-px-0{padding-left:0 !important}.sd-p-1{padding:.25rem !important}.sd-pt-1,.sd-py-1{padding-top:.25rem !important}.sd-pr-1,.sd-px-1{padding-right:.25rem !important}.sd-pb-1,.sd-py-1{padding-bottom:.25rem !important}.sd-pl-1,.sd-px-1{padding-left:.25rem !important}.sd-p-2{padding:.5rem !important}.sd-pt-2,.sd-py-2{padding-top:.5rem !important}.sd-pr-2,.sd-px-2{padding-right:.5rem !important}.sd-pb-2,.sd-py-2{padding-bottom:.5rem !important}.sd-pl-2,.sd-px-2{padding-left:.5rem !important}.sd-p-3{padding:1rem !important}.sd-pt-3,.sd-py-3{padding-top:1rem !important}.sd-pr-3,.sd-px-3{padding-right:1rem !important}.sd-pb-3,.sd-py-3{padding-bottom:1rem !important}.sd-pl-3,.sd-px-3{padding-left:1rem !important}.sd-p-4{padding:1.5rem !important}.sd-pt-4,.sd-py-4{padding-top:1.5rem !important}.sd-pr-4,.sd-px-4{padding-right:1.5rem !important}.sd-pb-4,.sd-py-4{padding-bottom:1.5rem !important}.sd-pl-4,.sd-px-4{padding-left:1.5rem !important}.sd-p-5{padding:3rem !important}.sd-pt-5,.sd-py-5{padding-top:3rem !important}.sd-pr-5,.sd-px-5{padding-right:3rem !important}.sd-pb-5,.sd-py-5{padding-bottom:3rem !important}.sd-pl-5,.sd-px-5{padding-left:3rem !important}.sd-m-auto{margin:auto !important}.sd-mt-auto,.sd-my-auto{margin-top:auto !important}.sd-mr-auto,.sd-mx-auto{margin-right:auto !important}.sd-mb-auto,.sd-my-auto{margin-bottom:auto !important}.sd-ml-auto,.sd-mx-auto{margin-left:auto !important}.sd-m-0{margin:0 !important}.sd-mt-0,.sd-my-0{margin-top:0 !important}.sd-mr-0,.sd-mx-0{margin-right:0 !important}.sd-mb-0,.sd-my-0{margin-bottom:0 !important}.sd-ml-0,.sd-mx-0{margin-left:0 !important}.sd-m-1{margin:.25rem !important}.sd-mt-1,.sd-my-1{margin-top:.25rem !important}.sd-mr-1,.sd-mx-1{margin-right:.25rem !important}.sd-mb-1,.sd-my-1{margin-bottom:.25rem !important}.sd-ml-1,.sd-mx-1{margin-left:.25rem !important}.sd-m-2{margin:.5rem !important}.sd-mt-2,.sd-my-2{margin-top:.5rem !important}.sd-mr-2,.sd-mx-2{margin-right:.5rem !important}.sd-mb-2,.sd-my-2{margin-bottom:.5rem !important}.sd-ml-2,.sd-mx-2{margin-left:.5rem !important}.sd-m-3{margin:1rem !important}.sd-mt-3,.sd-my-3{margin-top:1rem !important}.sd-mr-3,.sd-mx-3{margin-right:1rem !important}.sd-mb-3,.sd-my-3{margin-bottom:1rem !important}.sd-ml-3,.sd-mx-3{margin-left:1rem !important}.sd-m-4{margin:1.5rem !important}.sd-mt-4,.sd-my-4{margin-top:1.5rem !important}.sd-mr-4,.sd-mx-4{margin-right:1.5rem !important}.sd-mb-4,.sd-my-4{margin-bottom:1.5rem !important}.sd-ml-4,.sd-mx-4{margin-left:1.5rem !important}.sd-m-5{margin:3rem !important}.sd-mt-5,.sd-my-5{margin-top:3rem !important}.sd-mr-5,.sd-mx-5{margin-right:3rem !important}.sd-mb-5,.sd-my-5{margin-bottom:3rem !important}.sd-ml-5,.sd-mx-5{margin-left:3rem !important}.sd-w-25{width:25% !important}.sd-w-50{width:50% !important}.sd-w-75{width:75% !important}.sd-w-100{width:100% !important}.sd-w-auto{width:auto !important}.sd-h-25{height:25% !important}.sd-h-50{height:50% !important}.sd-h-75{height:75% !important}.sd-h-100{height:100% !important}.sd-h-auto{height:auto !important}.sd-d-none{display:none !important}.sd-d-inline{display:inline !important}.sd-d-inline-block{display:inline-block !important}.sd-d-block{display:block !important}.sd-d-grid{display:grid !important}.sd-d-flex-row{display:-ms-flexbox !important;display:flex !important;flex-direction:row !important}.sd-d-flex-column{display:-ms-flexbox !important;display:flex !important;flex-direction:column !important}.sd-d-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}@media(min-width: 576px){.sd-d-sm-none{display:none !important}.sd-d-sm-inline{display:inline !important}.sd-d-sm-inline-block{display:inline-block !important}.sd-d-sm-block{display:block !important}.sd-d-sm-grid{display:grid !important}.sd-d-sm-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-sm-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 768px){.sd-d-md-none{display:none !important}.sd-d-md-inline{display:inline !important}.sd-d-md-inline-block{display:inline-block !important}.sd-d-md-block{display:block !important}.sd-d-md-grid{display:grid !important}.sd-d-md-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-md-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 992px){.sd-d-lg-none{display:none !important}.sd-d-lg-inline{display:inline !important}.sd-d-lg-inline-block{display:inline-block !important}.sd-d-lg-block{display:block !important}.sd-d-lg-grid{display:grid !important}.sd-d-lg-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-lg-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 1200px){.sd-d-xl-none{display:none !important}.sd-d-xl-inline{display:inline !important}.sd-d-xl-inline-block{display:inline-block !important}.sd-d-xl-block{display:block !important}.sd-d-xl-grid{display:grid !important}.sd-d-xl-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-xl-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}.sd-align-major-start{justify-content:flex-start !important}.sd-align-major-end{justify-content:flex-end !important}.sd-align-major-center{justify-content:center !important}.sd-align-major-justify{justify-content:space-between !important}.sd-align-major-spaced{justify-content:space-evenly !important}.sd-align-minor-start{align-items:flex-start !important}.sd-align-minor-end{align-items:flex-end !important}.sd-align-minor-center{align-items:center !important}.sd-align-minor-stretch{align-items:stretch !important}.sd-text-justify{text-align:justify !important}.sd-text-left{text-align:left !important}.sd-text-right{text-align:right !important}.sd-text-center{text-align:center !important}.sd-font-weight-light{font-weight:300 !important}.sd-font-weight-lighter{font-weight:lighter !important}.sd-font-weight-normal{font-weight:400 !important}.sd-font-weight-bold{font-weight:700 !important}.sd-font-weight-bolder{font-weight:bolder !important}.sd-font-italic{font-style:italic !important}.sd-text-decoration-none{text-decoration:none !important}.sd-text-lowercase{text-transform:lowercase !important}.sd-text-uppercase{text-transform:uppercase !important}.sd-text-capitalize{text-transform:capitalize !important}.sd-text-wrap{white-space:normal !important}.sd-text-nowrap{white-space:nowrap !important}.sd-text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.sd-fs-1,.sd-fs-1>p{font-size:calc(1.375rem + 1.5vw) !important;line-height:unset !important}.sd-fs-2,.sd-fs-2>p{font-size:calc(1.325rem + 0.9vw) !important;line-height:unset !important}.sd-fs-3,.sd-fs-3>p{font-size:calc(1.3rem + 0.6vw) !important;line-height:unset !important}.sd-fs-4,.sd-fs-4>p{font-size:calc(1.275rem + 0.3vw) !important;line-height:unset !important}.sd-fs-5,.sd-fs-5>p{font-size:1.25rem !important;line-height:unset !important}.sd-fs-6,.sd-fs-6>p{font-size:1rem !important;line-height:unset !important}.sd-border-0{border:0 solid !important}.sd-border-top-0{border-top:0 solid !important}.sd-border-bottom-0{border-bottom:0 solid !important}.sd-border-right-0{border-right:0 solid !important}.sd-border-left-0{border-left:0 solid !important}.sd-border-1{border:1px solid !important}.sd-border-top-1{border-top:1px solid !important}.sd-border-bottom-1{border-bottom:1px solid !important}.sd-border-right-1{border-right:1px solid !important}.sd-border-left-1{border-left:1px solid !important}.sd-border-2{border:2px solid !important}.sd-border-top-2{border-top:2px solid !important}.sd-border-bottom-2{border-bottom:2px solid !important}.sd-border-right-2{border-right:2px solid !important}.sd-border-left-2{border-left:2px solid !important}.sd-border-3{border:3px solid !important}.sd-border-top-3{border-top:3px solid !important}.sd-border-bottom-3{border-bottom:3px solid !important}.sd-border-right-3{border-right:3px solid !important}.sd-border-left-3{border-left:3px solid !important}.sd-border-4{border:4px solid !important}.sd-border-top-4{border-top:4px solid !important}.sd-border-bottom-4{border-bottom:4px solid !important}.sd-border-right-4{border-right:4px solid !important}.sd-border-left-4{border-left:4px solid !important}.sd-border-5{border:5px solid !important}.sd-border-top-5{border-top:5px solid !important}.sd-border-bottom-5{border-bottom:5px solid !important}.sd-border-right-5{border-right:5px solid !important}.sd-border-left-5{border-left:5px solid !important}.sd-rounded-0{border-radius:0 !important}.sd-rounded-1{border-radius:.2rem !important}.sd-rounded-2{border-radius:.3rem !important}.sd-rounded-3{border-radius:.5rem !important}.sd-rounded-pill{border-radius:50rem !important}.sd-rounded-circle{border-radius:50% !important}.shadow-none{box-shadow:none !important}.sd-shadow-sm{box-shadow:0 .125rem .25rem var(--sd-color-shadow) !important}.sd-shadow-md{box-shadow:0 .5rem 1rem var(--sd-color-shadow) !important}.sd-shadow-lg{box-shadow:0 1rem 3rem var(--sd-color-shadow) !important}@keyframes sd-slide-from-left{0%{transform:translateX(-100%)}100%{transform:translateX(0)}}@keyframes sd-slide-from-right{0%{transform:translateX(200%)}100%{transform:translateX(0)}}@keyframes sd-grow100{0%{transform:scale(0);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50{0%{transform:scale(0.5);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50-rot20{0%{transform:scale(0.5) rotateZ(-20deg);opacity:.5}75%{transform:scale(1) rotateZ(5deg);opacity:1}95%{transform:scale(1) rotateZ(-1deg);opacity:1}100%{transform:scale(1) rotateZ(0);opacity:1}}.sd-animate-slide-from-left{animation:1s ease-out 0s 1 normal none running sd-slide-from-left}.sd-animate-slide-from-right{animation:1s ease-out 0s 1 normal none running sd-slide-from-right}.sd-animate-grow100{animation:1s ease-out 0s 1 normal none running sd-grow100}.sd-animate-grow50{animation:1s ease-out 0s 1 normal none running sd-grow50}.sd-animate-grow50-rot20{animation:1s ease-out 0s 1 normal none running sd-grow50-rot20}.sd-badge{display:inline-block;padding:.35em .65em;font-size:.75em;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem}.sd-badge:empty{display:none}a.sd-badge{text-decoration:none}.sd-btn .sd-badge{position:relative;top:-1px}.sd-btn{background-color:transparent;border:1px solid transparent;border-radius:.25rem;cursor:pointer;display:inline-block;font-weight:400;font-size:1rem;line-height:1.5;padding:.375rem .75rem;text-align:center;text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;vertical-align:middle;user-select:none;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none}.sd-btn:hover{text-decoration:none}@media(prefers-reduced-motion: reduce){.sd-btn{transition:none}}.sd-btn-primary,.sd-btn-outline-primary:hover,.sd-btn-outline-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-primary:hover,.sd-btn-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary-highlight) !important;border-color:var(--sd-color-primary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-primary{color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary,.sd-btn-outline-secondary:hover,.sd-btn-outline-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary:hover,.sd-btn-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary-highlight) !important;border-color:var(--sd-color-secondary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-secondary{color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success,.sd-btn-outline-success:hover,.sd-btn-outline-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success:hover,.sd-btn-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success-highlight) !important;border-color:var(--sd-color-success-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-success{color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info,.sd-btn-outline-info:hover,.sd-btn-outline-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info:hover,.sd-btn-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info-highlight) !important;border-color:var(--sd-color-info-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-info{color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning,.sd-btn-outline-warning:hover,.sd-btn-outline-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning:hover,.sd-btn-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning-highlight) !important;border-color:var(--sd-color-warning-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-warning{color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger,.sd-btn-outline-danger:hover,.sd-btn-outline-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger:hover,.sd-btn-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger-highlight) !important;border-color:var(--sd-color-danger-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-danger{color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light,.sd-btn-outline-light:hover,.sd-btn-outline-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light:hover,.sd-btn-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light-highlight) !important;border-color:var(--sd-color-light-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-light{color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted,.sd-btn-outline-muted:hover,.sd-btn-outline-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted:hover,.sd-btn-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted-highlight) !important;border-color:var(--sd-color-muted-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-muted{color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark,.sd-btn-outline-dark:hover,.sd-btn-outline-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark:hover,.sd-btn-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark-highlight) !important;border-color:var(--sd-color-dark-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-dark{color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black,.sd-btn-outline-black:hover,.sd-btn-outline-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black:hover,.sd-btn-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black-highlight) !important;border-color:var(--sd-color-black-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-black{color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white,.sd-btn-outline-white:hover,.sd-btn-outline-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white:hover,.sd-btn-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white-highlight) !important;border-color:var(--sd-color-white-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-white{color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.sd-hide-link-text{font-size:0}.sd-octicon,.sd-material-icon{display:inline-block;fill:currentColor;vertical-align:middle}.sd-avatar-xs{border-radius:50%;object-fit:cover;object-position:center;width:1rem;height:1rem}.sd-avatar-sm{border-radius:50%;object-fit:cover;object-position:center;width:3rem;height:3rem}.sd-avatar-md{border-radius:50%;object-fit:cover;object-position:center;width:5rem;height:5rem}.sd-avatar-lg{border-radius:50%;object-fit:cover;object-position:center;width:7rem;height:7rem}.sd-avatar-xl{border-radius:50%;object-fit:cover;object-position:center;width:10rem;height:10rem}.sd-avatar-inherit{border-radius:50%;object-fit:cover;object-position:center;width:inherit;height:inherit}.sd-avatar-initial{border-radius:50%;object-fit:cover;object-position:center;width:initial;height:initial}.sd-card{background-clip:border-box;background-color:var(--sd-color-card-background);border:1px solid var(--sd-color-card-border);border-radius:.25rem;color:var(--sd-color-card-text);display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;min-width:0;position:relative;word-wrap:break-word}.sd-card>hr{margin-left:0;margin-right:0}.sd-card-hover:hover{border-color:var(--sd-color-card-border-hover);transform:scale(1.01)}.sd-card-body{-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem 1rem}.sd-card-title{margin-bottom:.5rem}.sd-card-subtitle{margin-top:-0.25rem;margin-bottom:0}.sd-card-text:last-child{margin-bottom:0}.sd-card-link:hover{text-decoration:none}.sd-card-link+.card-link{margin-left:1rem}.sd-card-header{padding:.5rem 1rem;margin-bottom:0;background-color:var(--sd-color-card-header);border-bottom:1px solid var(--sd-color-card-border)}.sd-card-header:first-child{border-radius:calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0}.sd-card-footer{padding:.5rem 1rem;background-color:var(--sd-color-card-footer);border-top:1px solid var(--sd-color-card-border)}.sd-card-footer:last-child{border-radius:0 0 calc(0.25rem - 1px) calc(0.25rem - 1px)}.sd-card-header-tabs{margin-right:-0.5rem;margin-bottom:-0.5rem;margin-left:-0.5rem;border-bottom:0}.sd-card-header-pills{margin-right:-0.5rem;margin-left:-0.5rem}.sd-card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1rem;border-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom,.sd-card-img-top{width:100%}.sd-card-img,.sd-card-img-top{border-top-left-radius:calc(0.25rem - 1px);border-top-right-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom{border-bottom-left-radius:calc(0.25rem - 1px);border-bottom-right-radius:calc(0.25rem - 1px)}.sd-cards-carousel{width:100%;display:flex;flex-wrap:nowrap;-ms-flex-direction:row;flex-direction:row;overflow-x:hidden;scroll-snap-type:x mandatory}.sd-cards-carousel.sd-show-scrollbar{overflow-x:auto}.sd-cards-carousel:hover,.sd-cards-carousel:focus{overflow-x:auto}.sd-cards-carousel>.sd-card{flex-shrink:0;scroll-snap-align:start}.sd-cards-carousel>.sd-card:not(:last-child){margin-right:3px}.sd-card-cols-1>.sd-card{width:90%}.sd-card-cols-2>.sd-card{width:45%}.sd-card-cols-3>.sd-card{width:30%}.sd-card-cols-4>.sd-card{width:22.5%}.sd-card-cols-5>.sd-card{width:18%}.sd-card-cols-6>.sd-card{width:15%}.sd-card-cols-7>.sd-card{width:12.8571428571%}.sd-card-cols-8>.sd-card{width:11.25%}.sd-card-cols-9>.sd-card{width:10%}.sd-card-cols-10>.sd-card{width:9%}.sd-card-cols-11>.sd-card{width:8.1818181818%}.sd-card-cols-12>.sd-card{width:7.5%}.sd-container,.sd-container-fluid,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container-xl{margin-left:auto;margin-right:auto;padding-left:var(--sd-gutter-x, 0.75rem);padding-right:var(--sd-gutter-x, 0.75rem);width:100%}@media(min-width: 576px){.sd-container-sm,.sd-container{max-width:540px}}@media(min-width: 768px){.sd-container-md,.sd-container-sm,.sd-container{max-width:720px}}@media(min-width: 992px){.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:960px}}@media(min-width: 1200px){.sd-container-xl,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:1140px}}.sd-row{--sd-gutter-x: 1.5rem;--sd-gutter-y: 0;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-top:calc(var(--sd-gutter-y) * -1);margin-right:calc(var(--sd-gutter-x) * -0.5);margin-left:calc(var(--sd-gutter-x) * -0.5)}.sd-row>*{box-sizing:border-box;flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--sd-gutter-x) * 0.5);padding-left:calc(var(--sd-gutter-x) * 0.5);margin-top:var(--sd-gutter-y)}.sd-col{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-auto>*{flex:0 0 auto;width:auto}.sd-row-cols-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}@media(min-width: 576px){.sd-col-sm{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-sm-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-sm-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-sm-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-sm-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-sm-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-sm-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-sm-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-sm-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-sm-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-sm-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-sm-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-sm-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-sm-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 768px){.sd-col-md{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-md-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-md-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-md-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-md-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-md-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-md-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-md-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-md-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-md-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-md-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-md-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-md-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-md-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 992px){.sd-col-lg{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-lg-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-lg-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-lg-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-lg-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-lg-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-lg-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-lg-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-lg-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-lg-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-lg-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-lg-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-lg-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-lg-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 1200px){.sd-col-xl{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-xl-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-xl-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-xl-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-xl-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-xl-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-xl-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-xl-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-xl-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-xl-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-xl-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-xl-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-xl-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-xl-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}.sd-col-auto{flex:0 0 auto;-ms-flex:0 0 auto;width:auto}.sd-col-1{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}.sd-col-2{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-col-3{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-col-4{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-col-5{flex:0 0 auto;-ms-flex:0 0 auto;width:41.6666666667%}.sd-col-6{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-col-7{flex:0 0 auto;-ms-flex:0 0 auto;width:58.3333333333%}.sd-col-8{flex:0 0 auto;-ms-flex:0 0 auto;width:66.6666666667%}.sd-col-9{flex:0 0 auto;-ms-flex:0 0 auto;width:75%}.sd-col-10{flex:0 0 auto;-ms-flex:0 0 auto;width:83.3333333333%}.sd-col-11{flex:0 0 auto;-ms-flex:0 0 auto;width:91.6666666667%}.sd-col-12{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-g-0,.sd-gy-0{--sd-gutter-y: 0}.sd-g-0,.sd-gx-0{--sd-gutter-x: 0}.sd-g-1,.sd-gy-1{--sd-gutter-y: 0.25rem}.sd-g-1,.sd-gx-1{--sd-gutter-x: 0.25rem}.sd-g-2,.sd-gy-2{--sd-gutter-y: 0.5rem}.sd-g-2,.sd-gx-2{--sd-gutter-x: 0.5rem}.sd-g-3,.sd-gy-3{--sd-gutter-y: 1rem}.sd-g-3,.sd-gx-3{--sd-gutter-x: 1rem}.sd-g-4,.sd-gy-4{--sd-gutter-y: 1.5rem}.sd-g-4,.sd-gx-4{--sd-gutter-x: 1.5rem}.sd-g-5,.sd-gy-5{--sd-gutter-y: 3rem}.sd-g-5,.sd-gx-5{--sd-gutter-x: 3rem}@media(min-width: 576px){.sd-col-sm-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-sm-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-sm-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-sm-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-sm-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-sm-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-sm-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-sm-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-sm-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-sm-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-sm-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-sm-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-sm-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-sm-0,.sd-gy-sm-0{--sd-gutter-y: 0}.sd-g-sm-0,.sd-gx-sm-0{--sd-gutter-x: 0}.sd-g-sm-1,.sd-gy-sm-1{--sd-gutter-y: 0.25rem}.sd-g-sm-1,.sd-gx-sm-1{--sd-gutter-x: 0.25rem}.sd-g-sm-2,.sd-gy-sm-2{--sd-gutter-y: 0.5rem}.sd-g-sm-2,.sd-gx-sm-2{--sd-gutter-x: 0.5rem}.sd-g-sm-3,.sd-gy-sm-3{--sd-gutter-y: 1rem}.sd-g-sm-3,.sd-gx-sm-3{--sd-gutter-x: 1rem}.sd-g-sm-4,.sd-gy-sm-4{--sd-gutter-y: 1.5rem}.sd-g-sm-4,.sd-gx-sm-4{--sd-gutter-x: 1.5rem}.sd-g-sm-5,.sd-gy-sm-5{--sd-gutter-y: 3rem}.sd-g-sm-5,.sd-gx-sm-5{--sd-gutter-x: 3rem}}@media(min-width: 768px){.sd-col-md-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-md-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-md-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-md-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-md-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-md-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-md-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-md-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-md-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-md-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-md-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-md-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-md-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-md-0,.sd-gy-md-0{--sd-gutter-y: 0}.sd-g-md-0,.sd-gx-md-0{--sd-gutter-x: 0}.sd-g-md-1,.sd-gy-md-1{--sd-gutter-y: 0.25rem}.sd-g-md-1,.sd-gx-md-1{--sd-gutter-x: 0.25rem}.sd-g-md-2,.sd-gy-md-2{--sd-gutter-y: 0.5rem}.sd-g-md-2,.sd-gx-md-2{--sd-gutter-x: 0.5rem}.sd-g-md-3,.sd-gy-md-3{--sd-gutter-y: 1rem}.sd-g-md-3,.sd-gx-md-3{--sd-gutter-x: 1rem}.sd-g-md-4,.sd-gy-md-4{--sd-gutter-y: 1.5rem}.sd-g-md-4,.sd-gx-md-4{--sd-gutter-x: 1.5rem}.sd-g-md-5,.sd-gy-md-5{--sd-gutter-y: 3rem}.sd-g-md-5,.sd-gx-md-5{--sd-gutter-x: 3rem}}@media(min-width: 992px){.sd-col-lg-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-lg-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-lg-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-lg-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-lg-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-lg-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-lg-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-lg-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-lg-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-lg-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-lg-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-lg-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-lg-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-lg-0,.sd-gy-lg-0{--sd-gutter-y: 0}.sd-g-lg-0,.sd-gx-lg-0{--sd-gutter-x: 0}.sd-g-lg-1,.sd-gy-lg-1{--sd-gutter-y: 0.25rem}.sd-g-lg-1,.sd-gx-lg-1{--sd-gutter-x: 0.25rem}.sd-g-lg-2,.sd-gy-lg-2{--sd-gutter-y: 0.5rem}.sd-g-lg-2,.sd-gx-lg-2{--sd-gutter-x: 0.5rem}.sd-g-lg-3,.sd-gy-lg-3{--sd-gutter-y: 1rem}.sd-g-lg-3,.sd-gx-lg-3{--sd-gutter-x: 1rem}.sd-g-lg-4,.sd-gy-lg-4{--sd-gutter-y: 1.5rem}.sd-g-lg-4,.sd-gx-lg-4{--sd-gutter-x: 1.5rem}.sd-g-lg-5,.sd-gy-lg-5{--sd-gutter-y: 3rem}.sd-g-lg-5,.sd-gx-lg-5{--sd-gutter-x: 3rem}}@media(min-width: 1200px){.sd-col-xl-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-xl-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-xl-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-xl-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-xl-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-xl-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-xl-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-xl-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-xl-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-xl-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-xl-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-xl-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-xl-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-xl-0,.sd-gy-xl-0{--sd-gutter-y: 0}.sd-g-xl-0,.sd-gx-xl-0{--sd-gutter-x: 0}.sd-g-xl-1,.sd-gy-xl-1{--sd-gutter-y: 0.25rem}.sd-g-xl-1,.sd-gx-xl-1{--sd-gutter-x: 0.25rem}.sd-g-xl-2,.sd-gy-xl-2{--sd-gutter-y: 0.5rem}.sd-g-xl-2,.sd-gx-xl-2{--sd-gutter-x: 0.5rem}.sd-g-xl-3,.sd-gy-xl-3{--sd-gutter-y: 1rem}.sd-g-xl-3,.sd-gx-xl-3{--sd-gutter-x: 1rem}.sd-g-xl-4,.sd-gy-xl-4{--sd-gutter-y: 1.5rem}.sd-g-xl-4,.sd-gx-xl-4{--sd-gutter-x: 1.5rem}.sd-g-xl-5,.sd-gy-xl-5{--sd-gutter-y: 3rem}.sd-g-xl-5,.sd-gx-xl-5{--sd-gutter-x: 3rem}}.sd-flex-row-reverse{flex-direction:row-reverse !important}details.sd-dropdown{position:relative}details.sd-dropdown .sd-summary-title{font-weight:700;padding-right:3em !important;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none;user-select:none}details.sd-dropdown:hover{cursor:pointer}details.sd-dropdown .sd-summary-content{cursor:default}details.sd-dropdown summary{list-style:none;padding:1em}details.sd-dropdown summary .sd-octicon.no-title{vertical-align:middle}details.sd-dropdown[open] summary .sd-octicon.no-title{visibility:hidden}details.sd-dropdown summary::-webkit-details-marker{display:none}details.sd-dropdown summary:focus{outline:none}details.sd-dropdown .sd-summary-icon{margin-right:.5em}details.sd-dropdown .sd-summary-icon svg{opacity:.8}details.sd-dropdown summary:hover .sd-summary-up svg,details.sd-dropdown summary:hover .sd-summary-down svg{opacity:1;transform:scale(1.1)}details.sd-dropdown .sd-summary-up svg,details.sd-dropdown .sd-summary-down svg{display:block;opacity:.6}details.sd-dropdown .sd-summary-up,details.sd-dropdown .sd-summary-down{pointer-events:none;position:absolute;right:1em;top:1em}details.sd-dropdown[open]>.sd-summary-title .sd-summary-down{visibility:hidden}details.sd-dropdown:not([open])>.sd-summary-title .sd-summary-up{visibility:hidden}details.sd-dropdown:not([open]).sd-card{border:none}details.sd-dropdown:not([open])>.sd-card-header{border:1px solid var(--sd-color-card-border);border-radius:.25rem}details.sd-dropdown.sd-fade-in[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out;animation:sd-fade-in .5s ease-in-out}details.sd-dropdown.sd-fade-in-slide-down[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out}.sd-col>.sd-dropdown{width:100%}.sd-summary-content>.sd-tab-set:first-child{margin-top:0}@keyframes sd-fade-in{0%{opacity:0}100%{opacity:1}}@keyframes sd-slide-down{0%{transform:translate(0, -10px)}100%{transform:translate(0, 0)}}.sd-tab-set{border-radius:.125rem;display:flex;flex-wrap:wrap;margin:1em 0;position:relative}.sd-tab-set>input{opacity:0;position:absolute}.sd-tab-set>input:checked+label{border-color:var(--sd-color-tabs-underline-active);color:var(--sd-color-tabs-label-active)}.sd-tab-set>input:checked+label+.sd-tab-content{display:block}.sd-tab-set>input:not(:checked)+label:hover{color:var(--sd-color-tabs-label-hover);border-color:var(--sd-color-tabs-underline-hover)}.sd-tab-set>input:focus+label{outline-style:auto}.sd-tab-set>input:not(.focus-visible)+label{outline:none;-webkit-tap-highlight-color:transparent}.sd-tab-set>label{border-bottom:.125rem solid transparent;margin-bottom:0;color:var(--sd-color-tabs-label-inactive);border-color:var(--sd-color-tabs-underline-inactive);cursor:pointer;font-size:var(--sd-fontsize-tabs-label);font-weight:700;padding:1em 1.25em .5em;transition:color 250ms;width:auto;z-index:1}html .sd-tab-set>label:hover{color:var(--sd-color-tabs-label-active)}.sd-col>.sd-tab-set{width:100%}.sd-tab-content{box-shadow:0 -0.0625rem var(--sd-color-tabs-overline),0 .0625rem var(--sd-color-tabs-underline);display:none;order:99;padding-bottom:.75rem;padding-top:.75rem;width:100%}.sd-tab-content>:first-child{margin-top:0 !important}.sd-tab-content>:last-child{margin-bottom:0 !important}.sd-tab-content>.sd-tab-set{margin:0}.sd-sphinx-override,.sd-sphinx-override *{-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box}.sd-sphinx-override p{margin-top:0}:root{--sd-color-primary: #007bff;--sd-color-secondary: #6c757d;--sd-color-success: #28a745;--sd-color-info: #17a2b8;--sd-color-warning: #f0b37e;--sd-color-danger: #dc3545;--sd-color-light: #f8f9fa;--sd-color-muted: #6c757d;--sd-color-dark: #212529;--sd-color-black: black;--sd-color-white: white;--sd-color-primary-highlight: #0069d9;--sd-color-secondary-highlight: #5c636a;--sd-color-success-highlight: #228e3b;--sd-color-info-highlight: #148a9c;--sd-color-warning-highlight: #cc986b;--sd-color-danger-highlight: #bb2d3b;--sd-color-light-highlight: #d3d4d5;--sd-color-muted-highlight: #5c636a;--sd-color-dark-highlight: #1c1f23;--sd-color-black-highlight: black;--sd-color-white-highlight: #d9d9d9;--sd-color-primary-text: #fff;--sd-color-secondary-text: #fff;--sd-color-success-text: #fff;--sd-color-info-text: #fff;--sd-color-warning-text: #212529;--sd-color-danger-text: #fff;--sd-color-light-text: #212529;--sd-color-muted-text: #fff;--sd-color-dark-text: #fff;--sd-color-black-text: #fff;--sd-color-white-text: #212529;--sd-color-shadow: rgba(0, 0, 0, 0.15);--sd-color-card-border: rgba(0, 0, 0, 0.125);--sd-color-card-border-hover: hsla(231, 99%, 66%, 1);--sd-color-card-background: transparent;--sd-color-card-text: inherit;--sd-color-card-header: transparent;--sd-color-card-footer: transparent;--sd-color-tabs-label-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-hover: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-inactive: hsl(0, 0%, 66%);--sd-color-tabs-underline-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-underline-hover: rgba(178, 206, 245, 0.62);--sd-color-tabs-underline-inactive: transparent;--sd-color-tabs-overline: rgb(222, 222, 222);--sd-color-tabs-underline: rgb(222, 222, 222);--sd-fontsize-tabs-label: 1rem} diff --git a/_sphinx_design_static/design-tabs.js b/_sphinx_design_static/design-tabs.js new file mode 100644 index 0000000..36b38cf --- /dev/null +++ b/_sphinx_design_static/design-tabs.js @@ -0,0 +1,27 @@ +var sd_labels_by_text = {}; + +function ready() { + const li = document.getElementsByClassName("sd-tab-label"); + for (const label of li) { + syncId = label.getAttribute("data-sync-id"); + if (syncId) { + label.onclick = onLabelClick; + if (!sd_labels_by_text[syncId]) { + sd_labels_by_text[syncId] = []; + } + sd_labels_by_text[syncId].push(label); + } + } +} + +function onLabelClick() { + // Activate other inputs with the same sync id. + syncId = this.getAttribute("data-sync-id"); + for (label of sd_labels_by_text[syncId]) { + if (label === this) continue; + label.previousElementSibling.checked = true; + } + window.localStorage.setItem("sphinx-design-last-tab", syncId); +} + +document.addEventListener("DOMContentLoaded", ready, false); diff --git a/_static/_sphinx_javascript_frameworks_compat.js b/_static/_sphinx_javascript_frameworks_compat.js new file mode 100644 index 0000000..8549469 --- /dev/null +++ b/_static/_sphinx_javascript_frameworks_compat.js @@ -0,0 +1,134 @@ +/* + * _sphinx_javascript_frameworks_compat.js + * ~~~~~~~~~~ + * + * Compatability shim for jQuery and underscores.js. + * + * WILL BE REMOVED IN Sphinx 6.0 + * xref RemovedInSphinx60Warning + * + */ + +/** + * select a different prefix for underscore + */ +$u = _.noConflict(); + + +/** + * small helper function to urldecode strings + * + * See https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/decodeURIComponent#Decoding_query_parameters_from_a_URL + */ +jQuery.urldecode = function(x) { + if (!x) { + return x + } + return decodeURIComponent(x.replace(/\+/g, ' ')); +}; + +/** + * small helper function to urlencode strings + */ +jQuery.urlencode = encodeURIComponent; + +/** + * This function returns the parsed url parameters of the + * current request. Multiple values per key are supported, + * it will always return arrays of strings for the value parts. + */ +jQuery.getQueryParameters = function(s) { + if (typeof s === 'undefined') + s = document.location.search; + var parts = s.substr(s.indexOf('?') + 1).split('&'); + var result = {}; + for (var i = 0; i < parts.length; i++) { + var tmp = parts[i].split('=', 2); + var key = jQuery.urldecode(tmp[0]); + var value = jQuery.urldecode(tmp[1]); + if (key in result) + result[key].push(value); + else + result[key] = [value]; + } + return result; +}; + +/** + * highlight a given string on a jquery object by wrapping it in + * span elements with the given class name. + */ +jQuery.fn.highlightText = function(text, className) { + function highlight(node, addItems) { + if (node.nodeType === 3) { + var val = node.nodeValue; + var pos = val.toLowerCase().indexOf(text); + if (pos >= 0 && + !jQuery(node.parentNode).hasClass(className) && + !jQuery(node.parentNode).hasClass("nohighlight")) { + var span; + var isInSVG = jQuery(node).closest("body, svg, foreignObject").is("svg"); + if (isInSVG) { + span = document.createElementNS("http://www.w3.org/2000/svg", "tspan"); + } else { + span = document.createElement("span"); + span.className = className; + } + span.appendChild(document.createTextNode(val.substr(pos, text.length))); + node.parentNode.insertBefore(span, node.parentNode.insertBefore( + document.createTextNode(val.substr(pos + text.length)), + node.nextSibling)); + node.nodeValue = val.substr(0, pos); + if (isInSVG) { + var rect = document.createElementNS("http://www.w3.org/2000/svg", "rect"); + var bbox = node.parentElement.getBBox(); + rect.x.baseVal.value = bbox.x; + rect.y.baseVal.value = bbox.y; + rect.width.baseVal.value = bbox.width; + rect.height.baseVal.value = bbox.height; + rect.setAttribute('class', className); + addItems.push({ + "parent": node.parentNode, + "target": rect}); + } + } + } + else if (!jQuery(node).is("button, select, textarea")) { + jQuery.each(node.childNodes, function() { + highlight(this, addItems); + }); + } + } + var addItems = []; + var result = this.each(function() { + highlight(this, addItems); + }); + for (var i = 0; i < addItems.length; ++i) { + jQuery(addItems[i].parent).before(addItems[i].target); + } + return result; +}; + +/* + * backward compatibility for jQuery.browser + * This will be supported until firefox bug is fixed. + */ +if (!jQuery.browser) { + jQuery.uaMatch = function(ua) { + ua = ua.toLowerCase(); + + var match = /(chrome)[ \/]([\w.]+)/.exec(ua) || + /(webkit)[ \/]([\w.]+)/.exec(ua) || + /(opera)(?:.*version|)[ \/]([\w.]+)/.exec(ua) || + /(msie) ([\w.]+)/.exec(ua) || + ua.indexOf("compatible") < 0 && /(mozilla)(?:.*? rv:([\w.]+)|)/.exec(ua) || + []; + + return { + browser: match[ 1 ] || "", + version: match[ 2 ] || "0" + }; + }; + jQuery.browser = {}; + jQuery.browser[jQuery.uaMatch(navigator.userAgent).browser] = true; +} diff --git a/_static/basic.css b/_static/basic.css new file mode 100644 index 0000000..9e364ed --- /dev/null +++ b/_static/basic.css @@ -0,0 +1,930 @@ +/* + * basic.css + * ~~~~~~~~~ + * + * Sphinx stylesheet -- basic theme. + * + * :copyright: Copyright 2007-2022 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +/* -- main layout ----------------------------------------------------------- */ + +div.clearer { + clear: both; +} + +div.section::after { + display: block; + content: ''; + clear: left; +} + +/* -- relbar ---------------------------------------------------------------- */ + +div.related { + width: 100%; + font-size: 90%; +} + +div.related h3 { + display: none; +} + +div.related ul { + margin: 0; + padding: 0 0 0 10px; + list-style: none; +} + +div.related li { + display: inline; +} + +div.related li.right { + float: right; + margin-right: 5px; +} + +/* -- sidebar --------------------------------------------------------------- */ + +div.sphinxsidebarwrapper { + padding: 10px 5px 0 10px; +} + +div.sphinxsidebar { + float: left; + width: 270px; + margin-left: -100%; + font-size: 90%; + word-wrap: break-word; + overflow-wrap : break-word; +} + +div.sphinxsidebar ul { + list-style: none; +} + +div.sphinxsidebar ul ul, +div.sphinxsidebar ul.want-points { + margin-left: 20px; + list-style: square; +} + +div.sphinxsidebar ul ul { + margin-top: 0; + margin-bottom: 0; +} + +div.sphinxsidebar form { + margin-top: 10px; +} + +div.sphinxsidebar input { + border: 1px solid #98dbcc; + font-family: sans-serif; + font-size: 1em; +} + +div.sphinxsidebar #searchbox form.search { + overflow: hidden; +} + +div.sphinxsidebar #searchbox input[type="text"] { + float: left; + width: 80%; + padding: 0.25em; + box-sizing: border-box; +} + +div.sphinxsidebar #searchbox input[type="submit"] { + float: left; + width: 20%; + border-left: none; + padding: 0.25em; + box-sizing: border-box; +} + + +img { + border: 0; + max-width: 100%; +} + +/* -- search page ----------------------------------------------------------- */ + +ul.search { + margin: 10px 0 0 20px; + padding: 0; +} + +ul.search li { + padding: 5px 0 5px 20px; + background-image: url(file.png); + background-repeat: no-repeat; + background-position: 0 7px; +} + +ul.search li a { + font-weight: bold; +} + +ul.search li p.context { + color: #888; + margin: 2px 0 0 30px; + text-align: left; +} + +ul.keywordmatches li.goodmatch a { + font-weight: bold; +} + +/* -- index page ------------------------------------------------------------ */ + +table.contentstable { + width: 90%; + margin-left: auto; + margin-right: auto; +} + +table.contentstable p.biglink { + line-height: 150%; +} + +a.biglink { + font-size: 1.3em; +} + +span.linkdescr { + font-style: italic; + padding-top: 5px; + font-size: 90%; +} + +/* -- general index --------------------------------------------------------- */ + +table.indextable { + width: 100%; +} + +table.indextable td { + text-align: left; + vertical-align: top; +} + +table.indextable ul { + margin-top: 0; + margin-bottom: 0; + list-style-type: none; +} + +table.indextable > tbody > tr > td > ul { + padding-left: 0em; +} + +table.indextable tr.pcap { + height: 10px; +} + +table.indextable tr.cap { + margin-top: 10px; + background-color: #f2f2f2; +} + +img.toggler { + margin-right: 3px; + margin-top: 3px; + cursor: pointer; +} + +div.modindex-jumpbox { + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 1em 0 1em 0; + padding: 0.4em; +} + +div.genindex-jumpbox { + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 1em 0 1em 0; + padding: 0.4em; +} + +/* -- domain module index --------------------------------------------------- */ + +table.modindextable td { + padding: 2px; + border-collapse: collapse; +} + +/* -- general body styles --------------------------------------------------- */ + +div.body { + min-width: 360px; + max-width: 800px; +} + +div.body p, div.body dd, div.body li, div.body blockquote { + -moz-hyphens: auto; + -ms-hyphens: auto; + -webkit-hyphens: auto; + hyphens: auto; +} + +a.headerlink { + visibility: hidden; +} + +h1:hover > a.headerlink, +h2:hover > a.headerlink, +h3:hover > a.headerlink, +h4:hover > a.headerlink, +h5:hover > a.headerlink, +h6:hover > a.headerlink, +dt:hover > a.headerlink, +caption:hover > a.headerlink, +p.caption:hover > a.headerlink, +div.code-block-caption:hover > a.headerlink { + visibility: visible; +} + +div.body p.caption { + text-align: inherit; +} + +div.body td { + text-align: left; +} + +.first { + margin-top: 0 !important; +} + +p.rubric { + margin-top: 30px; + font-weight: bold; +} + +img.align-left, figure.align-left, .figure.align-left, object.align-left { + clear: left; + float: left; + margin-right: 1em; +} + +img.align-right, figure.align-right, .figure.align-right, object.align-right { + clear: right; + float: right; + margin-left: 1em; +} + +img.align-center, figure.align-center, .figure.align-center, object.align-center { + display: block; + margin-left: auto; + margin-right: auto; +} + +img.align-default, figure.align-default, .figure.align-default { + display: block; + margin-left: auto; + margin-right: auto; +} + +.align-left { + text-align: left; +} + +.align-center { + text-align: center; +} + +.align-default { + text-align: center; +} + +.align-right { + text-align: right; +} + +/* -- sidebars -------------------------------------------------------------- */ + +div.sidebar, +aside.sidebar { + margin: 0 0 0.5em 1em; + border: 1px solid #ddb; + padding: 7px; + background-color: #ffe; + width: 40%; + float: right; + clear: right; + overflow-x: auto; +} + +p.sidebar-title { + font-weight: bold; +} +nav.contents, +aside.topic, + +div.admonition, div.topic, blockquote { + clear: left; +} + +/* -- topics ---------------------------------------------------------------- */ +nav.contents, +aside.topic, + +div.topic { + border: 1px solid #ccc; + padding: 7px; + margin: 10px 0 10px 0; +} + +p.topic-title { + font-size: 1.1em; + font-weight: bold; + margin-top: 10px; +} + +/* -- admonitions ----------------------------------------------------------- */ + +div.admonition { + margin-top: 10px; + margin-bottom: 10px; + padding: 7px; +} + +div.admonition dt { + font-weight: bold; +} + +p.admonition-title { + margin: 0px 10px 5px 0px; + font-weight: bold; +} + +div.body p.centered { + text-align: center; + margin-top: 25px; +} + +/* -- content of sidebars/topics/admonitions -------------------------------- */ + +div.sidebar > :last-child, +aside.sidebar > :last-child, +nav.contents > :last-child, +aside.topic > :last-child, + +div.topic > :last-child, +div.admonition > :last-child { + margin-bottom: 0; +} + +div.sidebar::after, +aside.sidebar::after, +nav.contents::after, +aside.topic::after, + +div.topic::after, +div.admonition::after, +blockquote::after { + display: block; + content: ''; + clear: both; +} + +/* -- tables ---------------------------------------------------------------- */ + +table.docutils { + margin-top: 10px; + margin-bottom: 10px; + border: 0; + border-collapse: collapse; +} + +table.align-center { + margin-left: auto; + margin-right: auto; +} + +table.align-default { + margin-left: auto; + margin-right: auto; +} + +table caption span.caption-number { + font-style: italic; +} + +table caption span.caption-text { +} + +table.docutils td, table.docutils th { + padding: 1px 8px 1px 5px; + border-top: 0; + border-left: 0; + border-right: 0; + border-bottom: 1px solid #aaa; +} + +th { + text-align: left; + padding-right: 5px; +} + +table.citation { + border-left: solid 1px gray; + margin-left: 1px; +} + +table.citation td { + border-bottom: none; +} + +th > :first-child, +td > :first-child { + margin-top: 0px; +} + +th > :last-child, +td > :last-child { + margin-bottom: 0px; +} + +/* -- figures --------------------------------------------------------------- */ + +div.figure, figure { + margin: 0.5em; + padding: 0.5em; +} + +div.figure p.caption, figcaption { + padding: 0.3em; +} + +div.figure p.caption span.caption-number, +figcaption span.caption-number { + font-style: italic; +} + +div.figure p.caption span.caption-text, +figcaption span.caption-text { +} + +/* -- field list styles ----------------------------------------------------- */ + +table.field-list td, table.field-list th { + border: 0 !important; +} + +.field-list ul { + margin: 0; + padding-left: 1em; +} + +.field-list p { + margin: 0; +} + +.field-name { + -moz-hyphens: manual; + -ms-hyphens: manual; + -webkit-hyphens: manual; + hyphens: manual; +} + +/* -- hlist styles ---------------------------------------------------------- */ + +table.hlist { + margin: 1em 0; +} + +table.hlist td { + vertical-align: top; +} + +/* -- object description styles --------------------------------------------- */ + +.sig { + font-family: 'Consolas', 'Menlo', 'DejaVu Sans Mono', 'Bitstream Vera Sans Mono', monospace; +} + +.sig-name, code.descname { + background-color: transparent; + font-weight: bold; +} + +.sig-name { + font-size: 1.1em; +} + +code.descname { + font-size: 1.2em; +} + +.sig-prename, code.descclassname { + background-color: transparent; +} + +.optional { + font-size: 1.3em; +} + +.sig-paren { + font-size: larger; +} + +.sig-param.n { + font-style: italic; +} + +/* C++ specific styling */ + +.sig-inline.c-texpr, +.sig-inline.cpp-texpr { + font-family: unset; +} + +.sig.c .k, .sig.c .kt, +.sig.cpp .k, .sig.cpp .kt { + color: #0033B3; +} + +.sig.c .m, +.sig.cpp .m { + color: #1750EB; +} + +.sig.c .s, .sig.c .sc, +.sig.cpp .s, .sig.cpp .sc { + color: #067D17; +} + + +/* -- other body styles ----------------------------------------------------- */ + +ol.arabic { + list-style: decimal; +} + +ol.loweralpha { + list-style: lower-alpha; +} + +ol.upperalpha { + list-style: upper-alpha; +} + +ol.lowerroman { + list-style: lower-roman; +} + +ol.upperroman { + list-style: upper-roman; +} + +:not(li) > ol > li:first-child > :first-child, +:not(li) > ul > li:first-child > :first-child { + margin-top: 0px; +} + +:not(li) > ol > li:last-child > :last-child, +:not(li) > ul > li:last-child > :last-child { + margin-bottom: 0px; +} + +ol.simple ol p, +ol.simple ul p, +ul.simple ol p, +ul.simple ul p { + margin-top: 0; +} + +ol.simple > li:not(:first-child) > p, +ul.simple > li:not(:first-child) > p { + margin-top: 0; +} + +ol.simple p, +ul.simple p { + margin-bottom: 0; +} + +/* Docutils 0.17 and older (footnotes & citations) */ +dl.footnote > dt, +dl.citation > dt { + float: left; + margin-right: 0.5em; +} + +dl.footnote > dd, +dl.citation > dd { + margin-bottom: 0em; +} + +dl.footnote > dd:after, +dl.citation > dd:after { + content: ""; + clear: both; +} + +/* Docutils 0.18+ (footnotes & citations) */ +aside.footnote > span, +div.citation > span { + float: left; +} +aside.footnote > span:last-of-type, +div.citation > span:last-of-type { + padding-right: 0.5em; +} +aside.footnote > p { + margin-left: 2em; +} +div.citation > p { + margin-left: 4em; +} +aside.footnote > p:last-of-type, +div.citation > p:last-of-type { + margin-bottom: 0em; +} +aside.footnote > p:last-of-type:after, +div.citation > p:last-of-type:after { + content: ""; + clear: both; +} + +/* Footnotes & citations ends */ + +dl.field-list { + display: grid; + grid-template-columns: fit-content(30%) auto; +} + +dl.field-list > dt { + font-weight: bold; + word-break: break-word; + padding-left: 0.5em; + padding-right: 5px; +} + +dl.field-list > dt:after { + content: ":"; +} + +dl.field-list > dd { + padding-left: 0.5em; + margin-top: 0em; + margin-left: 0em; + margin-bottom: 0em; +} + +dl { + margin-bottom: 15px; +} + +dd > :first-child { + margin-top: 0px; +} + +dd ul, dd table { + margin-bottom: 10px; +} + +dd { + margin-top: 3px; + margin-bottom: 10px; + margin-left: 30px; +} + +dl > dd:last-child, +dl > dd:last-child > :last-child { + margin-bottom: 0; +} + +dt:target, span.highlighted { + background-color: #fbe54e; +} + +rect.highlighted { + fill: #fbe54e; +} + +dl.glossary dt { + font-weight: bold; + font-size: 1.1em; +} + +.versionmodified { + font-style: italic; +} + +.system-message { + background-color: #fda; + padding: 5px; + border: 3px solid red; +} + +.footnote:target { + background-color: #ffa; +} + +.line-block { + display: block; + margin-top: 1em; + margin-bottom: 1em; +} + +.line-block .line-block { + margin-top: 0; + margin-bottom: 0; + margin-left: 1.5em; +} + +.guilabel, .menuselection { + font-family: sans-serif; +} + +.accelerator { + text-decoration: underline; +} + +.classifier { + font-style: oblique; +} + +.classifier:before { + font-style: normal; + margin: 0 0.5em; + content: ":"; + display: inline-block; +} + +abbr, acronym { + border-bottom: dotted 1px; + cursor: help; +} + +/* -- code displays --------------------------------------------------------- */ + +pre { + overflow: auto; + overflow-y: hidden; /* fixes display issues on Chrome browsers */ +} + +pre, div[class*="highlight-"] { + clear: both; +} + +span.pre { + -moz-hyphens: none; + -ms-hyphens: none; + -webkit-hyphens: none; + hyphens: none; + white-space: nowrap; +} + +div[class*="highlight-"] { + margin: 1em 0; +} + +td.linenos pre { + border: 0; + background-color: transparent; + color: #aaa; +} + +table.highlighttable { + display: block; +} + +table.highlighttable tbody { + display: block; +} + +table.highlighttable tr { + display: flex; +} + +table.highlighttable td { + margin: 0; + padding: 0; +} + +table.highlighttable td.linenos { + padding-right: 0.5em; +} + +table.highlighttable td.code { + flex: 1; + overflow: hidden; +} + +.highlight .hll { + display: block; +} + +div.highlight pre, +table.highlighttable pre { + margin: 0; +} + +div.code-block-caption + div { + margin-top: 0; +} + +div.code-block-caption { + margin-top: 1em; + padding: 2px 5px; + font-size: small; +} + +div.code-block-caption code { + background-color: transparent; +} + +table.highlighttable td.linenos, +span.linenos, +div.highlight span.gp { /* gp: Generic.Prompt */ + user-select: none; + -webkit-user-select: text; /* Safari fallback only */ + -webkit-user-select: none; /* Chrome/Safari */ + -moz-user-select: none; /* Firefox */ + -ms-user-select: none; /* IE10+ */ +} + +div.code-block-caption span.caption-number { + padding: 0.1em 0.3em; + font-style: italic; +} + +div.code-block-caption span.caption-text { +} + +div.literal-block-wrapper { + margin: 1em 0; +} + +code.xref, a code { + background-color: transparent; + font-weight: bold; +} + +h1 code, h2 code, h3 code, h4 code, h5 code, h6 code { + background-color: transparent; +} + +.viewcode-link { + float: right; +} + +.viewcode-back { + float: right; + font-family: sans-serif; +} + +div.viewcode-block:target { + margin: -1px -10px; + padding: 0 10px; +} + +/* -- math display ---------------------------------------------------------- */ + +img.math { + vertical-align: middle; +} + +div.body div.math p { + text-align: center; +} + +span.eqno { + float: right; +} + +span.eqno a.headerlink { + position: absolute; + z-index: 1; +} + +div.math:hover a.headerlink { + visibility: visible; +} + +/* -- printout stylesheet --------------------------------------------------- */ + +@media print { + div.document, + div.documentwrapper, + div.bodywrapper { + margin: 0 !important; + width: 100%; + } + + div.sphinxsidebar, + div.related, + div.footer, + #top-link { + display: none; + } +} \ No newline at end of file diff --git a/_static/check-solid.svg b/_static/check-solid.svg new file mode 100644 index 0000000..92fad4b --- /dev/null +++ b/_static/check-solid.svg @@ -0,0 +1,4 @@ + + + + diff --git a/_static/clipboard.min.js b/_static/clipboard.min.js new file mode 100644 index 0000000..54b3c46 --- /dev/null +++ b/_static/clipboard.min.js @@ -0,0 +1,7 @@ +/*! + * clipboard.js v2.0.8 + * https://clipboardjs.com/ + * + * Licensed MIT © Zeno Rocha + */ +!function(t,e){"object"==typeof exports&&"object"==typeof module?module.exports=e():"function"==typeof define&&define.amd?define([],e):"object"==typeof exports?exports.ClipboardJS=e():t.ClipboardJS=e()}(this,function(){return n={686:function(t,e,n){"use strict";n.d(e,{default:function(){return o}});var e=n(279),i=n.n(e),e=n(370),u=n.n(e),e=n(817),c=n.n(e);function a(t){try{return document.execCommand(t)}catch(t){return}}var f=function(t){t=c()(t);return a("cut"),t};var l=function(t){var e,n,o,r=1 + + + + diff --git a/_static/copybutton.css b/_static/copybutton.css new file mode 100644 index 0000000..f1916ec --- /dev/null +++ b/_static/copybutton.css @@ -0,0 +1,94 @@ +/* Copy buttons */ +button.copybtn { + position: absolute; + display: flex; + top: .3em; + right: .3em; + width: 1.7em; + height: 1.7em; + opacity: 0; + transition: opacity 0.3s, border .3s, background-color .3s; + user-select: none; + padding: 0; + border: none; + outline: none; + border-radius: 0.4em; + /* The colors that GitHub uses */ + border: #1b1f2426 1px solid; + background-color: #f6f8fa; + color: #57606a; +} + +button.copybtn.success { + border-color: #22863a; + color: #22863a; +} + +button.copybtn svg { + stroke: currentColor; + width: 1.5em; + height: 1.5em; + padding: 0.1em; +} + +div.highlight { + position: relative; +} + +/* Show the copybutton */ +.highlight:hover button.copybtn, button.copybtn.success { + opacity: 1; +} + +.highlight button.copybtn:hover { + background-color: rgb(235, 235, 235); +} + +.highlight button.copybtn:active { + background-color: rgb(187, 187, 187); +} + +/** + * A minimal CSS-only tooltip copied from: + * https://codepen.io/mildrenben/pen/rVBrpK + * + * To use, write HTML like the following: + * + *

Short

+ */ + .o-tooltip--left { + position: relative; + } + + .o-tooltip--left:after { + opacity: 0; + visibility: hidden; + position: absolute; + content: attr(data-tooltip); + padding: .2em; + font-size: .8em; + left: -.2em; + background: grey; + color: white; + white-space: nowrap; + z-index: 2; + border-radius: 2px; + transform: translateX(-102%) translateY(0); + transition: opacity 0.2s cubic-bezier(0.64, 0.09, 0.08, 1), transform 0.2s cubic-bezier(0.64, 0.09, 0.08, 1); +} + +.o-tooltip--left:hover:after { + display: block; + opacity: 1; + visibility: visible; + transform: translateX(-100%) translateY(0); + transition: opacity 0.2s cubic-bezier(0.64, 0.09, 0.08, 1), transform 0.2s cubic-bezier(0.64, 0.09, 0.08, 1); + transition-delay: .5s; +} + +/* By default the copy button shouldn't show up when printing a page */ +@media print { + button.copybtn { + display: none; + } +} diff --git a/_static/copybutton.js b/_static/copybutton.js new file mode 100644 index 0000000..2ea7ff3 --- /dev/null +++ b/_static/copybutton.js @@ -0,0 +1,248 @@ +// Localization support +const messages = { + 'en': { + 'copy': 'Copy', + 'copy_to_clipboard': 'Copy to clipboard', + 'copy_success': 'Copied!', + 'copy_failure': 'Failed to copy', + }, + 'es' : { + 'copy': 'Copiar', + 'copy_to_clipboard': 'Copiar al portapapeles', + 'copy_success': '¡Copiado!', + 'copy_failure': 'Error al copiar', + }, + 'de' : { + 'copy': 'Kopieren', + 'copy_to_clipboard': 'In die Zwischenablage kopieren', + 'copy_success': 'Kopiert!', + 'copy_failure': 'Fehler beim Kopieren', + }, + 'fr' : { + 'copy': 'Copier', + 'copy_to_clipboard': 'Copier dans le presse-papier', + 'copy_success': 'Copié !', + 'copy_failure': 'Échec de la copie', + }, + 'ru': { + 'copy': 'Скопировать', + 'copy_to_clipboard': 'Скопировать в буфер', + 'copy_success': 'Скопировано!', + 'copy_failure': 'Не удалось скопировать', + }, + 'zh-CN': { + 'copy': '复制', + 'copy_to_clipboard': '复制到剪贴板', + 'copy_success': '复制成功!', + 'copy_failure': '复制失败', + }, + 'it' : { + 'copy': 'Copiare', + 'copy_to_clipboard': 'Copiato negli appunti', + 'copy_success': 'Copiato!', + 'copy_failure': 'Errore durante la copia', + } +} + +let locale = 'en' +if( document.documentElement.lang !== undefined + && messages[document.documentElement.lang] !== undefined ) { + locale = document.documentElement.lang +} + +let doc_url_root = DOCUMENTATION_OPTIONS.URL_ROOT; +if (doc_url_root == '#') { + doc_url_root = ''; +} + +/** + * SVG files for our copy buttons + */ +let iconCheck = ` + ${messages[locale]['copy_success']} + + +` + +// If the user specified their own SVG use that, otherwise use the default +let iconCopy = ``; +if (!iconCopy) { + iconCopy = ` + ${messages[locale]['copy_to_clipboard']} + + + +` +} + +/** + * Set up copy/paste for code blocks + */ + +const runWhenDOMLoaded = cb => { + if (document.readyState != 'loading') { + cb() + } else if (document.addEventListener) { + document.addEventListener('DOMContentLoaded', cb) + } else { + document.attachEvent('onreadystatechange', function() { + if (document.readyState == 'complete') cb() + }) + } +} + +const codeCellId = index => `codecell${index}` + +// Clears selected text since ClipboardJS will select the text when copying +const clearSelection = () => { + if (window.getSelection) { + window.getSelection().removeAllRanges() + } else if (document.selection) { + document.selection.empty() + } +} + +// Changes tooltip text for a moment, then changes it back +// We want the timeout of our `success` class to be a bit shorter than the +// tooltip and icon change, so that we can hide the icon before changing back. +var timeoutIcon = 2000; +var timeoutSuccessClass = 1500; + +const temporarilyChangeTooltip = (el, oldText, newText) => { + el.setAttribute('data-tooltip', newText) + el.classList.add('success') + // Remove success a little bit sooner than we change the tooltip + // So that we can use CSS to hide the copybutton first + setTimeout(() => el.classList.remove('success'), timeoutSuccessClass) + setTimeout(() => el.setAttribute('data-tooltip', oldText), timeoutIcon) +} + +// Changes the copy button icon for two seconds, then changes it back +const temporarilyChangeIcon = (el) => { + el.innerHTML = iconCheck; + setTimeout(() => {el.innerHTML = iconCopy}, timeoutIcon) +} + +const addCopyButtonToCodeCells = () => { + // If ClipboardJS hasn't loaded, wait a bit and try again. This + // happens because we load ClipboardJS asynchronously. + if (window.ClipboardJS === undefined) { + setTimeout(addCopyButtonToCodeCells, 250) + return + } + + // Add copybuttons to all of our code cells + const COPYBUTTON_SELECTOR = 'div.highlight pre'; + const codeCells = document.querySelectorAll(COPYBUTTON_SELECTOR) + codeCells.forEach((codeCell, index) => { + const id = codeCellId(index) + codeCell.setAttribute('id', id) + + const clipboardButton = id => + `` + codeCell.insertAdjacentHTML('afterend', clipboardButton(id)) + }) + +function escapeRegExp(string) { + return string.replace(/[.*+?^${}()|[\]\\]/g, '\\$&'); // $& means the whole matched string +} + +/** + * Removes excluded text from a Node. + * + * @param {Node} target Node to filter. + * @param {string} exclude CSS selector of nodes to exclude. + * @returns {DOMString} Text from `target` with text removed. + */ +function filterText(target, exclude) { + const clone = target.cloneNode(true); // clone as to not modify the live DOM + if (exclude) { + // remove excluded nodes + clone.querySelectorAll(exclude).forEach(node => node.remove()); + } + return clone.innerText; +} + +// Callback when a copy button is clicked. Will be passed the node that was clicked +// should then grab the text and replace pieces of text that shouldn't be used in output +function formatCopyText(textContent, copybuttonPromptText, isRegexp = false, onlyCopyPromptLines = true, removePrompts = true, copyEmptyLines = true, lineContinuationChar = "", hereDocDelim = "") { + var regexp; + var match; + + // Do we check for line continuation characters and "HERE-documents"? + var useLineCont = !!lineContinuationChar + var useHereDoc = !!hereDocDelim + + // create regexp to capture prompt and remaining line + if (isRegexp) { + regexp = new RegExp('^(' + copybuttonPromptText + ')(.*)') + } else { + regexp = new RegExp('^(' + escapeRegExp(copybuttonPromptText) + ')(.*)') + } + + const outputLines = []; + var promptFound = false; + var gotLineCont = false; + var gotHereDoc = false; + const lineGotPrompt = []; + for (const line of textContent.split('\n')) { + match = line.match(regexp) + if (match || gotLineCont || gotHereDoc) { + promptFound = regexp.test(line) + lineGotPrompt.push(promptFound) + if (removePrompts && promptFound) { + outputLines.push(match[2]) + } else { + outputLines.push(line) + } + gotLineCont = line.endsWith(lineContinuationChar) & useLineCont + if (line.includes(hereDocDelim) & useHereDoc) + gotHereDoc = !gotHereDoc + } else if (!onlyCopyPromptLines) { + outputLines.push(line) + } else if (copyEmptyLines && line.trim() === '') { + outputLines.push(line) + } + } + + // If no lines with the prompt were found then just use original lines + if (lineGotPrompt.some(v => v === true)) { + textContent = outputLines.join('\n'); + } + + // Remove a trailing newline to avoid auto-running when pasting + if (textContent.endsWith("\n")) { + textContent = textContent.slice(0, -1) + } + return textContent +} + + +var copyTargetText = (trigger) => { + var target = document.querySelector(trigger.attributes['data-clipboard-target'].value); + + // get filtered text + let exclude = '.linenos'; + + let text = filterText(target, exclude); + return formatCopyText(text, '', false, true, true, true, '', '') +} + + // Initialize with a callback so we can modify the text before copy + const clipboard = new ClipboardJS('.copybtn', {text: copyTargetText}) + + // Update UI with error/success messages + clipboard.on('success', event => { + clearSelection() + temporarilyChangeTooltip(event.trigger, messages[locale]['copy'], messages[locale]['copy_success']) + temporarilyChangeIcon(event.trigger) + }) + + clipboard.on('error', event => { + temporarilyChangeTooltip(event.trigger, messages[locale]['copy'], messages[locale]['copy_failure']) + }) +} + +runWhenDOMLoaded(addCopyButtonToCodeCells) \ No newline at end of file diff --git a/_static/copybutton_funcs.js b/_static/copybutton_funcs.js new file mode 100644 index 0000000..dbe1aaa --- /dev/null +++ b/_static/copybutton_funcs.js @@ -0,0 +1,73 @@ +function escapeRegExp(string) { + return string.replace(/[.*+?^${}()|[\]\\]/g, '\\$&'); // $& means the whole matched string +} + +/** + * Removes excluded text from a Node. + * + * @param {Node} target Node to filter. + * @param {string} exclude CSS selector of nodes to exclude. + * @returns {DOMString} Text from `target` with text removed. + */ +export function filterText(target, exclude) { + const clone = target.cloneNode(true); // clone as to not modify the live DOM + if (exclude) { + // remove excluded nodes + clone.querySelectorAll(exclude).forEach(node => node.remove()); + } + return clone.innerText; +} + +// Callback when a copy button is clicked. Will be passed the node that was clicked +// should then grab the text and replace pieces of text that shouldn't be used in output +export function formatCopyText(textContent, copybuttonPromptText, isRegexp = false, onlyCopyPromptLines = true, removePrompts = true, copyEmptyLines = true, lineContinuationChar = "", hereDocDelim = "") { + var regexp; + var match; + + // Do we check for line continuation characters and "HERE-documents"? + var useLineCont = !!lineContinuationChar + var useHereDoc = !!hereDocDelim + + // create regexp to capture prompt and remaining line + if (isRegexp) { + regexp = new RegExp('^(' + copybuttonPromptText + ')(.*)') + } else { + regexp = new RegExp('^(' + escapeRegExp(copybuttonPromptText) + ')(.*)') + } + + const outputLines = []; + var promptFound = false; + var gotLineCont = false; + var gotHereDoc = false; + const lineGotPrompt = []; + for (const line of textContent.split('\n')) { + match = line.match(regexp) + if (match || gotLineCont || gotHereDoc) { + promptFound = regexp.test(line) + lineGotPrompt.push(promptFound) + if (removePrompts && promptFound) { + outputLines.push(match[2]) + } else { + outputLines.push(line) + } + gotLineCont = line.endsWith(lineContinuationChar) & useLineCont + if (line.includes(hereDocDelim) & useHereDoc) + gotHereDoc = !gotHereDoc + } else if (!onlyCopyPromptLines) { + outputLines.push(line) + } else if (copyEmptyLines && line.trim() === '') { + outputLines.push(line) + } + } + + // If no lines with the prompt were found then just use original lines + if (lineGotPrompt.some(v => v === true)) { + textContent = outputLines.join('\n'); + } + + // Remove a trailing newline to avoid auto-running when pasting + if (textContent.endsWith("\n")) { + textContent = textContent.slice(0, -1) + } + return textContent +} diff --git a/_static/design-style.4045f2051d55cab465a707391d5b2007.min.css b/_static/design-style.4045f2051d55cab465a707391d5b2007.min.css new file mode 100644 index 0000000..3225661 --- /dev/null +++ b/_static/design-style.4045f2051d55cab465a707391d5b2007.min.css @@ -0,0 +1 @@ +.sd-bg-primary{background-color:var(--sd-color-primary) !important}.sd-bg-text-primary{color:var(--sd-color-primary-text) !important}button.sd-bg-primary:focus,button.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}a.sd-bg-primary:focus,a.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}.sd-bg-secondary{background-color:var(--sd-color-secondary) !important}.sd-bg-text-secondary{color:var(--sd-color-secondary-text) !important}button.sd-bg-secondary:focus,button.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}a.sd-bg-secondary:focus,a.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}.sd-bg-success{background-color:var(--sd-color-success) !important}.sd-bg-text-success{color:var(--sd-color-success-text) !important}button.sd-bg-success:focus,button.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}a.sd-bg-success:focus,a.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}.sd-bg-info{background-color:var(--sd-color-info) !important}.sd-bg-text-info{color:var(--sd-color-info-text) !important}button.sd-bg-info:focus,button.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}a.sd-bg-info:focus,a.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}.sd-bg-warning{background-color:var(--sd-color-warning) !important}.sd-bg-text-warning{color:var(--sd-color-warning-text) !important}button.sd-bg-warning:focus,button.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}a.sd-bg-warning:focus,a.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}.sd-bg-danger{background-color:var(--sd-color-danger) !important}.sd-bg-text-danger{color:var(--sd-color-danger-text) !important}button.sd-bg-danger:focus,button.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}a.sd-bg-danger:focus,a.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}.sd-bg-light{background-color:var(--sd-color-light) !important}.sd-bg-text-light{color:var(--sd-color-light-text) !important}button.sd-bg-light:focus,button.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}a.sd-bg-light:focus,a.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}.sd-bg-muted{background-color:var(--sd-color-muted) !important}.sd-bg-text-muted{color:var(--sd-color-muted-text) !important}button.sd-bg-muted:focus,button.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}a.sd-bg-muted:focus,a.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}.sd-bg-dark{background-color:var(--sd-color-dark) !important}.sd-bg-text-dark{color:var(--sd-color-dark-text) !important}button.sd-bg-dark:focus,button.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}a.sd-bg-dark:focus,a.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}.sd-bg-black{background-color:var(--sd-color-black) !important}.sd-bg-text-black{color:var(--sd-color-black-text) !important}button.sd-bg-black:focus,button.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}a.sd-bg-black:focus,a.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}.sd-bg-white{background-color:var(--sd-color-white) !important}.sd-bg-text-white{color:var(--sd-color-white-text) !important}button.sd-bg-white:focus,button.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}a.sd-bg-white:focus,a.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}.sd-text-primary,.sd-text-primary>p{color:var(--sd-color-primary) !important}a.sd-text-primary:focus,a.sd-text-primary:hover{color:var(--sd-color-primary-highlight) !important}.sd-text-secondary,.sd-text-secondary>p{color:var(--sd-color-secondary) !important}a.sd-text-secondary:focus,a.sd-text-secondary:hover{color:var(--sd-color-secondary-highlight) !important}.sd-text-success,.sd-text-success>p{color:var(--sd-color-success) !important}a.sd-text-success:focus,a.sd-text-success:hover{color:var(--sd-color-success-highlight) !important}.sd-text-info,.sd-text-info>p{color:var(--sd-color-info) !important}a.sd-text-info:focus,a.sd-text-info:hover{color:var(--sd-color-info-highlight) !important}.sd-text-warning,.sd-text-warning>p{color:var(--sd-color-warning) !important}a.sd-text-warning:focus,a.sd-text-warning:hover{color:var(--sd-color-warning-highlight) !important}.sd-text-danger,.sd-text-danger>p{color:var(--sd-color-danger) !important}a.sd-text-danger:focus,a.sd-text-danger:hover{color:var(--sd-color-danger-highlight) !important}.sd-text-light,.sd-text-light>p{color:var(--sd-color-light) !important}a.sd-text-light:focus,a.sd-text-light:hover{color:var(--sd-color-light-highlight) !important}.sd-text-muted,.sd-text-muted>p{color:var(--sd-color-muted) !important}a.sd-text-muted:focus,a.sd-text-muted:hover{color:var(--sd-color-muted-highlight) !important}.sd-text-dark,.sd-text-dark>p{color:var(--sd-color-dark) !important}a.sd-text-dark:focus,a.sd-text-dark:hover{color:var(--sd-color-dark-highlight) !important}.sd-text-black,.sd-text-black>p{color:var(--sd-color-black) !important}a.sd-text-black:focus,a.sd-text-black:hover{color:var(--sd-color-black-highlight) !important}.sd-text-white,.sd-text-white>p{color:var(--sd-color-white) !important}a.sd-text-white:focus,a.sd-text-white:hover{color:var(--sd-color-white-highlight) !important}.sd-outline-primary{border-color:var(--sd-color-primary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-primary:focus,a.sd-outline-primary:hover{border-color:var(--sd-color-primary-highlight) !important}.sd-outline-secondary{border-color:var(--sd-color-secondary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-secondary:focus,a.sd-outline-secondary:hover{border-color:var(--sd-color-secondary-highlight) !important}.sd-outline-success{border-color:var(--sd-color-success) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-success:focus,a.sd-outline-success:hover{border-color:var(--sd-color-success-highlight) !important}.sd-outline-info{border-color:var(--sd-color-info) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-info:focus,a.sd-outline-info:hover{border-color:var(--sd-color-info-highlight) !important}.sd-outline-warning{border-color:var(--sd-color-warning) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-warning:focus,a.sd-outline-warning:hover{border-color:var(--sd-color-warning-highlight) !important}.sd-outline-danger{border-color:var(--sd-color-danger) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-danger:focus,a.sd-outline-danger:hover{border-color:var(--sd-color-danger-highlight) !important}.sd-outline-light{border-color:var(--sd-color-light) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-light:focus,a.sd-outline-light:hover{border-color:var(--sd-color-light-highlight) !important}.sd-outline-muted{border-color:var(--sd-color-muted) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-muted:focus,a.sd-outline-muted:hover{border-color:var(--sd-color-muted-highlight) !important}.sd-outline-dark{border-color:var(--sd-color-dark) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-dark:focus,a.sd-outline-dark:hover{border-color:var(--sd-color-dark-highlight) !important}.sd-outline-black{border-color:var(--sd-color-black) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-black:focus,a.sd-outline-black:hover{border-color:var(--sd-color-black-highlight) !important}.sd-outline-white{border-color:var(--sd-color-white) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-white:focus,a.sd-outline-white:hover{border-color:var(--sd-color-white-highlight) !important}.sd-bg-transparent{background-color:transparent !important}.sd-outline-transparent{border-color:transparent !important}.sd-text-transparent{color:transparent !important}.sd-p-0{padding:0 !important}.sd-pt-0,.sd-py-0{padding-top:0 !important}.sd-pr-0,.sd-px-0{padding-right:0 !important}.sd-pb-0,.sd-py-0{padding-bottom:0 !important}.sd-pl-0,.sd-px-0{padding-left:0 !important}.sd-p-1{padding:.25rem !important}.sd-pt-1,.sd-py-1{padding-top:.25rem !important}.sd-pr-1,.sd-px-1{padding-right:.25rem !important}.sd-pb-1,.sd-py-1{padding-bottom:.25rem !important}.sd-pl-1,.sd-px-1{padding-left:.25rem !important}.sd-p-2{padding:.5rem !important}.sd-pt-2,.sd-py-2{padding-top:.5rem !important}.sd-pr-2,.sd-px-2{padding-right:.5rem !important}.sd-pb-2,.sd-py-2{padding-bottom:.5rem !important}.sd-pl-2,.sd-px-2{padding-left:.5rem !important}.sd-p-3{padding:1rem !important}.sd-pt-3,.sd-py-3{padding-top:1rem !important}.sd-pr-3,.sd-px-3{padding-right:1rem !important}.sd-pb-3,.sd-py-3{padding-bottom:1rem !important}.sd-pl-3,.sd-px-3{padding-left:1rem !important}.sd-p-4{padding:1.5rem !important}.sd-pt-4,.sd-py-4{padding-top:1.5rem !important}.sd-pr-4,.sd-px-4{padding-right:1.5rem !important}.sd-pb-4,.sd-py-4{padding-bottom:1.5rem !important}.sd-pl-4,.sd-px-4{padding-left:1.5rem !important}.sd-p-5{padding:3rem !important}.sd-pt-5,.sd-py-5{padding-top:3rem !important}.sd-pr-5,.sd-px-5{padding-right:3rem !important}.sd-pb-5,.sd-py-5{padding-bottom:3rem !important}.sd-pl-5,.sd-px-5{padding-left:3rem !important}.sd-m-auto{margin:auto !important}.sd-mt-auto,.sd-my-auto{margin-top:auto !important}.sd-mr-auto,.sd-mx-auto{margin-right:auto !important}.sd-mb-auto,.sd-my-auto{margin-bottom:auto !important}.sd-ml-auto,.sd-mx-auto{margin-left:auto !important}.sd-m-0{margin:0 !important}.sd-mt-0,.sd-my-0{margin-top:0 !important}.sd-mr-0,.sd-mx-0{margin-right:0 !important}.sd-mb-0,.sd-my-0{margin-bottom:0 !important}.sd-ml-0,.sd-mx-0{margin-left:0 !important}.sd-m-1{margin:.25rem !important}.sd-mt-1,.sd-my-1{margin-top:.25rem !important}.sd-mr-1,.sd-mx-1{margin-right:.25rem !important}.sd-mb-1,.sd-my-1{margin-bottom:.25rem !important}.sd-ml-1,.sd-mx-1{margin-left:.25rem !important}.sd-m-2{margin:.5rem !important}.sd-mt-2,.sd-my-2{margin-top:.5rem !important}.sd-mr-2,.sd-mx-2{margin-right:.5rem !important}.sd-mb-2,.sd-my-2{margin-bottom:.5rem !important}.sd-ml-2,.sd-mx-2{margin-left:.5rem !important}.sd-m-3{margin:1rem !important}.sd-mt-3,.sd-my-3{margin-top:1rem !important}.sd-mr-3,.sd-mx-3{margin-right:1rem !important}.sd-mb-3,.sd-my-3{margin-bottom:1rem !important}.sd-ml-3,.sd-mx-3{margin-left:1rem !important}.sd-m-4{margin:1.5rem !important}.sd-mt-4,.sd-my-4{margin-top:1.5rem !important}.sd-mr-4,.sd-mx-4{margin-right:1.5rem !important}.sd-mb-4,.sd-my-4{margin-bottom:1.5rem !important}.sd-ml-4,.sd-mx-4{margin-left:1.5rem !important}.sd-m-5{margin:3rem !important}.sd-mt-5,.sd-my-5{margin-top:3rem !important}.sd-mr-5,.sd-mx-5{margin-right:3rem !important}.sd-mb-5,.sd-my-5{margin-bottom:3rem !important}.sd-ml-5,.sd-mx-5{margin-left:3rem !important}.sd-w-25{width:25% !important}.sd-w-50{width:50% !important}.sd-w-75{width:75% !important}.sd-w-100{width:100% !important}.sd-w-auto{width:auto !important}.sd-h-25{height:25% !important}.sd-h-50{height:50% !important}.sd-h-75{height:75% !important}.sd-h-100{height:100% !important}.sd-h-auto{height:auto !important}.sd-d-none{display:none !important}.sd-d-inline{display:inline !important}.sd-d-inline-block{display:inline-block !important}.sd-d-block{display:block !important}.sd-d-grid{display:grid !important}.sd-d-flex-row{display:-ms-flexbox !important;display:flex !important;flex-direction:row !important}.sd-d-flex-column{display:-ms-flexbox !important;display:flex !important;flex-direction:column !important}.sd-d-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}@media(min-width: 576px){.sd-d-sm-none{display:none !important}.sd-d-sm-inline{display:inline !important}.sd-d-sm-inline-block{display:inline-block !important}.sd-d-sm-block{display:block !important}.sd-d-sm-grid{display:grid !important}.sd-d-sm-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-sm-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 768px){.sd-d-md-none{display:none !important}.sd-d-md-inline{display:inline !important}.sd-d-md-inline-block{display:inline-block !important}.sd-d-md-block{display:block !important}.sd-d-md-grid{display:grid !important}.sd-d-md-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-md-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 992px){.sd-d-lg-none{display:none !important}.sd-d-lg-inline{display:inline !important}.sd-d-lg-inline-block{display:inline-block !important}.sd-d-lg-block{display:block !important}.sd-d-lg-grid{display:grid !important}.sd-d-lg-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-lg-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 1200px){.sd-d-xl-none{display:none !important}.sd-d-xl-inline{display:inline !important}.sd-d-xl-inline-block{display:inline-block !important}.sd-d-xl-block{display:block !important}.sd-d-xl-grid{display:grid !important}.sd-d-xl-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-xl-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}.sd-align-major-start{justify-content:flex-start !important}.sd-align-major-end{justify-content:flex-end !important}.sd-align-major-center{justify-content:center !important}.sd-align-major-justify{justify-content:space-between !important}.sd-align-major-spaced{justify-content:space-evenly !important}.sd-align-minor-start{align-items:flex-start !important}.sd-align-minor-end{align-items:flex-end !important}.sd-align-minor-center{align-items:center !important}.sd-align-minor-stretch{align-items:stretch !important}.sd-text-justify{text-align:justify !important}.sd-text-left{text-align:left !important}.sd-text-right{text-align:right !important}.sd-text-center{text-align:center !important}.sd-font-weight-light{font-weight:300 !important}.sd-font-weight-lighter{font-weight:lighter !important}.sd-font-weight-normal{font-weight:400 !important}.sd-font-weight-bold{font-weight:700 !important}.sd-font-weight-bolder{font-weight:bolder !important}.sd-font-italic{font-style:italic !important}.sd-text-decoration-none{text-decoration:none !important}.sd-text-lowercase{text-transform:lowercase !important}.sd-text-uppercase{text-transform:uppercase !important}.sd-text-capitalize{text-transform:capitalize !important}.sd-text-wrap{white-space:normal !important}.sd-text-nowrap{white-space:nowrap !important}.sd-text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.sd-fs-1,.sd-fs-1>p{font-size:calc(1.375rem + 1.5vw) !important;line-height:unset !important}.sd-fs-2,.sd-fs-2>p{font-size:calc(1.325rem + 0.9vw) !important;line-height:unset !important}.sd-fs-3,.sd-fs-3>p{font-size:calc(1.3rem + 0.6vw) !important;line-height:unset !important}.sd-fs-4,.sd-fs-4>p{font-size:calc(1.275rem + 0.3vw) !important;line-height:unset !important}.sd-fs-5,.sd-fs-5>p{font-size:1.25rem !important;line-height:unset !important}.sd-fs-6,.sd-fs-6>p{font-size:1rem !important;line-height:unset !important}.sd-border-0{border:0 solid !important}.sd-border-top-0{border-top:0 solid !important}.sd-border-bottom-0{border-bottom:0 solid !important}.sd-border-right-0{border-right:0 solid !important}.sd-border-left-0{border-left:0 solid !important}.sd-border-1{border:1px solid !important}.sd-border-top-1{border-top:1px solid !important}.sd-border-bottom-1{border-bottom:1px solid !important}.sd-border-right-1{border-right:1px solid !important}.sd-border-left-1{border-left:1px solid !important}.sd-border-2{border:2px solid !important}.sd-border-top-2{border-top:2px solid !important}.sd-border-bottom-2{border-bottom:2px solid !important}.sd-border-right-2{border-right:2px solid !important}.sd-border-left-2{border-left:2px solid !important}.sd-border-3{border:3px solid !important}.sd-border-top-3{border-top:3px solid !important}.sd-border-bottom-3{border-bottom:3px solid !important}.sd-border-right-3{border-right:3px solid !important}.sd-border-left-3{border-left:3px solid !important}.sd-border-4{border:4px solid !important}.sd-border-top-4{border-top:4px solid !important}.sd-border-bottom-4{border-bottom:4px solid !important}.sd-border-right-4{border-right:4px solid !important}.sd-border-left-4{border-left:4px solid !important}.sd-border-5{border:5px solid !important}.sd-border-top-5{border-top:5px solid !important}.sd-border-bottom-5{border-bottom:5px solid !important}.sd-border-right-5{border-right:5px solid !important}.sd-border-left-5{border-left:5px solid !important}.sd-rounded-0{border-radius:0 !important}.sd-rounded-1{border-radius:.2rem !important}.sd-rounded-2{border-radius:.3rem !important}.sd-rounded-3{border-radius:.5rem !important}.sd-rounded-pill{border-radius:50rem !important}.sd-rounded-circle{border-radius:50% !important}.shadow-none{box-shadow:none !important}.sd-shadow-sm{box-shadow:0 .125rem .25rem var(--sd-color-shadow) !important}.sd-shadow-md{box-shadow:0 .5rem 1rem var(--sd-color-shadow) !important}.sd-shadow-lg{box-shadow:0 1rem 3rem var(--sd-color-shadow) !important}@keyframes sd-slide-from-left{0%{transform:translateX(-100%)}100%{transform:translateX(0)}}@keyframes sd-slide-from-right{0%{transform:translateX(200%)}100%{transform:translateX(0)}}@keyframes sd-grow100{0%{transform:scale(0);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50{0%{transform:scale(0.5);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50-rot20{0%{transform:scale(0.5) rotateZ(-20deg);opacity:.5}75%{transform:scale(1) rotateZ(5deg);opacity:1}95%{transform:scale(1) rotateZ(-1deg);opacity:1}100%{transform:scale(1) rotateZ(0);opacity:1}}.sd-animate-slide-from-left{animation:1s ease-out 0s 1 normal none running sd-slide-from-left}.sd-animate-slide-from-right{animation:1s ease-out 0s 1 normal none running sd-slide-from-right}.sd-animate-grow100{animation:1s ease-out 0s 1 normal none running sd-grow100}.sd-animate-grow50{animation:1s ease-out 0s 1 normal none running sd-grow50}.sd-animate-grow50-rot20{animation:1s ease-out 0s 1 normal none running sd-grow50-rot20}.sd-badge{display:inline-block;padding:.35em .65em;font-size:.75em;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem}.sd-badge:empty{display:none}a.sd-badge{text-decoration:none}.sd-btn .sd-badge{position:relative;top:-1px}.sd-btn{background-color:transparent;border:1px solid transparent;border-radius:.25rem;cursor:pointer;display:inline-block;font-weight:400;font-size:1rem;line-height:1.5;padding:.375rem .75rem;text-align:center;text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;vertical-align:middle;user-select:none;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none}.sd-btn:hover{text-decoration:none}@media(prefers-reduced-motion: reduce){.sd-btn{transition:none}}.sd-btn-primary,.sd-btn-outline-primary:hover,.sd-btn-outline-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-primary:hover,.sd-btn-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary-highlight) !important;border-color:var(--sd-color-primary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-primary{color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary,.sd-btn-outline-secondary:hover,.sd-btn-outline-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary:hover,.sd-btn-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary-highlight) !important;border-color:var(--sd-color-secondary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-secondary{color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success,.sd-btn-outline-success:hover,.sd-btn-outline-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success:hover,.sd-btn-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success-highlight) !important;border-color:var(--sd-color-success-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-success{color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info,.sd-btn-outline-info:hover,.sd-btn-outline-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info:hover,.sd-btn-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info-highlight) !important;border-color:var(--sd-color-info-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-info{color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning,.sd-btn-outline-warning:hover,.sd-btn-outline-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning:hover,.sd-btn-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning-highlight) !important;border-color:var(--sd-color-warning-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-warning{color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger,.sd-btn-outline-danger:hover,.sd-btn-outline-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger:hover,.sd-btn-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger-highlight) !important;border-color:var(--sd-color-danger-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-danger{color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light,.sd-btn-outline-light:hover,.sd-btn-outline-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light:hover,.sd-btn-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light-highlight) !important;border-color:var(--sd-color-light-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-light{color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted,.sd-btn-outline-muted:hover,.sd-btn-outline-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted:hover,.sd-btn-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted-highlight) !important;border-color:var(--sd-color-muted-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-muted{color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark,.sd-btn-outline-dark:hover,.sd-btn-outline-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark:hover,.sd-btn-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark-highlight) !important;border-color:var(--sd-color-dark-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-dark{color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black,.sd-btn-outline-black:hover,.sd-btn-outline-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black:hover,.sd-btn-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black-highlight) !important;border-color:var(--sd-color-black-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-black{color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white,.sd-btn-outline-white:hover,.sd-btn-outline-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white:hover,.sd-btn-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white-highlight) !important;border-color:var(--sd-color-white-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-white{color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.sd-hide-link-text{font-size:0}.sd-octicon,.sd-material-icon{display:inline-block;fill:currentColor;vertical-align:middle}.sd-avatar-xs{border-radius:50%;object-fit:cover;object-position:center;width:1rem;height:1rem}.sd-avatar-sm{border-radius:50%;object-fit:cover;object-position:center;width:3rem;height:3rem}.sd-avatar-md{border-radius:50%;object-fit:cover;object-position:center;width:5rem;height:5rem}.sd-avatar-lg{border-radius:50%;object-fit:cover;object-position:center;width:7rem;height:7rem}.sd-avatar-xl{border-radius:50%;object-fit:cover;object-position:center;width:10rem;height:10rem}.sd-avatar-inherit{border-radius:50%;object-fit:cover;object-position:center;width:inherit;height:inherit}.sd-avatar-initial{border-radius:50%;object-fit:cover;object-position:center;width:initial;height:initial}.sd-card{background-clip:border-box;background-color:var(--sd-color-card-background);border:1px solid var(--sd-color-card-border);border-radius:.25rem;color:var(--sd-color-card-text);display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;min-width:0;position:relative;word-wrap:break-word}.sd-card>hr{margin-left:0;margin-right:0}.sd-card-hover:hover{border-color:var(--sd-color-card-border-hover);transform:scale(1.01)}.sd-card-body{-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem 1rem}.sd-card-title{margin-bottom:.5rem}.sd-card-subtitle{margin-top:-0.25rem;margin-bottom:0}.sd-card-text:last-child{margin-bottom:0}.sd-card-link:hover{text-decoration:none}.sd-card-link+.card-link{margin-left:1rem}.sd-card-header{padding:.5rem 1rem;margin-bottom:0;background-color:var(--sd-color-card-header);border-bottom:1px solid var(--sd-color-card-border)}.sd-card-header:first-child{border-radius:calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0}.sd-card-footer{padding:.5rem 1rem;background-color:var(--sd-color-card-footer);border-top:1px solid var(--sd-color-card-border)}.sd-card-footer:last-child{border-radius:0 0 calc(0.25rem - 1px) calc(0.25rem - 1px)}.sd-card-header-tabs{margin-right:-0.5rem;margin-bottom:-0.5rem;margin-left:-0.5rem;border-bottom:0}.sd-card-header-pills{margin-right:-0.5rem;margin-left:-0.5rem}.sd-card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1rem;border-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom,.sd-card-img-top{width:100%}.sd-card-img,.sd-card-img-top{border-top-left-radius:calc(0.25rem - 1px);border-top-right-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom{border-bottom-left-radius:calc(0.25rem - 1px);border-bottom-right-radius:calc(0.25rem - 1px)}.sd-cards-carousel{width:100%;display:flex;flex-wrap:nowrap;-ms-flex-direction:row;flex-direction:row;overflow-x:hidden;scroll-snap-type:x mandatory}.sd-cards-carousel.sd-show-scrollbar{overflow-x:auto}.sd-cards-carousel:hover,.sd-cards-carousel:focus{overflow-x:auto}.sd-cards-carousel>.sd-card{flex-shrink:0;scroll-snap-align:start}.sd-cards-carousel>.sd-card:not(:last-child){margin-right:3px}.sd-card-cols-1>.sd-card{width:90%}.sd-card-cols-2>.sd-card{width:45%}.sd-card-cols-3>.sd-card{width:30%}.sd-card-cols-4>.sd-card{width:22.5%}.sd-card-cols-5>.sd-card{width:18%}.sd-card-cols-6>.sd-card{width:15%}.sd-card-cols-7>.sd-card{width:12.8571428571%}.sd-card-cols-8>.sd-card{width:11.25%}.sd-card-cols-9>.sd-card{width:10%}.sd-card-cols-10>.sd-card{width:9%}.sd-card-cols-11>.sd-card{width:8.1818181818%}.sd-card-cols-12>.sd-card{width:7.5%}.sd-container,.sd-container-fluid,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container-xl{margin-left:auto;margin-right:auto;padding-left:var(--sd-gutter-x, 0.75rem);padding-right:var(--sd-gutter-x, 0.75rem);width:100%}@media(min-width: 576px){.sd-container-sm,.sd-container{max-width:540px}}@media(min-width: 768px){.sd-container-md,.sd-container-sm,.sd-container{max-width:720px}}@media(min-width: 992px){.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:960px}}@media(min-width: 1200px){.sd-container-xl,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:1140px}}.sd-row{--sd-gutter-x: 1.5rem;--sd-gutter-y: 0;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-top:calc(var(--sd-gutter-y) * -1);margin-right:calc(var(--sd-gutter-x) * -0.5);margin-left:calc(var(--sd-gutter-x) * -0.5)}.sd-row>*{box-sizing:border-box;flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--sd-gutter-x) * 0.5);padding-left:calc(var(--sd-gutter-x) * 0.5);margin-top:var(--sd-gutter-y)}.sd-col{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-auto>*{flex:0 0 auto;width:auto}.sd-row-cols-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}@media(min-width: 576px){.sd-col-sm{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-sm-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-sm-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-sm-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-sm-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-sm-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-sm-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-sm-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-sm-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-sm-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-sm-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-sm-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-sm-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-sm-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 768px){.sd-col-md{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-md-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-md-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-md-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-md-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-md-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-md-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-md-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-md-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-md-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-md-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-md-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-md-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-md-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 992px){.sd-col-lg{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-lg-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-lg-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-lg-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-lg-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-lg-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-lg-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-lg-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-lg-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-lg-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-lg-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-lg-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-lg-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-lg-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 1200px){.sd-col-xl{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-xl-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-xl-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-xl-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-xl-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-xl-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-xl-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-xl-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-xl-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-xl-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-xl-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-xl-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-xl-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-xl-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}.sd-col-auto{flex:0 0 auto;-ms-flex:0 0 auto;width:auto}.sd-col-1{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}.sd-col-2{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-col-3{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-col-4{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-col-5{flex:0 0 auto;-ms-flex:0 0 auto;width:41.6666666667%}.sd-col-6{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-col-7{flex:0 0 auto;-ms-flex:0 0 auto;width:58.3333333333%}.sd-col-8{flex:0 0 auto;-ms-flex:0 0 auto;width:66.6666666667%}.sd-col-9{flex:0 0 auto;-ms-flex:0 0 auto;width:75%}.sd-col-10{flex:0 0 auto;-ms-flex:0 0 auto;width:83.3333333333%}.sd-col-11{flex:0 0 auto;-ms-flex:0 0 auto;width:91.6666666667%}.sd-col-12{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-g-0,.sd-gy-0{--sd-gutter-y: 0}.sd-g-0,.sd-gx-0{--sd-gutter-x: 0}.sd-g-1,.sd-gy-1{--sd-gutter-y: 0.25rem}.sd-g-1,.sd-gx-1{--sd-gutter-x: 0.25rem}.sd-g-2,.sd-gy-2{--sd-gutter-y: 0.5rem}.sd-g-2,.sd-gx-2{--sd-gutter-x: 0.5rem}.sd-g-3,.sd-gy-3{--sd-gutter-y: 1rem}.sd-g-3,.sd-gx-3{--sd-gutter-x: 1rem}.sd-g-4,.sd-gy-4{--sd-gutter-y: 1.5rem}.sd-g-4,.sd-gx-4{--sd-gutter-x: 1.5rem}.sd-g-5,.sd-gy-5{--sd-gutter-y: 3rem}.sd-g-5,.sd-gx-5{--sd-gutter-x: 3rem}@media(min-width: 576px){.sd-col-sm-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-sm-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-sm-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-sm-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-sm-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-sm-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-sm-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-sm-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-sm-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-sm-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-sm-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-sm-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-sm-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-sm-0,.sd-gy-sm-0{--sd-gutter-y: 0}.sd-g-sm-0,.sd-gx-sm-0{--sd-gutter-x: 0}.sd-g-sm-1,.sd-gy-sm-1{--sd-gutter-y: 0.25rem}.sd-g-sm-1,.sd-gx-sm-1{--sd-gutter-x: 0.25rem}.sd-g-sm-2,.sd-gy-sm-2{--sd-gutter-y: 0.5rem}.sd-g-sm-2,.sd-gx-sm-2{--sd-gutter-x: 0.5rem}.sd-g-sm-3,.sd-gy-sm-3{--sd-gutter-y: 1rem}.sd-g-sm-3,.sd-gx-sm-3{--sd-gutter-x: 1rem}.sd-g-sm-4,.sd-gy-sm-4{--sd-gutter-y: 1.5rem}.sd-g-sm-4,.sd-gx-sm-4{--sd-gutter-x: 1.5rem}.sd-g-sm-5,.sd-gy-sm-5{--sd-gutter-y: 3rem}.sd-g-sm-5,.sd-gx-sm-5{--sd-gutter-x: 3rem}}@media(min-width: 768px){.sd-col-md-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-md-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-md-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-md-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-md-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-md-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-md-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-md-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-md-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-md-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-md-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-md-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-md-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-md-0,.sd-gy-md-0{--sd-gutter-y: 0}.sd-g-md-0,.sd-gx-md-0{--sd-gutter-x: 0}.sd-g-md-1,.sd-gy-md-1{--sd-gutter-y: 0.25rem}.sd-g-md-1,.sd-gx-md-1{--sd-gutter-x: 0.25rem}.sd-g-md-2,.sd-gy-md-2{--sd-gutter-y: 0.5rem}.sd-g-md-2,.sd-gx-md-2{--sd-gutter-x: 0.5rem}.sd-g-md-3,.sd-gy-md-3{--sd-gutter-y: 1rem}.sd-g-md-3,.sd-gx-md-3{--sd-gutter-x: 1rem}.sd-g-md-4,.sd-gy-md-4{--sd-gutter-y: 1.5rem}.sd-g-md-4,.sd-gx-md-4{--sd-gutter-x: 1.5rem}.sd-g-md-5,.sd-gy-md-5{--sd-gutter-y: 3rem}.sd-g-md-5,.sd-gx-md-5{--sd-gutter-x: 3rem}}@media(min-width: 992px){.sd-col-lg-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-lg-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-lg-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-lg-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-lg-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-lg-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-lg-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-lg-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-lg-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-lg-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-lg-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-lg-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-lg-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-lg-0,.sd-gy-lg-0{--sd-gutter-y: 0}.sd-g-lg-0,.sd-gx-lg-0{--sd-gutter-x: 0}.sd-g-lg-1,.sd-gy-lg-1{--sd-gutter-y: 0.25rem}.sd-g-lg-1,.sd-gx-lg-1{--sd-gutter-x: 0.25rem}.sd-g-lg-2,.sd-gy-lg-2{--sd-gutter-y: 0.5rem}.sd-g-lg-2,.sd-gx-lg-2{--sd-gutter-x: 0.5rem}.sd-g-lg-3,.sd-gy-lg-3{--sd-gutter-y: 1rem}.sd-g-lg-3,.sd-gx-lg-3{--sd-gutter-x: 1rem}.sd-g-lg-4,.sd-gy-lg-4{--sd-gutter-y: 1.5rem}.sd-g-lg-4,.sd-gx-lg-4{--sd-gutter-x: 1.5rem}.sd-g-lg-5,.sd-gy-lg-5{--sd-gutter-y: 3rem}.sd-g-lg-5,.sd-gx-lg-5{--sd-gutter-x: 3rem}}@media(min-width: 1200px){.sd-col-xl-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-xl-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-xl-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-xl-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-xl-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-xl-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-xl-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-xl-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-xl-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-xl-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-xl-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-xl-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-xl-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-xl-0,.sd-gy-xl-0{--sd-gutter-y: 0}.sd-g-xl-0,.sd-gx-xl-0{--sd-gutter-x: 0}.sd-g-xl-1,.sd-gy-xl-1{--sd-gutter-y: 0.25rem}.sd-g-xl-1,.sd-gx-xl-1{--sd-gutter-x: 0.25rem}.sd-g-xl-2,.sd-gy-xl-2{--sd-gutter-y: 0.5rem}.sd-g-xl-2,.sd-gx-xl-2{--sd-gutter-x: 0.5rem}.sd-g-xl-3,.sd-gy-xl-3{--sd-gutter-y: 1rem}.sd-g-xl-3,.sd-gx-xl-3{--sd-gutter-x: 1rem}.sd-g-xl-4,.sd-gy-xl-4{--sd-gutter-y: 1.5rem}.sd-g-xl-4,.sd-gx-xl-4{--sd-gutter-x: 1.5rem}.sd-g-xl-5,.sd-gy-xl-5{--sd-gutter-y: 3rem}.sd-g-xl-5,.sd-gx-xl-5{--sd-gutter-x: 3rem}}.sd-flex-row-reverse{flex-direction:row-reverse !important}details.sd-dropdown{position:relative}details.sd-dropdown .sd-summary-title{font-weight:700;padding-right:3em !important;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none;user-select:none}details.sd-dropdown:hover{cursor:pointer}details.sd-dropdown .sd-summary-content{cursor:default}details.sd-dropdown summary{list-style:none;padding:1em}details.sd-dropdown summary .sd-octicon.no-title{vertical-align:middle}details.sd-dropdown[open] summary .sd-octicon.no-title{visibility:hidden}details.sd-dropdown summary::-webkit-details-marker{display:none}details.sd-dropdown summary:focus{outline:none}details.sd-dropdown .sd-summary-icon{margin-right:.5em}details.sd-dropdown .sd-summary-icon svg{opacity:.8}details.sd-dropdown summary:hover .sd-summary-up svg,details.sd-dropdown summary:hover .sd-summary-down svg{opacity:1;transform:scale(1.1)}details.sd-dropdown .sd-summary-up svg,details.sd-dropdown .sd-summary-down svg{display:block;opacity:.6}details.sd-dropdown .sd-summary-up,details.sd-dropdown .sd-summary-down{pointer-events:none;position:absolute;right:1em;top:1em}details.sd-dropdown[open]>.sd-summary-title .sd-summary-down{visibility:hidden}details.sd-dropdown:not([open])>.sd-summary-title .sd-summary-up{visibility:hidden}details.sd-dropdown:not([open]).sd-card{border:none}details.sd-dropdown:not([open])>.sd-card-header{border:1px solid var(--sd-color-card-border);border-radius:.25rem}details.sd-dropdown.sd-fade-in[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out;animation:sd-fade-in .5s ease-in-out}details.sd-dropdown.sd-fade-in-slide-down[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out}.sd-col>.sd-dropdown{width:100%}.sd-summary-content>.sd-tab-set:first-child{margin-top:0}@keyframes sd-fade-in{0%{opacity:0}100%{opacity:1}}@keyframes sd-slide-down{0%{transform:translate(0, -10px)}100%{transform:translate(0, 0)}}.sd-tab-set{border-radius:.125rem;display:flex;flex-wrap:wrap;margin:1em 0;position:relative}.sd-tab-set>input{opacity:0;position:absolute}.sd-tab-set>input:checked+label{border-color:var(--sd-color-tabs-underline-active);color:var(--sd-color-tabs-label-active)}.sd-tab-set>input:checked+label+.sd-tab-content{display:block}.sd-tab-set>input:not(:checked)+label:hover{color:var(--sd-color-tabs-label-hover);border-color:var(--sd-color-tabs-underline-hover)}.sd-tab-set>input:focus+label{outline-style:auto}.sd-tab-set>input:not(.focus-visible)+label{outline:none;-webkit-tap-highlight-color:transparent}.sd-tab-set>label{border-bottom:.125rem solid transparent;margin-bottom:0;color:var(--sd-color-tabs-label-inactive);border-color:var(--sd-color-tabs-underline-inactive);cursor:pointer;font-size:var(--sd-fontsize-tabs-label);font-weight:700;padding:1em 1.25em .5em;transition:color 250ms;width:auto;z-index:1}html .sd-tab-set>label:hover{color:var(--sd-color-tabs-label-active)}.sd-col>.sd-tab-set{width:100%}.sd-tab-content{box-shadow:0 -0.0625rem var(--sd-color-tabs-overline),0 .0625rem var(--sd-color-tabs-underline);display:none;order:99;padding-bottom:.75rem;padding-top:.75rem;width:100%}.sd-tab-content>:first-child{margin-top:0 !important}.sd-tab-content>:last-child{margin-bottom:0 !important}.sd-tab-content>.sd-tab-set{margin:0}.sd-sphinx-override,.sd-sphinx-override *{-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box}.sd-sphinx-override p{margin-top:0}:root{--sd-color-primary: #007bff;--sd-color-secondary: #6c757d;--sd-color-success: #28a745;--sd-color-info: #17a2b8;--sd-color-warning: #f0b37e;--sd-color-danger: #dc3545;--sd-color-light: #f8f9fa;--sd-color-muted: #6c757d;--sd-color-dark: #212529;--sd-color-black: black;--sd-color-white: white;--sd-color-primary-highlight: #0069d9;--sd-color-secondary-highlight: #5c636a;--sd-color-success-highlight: #228e3b;--sd-color-info-highlight: #148a9c;--sd-color-warning-highlight: #cc986b;--sd-color-danger-highlight: #bb2d3b;--sd-color-light-highlight: #d3d4d5;--sd-color-muted-highlight: #5c636a;--sd-color-dark-highlight: #1c1f23;--sd-color-black-highlight: black;--sd-color-white-highlight: #d9d9d9;--sd-color-primary-text: #fff;--sd-color-secondary-text: #fff;--sd-color-success-text: #fff;--sd-color-info-text: #fff;--sd-color-warning-text: #212529;--sd-color-danger-text: #fff;--sd-color-light-text: #212529;--sd-color-muted-text: #fff;--sd-color-dark-text: #fff;--sd-color-black-text: #fff;--sd-color-white-text: #212529;--sd-color-shadow: rgba(0, 0, 0, 0.15);--sd-color-card-border: rgba(0, 0, 0, 0.125);--sd-color-card-border-hover: hsla(231, 99%, 66%, 1);--sd-color-card-background: transparent;--sd-color-card-text: inherit;--sd-color-card-header: transparent;--sd-color-card-footer: transparent;--sd-color-tabs-label-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-hover: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-inactive: hsl(0, 0%, 66%);--sd-color-tabs-underline-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-underline-hover: rgba(178, 206, 245, 0.62);--sd-color-tabs-underline-inactive: transparent;--sd-color-tabs-overline: rgb(222, 222, 222);--sd-color-tabs-underline: rgb(222, 222, 222);--sd-fontsize-tabs-label: 1rem} diff --git a/_static/design-tabs.js b/_static/design-tabs.js new file mode 100644 index 0000000..36b38cf --- /dev/null +++ b/_static/design-tabs.js @@ -0,0 +1,27 @@ +var sd_labels_by_text = {}; + +function ready() { + const li = document.getElementsByClassName("sd-tab-label"); + for (const label of li) { + syncId = label.getAttribute("data-sync-id"); + if (syncId) { + label.onclick = onLabelClick; + if (!sd_labels_by_text[syncId]) { + sd_labels_by_text[syncId] = []; + } + sd_labels_by_text[syncId].push(label); + } + } +} + +function onLabelClick() { + // Activate other inputs with the same sync id. + syncId = this.getAttribute("data-sync-id"); + for (label of sd_labels_by_text[syncId]) { + if (label === this) continue; + label.previousElementSibling.checked = true; + } + window.localStorage.setItem("sphinx-design-last-tab", syncId); +} + +document.addEventListener("DOMContentLoaded", ready, false); diff --git a/_static/doctools.js b/_static/doctools.js new file mode 100644 index 0000000..c3db08d --- /dev/null +++ b/_static/doctools.js @@ -0,0 +1,264 @@ +/* + * doctools.js + * ~~~~~~~~~~~ + * + * Base JavaScript utilities for all Sphinx HTML documentation. + * + * :copyright: Copyright 2007-2022 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ +"use strict"; + +const _ready = (callback) => { + if (document.readyState !== "loading") { + callback(); + } else { + document.addEventListener("DOMContentLoaded", callback); + } +}; + +/** + * highlight a given string on a node by wrapping it in + * span elements with the given class name. + */ +const _highlight = (node, addItems, text, className) => { + if (node.nodeType === Node.TEXT_NODE) { + const val = node.nodeValue; + const parent = node.parentNode; + const pos = val.toLowerCase().indexOf(text); + if ( + pos >= 0 && + !parent.classList.contains(className) && + !parent.classList.contains("nohighlight") + ) { + let span; + + const closestNode = parent.closest("body, svg, foreignObject"); + const isInSVG = closestNode && closestNode.matches("svg"); + if (isInSVG) { + span = document.createElementNS("http://www.w3.org/2000/svg", "tspan"); + } else { + span = document.createElement("span"); + span.classList.add(className); + } + + span.appendChild(document.createTextNode(val.substr(pos, text.length))); + parent.insertBefore( + span, + parent.insertBefore( + document.createTextNode(val.substr(pos + text.length)), + node.nextSibling + ) + ); + node.nodeValue = val.substr(0, pos); + + if (isInSVG) { + const rect = document.createElementNS( + "http://www.w3.org/2000/svg", + "rect" + ); + const bbox = parent.getBBox(); + rect.x.baseVal.value = bbox.x; + rect.y.baseVal.value = bbox.y; + rect.width.baseVal.value = bbox.width; + rect.height.baseVal.value = bbox.height; + rect.setAttribute("class", className); + addItems.push({ parent: parent, target: rect }); + } + } + } else if (node.matches && !node.matches("button, select, textarea")) { + node.childNodes.forEach((el) => _highlight(el, addItems, text, className)); + } +}; +const _highlightText = (thisNode, text, className) => { + let addItems = []; + _highlight(thisNode, addItems, text, className); + addItems.forEach((obj) => + obj.parent.insertAdjacentElement("beforebegin", obj.target) + ); +}; + +/** + * Small JavaScript module for the documentation. + */ +const Documentation = { + init: () => { + Documentation.highlightSearchWords(); + Documentation.initDomainIndexTable(); + Documentation.initOnKeyListeners(); + }, + + /** + * i18n support + */ + TRANSLATIONS: {}, + PLURAL_EXPR: (n) => (n === 1 ? 0 : 1), + LOCALE: "unknown", + + // gettext and ngettext don't access this so that the functions + // can safely bound to a different name (_ = Documentation.gettext) + gettext: (string) => { + const translated = Documentation.TRANSLATIONS[string]; + switch (typeof translated) { + case "undefined": + return string; // no translation + case "string": + return translated; // translation exists + default: + return translated[0]; // (singular, plural) translation tuple exists + } + }, + + ngettext: (singular, plural, n) => { + const translated = Documentation.TRANSLATIONS[singular]; + if (typeof translated !== "undefined") + return translated[Documentation.PLURAL_EXPR(n)]; + return n === 1 ? singular : plural; + }, + + addTranslations: (catalog) => { + Object.assign(Documentation.TRANSLATIONS, catalog.messages); + Documentation.PLURAL_EXPR = new Function( + "n", + `return (${catalog.plural_expr})` + ); + Documentation.LOCALE = catalog.locale; + }, + + /** + * highlight the search words provided in the url in the text + */ + highlightSearchWords: () => { + const highlight = + new URLSearchParams(window.location.search).get("highlight") || ""; + const terms = highlight.toLowerCase().split(/\s+/).filter(x => x); + if (terms.length === 0) return; // nothing to do + + // There should never be more than one element matching "div.body" + const divBody = document.querySelectorAll("div.body"); + const body = divBody.length ? divBody[0] : document.querySelector("body"); + window.setTimeout(() => { + terms.forEach((term) => _highlightText(body, term, "highlighted")); + }, 10); + + const searchBox = document.getElementById("searchbox"); + if (searchBox === null) return; + searchBox.appendChild( + document + .createRange() + .createContextualFragment( + '

' + + '' + + Documentation.gettext("Hide Search Matches") + + "

" + ) + ); + }, + + /** + * helper function to hide the search marks again + */ + hideSearchWords: () => { + document + .querySelectorAll("#searchbox .highlight-link") + .forEach((el) => el.remove()); + document + .querySelectorAll("span.highlighted") + .forEach((el) => el.classList.remove("highlighted")); + const url = new URL(window.location); + url.searchParams.delete("highlight"); + window.history.replaceState({}, "", url); + }, + + /** + * helper function to focus on search bar + */ + focusSearchBar: () => { + document.querySelectorAll("input[name=q]")[0]?.focus(); + }, + + /** + * Initialise the domain index toggle buttons + */ + initDomainIndexTable: () => { + const toggler = (el) => { + const idNumber = el.id.substr(7); + const toggledRows = document.querySelectorAll(`tr.cg-${idNumber}`); + if (el.src.substr(-9) === "minus.png") { + el.src = `${el.src.substr(0, el.src.length - 9)}plus.png`; + toggledRows.forEach((el) => (el.style.display = "none")); + } else { + el.src = `${el.src.substr(0, el.src.length - 8)}minus.png`; + toggledRows.forEach((el) => (el.style.display = "")); + } + }; + + const togglerElements = document.querySelectorAll("img.toggler"); + togglerElements.forEach((el) => + el.addEventListener("click", (event) => toggler(event.currentTarget)) + ); + togglerElements.forEach((el) => (el.style.display = "")); + if (DOCUMENTATION_OPTIONS.COLLAPSE_INDEX) togglerElements.forEach(toggler); + }, + + initOnKeyListeners: () => { + // only install a listener if it is really needed + if ( + !DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS && + !DOCUMENTATION_OPTIONS.ENABLE_SEARCH_SHORTCUTS + ) + return; + + const blacklistedElements = new Set([ + "TEXTAREA", + "INPUT", + "SELECT", + "BUTTON", + ]); + document.addEventListener("keydown", (event) => { + if (blacklistedElements.has(document.activeElement.tagName)) return; // bail for input elements + if (event.altKey || event.ctrlKey || event.metaKey) return; // bail with special keys + + if (!event.shiftKey) { + switch (event.key) { + case "ArrowLeft": + if (!DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS) break; + + const prevLink = document.querySelector('link[rel="prev"]'); + if (prevLink && prevLink.href) { + window.location.href = prevLink.href; + event.preventDefault(); + } + break; + case "ArrowRight": + if (!DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS) break; + + const nextLink = document.querySelector('link[rel="next"]'); + if (nextLink && nextLink.href) { + window.location.href = nextLink.href; + event.preventDefault(); + } + break; + case "Escape": + if (!DOCUMENTATION_OPTIONS.ENABLE_SEARCH_SHORTCUTS) break; + Documentation.hideSearchWords(); + event.preventDefault(); + } + } + + // some keyboard layouts may need Shift to get / + switch (event.key) { + case "/": + if (!DOCUMENTATION_OPTIONS.ENABLE_SEARCH_SHORTCUTS) break; + Documentation.focusSearchBar(); + event.preventDefault(); + } + }); + }, +}; + +// quick alias for translations +const _ = Documentation.gettext; + +_ready(Documentation.init); diff --git a/_static/documentation_options.js b/_static/documentation_options.js new file mode 100644 index 0000000..3063782 --- /dev/null +++ b/_static/documentation_options.js @@ -0,0 +1,14 @@ +var DOCUMENTATION_OPTIONS = { + URL_ROOT: document.getElementById("documentation_options").getAttribute('data-url_root'), + VERSION: '', + LANGUAGE: 'en', + COLLAPSE_INDEX: false, + BUILDER: 'html', + FILE_SUFFIX: '.html', + LINK_SUFFIX: '.html', + HAS_SOURCE: true, + SOURCELINK_SUFFIX: '', + NAVIGATION_WITH_KEYS: true, + SHOW_SEARCH_SUMMARY: true, + ENABLE_SEARCH_SHORTCUTS: false, +}; \ No newline at end of file diff --git a/_static/file.png b/_static/file.png new file mode 100644 index 0000000..a858a41 Binary files /dev/null and b/_static/file.png differ diff --git a/_static/images/logo_binder.svg b/_static/images/logo_binder.svg new file mode 100644 index 0000000..45fecf7 --- /dev/null +++ b/_static/images/logo_binder.svg @@ -0,0 +1,19 @@ + + + + +logo + + + + + + + + diff --git a/_static/images/logo_colab.png b/_static/images/logo_colab.png new file mode 100644 index 0000000..b7560ec Binary files /dev/null and b/_static/images/logo_colab.png differ diff --git a/_static/images/logo_deepnote.svg b/_static/images/logo_deepnote.svg new file mode 100644 index 0000000..fa77ebf --- /dev/null +++ b/_static/images/logo_deepnote.svg @@ -0,0 +1 @@ + diff --git a/_static/images/logo_jupyterhub.svg b/_static/images/logo_jupyterhub.svg new file mode 100644 index 0000000..60cfe9f --- /dev/null +++ b/_static/images/logo_jupyterhub.svg @@ -0,0 +1 @@ +logo_jupyterhubHub diff --git a/_static/jquery-3.6.0.js b/_static/jquery-3.6.0.js new file mode 100644 index 0000000..fc6c299 --- /dev/null +++ b/_static/jquery-3.6.0.js @@ -0,0 +1,10881 @@ +/*! + * jQuery JavaScript Library v3.6.0 + * https://jquery.com/ + * + * Includes Sizzle.js + * https://sizzlejs.com/ + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license + * https://jquery.org/license + * + * Date: 2021-03-02T17:08Z + */ +( function( global, factory ) { + + "use strict"; + + if ( typeof module === "object" && typeof module.exports === "object" ) { + + // For CommonJS and CommonJS-like environments where a proper `window` + // is present, execute the factory and get jQuery. + // For environments that do not have a `window` with a `document` + // (such as Node.js), expose a factory as module.exports. + // This accentuates the need for the creation of a real `window`. + // e.g. var jQuery = require("jquery")(window); + // See ticket #14549 for more info. + module.exports = global.document ? + factory( global, true ) : + function( w ) { + if ( !w.document ) { + throw new Error( "jQuery requires a window with a document" ); + } + return factory( w ); + }; + } else { + factory( global ); + } + +// Pass this if window is not defined yet +} )( typeof window !== "undefined" ? window : this, function( window, noGlobal ) { + +// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1 +// throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode +// arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common +// enough that all such attempts are guarded in a try block. +"use strict"; + +var arr = []; + +var getProto = Object.getPrototypeOf; + +var slice = arr.slice; + +var flat = arr.flat ? function( array ) { + return arr.flat.call( array ); +} : function( array ) { + return arr.concat.apply( [], array ); +}; + + +var push = arr.push; + +var indexOf = arr.indexOf; + +var class2type = {}; + +var toString = class2type.toString; + +var hasOwn = class2type.hasOwnProperty; + +var fnToString = hasOwn.toString; + +var ObjectFunctionString = fnToString.call( Object ); + +var support = {}; + +var isFunction = function isFunction( obj ) { + + // Support: Chrome <=57, Firefox <=52 + // In some browsers, typeof returns "function" for HTML elements + // (i.e., `typeof document.createElement( "object" ) === "function"`). + // We don't want to classify *any* DOM node as a function. + // Support: QtWeb <=3.8.5, WebKit <=534.34, wkhtmltopdf tool <=0.12.5 + // Plus for old WebKit, typeof returns "function" for HTML collections + // (e.g., `typeof document.getElementsByTagName("div") === "function"`). (gh-4756) + return typeof obj === "function" && typeof obj.nodeType !== "number" && + typeof obj.item !== "function"; + }; + + +var isWindow = function isWindow( obj ) { + return obj != null && obj === obj.window; + }; + + +var document = window.document; + + + + var preservedScriptAttributes = { + type: true, + src: true, + nonce: true, + noModule: true + }; + + function DOMEval( code, node, doc ) { + doc = doc || document; + + var i, val, + script = doc.createElement( "script" ); + + script.text = code; + if ( node ) { + for ( i in preservedScriptAttributes ) { + + // Support: Firefox 64+, Edge 18+ + // Some browsers don't support the "nonce" property on scripts. + // On the other hand, just using `getAttribute` is not enough as + // the `nonce` attribute is reset to an empty string whenever it + // becomes browsing-context connected. + // See https://github.com/whatwg/html/issues/2369 + // See https://html.spec.whatwg.org/#nonce-attributes + // The `node.getAttribute` check was added for the sake of + // `jQuery.globalEval` so that it can fake a nonce-containing node + // via an object. + val = node[ i ] || node.getAttribute && node.getAttribute( i ); + if ( val ) { + script.setAttribute( i, val ); + } + } + } + doc.head.appendChild( script ).parentNode.removeChild( script ); + } + + +function toType( obj ) { + if ( obj == null ) { + return obj + ""; + } + + // Support: Android <=2.3 only (functionish RegExp) + return typeof obj === "object" || typeof obj === "function" ? + class2type[ toString.call( obj ) ] || "object" : + typeof obj; +} +/* global Symbol */ +// Defining this global in .eslintrc.json would create a danger of using the global +// unguarded in another place, it seems safer to define global only for this module + + + +var + version = "3.6.0", + + // Define a local copy of jQuery + jQuery = function( selector, context ) { + + // The jQuery object is actually just the init constructor 'enhanced' + // Need init if jQuery is called (just allow error to be thrown if not included) + return new jQuery.fn.init( selector, context ); + }; + +jQuery.fn = jQuery.prototype = { + + // The current version of jQuery being used + jquery: version, + + constructor: jQuery, + + // The default length of a jQuery object is 0 + length: 0, + + toArray: function() { + return slice.call( this ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + + // Return all the elements in a clean array + if ( num == null ) { + return slice.call( this ); + } + + // Return just the one element from the set + return num < 0 ? this[ num + this.length ] : this[ num ]; + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems ) { + + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + each: function( callback ) { + return jQuery.each( this, callback ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map( this, function( elem, i ) { + return callback.call( elem, i, elem ); + } ) ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ) ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + even: function() { + return this.pushStack( jQuery.grep( this, function( _elem, i ) { + return ( i + 1 ) % 2; + } ) ); + }, + + odd: function() { + return this.pushStack( jQuery.grep( this, function( _elem, i ) { + return i % 2; + } ) ); + }, + + eq: function( i ) { + var len = this.length, + j = +i + ( i < 0 ? len : 0 ); + return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] ); + }, + + end: function() { + return this.prevObject || this.constructor(); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: arr.sort, + splice: arr.splice +}; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[ 0 ] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + + // Skip the boolean and the target + target = arguments[ i ] || {}; + i++; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !isFunction( target ) ) { + target = {}; + } + + // Extend jQuery itself if only one argument is passed + if ( i === length ) { + target = this; + i--; + } + + for ( ; i < length; i++ ) { + + // Only deal with non-null/undefined values + if ( ( options = arguments[ i ] ) != null ) { + + // Extend the base object + for ( name in options ) { + copy = options[ name ]; + + // Prevent Object.prototype pollution + // Prevent never-ending loop + if ( name === "__proto__" || target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject( copy ) || + ( copyIsArray = Array.isArray( copy ) ) ) ) { + src = target[ name ]; + + // Ensure proper type for the source value + if ( copyIsArray && !Array.isArray( src ) ) { + clone = []; + } else if ( !copyIsArray && !jQuery.isPlainObject( src ) ) { + clone = {}; + } else { + clone = src; + } + copyIsArray = false; + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend( { + + // Unique for each copy of jQuery on the page + expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ), + + // Assume jQuery is ready without the ready module + isReady: true, + + error: function( msg ) { + throw new Error( msg ); + }, + + noop: function() {}, + + isPlainObject: function( obj ) { + var proto, Ctor; + + // Detect obvious negatives + // Use toString instead of jQuery.type to catch host objects + if ( !obj || toString.call( obj ) !== "[object Object]" ) { + return false; + } + + proto = getProto( obj ); + + // Objects with no prototype (e.g., `Object.create( null )`) are plain + if ( !proto ) { + return true; + } + + // Objects with prototype are plain iff they were constructed by a global Object function + Ctor = hasOwn.call( proto, "constructor" ) && proto.constructor; + return typeof Ctor === "function" && fnToString.call( Ctor ) === ObjectFunctionString; + }, + + isEmptyObject: function( obj ) { + var name; + + for ( name in obj ) { + return false; + } + return true; + }, + + // Evaluates a script in a provided context; falls back to the global one + // if not specified. + globalEval: function( code, options, doc ) { + DOMEval( code, { nonce: options && options.nonce }, doc ); + }, + + each: function( obj, callback ) { + var length, i = 0; + + if ( isArrayLike( obj ) ) { + length = obj.length; + for ( ; i < length; i++ ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } else { + for ( i in obj ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } + + return obj; + }, + + // results is for internal usage only + makeArray: function( arr, results ) { + var ret = results || []; + + if ( arr != null ) { + if ( isArrayLike( Object( arr ) ) ) { + jQuery.merge( ret, + typeof arr === "string" ? + [ arr ] : arr + ); + } else { + push.call( ret, arr ); + } + } + + return ret; + }, + + inArray: function( elem, arr, i ) { + return arr == null ? -1 : indexOf.call( arr, elem, i ); + }, + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + merge: function( first, second ) { + var len = +second.length, + j = 0, + i = first.length; + + for ( ; j < len; j++ ) { + first[ i++ ] = second[ j ]; + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, invert ) { + var callbackInverse, + matches = [], + i = 0, + length = elems.length, + callbackExpect = !invert; + + // Go through the array, only saving the items + // that pass the validator function + for ( ; i < length; i++ ) { + callbackInverse = !callback( elems[ i ], i ); + if ( callbackInverse !== callbackExpect ) { + matches.push( elems[ i ] ); + } + } + + return matches; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var length, value, + i = 0, + ret = []; + + // Go through the array, translating each of the items to their new values + if ( isArrayLike( elems ) ) { + length = elems.length; + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + + // Go through every key on the object, + } else { + for ( i in elems ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + } + + // Flatten any nested arrays + return flat( ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // jQuery.support is not used in Core but other projects attach their + // properties to it so it needs to exist. + support: support +} ); + +if ( typeof Symbol === "function" ) { + jQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ]; +} + +// Populate the class2type map +jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ), + function( _i, name ) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); + } ); + +function isArrayLike( obj ) { + + // Support: real iOS 8.2 only (not reproducible in simulator) + // `in` check used to prevent JIT error (gh-2145) + // hasOwn isn't used here due to false negatives + // regarding Nodelist length in IE + var length = !!obj && "length" in obj && obj.length, + type = toType( obj ); + + if ( isFunction( obj ) || isWindow( obj ) ) { + return false; + } + + return type === "array" || length === 0 || + typeof length === "number" && length > 0 && ( length - 1 ) in obj; +} +var Sizzle = +/*! + * Sizzle CSS Selector Engine v2.3.6 + * https://sizzlejs.com/ + * + * Copyright JS Foundation and other contributors + * Released under the MIT license + * https://js.foundation/ + * + * Date: 2021-02-16 + */ +( function( window ) { +var i, + support, + Expr, + getText, + isXML, + tokenize, + compile, + select, + outermostContext, + sortInput, + hasDuplicate, + + // Local document vars + setDocument, + document, + docElem, + documentIsHTML, + rbuggyQSA, + rbuggyMatches, + matches, + contains, + + // Instance-specific data + expando = "sizzle" + 1 * new Date(), + preferredDoc = window.document, + dirruns = 0, + done = 0, + classCache = createCache(), + tokenCache = createCache(), + compilerCache = createCache(), + nonnativeSelectorCache = createCache(), + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + } + return 0; + }, + + // Instance methods + hasOwn = ( {} ).hasOwnProperty, + arr = [], + pop = arr.pop, + pushNative = arr.push, + push = arr.push, + slice = arr.slice, + + // Use a stripped-down indexOf as it's faster than native + // https://jsperf.com/thor-indexof-vs-for/5 + indexOf = function( list, elem ) { + var i = 0, + len = list.length; + for ( ; i < len; i++ ) { + if ( list[ i ] === elem ) { + return i; + } + } + return -1; + }, + + booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|" + + "ismap|loop|multiple|open|readonly|required|scoped", + + // Regular expressions + + // http://www.w3.org/TR/css3-selectors/#whitespace + whitespace = "[\\x20\\t\\r\\n\\f]", + + // https://www.w3.org/TR/css-syntax-3/#ident-token-diagram + identifier = "(?:\\\\[\\da-fA-F]{1,6}" + whitespace + + "?|\\\\[^\\r\\n\\f]|[\\w-]|[^\0-\\x7f])+", + + // Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors + attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace + + + // Operator (capture 2) + "*([*^$|!~]?=)" + whitespace + + + // "Attribute values must be CSS identifiers [capture 5] + // or strings [capture 3 or capture 4]" + "*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" + + whitespace + "*\\]", + + pseudos = ":(" + identifier + ")(?:\\((" + + + // To reduce the number of selectors needing tokenize in the preFilter, prefer arguments: + // 1. quoted (capture 3; capture 4 or capture 5) + "('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" + + + // 2. simple (capture 6) + "((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" + + + // 3. anything else (capture 2) + ".*" + + ")\\)|)", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rwhitespace = new RegExp( whitespace + "+", "g" ), + rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + + whitespace + "+$", "g" ), + + rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ), + rcombinators = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + + "*" ), + rdescend = new RegExp( whitespace + "|>" ), + + rpseudo = new RegExp( pseudos ), + ridentifier = new RegExp( "^" + identifier + "$" ), + + matchExpr = { + "ID": new RegExp( "^#(" + identifier + ")" ), + "CLASS": new RegExp( "^\\.(" + identifier + ")" ), + "TAG": new RegExp( "^(" + identifier + "|[*])" ), + "ATTR": new RegExp( "^" + attributes ), + "PSEUDO": new RegExp( "^" + pseudos ), + "CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + + whitespace + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + + whitespace + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ), + "bool": new RegExp( "^(?:" + booleans + ")$", "i" ), + + // For use in libraries implementing .is() + // We use this for POS matching in `select` + "needsContext": new RegExp( "^" + whitespace + + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + whitespace + + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" ) + }, + + rhtml = /HTML$/i, + rinputs = /^(?:input|select|textarea|button)$/i, + rheader = /^h\d$/i, + + rnative = /^[^{]+\{\s*\[native \w/, + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, + + rsibling = /[+~]/, + + // CSS escapes + // http://www.w3.org/TR/CSS21/syndata.html#escaped-characters + runescape = new RegExp( "\\\\[\\da-fA-F]{1,6}" + whitespace + "?|\\\\([^\\r\\n\\f])", "g" ), + funescape = function( escape, nonHex ) { + var high = "0x" + escape.slice( 1 ) - 0x10000; + + return nonHex ? + + // Strip the backslash prefix from a non-hex escape sequence + nonHex : + + // Replace a hexadecimal escape sequence with the encoded Unicode code point + // Support: IE <=11+ + // For values outside the Basic Multilingual Plane (BMP), manually construct a + // surrogate pair + high < 0 ? + String.fromCharCode( high + 0x10000 ) : + String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 ); + }, + + // CSS string/identifier serialization + // https://drafts.csswg.org/cssom/#common-serializing-idioms + rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g, + fcssescape = function( ch, asCodePoint ) { + if ( asCodePoint ) { + + // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER + if ( ch === "\0" ) { + return "\uFFFD"; + } + + // Control characters and (dependent upon position) numbers get escaped as code points + return ch.slice( 0, -1 ) + "\\" + + ch.charCodeAt( ch.length - 1 ).toString( 16 ) + " "; + } + + // Other potentially-special ASCII characters get backslash-escaped + return "\\" + ch; + }, + + // Used for iframes + // See setDocument() + // Removing the function wrapper causes a "Permission Denied" + // error in IE + unloadHandler = function() { + setDocument(); + }, + + inDisabledFieldset = addCombinator( + function( elem ) { + return elem.disabled === true && elem.nodeName.toLowerCase() === "fieldset"; + }, + { dir: "parentNode", next: "legend" } + ); + +// Optimize for push.apply( _, NodeList ) +try { + push.apply( + ( arr = slice.call( preferredDoc.childNodes ) ), + preferredDoc.childNodes + ); + + // Support: Android<4.0 + // Detect silently failing push.apply + // eslint-disable-next-line no-unused-expressions + arr[ preferredDoc.childNodes.length ].nodeType; +} catch ( e ) { + push = { apply: arr.length ? + + // Leverage slice if possible + function( target, els ) { + pushNative.apply( target, slice.call( els ) ); + } : + + // Support: IE<9 + // Otherwise append directly + function( target, els ) { + var j = target.length, + i = 0; + + // Can't trust NodeList.length + while ( ( target[ j++ ] = els[ i++ ] ) ) {} + target.length = j - 1; + } + }; +} + +function Sizzle( selector, context, results, seed ) { + var m, i, elem, nid, match, groups, newSelector, + newContext = context && context.ownerDocument, + + // nodeType defaults to 9, since context defaults to document + nodeType = context ? context.nodeType : 9; + + results = results || []; + + // Return early from calls with invalid selector or context + if ( typeof selector !== "string" || !selector || + nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) { + + return results; + } + + // Try to shortcut find operations (as opposed to filters) in HTML documents + if ( !seed ) { + setDocument( context ); + context = context || document; + + if ( documentIsHTML ) { + + // If the selector is sufficiently simple, try using a "get*By*" DOM method + // (excepting DocumentFragment context, where the methods don't exist) + if ( nodeType !== 11 && ( match = rquickExpr.exec( selector ) ) ) { + + // ID selector + if ( ( m = match[ 1 ] ) ) { + + // Document context + if ( nodeType === 9 ) { + if ( ( elem = context.getElementById( m ) ) ) { + + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if ( elem.id === m ) { + results.push( elem ); + return results; + } + } else { + return results; + } + + // Element context + } else { + + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if ( newContext && ( elem = newContext.getElementById( m ) ) && + contains( context, elem ) && + elem.id === m ) { + + results.push( elem ); + return results; + } + } + + // Type selector + } else if ( match[ 2 ] ) { + push.apply( results, context.getElementsByTagName( selector ) ); + return results; + + // Class selector + } else if ( ( m = match[ 3 ] ) && support.getElementsByClassName && + context.getElementsByClassName ) { + + push.apply( results, context.getElementsByClassName( m ) ); + return results; + } + } + + // Take advantage of querySelectorAll + if ( support.qsa && + !nonnativeSelectorCache[ selector + " " ] && + ( !rbuggyQSA || !rbuggyQSA.test( selector ) ) && + + // Support: IE 8 only + // Exclude object elements + ( nodeType !== 1 || context.nodeName.toLowerCase() !== "object" ) ) { + + newSelector = selector; + newContext = context; + + // qSA considers elements outside a scoping root when evaluating child or + // descendant combinators, which is not what we want. + // In such cases, we work around the behavior by prefixing every selector in the + // list with an ID selector referencing the scope context. + // The technique has to be used as well when a leading combinator is used + // as such selectors are not recognized by querySelectorAll. + // Thanks to Andrew Dupont for this technique. + if ( nodeType === 1 && + ( rdescend.test( selector ) || rcombinators.test( selector ) ) ) { + + // Expand context for sibling selectors + newContext = rsibling.test( selector ) && testContext( context.parentNode ) || + context; + + // We can use :scope instead of the ID hack if the browser + // supports it & if we're not changing the context. + if ( newContext !== context || !support.scope ) { + + // Capture the context ID, setting it first if necessary + if ( ( nid = context.getAttribute( "id" ) ) ) { + nid = nid.replace( rcssescape, fcssescape ); + } else { + context.setAttribute( "id", ( nid = expando ) ); + } + } + + // Prefix every selector in the list + groups = tokenize( selector ); + i = groups.length; + while ( i-- ) { + groups[ i ] = ( nid ? "#" + nid : ":scope" ) + " " + + toSelector( groups[ i ] ); + } + newSelector = groups.join( "," ); + } + + try { + push.apply( results, + newContext.querySelectorAll( newSelector ) + ); + return results; + } catch ( qsaError ) { + nonnativeSelectorCache( selector, true ); + } finally { + if ( nid === expando ) { + context.removeAttribute( "id" ); + } + } + } + } + } + + // All others + return select( selector.replace( rtrim, "$1" ), context, results, seed ); +} + +/** + * Create key-value caches of limited size + * @returns {function(string, object)} Returns the Object data after storing it on itself with + * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength) + * deleting the oldest entry + */ +function createCache() { + var keys = []; + + function cache( key, value ) { + + // Use (key + " ") to avoid collision with native prototype properties (see Issue #157) + if ( keys.push( key + " " ) > Expr.cacheLength ) { + + // Only keep the most recent entries + delete cache[ keys.shift() ]; + } + return ( cache[ key + " " ] = value ); + } + return cache; +} + +/** + * Mark a function for special use by Sizzle + * @param {Function} fn The function to mark + */ +function markFunction( fn ) { + fn[ expando ] = true; + return fn; +} + +/** + * Support testing using an element + * @param {Function} fn Passed the created element and returns a boolean result + */ +function assert( fn ) { + var el = document.createElement( "fieldset" ); + + try { + return !!fn( el ); + } catch ( e ) { + return false; + } finally { + + // Remove from its parent by default + if ( el.parentNode ) { + el.parentNode.removeChild( el ); + } + + // release memory in IE + el = null; + } +} + +/** + * Adds the same handler for all of the specified attrs + * @param {String} attrs Pipe-separated list of attributes + * @param {Function} handler The method that will be applied + */ +function addHandle( attrs, handler ) { + var arr = attrs.split( "|" ), + i = arr.length; + + while ( i-- ) { + Expr.attrHandle[ arr[ i ] ] = handler; + } +} + +/** + * Checks document order of two siblings + * @param {Element} a + * @param {Element} b + * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b + */ +function siblingCheck( a, b ) { + var cur = b && a, + diff = cur && a.nodeType === 1 && b.nodeType === 1 && + a.sourceIndex - b.sourceIndex; + + // Use IE sourceIndex if available on both nodes + if ( diff ) { + return diff; + } + + // Check if b follows a + if ( cur ) { + while ( ( cur = cur.nextSibling ) ) { + if ( cur === b ) { + return -1; + } + } + } + + return a ? 1 : -1; +} + +/** + * Returns a function to use in pseudos for input types + * @param {String} type + */ +function createInputPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for buttons + * @param {String} type + */ +function createButtonPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return ( name === "input" || name === "button" ) && elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for :enabled/:disabled + * @param {Boolean} disabled true for :disabled; false for :enabled + */ +function createDisabledPseudo( disabled ) { + + // Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable + return function( elem ) { + + // Only certain elements can match :enabled or :disabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled + if ( "form" in elem ) { + + // Check for inherited disabledness on relevant non-disabled elements: + // * listed form-associated elements in a disabled fieldset + // https://html.spec.whatwg.org/multipage/forms.html#category-listed + // https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled + // * option elements in a disabled optgroup + // https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled + // All such elements have a "form" property. + if ( elem.parentNode && elem.disabled === false ) { + + // Option elements defer to a parent optgroup if present + if ( "label" in elem ) { + if ( "label" in elem.parentNode ) { + return elem.parentNode.disabled === disabled; + } else { + return elem.disabled === disabled; + } + } + + // Support: IE 6 - 11 + // Use the isDisabled shortcut property to check for disabled fieldset ancestors + return elem.isDisabled === disabled || + + // Where there is no isDisabled, check manually + /* jshint -W018 */ + elem.isDisabled !== !disabled && + inDisabledFieldset( elem ) === disabled; + } + + return elem.disabled === disabled; + + // Try to winnow out elements that can't be disabled before trusting the disabled property. + // Some victims get caught in our net (label, legend, menu, track), but it shouldn't + // even exist on them, let alone have a boolean value. + } else if ( "label" in elem ) { + return elem.disabled === disabled; + } + + // Remaining elements are neither :enabled nor :disabled + return false; + }; +} + +/** + * Returns a function to use in pseudos for positionals + * @param {Function} fn + */ +function createPositionalPseudo( fn ) { + return markFunction( function( argument ) { + argument = +argument; + return markFunction( function( seed, matches ) { + var j, + matchIndexes = fn( [], seed.length, argument ), + i = matchIndexes.length; + + // Match elements found at the specified indexes + while ( i-- ) { + if ( seed[ ( j = matchIndexes[ i ] ) ] ) { + seed[ j ] = !( matches[ j ] = seed[ j ] ); + } + } + } ); + } ); +} + +/** + * Checks a node for validity as a Sizzle context + * @param {Element|Object=} context + * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value + */ +function testContext( context ) { + return context && typeof context.getElementsByTagName !== "undefined" && context; +} + +// Expose support vars for convenience +support = Sizzle.support = {}; + +/** + * Detects XML nodes + * @param {Element|Object} elem An element or a document + * @returns {Boolean} True iff elem is a non-HTML XML node + */ +isXML = Sizzle.isXML = function( elem ) { + var namespace = elem && elem.namespaceURI, + docElem = elem && ( elem.ownerDocument || elem ).documentElement; + + // Support: IE <=8 + // Assume HTML when documentElement doesn't yet exist, such as inside loading iframes + // https://bugs.jquery.com/ticket/4833 + return !rhtml.test( namespace || docElem && docElem.nodeName || "HTML" ); +}; + +/** + * Sets document-related variables once based on the current document + * @param {Element|Object} [doc] An element or document object to use to set the document + * @returns {Object} Returns the current document + */ +setDocument = Sizzle.setDocument = function( node ) { + var hasCompare, subWindow, + doc = node ? node.ownerDocument || node : preferredDoc; + + // Return early if doc is invalid or already selected + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( doc == document || doc.nodeType !== 9 || !doc.documentElement ) { + return document; + } + + // Update global variables + document = doc; + docElem = document.documentElement; + documentIsHTML = !isXML( document ); + + // Support: IE 9 - 11+, Edge 12 - 18+ + // Accessing iframe documents after unload throws "permission denied" errors (jQuery #13936) + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( preferredDoc != document && + ( subWindow = document.defaultView ) && subWindow.top !== subWindow ) { + + // Support: IE 11, Edge + if ( subWindow.addEventListener ) { + subWindow.addEventListener( "unload", unloadHandler, false ); + + // Support: IE 9 - 10 only + } else if ( subWindow.attachEvent ) { + subWindow.attachEvent( "onunload", unloadHandler ); + } + } + + // Support: IE 8 - 11+, Edge 12 - 18+, Chrome <=16 - 25 only, Firefox <=3.6 - 31 only, + // Safari 4 - 5 only, Opera <=11.6 - 12.x only + // IE/Edge & older browsers don't support the :scope pseudo-class. + // Support: Safari 6.0 only + // Safari 6.0 supports :scope but it's an alias of :root there. + support.scope = assert( function( el ) { + docElem.appendChild( el ).appendChild( document.createElement( "div" ) ); + return typeof el.querySelectorAll !== "undefined" && + !el.querySelectorAll( ":scope fieldset div" ).length; + } ); + + /* Attributes + ---------------------------------------------------------------------- */ + + // Support: IE<8 + // Verify that getAttribute really returns attributes and not properties + // (excepting IE8 booleans) + support.attributes = assert( function( el ) { + el.className = "i"; + return !el.getAttribute( "className" ); + } ); + + /* getElement(s)By* + ---------------------------------------------------------------------- */ + + // Check if getElementsByTagName("*") returns only elements + support.getElementsByTagName = assert( function( el ) { + el.appendChild( document.createComment( "" ) ); + return !el.getElementsByTagName( "*" ).length; + } ); + + // Support: IE<9 + support.getElementsByClassName = rnative.test( document.getElementsByClassName ); + + // Support: IE<10 + // Check if getElementById returns elements by name + // The broken getElementById methods don't pick up programmatically-set names, + // so use a roundabout getElementsByName test + support.getById = assert( function( el ) { + docElem.appendChild( el ).id = expando; + return !document.getElementsByName || !document.getElementsByName( expando ).length; + } ); + + // ID filter and find + if ( support.getById ) { + Expr.filter[ "ID" ] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + return elem.getAttribute( "id" ) === attrId; + }; + }; + Expr.find[ "ID" ] = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var elem = context.getElementById( id ); + return elem ? [ elem ] : []; + } + }; + } else { + Expr.filter[ "ID" ] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + var node = typeof elem.getAttributeNode !== "undefined" && + elem.getAttributeNode( "id" ); + return node && node.value === attrId; + }; + }; + + // Support: IE 6 - 7 only + // getElementById is not reliable as a find shortcut + Expr.find[ "ID" ] = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var node, i, elems, + elem = context.getElementById( id ); + + if ( elem ) { + + // Verify the id attribute + node = elem.getAttributeNode( "id" ); + if ( node && node.value === id ) { + return [ elem ]; + } + + // Fall back on getElementsByName + elems = context.getElementsByName( id ); + i = 0; + while ( ( elem = elems[ i++ ] ) ) { + node = elem.getAttributeNode( "id" ); + if ( node && node.value === id ) { + return [ elem ]; + } + } + } + + return []; + } + }; + } + + // Tag + Expr.find[ "TAG" ] = support.getElementsByTagName ? + function( tag, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( tag ); + + // DocumentFragment nodes don't have gEBTN + } else if ( support.qsa ) { + return context.querySelectorAll( tag ); + } + } : + + function( tag, context ) { + var elem, + tmp = [], + i = 0, + + // By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too + results = context.getElementsByTagName( tag ); + + // Filter out possible comments + if ( tag === "*" ) { + while ( ( elem = results[ i++ ] ) ) { + if ( elem.nodeType === 1 ) { + tmp.push( elem ); + } + } + + return tmp; + } + return results; + }; + + // Class + Expr.find[ "CLASS" ] = support.getElementsByClassName && function( className, context ) { + if ( typeof context.getElementsByClassName !== "undefined" && documentIsHTML ) { + return context.getElementsByClassName( className ); + } + }; + + /* QSA/matchesSelector + ---------------------------------------------------------------------- */ + + // QSA and matchesSelector support + + // matchesSelector(:active) reports false when true (IE9/Opera 11.5) + rbuggyMatches = []; + + // qSa(:focus) reports false when true (Chrome 21) + // We allow this because of a bug in IE8/9 that throws an error + // whenever `document.activeElement` is accessed on an iframe + // So, we allow :focus to pass through QSA all the time to avoid the IE error + // See https://bugs.jquery.com/ticket/13378 + rbuggyQSA = []; + + if ( ( support.qsa = rnative.test( document.querySelectorAll ) ) ) { + + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert( function( el ) { + + var input; + + // Select is set to empty string on purpose + // This is to test IE's treatment of not explicitly + // setting a boolean content attribute, + // since its presence should be enough + // https://bugs.jquery.com/ticket/12359 + docElem.appendChild( el ).innerHTML = "" + + ""; + + // Support: IE8, Opera 11-12.16 + // Nothing should be selected when empty strings follow ^= or $= or *= + // The test attribute must be unknown in Opera but "safe" for WinRT + // https://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section + if ( el.querySelectorAll( "[msallowcapture^='']" ).length ) { + rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:''|\"\")" ); + } + + // Support: IE8 + // Boolean attributes and "value" are not treated correctly + if ( !el.querySelectorAll( "[selected]" ).length ) { + rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" ); + } + + // Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+ + if ( !el.querySelectorAll( "[id~=" + expando + "-]" ).length ) { + rbuggyQSA.push( "~=" ); + } + + // Support: IE 11+, Edge 15 - 18+ + // IE 11/Edge don't find elements on a `[name='']` query in some cases. + // Adding a temporary attribute to the document before the selection works + // around the issue. + // Interestingly, IE 10 & older don't seem to have the issue. + input = document.createElement( "input" ); + input.setAttribute( "name", "" ); + el.appendChild( input ); + if ( !el.querySelectorAll( "[name='']" ).length ) { + rbuggyQSA.push( "\\[" + whitespace + "*name" + whitespace + "*=" + + whitespace + "*(?:''|\"\")" ); + } + + // Webkit/Opera - :checked should return selected option elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + // IE8 throws error here and will not see later tests + if ( !el.querySelectorAll( ":checked" ).length ) { + rbuggyQSA.push( ":checked" ); + } + + // Support: Safari 8+, iOS 8+ + // https://bugs.webkit.org/show_bug.cgi?id=136851 + // In-page `selector#id sibling-combinator selector` fails + if ( !el.querySelectorAll( "a#" + expando + "+*" ).length ) { + rbuggyQSA.push( ".#.+[+~]" ); + } + + // Support: Firefox <=3.6 - 5 only + // Old Firefox doesn't throw on a badly-escaped identifier. + el.querySelectorAll( "\\\f" ); + rbuggyQSA.push( "[\\r\\n\\f]" ); + } ); + + assert( function( el ) { + el.innerHTML = "" + + ""; + + // Support: Windows 8 Native Apps + // The type and name attributes are restricted during .innerHTML assignment + var input = document.createElement( "input" ); + input.setAttribute( "type", "hidden" ); + el.appendChild( input ).setAttribute( "name", "D" ); + + // Support: IE8 + // Enforce case-sensitivity of name attribute + if ( el.querySelectorAll( "[name=d]" ).length ) { + rbuggyQSA.push( "name" + whitespace + "*[*^$|!~]?=" ); + } + + // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled) + // IE8 throws error here and will not see later tests + if ( el.querySelectorAll( ":enabled" ).length !== 2 ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Support: IE9-11+ + // IE's :disabled selector does not pick up the children of disabled fieldsets + docElem.appendChild( el ).disabled = true; + if ( el.querySelectorAll( ":disabled" ).length !== 2 ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Support: Opera 10 - 11 only + // Opera 10-11 does not throw on post-comma invalid pseudos + el.querySelectorAll( "*,:x" ); + rbuggyQSA.push( ",.*:" ); + } ); + } + + if ( ( support.matchesSelector = rnative.test( ( matches = docElem.matches || + docElem.webkitMatchesSelector || + docElem.mozMatchesSelector || + docElem.oMatchesSelector || + docElem.msMatchesSelector ) ) ) ) { + + assert( function( el ) { + + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9) + support.disconnectedMatch = matches.call( el, "*" ); + + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( el, "[s!='']:x" ); + rbuggyMatches.push( "!=", pseudos ); + } ); + } + + rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join( "|" ) ); + rbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join( "|" ) ); + + /* Contains + ---------------------------------------------------------------------- */ + hasCompare = rnative.test( docElem.compareDocumentPosition ); + + // Element contains another + // Purposefully self-exclusive + // As in, an element does not contain itself + contains = hasCompare || rnative.test( docElem.contains ) ? + function( a, b ) { + var adown = a.nodeType === 9 ? a.documentElement : a, + bup = b && b.parentNode; + return a === bup || !!( bup && bup.nodeType === 1 && ( + adown.contains ? + adown.contains( bup ) : + a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16 + ) ); + } : + function( a, b ) { + if ( b ) { + while ( ( b = b.parentNode ) ) { + if ( b === a ) { + return true; + } + } + } + return false; + }; + + /* Sorting + ---------------------------------------------------------------------- */ + + // Document order sorting + sortOrder = hasCompare ? + function( a, b ) { + + // Flag for duplicate removal + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + // Sort on method existence if only one input has compareDocumentPosition + var compare = !a.compareDocumentPosition - !b.compareDocumentPosition; + if ( compare ) { + return compare; + } + + // Calculate position if both inputs belong to the same document + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + compare = ( a.ownerDocument || a ) == ( b.ownerDocument || b ) ? + a.compareDocumentPosition( b ) : + + // Otherwise we know they are disconnected + 1; + + // Disconnected nodes + if ( compare & 1 || + ( !support.sortDetached && b.compareDocumentPosition( a ) === compare ) ) { + + // Choose the first element that is related to our preferred document + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( a == document || a.ownerDocument == preferredDoc && + contains( preferredDoc, a ) ) { + return -1; + } + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( b == document || b.ownerDocument == preferredDoc && + contains( preferredDoc, b ) ) { + return 1; + } + + // Maintain original order + return sortInput ? + ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) : + 0; + } + + return compare & 4 ? -1 : 1; + } : + function( a, b ) { + + // Exit early if the nodes are identical + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + var cur, + i = 0, + aup = a.parentNode, + bup = b.parentNode, + ap = [ a ], + bp = [ b ]; + + // Parentless nodes are either documents or disconnected + if ( !aup || !bup ) { + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + /* eslint-disable eqeqeq */ + return a == document ? -1 : + b == document ? 1 : + /* eslint-enable eqeqeq */ + aup ? -1 : + bup ? 1 : + sortInput ? + ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) : + 0; + + // If the nodes are siblings, we can do a quick check + } else if ( aup === bup ) { + return siblingCheck( a, b ); + } + + // Otherwise we need full lists of their ancestors for comparison + cur = a; + while ( ( cur = cur.parentNode ) ) { + ap.unshift( cur ); + } + cur = b; + while ( ( cur = cur.parentNode ) ) { + bp.unshift( cur ); + } + + // Walk down the tree looking for a discrepancy + while ( ap[ i ] === bp[ i ] ) { + i++; + } + + return i ? + + // Do a sibling check if the nodes have a common ancestor + siblingCheck( ap[ i ], bp[ i ] ) : + + // Otherwise nodes in our document sort first + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + /* eslint-disable eqeqeq */ + ap[ i ] == preferredDoc ? -1 : + bp[ i ] == preferredDoc ? 1 : + /* eslint-enable eqeqeq */ + 0; + }; + + return document; +}; + +Sizzle.matches = function( expr, elements ) { + return Sizzle( expr, null, null, elements ); +}; + +Sizzle.matchesSelector = function( elem, expr ) { + setDocument( elem ); + + if ( support.matchesSelector && documentIsHTML && + !nonnativeSelectorCache[ expr + " " ] && + ( !rbuggyMatches || !rbuggyMatches.test( expr ) ) && + ( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) { + + try { + var ret = matches.call( elem, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || support.disconnectedMatch || + + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11 ) { + return ret; + } + } catch ( e ) { + nonnativeSelectorCache( expr, true ); + } + } + + return Sizzle( expr, document, null, [ elem ] ).length > 0; +}; + +Sizzle.contains = function( context, elem ) { + + // Set document vars if needed + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( ( context.ownerDocument || context ) != document ) { + setDocument( context ); + } + return contains( context, elem ); +}; + +Sizzle.attr = function( elem, name ) { + + // Set document vars if needed + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( ( elem.ownerDocument || elem ) != document ) { + setDocument( elem ); + } + + var fn = Expr.attrHandle[ name.toLowerCase() ], + + // Don't get fooled by Object.prototype properties (jQuery #13807) + val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ? + fn( elem, name, !documentIsHTML ) : + undefined; + + return val !== undefined ? + val : + support.attributes || !documentIsHTML ? + elem.getAttribute( name ) : + ( val = elem.getAttributeNode( name ) ) && val.specified ? + val.value : + null; +}; + +Sizzle.escape = function( sel ) { + return ( sel + "" ).replace( rcssescape, fcssescape ); +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +/** + * Document sorting and removing duplicates + * @param {ArrayLike} results + */ +Sizzle.uniqueSort = function( results ) { + var elem, + duplicates = [], + j = 0, + i = 0; + + // Unless we *know* we can detect duplicates, assume their presence + hasDuplicate = !support.detectDuplicates; + sortInput = !support.sortStable && results.slice( 0 ); + results.sort( sortOrder ); + + if ( hasDuplicate ) { + while ( ( elem = results[ i++ ] ) ) { + if ( elem === results[ i ] ) { + j = duplicates.push( i ); + } + } + while ( j-- ) { + results.splice( duplicates[ j ], 1 ); + } + } + + // Clear input after sorting to release objects + // See https://github.com/jquery/sizzle/pull/225 + sortInput = null; + + return results; +}; + +/** + * Utility function for retrieving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +getText = Sizzle.getText = function( elem ) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; + + if ( !nodeType ) { + + // If no nodeType, this is expected to be an array + while ( ( node = elem[ i++ ] ) ) { + + // Do not traverse comment nodes + ret += getText( node ); + } + } else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { + + // Use textContent for elements + // innerText usage removed for consistency of new lines (jQuery #11153) + if ( typeof elem.textContent === "string" ) { + return elem.textContent; + } else { + + // Traverse its children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + + // Do not include comment or processing instruction nodes + + return ret; +}; + +Expr = Sizzle.selectors = { + + // Can be adjusted by the user + cacheLength: 50, + + createPseudo: markFunction, + + match: matchExpr, + + attrHandle: {}, + + find: {}, + + relative: { + ">": { dir: "parentNode", first: true }, + " ": { dir: "parentNode" }, + "+": { dir: "previousSibling", first: true }, + "~": { dir: "previousSibling" } + }, + + preFilter: { + "ATTR": function( match ) { + match[ 1 ] = match[ 1 ].replace( runescape, funescape ); + + // Move the given value to match[3] whether quoted or unquoted + match[ 3 ] = ( match[ 3 ] || match[ 4 ] || + match[ 5 ] || "" ).replace( runescape, funescape ); + + if ( match[ 2 ] === "~=" ) { + match[ 3 ] = " " + match[ 3 ] + " "; + } + + return match.slice( 0, 4 ); + }, + + "CHILD": function( match ) { + + /* matches from matchExpr["CHILD"] + 1 type (only|nth|...) + 2 what (child|of-type) + 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 4 xn-component of xn+y argument ([+-]?\d*n|) + 5 sign of xn-component + 6 x of xn-component + 7 sign of y-component + 8 y of y-component + */ + match[ 1 ] = match[ 1 ].toLowerCase(); + + if ( match[ 1 ].slice( 0, 3 ) === "nth" ) { + + // nth-* requires argument + if ( !match[ 3 ] ) { + Sizzle.error( match[ 0 ] ); + } + + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[ 4 ] = +( match[ 4 ] ? + match[ 5 ] + ( match[ 6 ] || 1 ) : + 2 * ( match[ 3 ] === "even" || match[ 3 ] === "odd" ) ); + match[ 5 ] = +( ( match[ 7 ] + match[ 8 ] ) || match[ 3 ] === "odd" ); + + // other types prohibit arguments + } else if ( match[ 3 ] ) { + Sizzle.error( match[ 0 ] ); + } + + return match; + }, + + "PSEUDO": function( match ) { + var excess, + unquoted = !match[ 6 ] && match[ 2 ]; + + if ( matchExpr[ "CHILD" ].test( match[ 0 ] ) ) { + return null; + } + + // Accept quoted arguments as-is + if ( match[ 3 ] ) { + match[ 2 ] = match[ 4 ] || match[ 5 ] || ""; + + // Strip excess characters from unquoted arguments + } else if ( unquoted && rpseudo.test( unquoted ) && + + // Get excess from tokenize (recursively) + ( excess = tokenize( unquoted, true ) ) && + + // advance to the next closing parenthesis + ( excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length ) ) { + + // excess is a negative index + match[ 0 ] = match[ 0 ].slice( 0, excess ); + match[ 2 ] = unquoted.slice( 0, excess ); + } + + // Return only captures needed by the pseudo filter method (type and argument) + return match.slice( 0, 3 ); + } + }, + + filter: { + + "TAG": function( nodeNameSelector ) { + var nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase(); + return nodeNameSelector === "*" ? + function() { + return true; + } : + function( elem ) { + return elem.nodeName && elem.nodeName.toLowerCase() === nodeName; + }; + }, + + "CLASS": function( className ) { + var pattern = classCache[ className + " " ]; + + return pattern || + ( pattern = new RegExp( "(^|" + whitespace + + ")" + className + "(" + whitespace + "|$)" ) ) && classCache( + className, function( elem ) { + return pattern.test( + typeof elem.className === "string" && elem.className || + typeof elem.getAttribute !== "undefined" && + elem.getAttribute( "class" ) || + "" + ); + } ); + }, + + "ATTR": function( name, operator, check ) { + return function( elem ) { + var result = Sizzle.attr( elem, name ); + + if ( result == null ) { + return operator === "!="; + } + if ( !operator ) { + return true; + } + + result += ""; + + /* eslint-disable max-len */ + + return operator === "=" ? result === check : + operator === "!=" ? result !== check : + operator === "^=" ? check && result.indexOf( check ) === 0 : + operator === "*=" ? check && result.indexOf( check ) > -1 : + operator === "$=" ? check && result.slice( -check.length ) === check : + operator === "~=" ? ( " " + result.replace( rwhitespace, " " ) + " " ).indexOf( check ) > -1 : + operator === "|=" ? result === check || result.slice( 0, check.length + 1 ) === check + "-" : + false; + /* eslint-enable max-len */ + + }; + }, + + "CHILD": function( type, what, _argument, first, last ) { + var simple = type.slice( 0, 3 ) !== "nth", + forward = type.slice( -4 ) !== "last", + ofType = what === "of-type"; + + return first === 1 && last === 0 ? + + // Shortcut for :nth-*(n) + function( elem ) { + return !!elem.parentNode; + } : + + function( elem, _context, xml ) { + var cache, uniqueCache, outerCache, node, nodeIndex, start, + dir = simple !== forward ? "nextSibling" : "previousSibling", + parent = elem.parentNode, + name = ofType && elem.nodeName.toLowerCase(), + useCache = !xml && !ofType, + diff = false; + + if ( parent ) { + + // :(first|last|only)-(child|of-type) + if ( simple ) { + while ( dir ) { + node = elem; + while ( ( node = node[ dir ] ) ) { + if ( ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1 ) { + + return false; + } + } + + // Reverse direction for :only-* (if we haven't yet done so) + start = dir = type === "only" && !start && "nextSibling"; + } + return true; + } + + start = [ forward ? parent.firstChild : parent.lastChild ]; + + // non-xml :nth-child(...) stores cache data on `parent` + if ( forward && useCache ) { + + // Seek `elem` from a previously-cached index + + // ...in a gzip-friendly way + node = parent; + outerCache = node[ expando ] || ( node[ expando ] = {} ); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + ( outerCache[ node.uniqueID ] = {} ); + + cache = uniqueCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex && cache[ 2 ]; + node = nodeIndex && parent.childNodes[ nodeIndex ]; + + while ( ( node = ++nodeIndex && node && node[ dir ] || + + // Fallback to seeking `elem` from the start + ( diff = nodeIndex = 0 ) || start.pop() ) ) { + + // When found, cache indexes on `parent` and break + if ( node.nodeType === 1 && ++diff && node === elem ) { + uniqueCache[ type ] = [ dirruns, nodeIndex, diff ]; + break; + } + } + + } else { + + // Use previously-cached element index if available + if ( useCache ) { + + // ...in a gzip-friendly way + node = elem; + outerCache = node[ expando ] || ( node[ expando ] = {} ); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + ( outerCache[ node.uniqueID ] = {} ); + + cache = uniqueCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex; + } + + // xml :nth-child(...) + // or :nth-last-child(...) or :nth(-last)?-of-type(...) + if ( diff === false ) { + + // Use the same loop as above to seek `elem` from the start + while ( ( node = ++nodeIndex && node && node[ dir ] || + ( diff = nodeIndex = 0 ) || start.pop() ) ) { + + if ( ( ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1 ) && + ++diff ) { + + // Cache the index of each encountered element + if ( useCache ) { + outerCache = node[ expando ] || + ( node[ expando ] = {} ); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + ( outerCache[ node.uniqueID ] = {} ); + + uniqueCache[ type ] = [ dirruns, diff ]; + } + + if ( node === elem ) { + break; + } + } + } + } + } + + // Incorporate the offset, then check against cycle size + diff -= last; + return diff === first || ( diff % first === 0 && diff / first >= 0 ); + } + }; + }, + + "PSEUDO": function( pseudo, argument ) { + + // pseudo-class names are case-insensitive + // http://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + // Remember that setFilters inherits from pseudos + var args, + fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] || + Sizzle.error( "unsupported pseudo: " + pseudo ); + + // The user may use createPseudo to indicate that + // arguments are needed to create the filter function + // just as Sizzle does + if ( fn[ expando ] ) { + return fn( argument ); + } + + // But maintain support for old signatures + if ( fn.length > 1 ) { + args = [ pseudo, pseudo, "", argument ]; + return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ? + markFunction( function( seed, matches ) { + var idx, + matched = fn( seed, argument ), + i = matched.length; + while ( i-- ) { + idx = indexOf( seed, matched[ i ] ); + seed[ idx ] = !( matches[ idx ] = matched[ i ] ); + } + } ) : + function( elem ) { + return fn( elem, 0, args ); + }; + } + + return fn; + } + }, + + pseudos: { + + // Potentially complex pseudos + "not": markFunction( function( selector ) { + + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var input = [], + results = [], + matcher = compile( selector.replace( rtrim, "$1" ) ); + + return matcher[ expando ] ? + markFunction( function( seed, matches, _context, xml ) { + var elem, + unmatched = matcher( seed, null, xml, [] ), + i = seed.length; + + // Match elements unmatched by `matcher` + while ( i-- ) { + if ( ( elem = unmatched[ i ] ) ) { + seed[ i ] = !( matches[ i ] = elem ); + } + } + } ) : + function( elem, _context, xml ) { + input[ 0 ] = elem; + matcher( input, null, xml, results ); + + // Don't keep the element (issue #299) + input[ 0 ] = null; + return !results.pop(); + }; + } ), + + "has": markFunction( function( selector ) { + return function( elem ) { + return Sizzle( selector, elem ).length > 0; + }; + } ), + + "contains": markFunction( function( text ) { + text = text.replace( runescape, funescape ); + return function( elem ) { + return ( elem.textContent || getText( elem ) ).indexOf( text ) > -1; + }; + } ), + + // "Whether an element is represented by a :lang() selector + // is based solely on the element's language value + // being equal to the identifier C, + // or beginning with the identifier C immediately followed by "-". + // The matching of C against the element's language value is performed case-insensitively. + // The identifier C does not have to be a valid language name." + // http://www.w3.org/TR/selectors/#lang-pseudo + "lang": markFunction( function( lang ) { + + // lang value must be a valid identifier + if ( !ridentifier.test( lang || "" ) ) { + Sizzle.error( "unsupported lang: " + lang ); + } + lang = lang.replace( runescape, funescape ).toLowerCase(); + return function( elem ) { + var elemLang; + do { + if ( ( elemLang = documentIsHTML ? + elem.lang : + elem.getAttribute( "xml:lang" ) || elem.getAttribute( "lang" ) ) ) { + + elemLang = elemLang.toLowerCase(); + return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0; + } + } while ( ( elem = elem.parentNode ) && elem.nodeType === 1 ); + return false; + }; + } ), + + // Miscellaneous + "target": function( elem ) { + var hash = window.location && window.location.hash; + return hash && hash.slice( 1 ) === elem.id; + }, + + "root": function( elem ) { + return elem === docElem; + }, + + "focus": function( elem ) { + return elem === document.activeElement && + ( !document.hasFocus || document.hasFocus() ) && + !!( elem.type || elem.href || ~elem.tabIndex ); + }, + + // Boolean properties + "enabled": createDisabledPseudo( false ), + "disabled": createDisabledPseudo( true ), + + "checked": function( elem ) { + + // In CSS3, :checked should return both checked and selected elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + var nodeName = elem.nodeName.toLowerCase(); + return ( nodeName === "input" && !!elem.checked ) || + ( nodeName === "option" && !!elem.selected ); + }, + + "selected": function( elem ) { + + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + // eslint-disable-next-line no-unused-expressions + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + // Contents + "empty": function( elem ) { + + // http://www.w3.org/TR/selectors/#empty-pseudo + // :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5), + // but not by others (comment: 8; processing instruction: 7; etc.) + // nodeType < 6 works because attributes (2) do not appear as children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + if ( elem.nodeType < 6 ) { + return false; + } + } + return true; + }, + + "parent": function( elem ) { + return !Expr.pseudos[ "empty" ]( elem ); + }, + + // Element/input types + "header": function( elem ) { + return rheader.test( elem.nodeName ); + }, + + "input": function( elem ) { + return rinputs.test( elem.nodeName ); + }, + + "button": function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === "button" || name === "button"; + }, + + "text": function( elem ) { + var attr; + return elem.nodeName.toLowerCase() === "input" && + elem.type === "text" && + + // Support: IE<8 + // New HTML5 attribute values (e.g., "search") appear with elem.type === "text" + ( ( attr = elem.getAttribute( "type" ) ) == null || + attr.toLowerCase() === "text" ); + }, + + // Position-in-collection + "first": createPositionalPseudo( function() { + return [ 0 ]; + } ), + + "last": createPositionalPseudo( function( _matchIndexes, length ) { + return [ length - 1 ]; + } ), + + "eq": createPositionalPseudo( function( _matchIndexes, length, argument ) { + return [ argument < 0 ? argument + length : argument ]; + } ), + + "even": createPositionalPseudo( function( matchIndexes, length ) { + var i = 0; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + "odd": createPositionalPseudo( function( matchIndexes, length ) { + var i = 1; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + "lt": createPositionalPseudo( function( matchIndexes, length, argument ) { + var i = argument < 0 ? + argument + length : + argument > length ? + length : + argument; + for ( ; --i >= 0; ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + "gt": createPositionalPseudo( function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; ++i < length; ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ) + } +}; + +Expr.pseudos[ "nth" ] = Expr.pseudos[ "eq" ]; + +// Add button/input type pseudos +for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) { + Expr.pseudos[ i ] = createInputPseudo( i ); +} +for ( i in { submit: true, reset: true } ) { + Expr.pseudos[ i ] = createButtonPseudo( i ); +} + +// Easy API for creating new setFilters +function setFilters() {} +setFilters.prototype = Expr.filters = Expr.pseudos; +Expr.setFilters = new setFilters(); + +tokenize = Sizzle.tokenize = function( selector, parseOnly ) { + var matched, match, tokens, type, + soFar, groups, preFilters, + cached = tokenCache[ selector + " " ]; + + if ( cached ) { + return parseOnly ? 0 : cached.slice( 0 ); + } + + soFar = selector; + groups = []; + preFilters = Expr.preFilter; + + while ( soFar ) { + + // Comma and first run + if ( !matched || ( match = rcomma.exec( soFar ) ) ) { + if ( match ) { + + // Don't consume trailing commas as valid + soFar = soFar.slice( match[ 0 ].length ) || soFar; + } + groups.push( ( tokens = [] ) ); + } + + matched = false; + + // Combinators + if ( ( match = rcombinators.exec( soFar ) ) ) { + matched = match.shift(); + tokens.push( { + value: matched, + + // Cast descendant combinators to space + type: match[ 0 ].replace( rtrim, " " ) + } ); + soFar = soFar.slice( matched.length ); + } + + // Filters + for ( type in Expr.filter ) { + if ( ( match = matchExpr[ type ].exec( soFar ) ) && ( !preFilters[ type ] || + ( match = preFilters[ type ]( match ) ) ) ) { + matched = match.shift(); + tokens.push( { + value: matched, + type: type, + matches: match + } ); + soFar = soFar.slice( matched.length ); + } + } + + if ( !matched ) { + break; + } + } + + // Return the length of the invalid excess + // if we're just parsing + // Otherwise, throw an error or return tokens + return parseOnly ? + soFar.length : + soFar ? + Sizzle.error( selector ) : + + // Cache the tokens + tokenCache( selector, groups ).slice( 0 ); +}; + +function toSelector( tokens ) { + var i = 0, + len = tokens.length, + selector = ""; + for ( ; i < len; i++ ) { + selector += tokens[ i ].value; + } + return selector; +} + +function addCombinator( matcher, combinator, base ) { + var dir = combinator.dir, + skip = combinator.next, + key = skip || dir, + checkNonElements = base && key === "parentNode", + doneName = done++; + + return combinator.first ? + + // Check against closest ancestor/preceding element + function( elem, context, xml ) { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + return matcher( elem, context, xml ); + } + } + return false; + } : + + // Check against all ancestor/preceding elements + function( elem, context, xml ) { + var oldCache, uniqueCache, outerCache, + newCache = [ dirruns, doneName ]; + + // We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching + if ( xml ) { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + if ( matcher( elem, context, xml ) ) { + return true; + } + } + } + } else { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + outerCache = elem[ expando ] || ( elem[ expando ] = {} ); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ elem.uniqueID ] || + ( outerCache[ elem.uniqueID ] = {} ); + + if ( skip && skip === elem.nodeName.toLowerCase() ) { + elem = elem[ dir ] || elem; + } else if ( ( oldCache = uniqueCache[ key ] ) && + oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) { + + // Assign to newCache so results back-propagate to previous elements + return ( newCache[ 2 ] = oldCache[ 2 ] ); + } else { + + // Reuse newcache so results back-propagate to previous elements + uniqueCache[ key ] = newCache; + + // A match means we're done; a fail means we have to keep checking + if ( ( newCache[ 2 ] = matcher( elem, context, xml ) ) ) { + return true; + } + } + } + } + } + return false; + }; +} + +function elementMatcher( matchers ) { + return matchers.length > 1 ? + function( elem, context, xml ) { + var i = matchers.length; + while ( i-- ) { + if ( !matchers[ i ]( elem, context, xml ) ) { + return false; + } + } + return true; + } : + matchers[ 0 ]; +} + +function multipleContexts( selector, contexts, results ) { + var i = 0, + len = contexts.length; + for ( ; i < len; i++ ) { + Sizzle( selector, contexts[ i ], results ); + } + return results; +} + +function condense( unmatched, map, filter, context, xml ) { + var elem, + newUnmatched = [], + i = 0, + len = unmatched.length, + mapped = map != null; + + for ( ; i < len; i++ ) { + if ( ( elem = unmatched[ i ] ) ) { + if ( !filter || filter( elem, context, xml ) ) { + newUnmatched.push( elem ); + if ( mapped ) { + map.push( i ); + } + } + } + } + + return newUnmatched; +} + +function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) { + if ( postFilter && !postFilter[ expando ] ) { + postFilter = setMatcher( postFilter ); + } + if ( postFinder && !postFinder[ expando ] ) { + postFinder = setMatcher( postFinder, postSelector ); + } + return markFunction( function( seed, results, context, xml ) { + var temp, i, elem, + preMap = [], + postMap = [], + preexisting = results.length, + + // Get initial elements from seed or context + elems = seed || multipleContexts( + selector || "*", + context.nodeType ? [ context ] : context, + [] + ), + + // Prefilter to get matcher input, preserving a map for seed-results synchronization + matcherIn = preFilter && ( seed || !selector ) ? + condense( elems, preMap, preFilter, context, xml ) : + elems, + + matcherOut = matcher ? + + // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results, + postFinder || ( seed ? preFilter : preexisting || postFilter ) ? + + // ...intermediate processing is necessary + [] : + + // ...otherwise use results directly + results : + matcherIn; + + // Find primary matches + if ( matcher ) { + matcher( matcherIn, matcherOut, context, xml ); + } + + // Apply postFilter + if ( postFilter ) { + temp = condense( matcherOut, postMap ); + postFilter( temp, [], context, xml ); + + // Un-match failing elements by moving them back to matcherIn + i = temp.length; + while ( i-- ) { + if ( ( elem = temp[ i ] ) ) { + matcherOut[ postMap[ i ] ] = !( matcherIn[ postMap[ i ] ] = elem ); + } + } + } + + if ( seed ) { + if ( postFinder || preFilter ) { + if ( postFinder ) { + + // Get the final matcherOut by condensing this intermediate into postFinder contexts + temp = []; + i = matcherOut.length; + while ( i-- ) { + if ( ( elem = matcherOut[ i ] ) ) { + + // Restore matcherIn since elem is not yet a final match + temp.push( ( matcherIn[ i ] = elem ) ); + } + } + postFinder( null, ( matcherOut = [] ), temp, xml ); + } + + // Move matched elements from seed to results to keep them synchronized + i = matcherOut.length; + while ( i-- ) { + if ( ( elem = matcherOut[ i ] ) && + ( temp = postFinder ? indexOf( seed, elem ) : preMap[ i ] ) > -1 ) { + + seed[ temp ] = !( results[ temp ] = elem ); + } + } + } + + // Add elements to results, through postFinder if defined + } else { + matcherOut = condense( + matcherOut === results ? + matcherOut.splice( preexisting, matcherOut.length ) : + matcherOut + ); + if ( postFinder ) { + postFinder( null, results, matcherOut, xml ); + } else { + push.apply( results, matcherOut ); + } + } + } ); +} + +function matcherFromTokens( tokens ) { + var checkContext, matcher, j, + len = tokens.length, + leadingRelative = Expr.relative[ tokens[ 0 ].type ], + implicitRelative = leadingRelative || Expr.relative[ " " ], + i = leadingRelative ? 1 : 0, + + // The foundational matcher ensures that elements are reachable from top-level context(s) + matchContext = addCombinator( function( elem ) { + return elem === checkContext; + }, implicitRelative, true ), + matchAnyContext = addCombinator( function( elem ) { + return indexOf( checkContext, elem ) > -1; + }, implicitRelative, true ), + matchers = [ function( elem, context, xml ) { + var ret = ( !leadingRelative && ( xml || context !== outermostContext ) ) || ( + ( checkContext = context ).nodeType ? + matchContext( elem, context, xml ) : + matchAnyContext( elem, context, xml ) ); + + // Avoid hanging onto element (issue #299) + checkContext = null; + return ret; + } ]; + + for ( ; i < len; i++ ) { + if ( ( matcher = Expr.relative[ tokens[ i ].type ] ) ) { + matchers = [ addCombinator( elementMatcher( matchers ), matcher ) ]; + } else { + matcher = Expr.filter[ tokens[ i ].type ].apply( null, tokens[ i ].matches ); + + // Return special upon seeing a positional matcher + if ( matcher[ expando ] ) { + + // Find the next relative operator (if any) for proper handling + j = ++i; + for ( ; j < len; j++ ) { + if ( Expr.relative[ tokens[ j ].type ] ) { + break; + } + } + return setMatcher( + i > 1 && elementMatcher( matchers ), + i > 1 && toSelector( + + // If the preceding token was a descendant combinator, insert an implicit any-element `*` + tokens + .slice( 0, i - 1 ) + .concat( { value: tokens[ i - 2 ].type === " " ? "*" : "" } ) + ).replace( rtrim, "$1" ), + matcher, + i < j && matcherFromTokens( tokens.slice( i, j ) ), + j < len && matcherFromTokens( ( tokens = tokens.slice( j ) ) ), + j < len && toSelector( tokens ) + ); + } + matchers.push( matcher ); + } + } + + return elementMatcher( matchers ); +} + +function matcherFromGroupMatchers( elementMatchers, setMatchers ) { + var bySet = setMatchers.length > 0, + byElement = elementMatchers.length > 0, + superMatcher = function( seed, context, xml, results, outermost ) { + var elem, j, matcher, + matchedCount = 0, + i = "0", + unmatched = seed && [], + setMatched = [], + contextBackup = outermostContext, + + // We must always have either seed elements or outermost context + elems = seed || byElement && Expr.find[ "TAG" ]( "*", outermost ), + + // Use integer dirruns iff this is the outermost matcher + dirrunsUnique = ( dirruns += contextBackup == null ? 1 : Math.random() || 0.1 ), + len = elems.length; + + if ( outermost ) { + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + outermostContext = context == document || context || outermost; + } + + // Add elements passing elementMatchers directly to results + // Support: IE<9, Safari + // Tolerate NodeList properties (IE: "length"; Safari: ) matching elements by id + for ( ; i !== len && ( elem = elems[ i ] ) != null; i++ ) { + if ( byElement && elem ) { + j = 0; + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( !context && elem.ownerDocument != document ) { + setDocument( elem ); + xml = !documentIsHTML; + } + while ( ( matcher = elementMatchers[ j++ ] ) ) { + if ( matcher( elem, context || document, xml ) ) { + results.push( elem ); + break; + } + } + if ( outermost ) { + dirruns = dirrunsUnique; + } + } + + // Track unmatched elements for set filters + if ( bySet ) { + + // They will have gone through all possible matchers + if ( ( elem = !matcher && elem ) ) { + matchedCount--; + } + + // Lengthen the array for every element, matched or not + if ( seed ) { + unmatched.push( elem ); + } + } + } + + // `i` is now the count of elements visited above, and adding it to `matchedCount` + // makes the latter nonnegative. + matchedCount += i; + + // Apply set filters to unmatched elements + // NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount` + // equals `i`), unless we didn't visit _any_ elements in the above loop because we have + // no element matchers and no seed. + // Incrementing an initially-string "0" `i` allows `i` to remain a string only in that + // case, which will result in a "00" `matchedCount` that differs from `i` but is also + // numerically zero. + if ( bySet && i !== matchedCount ) { + j = 0; + while ( ( matcher = setMatchers[ j++ ] ) ) { + matcher( unmatched, setMatched, context, xml ); + } + + if ( seed ) { + + // Reintegrate element matches to eliminate the need for sorting + if ( matchedCount > 0 ) { + while ( i-- ) { + if ( !( unmatched[ i ] || setMatched[ i ] ) ) { + setMatched[ i ] = pop.call( results ); + } + } + } + + // Discard index placeholder values to get only actual matches + setMatched = condense( setMatched ); + } + + // Add matches to results + push.apply( results, setMatched ); + + // Seedless set matches succeeding multiple successful matchers stipulate sorting + if ( outermost && !seed && setMatched.length > 0 && + ( matchedCount + setMatchers.length ) > 1 ) { + + Sizzle.uniqueSort( results ); + } + } + + // Override manipulation of globals by nested matchers + if ( outermost ) { + dirruns = dirrunsUnique; + outermostContext = contextBackup; + } + + return unmatched; + }; + + return bySet ? + markFunction( superMatcher ) : + superMatcher; +} + +compile = Sizzle.compile = function( selector, match /* Internal Use Only */ ) { + var i, + setMatchers = [], + elementMatchers = [], + cached = compilerCache[ selector + " " ]; + + if ( !cached ) { + + // Generate a function of recursive functions that can be used to check each element + if ( !match ) { + match = tokenize( selector ); + } + i = match.length; + while ( i-- ) { + cached = matcherFromTokens( match[ i ] ); + if ( cached[ expando ] ) { + setMatchers.push( cached ); + } else { + elementMatchers.push( cached ); + } + } + + // Cache the compiled function + cached = compilerCache( + selector, + matcherFromGroupMatchers( elementMatchers, setMatchers ) + ); + + // Save selector and tokenization + cached.selector = selector; + } + return cached; +}; + +/** + * A low-level selection function that works with Sizzle's compiled + * selector functions + * @param {String|Function} selector A selector or a pre-compiled + * selector function built with Sizzle.compile + * @param {Element} context + * @param {Array} [results] + * @param {Array} [seed] A set of elements to match against + */ +select = Sizzle.select = function( selector, context, results, seed ) { + var i, tokens, token, type, find, + compiled = typeof selector === "function" && selector, + match = !seed && tokenize( ( selector = compiled.selector || selector ) ); + + results = results || []; + + // Try to minimize operations if there is only one selector in the list and no seed + // (the latter of which guarantees us context) + if ( match.length === 1 ) { + + // Reduce context if the leading compound selector is an ID + tokens = match[ 0 ] = match[ 0 ].slice( 0 ); + if ( tokens.length > 2 && ( token = tokens[ 0 ] ).type === "ID" && + context.nodeType === 9 && documentIsHTML && Expr.relative[ tokens[ 1 ].type ] ) { + + context = ( Expr.find[ "ID" ]( token.matches[ 0 ] + .replace( runescape, funescape ), context ) || [] )[ 0 ]; + if ( !context ) { + return results; + + // Precompiled matchers will still verify ancestry, so step up a level + } else if ( compiled ) { + context = context.parentNode; + } + + selector = selector.slice( tokens.shift().value.length ); + } + + // Fetch a seed set for right-to-left matching + i = matchExpr[ "needsContext" ].test( selector ) ? 0 : tokens.length; + while ( i-- ) { + token = tokens[ i ]; + + // Abort if we hit a combinator + if ( Expr.relative[ ( type = token.type ) ] ) { + break; + } + if ( ( find = Expr.find[ type ] ) ) { + + // Search, expanding context for leading sibling combinators + if ( ( seed = find( + token.matches[ 0 ].replace( runescape, funescape ), + rsibling.test( tokens[ 0 ].type ) && testContext( context.parentNode ) || + context + ) ) ) { + + // If seed is empty or no tokens remain, we can return early + tokens.splice( i, 1 ); + selector = seed.length && toSelector( tokens ); + if ( !selector ) { + push.apply( results, seed ); + return results; + } + + break; + } + } + } + } + + // Compile and execute a filtering function if one is not provided + // Provide `match` to avoid retokenization if we modified the selector above + ( compiled || compile( selector, match ) )( + seed, + context, + !documentIsHTML, + results, + !context || rsibling.test( selector ) && testContext( context.parentNode ) || context + ); + return results; +}; + +// One-time assignments + +// Sort stability +support.sortStable = expando.split( "" ).sort( sortOrder ).join( "" ) === expando; + +// Support: Chrome 14-35+ +// Always assume duplicates if they aren't passed to the comparison function +support.detectDuplicates = !!hasDuplicate; + +// Initialize against the default document +setDocument(); + +// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27) +// Detached nodes confoundingly follow *each other* +support.sortDetached = assert( function( el ) { + + // Should return 1, but returns 4 (following) + return el.compareDocumentPosition( document.createElement( "fieldset" ) ) & 1; +} ); + +// Support: IE<8 +// Prevent attribute/property "interpolation" +// https://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx +if ( !assert( function( el ) { + el.innerHTML = ""; + return el.firstChild.getAttribute( "href" ) === "#"; +} ) ) { + addHandle( "type|href|height|width", function( elem, name, isXML ) { + if ( !isXML ) { + return elem.getAttribute( name, name.toLowerCase() === "type" ? 1 : 2 ); + } + } ); +} + +// Support: IE<9 +// Use defaultValue in place of getAttribute("value") +if ( !support.attributes || !assert( function( el ) { + el.innerHTML = ""; + el.firstChild.setAttribute( "value", "" ); + return el.firstChild.getAttribute( "value" ) === ""; +} ) ) { + addHandle( "value", function( elem, _name, isXML ) { + if ( !isXML && elem.nodeName.toLowerCase() === "input" ) { + return elem.defaultValue; + } + } ); +} + +// Support: IE<9 +// Use getAttributeNode to fetch booleans when getAttribute lies +if ( !assert( function( el ) { + return el.getAttribute( "disabled" ) == null; +} ) ) { + addHandle( booleans, function( elem, name, isXML ) { + var val; + if ( !isXML ) { + return elem[ name ] === true ? name.toLowerCase() : + ( val = elem.getAttributeNode( name ) ) && val.specified ? + val.value : + null; + } + } ); +} + +return Sizzle; + +} )( window ); + + + +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; + +// Deprecated +jQuery.expr[ ":" ] = jQuery.expr.pseudos; +jQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; +jQuery.escapeSelector = Sizzle.escape; + + + + +var dir = function( elem, dir, until ) { + var matched = [], + truncate = until !== undefined; + + while ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) { + if ( elem.nodeType === 1 ) { + if ( truncate && jQuery( elem ).is( until ) ) { + break; + } + matched.push( elem ); + } + } + return matched; +}; + + +var siblings = function( n, elem ) { + var matched = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + matched.push( n ); + } + } + + return matched; +}; + + +var rneedsContext = jQuery.expr.match.needsContext; + + + +function nodeName( elem, name ) { + + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); + +} +var rsingleTag = ( /^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i ); + + + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, not ) { + if ( isFunction( qualifier ) ) { + return jQuery.grep( elements, function( elem, i ) { + return !!qualifier.call( elem, i, elem ) !== not; + } ); + } + + // Single element + if ( qualifier.nodeType ) { + return jQuery.grep( elements, function( elem ) { + return ( elem === qualifier ) !== not; + } ); + } + + // Arraylike of elements (jQuery, arguments, Array) + if ( typeof qualifier !== "string" ) { + return jQuery.grep( elements, function( elem ) { + return ( indexOf.call( qualifier, elem ) > -1 ) !== not; + } ); + } + + // Filtered directly for both simple and complex selectors + return jQuery.filter( qualifier, elements, not ); +} + +jQuery.filter = function( expr, elems, not ) { + var elem = elems[ 0 ]; + + if ( not ) { + expr = ":not(" + expr + ")"; + } + + if ( elems.length === 1 && elem.nodeType === 1 ) { + return jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : []; + } + + return jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) { + return elem.nodeType === 1; + } ) ); +}; + +jQuery.fn.extend( { + find: function( selector ) { + var i, ret, + len = this.length, + self = this; + + if ( typeof selector !== "string" ) { + return this.pushStack( jQuery( selector ).filter( function() { + for ( i = 0; i < len; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + } ) ); + } + + ret = this.pushStack( [] ); + + for ( i = 0; i < len; i++ ) { + jQuery.find( selector, self[ i ], ret ); + } + + return len > 1 ? jQuery.uniqueSort( ret ) : ret; + }, + filter: function( selector ) { + return this.pushStack( winnow( this, selector || [], false ) ); + }, + not: function( selector ) { + return this.pushStack( winnow( this, selector || [], true ) ); + }, + is: function( selector ) { + return !!winnow( + this, + + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + typeof selector === "string" && rneedsContext.test( selector ) ? + jQuery( selector ) : + selector || [], + false + ).length; + } +} ); + + +// Initialize a jQuery object + + +// A central reference to the root jQuery(document) +var rootjQuery, + + // A simple way to check for HTML strings + // Prioritize #id over to avoid XSS via location.hash (#9521) + // Strict HTML recognition (#11290: must start with <) + // Shortcut simple #id case for speed + rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/, + + init = jQuery.fn.init = function( selector, context, root ) { + var match, elem; + + // HANDLE: $(""), $(null), $(undefined), $(false) + if ( !selector ) { + return this; + } + + // Method init() accepts an alternate rootjQuery + // so migrate can support jQuery.sub (gh-2101) + root = root || rootjQuery; + + // Handle HTML strings + if ( typeof selector === "string" ) { + if ( selector[ 0 ] === "<" && + selector[ selector.length - 1 ] === ">" && + selector.length >= 3 ) { + + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = rquickExpr.exec( selector ); + } + + // Match html or make sure no context is specified for #id + if ( match && ( match[ 1 ] || !context ) ) { + + // HANDLE: $(html) -> $(array) + if ( match[ 1 ] ) { + context = context instanceof jQuery ? context[ 0 ] : context; + + // Option to run scripts is true for back-compat + // Intentionally let the error be thrown if parseHTML is not present + jQuery.merge( this, jQuery.parseHTML( + match[ 1 ], + context && context.nodeType ? context.ownerDocument || context : document, + true + ) ); + + // HANDLE: $(html, props) + if ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) { + for ( match in context ) { + + // Properties of context are called as methods if possible + if ( isFunction( this[ match ] ) ) { + this[ match ]( context[ match ] ); + + // ...and otherwise set as attributes + } else { + this.attr( match, context[ match ] ); + } + } + } + + return this; + + // HANDLE: $(#id) + } else { + elem = document.getElementById( match[ 2 ] ); + + if ( elem ) { + + // Inject the element directly into the jQuery object + this[ 0 ] = elem; + this.length = 1; + } + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || root ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(DOMElement) + } else if ( selector.nodeType ) { + this[ 0 ] = selector; + this.length = 1; + return this; + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( isFunction( selector ) ) { + return root.ready !== undefined ? + root.ready( selector ) : + + // Execute immediately if ready is not present + selector( jQuery ); + } + + return jQuery.makeArray( selector, this ); + }; + +// Give the init function the jQuery prototype for later instantiation +init.prototype = jQuery.fn; + +// Initialize central reference +rootjQuery = jQuery( document ); + + +var rparentsprev = /^(?:parents|prev(?:Until|All))/, + + // Methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend( { + has: function( target ) { + var targets = jQuery( target, this ), + l = targets.length; + + return this.filter( function() { + var i = 0; + for ( ; i < l; i++ ) { + if ( jQuery.contains( this, targets[ i ] ) ) { + return true; + } + } + } ); + }, + + closest: function( selectors, context ) { + var cur, + i = 0, + l = this.length, + matched = [], + targets = typeof selectors !== "string" && jQuery( selectors ); + + // Positional selectors never match, since there's no _selection_ context + if ( !rneedsContext.test( selectors ) ) { + for ( ; i < l; i++ ) { + for ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) { + + // Always skip document fragments + if ( cur.nodeType < 11 && ( targets ? + targets.index( cur ) > -1 : + + // Don't pass non-elements to Sizzle + cur.nodeType === 1 && + jQuery.find.matchesSelector( cur, selectors ) ) ) { + + matched.push( cur ); + break; + } + } + } + } + + return this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched ); + }, + + // Determine the position of an element within the set + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1; + } + + // Index in selector + if ( typeof elem === "string" ) { + return indexOf.call( jQuery( elem ), this[ 0 ] ); + } + + // Locate the position of the desired element + return indexOf.call( this, + + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[ 0 ] : elem + ); + }, + + add: function( selector, context ) { + return this.pushStack( + jQuery.uniqueSort( + jQuery.merge( this.get(), jQuery( selector, context ) ) + ) + ); + }, + + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter( selector ) + ); + } +} ); + +function sibling( cur, dir ) { + while ( ( cur = cur[ dir ] ) && cur.nodeType !== 1 ) {} + return cur; +} + +jQuery.each( { + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, _i, until ) { + return dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return sibling( elem, "nextSibling" ); + }, + prev: function( elem ) { + return sibling( elem, "previousSibling" ); + }, + nextAll: function( elem ) { + return dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, _i, until ) { + return dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, _i, until ) { + return dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return siblings( ( elem.parentNode || {} ).firstChild, elem ); + }, + children: function( elem ) { + return siblings( elem.firstChild ); + }, + contents: function( elem ) { + if ( elem.contentDocument != null && + + // Support: IE 11+ + // elements with no `data` attribute has an object + // `contentDocument` with a `null` prototype. + getProto( elem.contentDocument ) ) { + + return elem.contentDocument; + } + + // Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only + // Treat the template element as a regular one in browsers that + // don't support it. + if ( nodeName( elem, "template" ) ) { + elem = elem.content || elem; + } + + return jQuery.merge( [], elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var matched = jQuery.map( this, fn, until ); + + if ( name.slice( -5 ) !== "Until" ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + matched = jQuery.filter( selector, matched ); + } + + if ( this.length > 1 ) { + + // Remove duplicates + if ( !guaranteedUnique[ name ] ) { + jQuery.uniqueSort( matched ); + } + + // Reverse order for parents* and prev-derivatives + if ( rparentsprev.test( name ) ) { + matched.reverse(); + } + } + + return this.pushStack( matched ); + }; +} ); +var rnothtmlwhite = ( /[^\x20\t\r\n\f]+/g ); + + + +// Convert String-formatted options into Object-formatted ones +function createOptions( options ) { + var object = {}; + jQuery.each( options.match( rnothtmlwhite ) || [], function( _, flag ) { + object[ flag ] = true; + } ); + return object; +} + +/* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( options ) { + + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + createOptions( options ) : + jQuery.extend( {}, options ); + + var // Flag to know if list is currently firing + firing, + + // Last fire value for non-forgettable lists + memory, + + // Flag to know if list was already fired + fired, + + // Flag to prevent firing + locked, + + // Actual callback list + list = [], + + // Queue of execution data for repeatable lists + queue = [], + + // Index of currently firing callback (modified by add/remove as needed) + firingIndex = -1, + + // Fire callbacks + fire = function() { + + // Enforce single-firing + locked = locked || options.once; + + // Execute callbacks for all pending executions, + // respecting firingIndex overrides and runtime changes + fired = firing = true; + for ( ; queue.length; firingIndex = -1 ) { + memory = queue.shift(); + while ( ++firingIndex < list.length ) { + + // Run callback and check for early termination + if ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false && + options.stopOnFalse ) { + + // Jump to end and forget the data so .add doesn't re-fire + firingIndex = list.length; + memory = false; + } + } + } + + // Forget the data if we're done with it + if ( !options.memory ) { + memory = false; + } + + firing = false; + + // Clean up if we're done firing for good + if ( locked ) { + + // Keep an empty list if we have data for future add calls + if ( memory ) { + list = []; + + // Otherwise, this object is spent + } else { + list = ""; + } + } + }, + + // Actual Callbacks object + self = { + + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + + // If we have memory from a past run, we should fire after adding + if ( memory && !firing ) { + firingIndex = list.length - 1; + queue.push( memory ); + } + + ( function add( args ) { + jQuery.each( args, function( _, arg ) { + if ( isFunction( arg ) ) { + if ( !options.unique || !self.has( arg ) ) { + list.push( arg ); + } + } else if ( arg && arg.length && toType( arg ) !== "string" ) { + + // Inspect recursively + add( arg ); + } + } ); + } )( arguments ); + + if ( memory && !firing ) { + fire(); + } + } + return this; + }, + + // Remove a callback from the list + remove: function() { + jQuery.each( arguments, function( _, arg ) { + var index; + while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) { + list.splice( index, 1 ); + + // Handle firing indexes + if ( index <= firingIndex ) { + firingIndex--; + } + } + } ); + return this; + }, + + // Check if a given callback is in the list. + // If no argument is given, return whether or not list has callbacks attached. + has: function( fn ) { + return fn ? + jQuery.inArray( fn, list ) > -1 : + list.length > 0; + }, + + // Remove all callbacks from the list + empty: function() { + if ( list ) { + list = []; + } + return this; + }, + + // Disable .fire and .add + // Abort any current/pending executions + // Clear all callbacks and values + disable: function() { + locked = queue = []; + list = memory = ""; + return this; + }, + disabled: function() { + return !list; + }, + + // Disable .fire + // Also disable .add unless we have memory (since it would have no effect) + // Abort any pending executions + lock: function() { + locked = queue = []; + if ( !memory && !firing ) { + list = memory = ""; + } + return this; + }, + locked: function() { + return !!locked; + }, + + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + if ( !locked ) { + args = args || []; + args = [ context, args.slice ? args.slice() : args ]; + queue.push( args ); + if ( !firing ) { + fire(); + } + } + return this; + }, + + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + + // To know if the callbacks have already been called at least once + fired: function() { + return !!fired; + } + }; + + return self; +}; + + +function Identity( v ) { + return v; +} +function Thrower( ex ) { + throw ex; +} + +function adoptValue( value, resolve, reject, noValue ) { + var method; + + try { + + // Check for promise aspect first to privilege synchronous behavior + if ( value && isFunction( ( method = value.promise ) ) ) { + method.call( value ).done( resolve ).fail( reject ); + + // Other thenables + } else if ( value && isFunction( ( method = value.then ) ) ) { + method.call( value, resolve, reject ); + + // Other non-thenables + } else { + + // Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer: + // * false: [ value ].slice( 0 ) => resolve( value ) + // * true: [ value ].slice( 1 ) => resolve() + resolve.apply( undefined, [ value ].slice( noValue ) ); + } + + // For Promises/A+, convert exceptions into rejections + // Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in + // Deferred#then to conditionally suppress rejection. + } catch ( value ) { + + // Support: Android 4.0 only + // Strict mode functions invoked without .call/.apply get global-object context + reject.apply( undefined, [ value ] ); + } +} + +jQuery.extend( { + + Deferred: function( func ) { + var tuples = [ + + // action, add listener, callbacks, + // ... .then handlers, argument index, [final state] + [ "notify", "progress", jQuery.Callbacks( "memory" ), + jQuery.Callbacks( "memory" ), 2 ], + [ "resolve", "done", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 0, "resolved" ], + [ "reject", "fail", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 1, "rejected" ] + ], + state = "pending", + promise = { + state: function() { + return state; + }, + always: function() { + deferred.done( arguments ).fail( arguments ); + return this; + }, + "catch": function( fn ) { + return promise.then( null, fn ); + }, + + // Keep pipe for back-compat + pipe: function( /* fnDone, fnFail, fnProgress */ ) { + var fns = arguments; + + return jQuery.Deferred( function( newDefer ) { + jQuery.each( tuples, function( _i, tuple ) { + + // Map tuples (progress, done, fail) to arguments (done, fail, progress) + var fn = isFunction( fns[ tuple[ 4 ] ] ) && fns[ tuple[ 4 ] ]; + + // deferred.progress(function() { bind to newDefer or newDefer.notify }) + // deferred.done(function() { bind to newDefer or newDefer.resolve }) + // deferred.fail(function() { bind to newDefer or newDefer.reject }) + deferred[ tuple[ 1 ] ]( function() { + var returned = fn && fn.apply( this, arguments ); + if ( returned && isFunction( returned.promise ) ) { + returned.promise() + .progress( newDefer.notify ) + .done( newDefer.resolve ) + .fail( newDefer.reject ); + } else { + newDefer[ tuple[ 0 ] + "With" ]( + this, + fn ? [ returned ] : arguments + ); + } + } ); + } ); + fns = null; + } ).promise(); + }, + then: function( onFulfilled, onRejected, onProgress ) { + var maxDepth = 0; + function resolve( depth, deferred, handler, special ) { + return function() { + var that = this, + args = arguments, + mightThrow = function() { + var returned, then; + + // Support: Promises/A+ section 2.3.3.3.3 + // https://promisesaplus.com/#point-59 + // Ignore double-resolution attempts + if ( depth < maxDepth ) { + return; + } + + returned = handler.apply( that, args ); + + // Support: Promises/A+ section 2.3.1 + // https://promisesaplus.com/#point-48 + if ( returned === deferred.promise() ) { + throw new TypeError( "Thenable self-resolution" ); + } + + // Support: Promises/A+ sections 2.3.3.1, 3.5 + // https://promisesaplus.com/#point-54 + // https://promisesaplus.com/#point-75 + // Retrieve `then` only once + then = returned && + + // Support: Promises/A+ section 2.3.4 + // https://promisesaplus.com/#point-64 + // Only check objects and functions for thenability + ( typeof returned === "object" || + typeof returned === "function" ) && + returned.then; + + // Handle a returned thenable + if ( isFunction( then ) ) { + + // Special processors (notify) just wait for resolution + if ( special ) { + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ) + ); + + // Normal processors (resolve) also hook into progress + } else { + + // ...and disregard older resolution values + maxDepth++; + + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ), + resolve( maxDepth, deferred, Identity, + deferred.notifyWith ) + ); + } + + // Handle all other returned values + } else { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Identity ) { + that = undefined; + args = [ returned ]; + } + + // Process the value(s) + // Default process is resolve + ( special || deferred.resolveWith )( that, args ); + } + }, + + // Only normal processors (resolve) catch and reject exceptions + process = special ? + mightThrow : + function() { + try { + mightThrow(); + } catch ( e ) { + + if ( jQuery.Deferred.exceptionHook ) { + jQuery.Deferred.exceptionHook( e, + process.stackTrace ); + } + + // Support: Promises/A+ section 2.3.3.3.4.1 + // https://promisesaplus.com/#point-61 + // Ignore post-resolution exceptions + if ( depth + 1 >= maxDepth ) { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Thrower ) { + that = undefined; + args = [ e ]; + } + + deferred.rejectWith( that, args ); + } + } + }; + + // Support: Promises/A+ section 2.3.3.3.1 + // https://promisesaplus.com/#point-57 + // Re-resolve promises immediately to dodge false rejection from + // subsequent errors + if ( depth ) { + process(); + } else { + + // Call an optional hook to record the stack, in case of exception + // since it's otherwise lost when execution goes async + if ( jQuery.Deferred.getStackHook ) { + process.stackTrace = jQuery.Deferred.getStackHook(); + } + window.setTimeout( process ); + } + }; + } + + return jQuery.Deferred( function( newDefer ) { + + // progress_handlers.add( ... ) + tuples[ 0 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onProgress ) ? + onProgress : + Identity, + newDefer.notifyWith + ) + ); + + // fulfilled_handlers.add( ... ) + tuples[ 1 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onFulfilled ) ? + onFulfilled : + Identity + ) + ); + + // rejected_handlers.add( ... ) + tuples[ 2 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onRejected ) ? + onRejected : + Thrower + ) + ); + } ).promise(); + }, + + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + return obj != null ? jQuery.extend( obj, promise ) : promise; + } + }, + deferred = {}; + + // Add list-specific methods + jQuery.each( tuples, function( i, tuple ) { + var list = tuple[ 2 ], + stateString = tuple[ 5 ]; + + // promise.progress = list.add + // promise.done = list.add + // promise.fail = list.add + promise[ tuple[ 1 ] ] = list.add; + + // Handle state + if ( stateString ) { + list.add( + function() { + + // state = "resolved" (i.e., fulfilled) + // state = "rejected" + state = stateString; + }, + + // rejected_callbacks.disable + // fulfilled_callbacks.disable + tuples[ 3 - i ][ 2 ].disable, + + // rejected_handlers.disable + // fulfilled_handlers.disable + tuples[ 3 - i ][ 3 ].disable, + + // progress_callbacks.lock + tuples[ 0 ][ 2 ].lock, + + // progress_handlers.lock + tuples[ 0 ][ 3 ].lock + ); + } + + // progress_handlers.fire + // fulfilled_handlers.fire + // rejected_handlers.fire + list.add( tuple[ 3 ].fire ); + + // deferred.notify = function() { deferred.notifyWith(...) } + // deferred.resolve = function() { deferred.resolveWith(...) } + // deferred.reject = function() { deferred.rejectWith(...) } + deferred[ tuple[ 0 ] ] = function() { + deferred[ tuple[ 0 ] + "With" ]( this === deferred ? undefined : this, arguments ); + return this; + }; + + // deferred.notifyWith = list.fireWith + // deferred.resolveWith = list.fireWith + // deferred.rejectWith = list.fireWith + deferred[ tuple[ 0 ] + "With" ] = list.fireWith; + } ); + + // Make the deferred a promise + promise.promise( deferred ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( singleValue ) { + var + + // count of uncompleted subordinates + remaining = arguments.length, + + // count of unprocessed arguments + i = remaining, + + // subordinate fulfillment data + resolveContexts = Array( i ), + resolveValues = slice.call( arguments ), + + // the primary Deferred + primary = jQuery.Deferred(), + + // subordinate callback factory + updateFunc = function( i ) { + return function( value ) { + resolveContexts[ i ] = this; + resolveValues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value; + if ( !( --remaining ) ) { + primary.resolveWith( resolveContexts, resolveValues ); + } + }; + }; + + // Single- and empty arguments are adopted like Promise.resolve + if ( remaining <= 1 ) { + adoptValue( singleValue, primary.done( updateFunc( i ) ).resolve, primary.reject, + !remaining ); + + // Use .then() to unwrap secondary thenables (cf. gh-3000) + if ( primary.state() === "pending" || + isFunction( resolveValues[ i ] && resolveValues[ i ].then ) ) { + + return primary.then(); + } + } + + // Multiple arguments are aggregated like Promise.all array elements + while ( i-- ) { + adoptValue( resolveValues[ i ], updateFunc( i ), primary.reject ); + } + + return primary.promise(); + } +} ); + + +// These usually indicate a programmer mistake during development, +// warn about them ASAP rather than swallowing them by default. +var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/; + +jQuery.Deferred.exceptionHook = function( error, stack ) { + + // Support: IE 8 - 9 only + // Console exists when dev tools are open, which can happen at any time + if ( window.console && window.console.warn && error && rerrorNames.test( error.name ) ) { + window.console.warn( "jQuery.Deferred exception: " + error.message, error.stack, stack ); + } +}; + + + + +jQuery.readyException = function( error ) { + window.setTimeout( function() { + throw error; + } ); +}; + + + + +// The deferred used on DOM ready +var readyList = jQuery.Deferred(); + +jQuery.fn.ready = function( fn ) { + + readyList + .then( fn ) + + // Wrap jQuery.readyException in a function so that the lookup + // happens at the time of error handling instead of callback + // registration. + .catch( function( error ) { + jQuery.readyException( error ); + } ); + + return this; +}; + +jQuery.extend( { + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Handle when the DOM is ready + ready: function( wait ) { + + // Abort if there are pending holds or we're already ready + if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) { + return; + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + } +} ); + +jQuery.ready.then = readyList.then; + +// The ready event handler and self cleanup method +function completed() { + document.removeEventListener( "DOMContentLoaded", completed ); + window.removeEventListener( "load", completed ); + jQuery.ready(); +} + +// Catch cases where $(document).ready() is called +// after the browser event has already occurred. +// Support: IE <=9 - 10 only +// Older IE sometimes signals "interactive" too soon +if ( document.readyState === "complete" || + ( document.readyState !== "loading" && !document.documentElement.doScroll ) ) { + + // Handle it asynchronously to allow scripts the opportunity to delay ready + window.setTimeout( jQuery.ready ); + +} else { + + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", completed ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", completed ); +} + + + + +// Multifunctional method to get and set values of a collection +// The value/s can optionally be executed if it's a function +var access = function( elems, fn, key, value, chainable, emptyGet, raw ) { + var i = 0, + len = elems.length, + bulk = key == null; + + // Sets many values + if ( toType( key ) === "object" ) { + chainable = true; + for ( i in key ) { + access( elems, fn, i, key[ i ], true, emptyGet, raw ); + } + + // Sets one value + } else if ( value !== undefined ) { + chainable = true; + + if ( !isFunction( value ) ) { + raw = true; + } + + if ( bulk ) { + + // Bulk operations run against the entire set + if ( raw ) { + fn.call( elems, value ); + fn = null; + + // ...except when executing function values + } else { + bulk = fn; + fn = function( elem, _key, value ) { + return bulk.call( jQuery( elem ), value ); + }; + } + } + + if ( fn ) { + for ( ; i < len; i++ ) { + fn( + elems[ i ], key, raw ? + value : + value.call( elems[ i ], i, fn( elems[ i ], key ) ) + ); + } + } + } + + if ( chainable ) { + return elems; + } + + // Gets + if ( bulk ) { + return fn.call( elems ); + } + + return len ? fn( elems[ 0 ], key ) : emptyGet; +}; + + +// Matches dashed string for camelizing +var rmsPrefix = /^-ms-/, + rdashAlpha = /-([a-z])/g; + +// Used by camelCase as callback to replace() +function fcamelCase( _all, letter ) { + return letter.toUpperCase(); +} + +// Convert dashed to camelCase; used by the css and data modules +// Support: IE <=9 - 11, Edge 12 - 15 +// Microsoft forgot to hump their vendor prefix (#9572) +function camelCase( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); +} +var acceptData = function( owner ) { + + // Accepts only: + // - Node + // - Node.ELEMENT_NODE + // - Node.DOCUMENT_NODE + // - Object + // - Any + return owner.nodeType === 1 || owner.nodeType === 9 || !( +owner.nodeType ); +}; + + + + +function Data() { + this.expando = jQuery.expando + Data.uid++; +} + +Data.uid = 1; + +Data.prototype = { + + cache: function( owner ) { + + // Check if the owner object already has a cache + var value = owner[ this.expando ]; + + // If not, create one + if ( !value ) { + value = {}; + + // We can accept data for non-element nodes in modern browsers, + // but we should not, see #8335. + // Always return an empty object. + if ( acceptData( owner ) ) { + + // If it is a node unlikely to be stringify-ed or looped over + // use plain assignment + if ( owner.nodeType ) { + owner[ this.expando ] = value; + + // Otherwise secure it in a non-enumerable property + // configurable must be true to allow the property to be + // deleted when data is removed + } else { + Object.defineProperty( owner, this.expando, { + value: value, + configurable: true + } ); + } + } + } + + return value; + }, + set: function( owner, data, value ) { + var prop, + cache = this.cache( owner ); + + // Handle: [ owner, key, value ] args + // Always use camelCase key (gh-2257) + if ( typeof data === "string" ) { + cache[ camelCase( data ) ] = value; + + // Handle: [ owner, { properties } ] args + } else { + + // Copy the properties one-by-one to the cache object + for ( prop in data ) { + cache[ camelCase( prop ) ] = data[ prop ]; + } + } + return cache; + }, + get: function( owner, key ) { + return key === undefined ? + this.cache( owner ) : + + // Always use camelCase key (gh-2257) + owner[ this.expando ] && owner[ this.expando ][ camelCase( key ) ]; + }, + access: function( owner, key, value ) { + + // In cases where either: + // + // 1. No key was specified + // 2. A string key was specified, but no value provided + // + // Take the "read" path and allow the get method to determine + // which value to return, respectively either: + // + // 1. The entire cache object + // 2. The data stored at the key + // + if ( key === undefined || + ( ( key && typeof key === "string" ) && value === undefined ) ) { + + return this.get( owner, key ); + } + + // When the key is not a string, or both a key and value + // are specified, set or extend (existing objects) with either: + // + // 1. An object of properties + // 2. A key and value + // + this.set( owner, key, value ); + + // Since the "set" path can have two possible entry points + // return the expected data based on which path was taken[*] + return value !== undefined ? value : key; + }, + remove: function( owner, key ) { + var i, + cache = owner[ this.expando ]; + + if ( cache === undefined ) { + return; + } + + if ( key !== undefined ) { + + // Support array or space separated string of keys + if ( Array.isArray( key ) ) { + + // If key is an array of keys... + // We always set camelCase keys, so remove that. + key = key.map( camelCase ); + } else { + key = camelCase( key ); + + // If a key with the spaces exists, use it. + // Otherwise, create an array by matching non-whitespace + key = key in cache ? + [ key ] : + ( key.match( rnothtmlwhite ) || [] ); + } + + i = key.length; + + while ( i-- ) { + delete cache[ key[ i ] ]; + } + } + + // Remove the expando if there's no more data + if ( key === undefined || jQuery.isEmptyObject( cache ) ) { + + // Support: Chrome <=35 - 45 + // Webkit & Blink performance suffers when deleting properties + // from DOM nodes, so set to undefined instead + // https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted) + if ( owner.nodeType ) { + owner[ this.expando ] = undefined; + } else { + delete owner[ this.expando ]; + } + } + }, + hasData: function( owner ) { + var cache = owner[ this.expando ]; + return cache !== undefined && !jQuery.isEmptyObject( cache ); + } +}; +var dataPriv = new Data(); + +var dataUser = new Data(); + + + +// Implementation Summary +// +// 1. Enforce API surface and semantic compatibility with 1.9.x branch +// 2. Improve the module's maintainability by reducing the storage +// paths to a single mechanism. +// 3. Use the same single mechanism to support "private" and "user" data. +// 4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData) +// 5. Avoid exposing implementation details on user objects (eg. expando properties) +// 6. Provide a clear path for implementation upgrade to WeakMap in 2014 + +var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/, + rmultiDash = /[A-Z]/g; + +function getData( data ) { + if ( data === "true" ) { + return true; + } + + if ( data === "false" ) { + return false; + } + + if ( data === "null" ) { + return null; + } + + // Only convert to a number if it doesn't change the string + if ( data === +data + "" ) { + return +data; + } + + if ( rbrace.test( data ) ) { + return JSON.parse( data ); + } + + return data; +} + +function dataAttr( elem, key, data ) { + var name; + + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + name = "data-" + key.replace( rmultiDash, "-$&" ).toLowerCase(); + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = getData( data ); + } catch ( e ) {} + + // Make sure we set the data so it isn't changed later + dataUser.set( elem, key, data ); + } else { + data = undefined; + } + } + return data; +} + +jQuery.extend( { + hasData: function( elem ) { + return dataUser.hasData( elem ) || dataPriv.hasData( elem ); + }, + + data: function( elem, name, data ) { + return dataUser.access( elem, name, data ); + }, + + removeData: function( elem, name ) { + dataUser.remove( elem, name ); + }, + + // TODO: Now that all calls to _data and _removeData have been replaced + // with direct calls to dataPriv methods, these can be deprecated. + _data: function( elem, name, data ) { + return dataPriv.access( elem, name, data ); + }, + + _removeData: function( elem, name ) { + dataPriv.remove( elem, name ); + } +} ); + +jQuery.fn.extend( { + data: function( key, value ) { + var i, name, data, + elem = this[ 0 ], + attrs = elem && elem.attributes; + + // Gets all values + if ( key === undefined ) { + if ( this.length ) { + data = dataUser.get( elem ); + + if ( elem.nodeType === 1 && !dataPriv.get( elem, "hasDataAttrs" ) ) { + i = attrs.length; + while ( i-- ) { + + // Support: IE 11 only + // The attrs elements can be null (#14894) + if ( attrs[ i ] ) { + name = attrs[ i ].name; + if ( name.indexOf( "data-" ) === 0 ) { + name = camelCase( name.slice( 5 ) ); + dataAttr( elem, name, data[ name ] ); + } + } + } + dataPriv.set( elem, "hasDataAttrs", true ); + } + } + + return data; + } + + // Sets multiple values + if ( typeof key === "object" ) { + return this.each( function() { + dataUser.set( this, key ); + } ); + } + + return access( this, function( value ) { + var data; + + // The calling jQuery object (element matches) is not empty + // (and therefore has an element appears at this[ 0 ]) and the + // `value` parameter was not undefined. An empty jQuery object + // will result in `undefined` for elem = this[ 0 ] which will + // throw an exception if an attempt to read a data cache is made. + if ( elem && value === undefined ) { + + // Attempt to get data from the cache + // The key will always be camelCased in Data + data = dataUser.get( elem, key ); + if ( data !== undefined ) { + return data; + } + + // Attempt to "discover" the data in + // HTML5 custom data-* attrs + data = dataAttr( elem, key ); + if ( data !== undefined ) { + return data; + } + + // We tried really hard, but the data doesn't exist. + return; + } + + // Set the data... + this.each( function() { + + // We always store the camelCased key + dataUser.set( this, key, value ); + } ); + }, null, value, arguments.length > 1, null, true ); + }, + + removeData: function( key ) { + return this.each( function() { + dataUser.remove( this, key ); + } ); + } +} ); + + +jQuery.extend( { + queue: function( elem, type, data ) { + var queue; + + if ( elem ) { + type = ( type || "fx" ) + "queue"; + queue = dataPriv.get( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !queue || Array.isArray( data ) ) { + queue = dataPriv.access( elem, type, jQuery.makeArray( data ) ); + } else { + queue.push( data ); + } + } + return queue || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + startLength = queue.length, + fn = queue.shift(), + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + startLength--; + } + + if ( fn ) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + // Clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); + } + + if ( !startLength && hooks ) { + hooks.empty.fire(); + } + }, + + // Not public - generate a queueHooks object, or return the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return dataPriv.get( elem, key ) || dataPriv.access( elem, key, { + empty: jQuery.Callbacks( "once memory" ).add( function() { + dataPriv.remove( elem, [ type + "queue", key ] ); + } ) + } ); + } +} ); + +jQuery.fn.extend( { + queue: function( type, data ) { + var setter = 2; + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + setter--; + } + + if ( arguments.length < setter ) { + return jQuery.queue( this[ 0 ], type ); + } + + return data === undefined ? + this : + this.each( function() { + var queue = jQuery.queue( this, type, data ); + + // Ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[ 0 ] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + } ); + }, + dequeue: function( type ) { + return this.each( function() { + jQuery.dequeue( this, type ); + } ); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + + if ( typeof type !== "string" ) { + obj = type; + type = undefined; + } + type = type || "fx"; + + while ( i-- ) { + tmp = dataPriv.get( elements[ i ], type + "queueHooks" ); + if ( tmp && tmp.empty ) { + count++; + tmp.empty.add( resolve ); + } + } + resolve(); + return defer.promise( obj ); + } +} ); +var pnum = ( /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/ ).source; + +var rcssNum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" ); + + +var cssExpand = [ "Top", "Right", "Bottom", "Left" ]; + +var documentElement = document.documentElement; + + + + var isAttached = function( elem ) { + return jQuery.contains( elem.ownerDocument, elem ); + }, + composed = { composed: true }; + + // Support: IE 9 - 11+, Edge 12 - 18+, iOS 10.0 - 10.2 only + // Check attachment across shadow DOM boundaries when possible (gh-3504) + // Support: iOS 10.0-10.2 only + // Early iOS 10 versions support `attachShadow` but not `getRootNode`, + // leading to errors. We need to check for `getRootNode`. + if ( documentElement.getRootNode ) { + isAttached = function( elem ) { + return jQuery.contains( elem.ownerDocument, elem ) || + elem.getRootNode( composed ) === elem.ownerDocument; + }; + } +var isHiddenWithinTree = function( elem, el ) { + + // isHiddenWithinTree might be called from jQuery#filter function; + // in that case, element will be second argument + elem = el || elem; + + // Inline style trumps all + return elem.style.display === "none" || + elem.style.display === "" && + + // Otherwise, check computed style + // Support: Firefox <=43 - 45 + // Disconnected elements can have computed display: none, so first confirm that elem is + // in the document. + isAttached( elem ) && + + jQuery.css( elem, "display" ) === "none"; + }; + + + +function adjustCSS( elem, prop, valueParts, tween ) { + var adjusted, scale, + maxIterations = 20, + currentValue = tween ? + function() { + return tween.cur(); + } : + function() { + return jQuery.css( elem, prop, "" ); + }, + initial = currentValue(), + unit = valueParts && valueParts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ), + + // Starting value computation is required for potential unit mismatches + initialInUnit = elem.nodeType && + ( jQuery.cssNumber[ prop ] || unit !== "px" && +initial ) && + rcssNum.exec( jQuery.css( elem, prop ) ); + + if ( initialInUnit && initialInUnit[ 3 ] !== unit ) { + + // Support: Firefox <=54 + // Halve the iteration target value to prevent interference from CSS upper bounds (gh-2144) + initial = initial / 2; + + // Trust units reported by jQuery.css + unit = unit || initialInUnit[ 3 ]; + + // Iteratively approximate from a nonzero starting point + initialInUnit = +initial || 1; + + while ( maxIterations-- ) { + + // Evaluate and update our best guess (doubling guesses that zero out). + // Finish if the scale equals or crosses 1 (making the old*new product non-positive). + jQuery.style( elem, prop, initialInUnit + unit ); + if ( ( 1 - scale ) * ( 1 - ( scale = currentValue() / initial || 0.5 ) ) <= 0 ) { + maxIterations = 0; + } + initialInUnit = initialInUnit / scale; + + } + + initialInUnit = initialInUnit * 2; + jQuery.style( elem, prop, initialInUnit + unit ); + + // Make sure we update the tween properties later on + valueParts = valueParts || []; + } + + if ( valueParts ) { + initialInUnit = +initialInUnit || +initial || 0; + + // Apply relative offset (+=/-=) if specified + adjusted = valueParts[ 1 ] ? + initialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] : + +valueParts[ 2 ]; + if ( tween ) { + tween.unit = unit; + tween.start = initialInUnit; + tween.end = adjusted; + } + } + return adjusted; +} + + +var defaultDisplayMap = {}; + +function getDefaultDisplay( elem ) { + var temp, + doc = elem.ownerDocument, + nodeName = elem.nodeName, + display = defaultDisplayMap[ nodeName ]; + + if ( display ) { + return display; + } + + temp = doc.body.appendChild( doc.createElement( nodeName ) ); + display = jQuery.css( temp, "display" ); + + temp.parentNode.removeChild( temp ); + + if ( display === "none" ) { + display = "block"; + } + defaultDisplayMap[ nodeName ] = display; + + return display; +} + +function showHide( elements, show ) { + var display, elem, + values = [], + index = 0, + length = elements.length; + + // Determine new display value for elements that need to change + for ( ; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + + display = elem.style.display; + if ( show ) { + + // Since we force visibility upon cascade-hidden elements, an immediate (and slow) + // check is required in this first loop unless we have a nonempty display value (either + // inline or about-to-be-restored) + if ( display === "none" ) { + values[ index ] = dataPriv.get( elem, "display" ) || null; + if ( !values[ index ] ) { + elem.style.display = ""; + } + } + if ( elem.style.display === "" && isHiddenWithinTree( elem ) ) { + values[ index ] = getDefaultDisplay( elem ); + } + } else { + if ( display !== "none" ) { + values[ index ] = "none"; + + // Remember what we're overwriting + dataPriv.set( elem, "display", display ); + } + } + } + + // Set the display of the elements in a second loop to avoid constant reflow + for ( index = 0; index < length; index++ ) { + if ( values[ index ] != null ) { + elements[ index ].style.display = values[ index ]; + } + } + + return elements; +} + +jQuery.fn.extend( { + show: function() { + return showHide( this, true ); + }, + hide: function() { + return showHide( this ); + }, + toggle: function( state ) { + if ( typeof state === "boolean" ) { + return state ? this.show() : this.hide(); + } + + return this.each( function() { + if ( isHiddenWithinTree( this ) ) { + jQuery( this ).show(); + } else { + jQuery( this ).hide(); + } + } ); + } +} ); +var rcheckableType = ( /^(?:checkbox|radio)$/i ); + +var rtagName = ( /<([a-z][^\/\0>\x20\t\r\n\f]*)/i ); + +var rscriptType = ( /^$|^module$|\/(?:java|ecma)script/i ); + + + +( function() { + var fragment = document.createDocumentFragment(), + div = fragment.appendChild( document.createElement( "div" ) ), + input = document.createElement( "input" ); + + // Support: Android 4.0 - 4.3 only + // Check state lost if the name is set (#11217) + // Support: Windows Web Apps (WWA) + // `name` and `type` must use .setAttribute for WWA (#14901) + input.setAttribute( "type", "radio" ); + input.setAttribute( "checked", "checked" ); + input.setAttribute( "name", "t" ); + + div.appendChild( input ); + + // Support: Android <=4.1 only + // Older WebKit doesn't clone checked state correctly in fragments + support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Support: IE <=11 only + // Make sure textarea (and checkbox) defaultValue is properly cloned + div.innerHTML = ""; + support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue; + + // Support: IE <=9 only + // IE <=9 replaces "; + support.option = !!div.lastChild; +} )(); + + +// We have to close these tags to support XHTML (#13200) +var wrapMap = { + + // XHTML parsers do not magically insert elements in the + // same way that tag soup parsers do. So we cannot shorten + // this by omitting or other required elements. + thead: [ 1, "", "
" ], + col: [ 2, "", "
" ], + tr: [ 2, "", "
" ], + td: [ 3, "", "
" ], + + _default: [ 0, "", "" ] +}; + +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// Support: IE <=9 only +if ( !support.option ) { + wrapMap.optgroup = wrapMap.option = [ 1, "" ]; +} + + +function getAll( context, tag ) { + + // Support: IE <=9 - 11 only + // Use typeof to avoid zero-argument method invocation on host objects (#15151) + var ret; + + if ( typeof context.getElementsByTagName !== "undefined" ) { + ret = context.getElementsByTagName( tag || "*" ); + + } else if ( typeof context.querySelectorAll !== "undefined" ) { + ret = context.querySelectorAll( tag || "*" ); + + } else { + ret = []; + } + + if ( tag === undefined || tag && nodeName( context, tag ) ) { + return jQuery.merge( [ context ], ret ); + } + + return ret; +} + + +// Mark scripts as having already been evaluated +function setGlobalEval( elems, refElements ) { + var i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + dataPriv.set( + elems[ i ], + "globalEval", + !refElements || dataPriv.get( refElements[ i ], "globalEval" ) + ); + } +} + + +var rhtml = /<|&#?\w+;/; + +function buildFragment( elems, context, scripts, selection, ignored ) { + var elem, tmp, tag, wrap, attached, j, + fragment = context.createDocumentFragment(), + nodes = [], + i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + elem = elems[ i ]; + + if ( elem || elem === 0 ) { + + // Add nodes directly + if ( toType( elem ) === "object" ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem ); + + // Convert non-html into a text node + } else if ( !rhtml.test( elem ) ) { + nodes.push( context.createTextNode( elem ) ); + + // Convert html into DOM nodes + } else { + tmp = tmp || fragment.appendChild( context.createElement( "div" ) ); + + // Deserialize a standard representation + tag = ( rtagName.exec( elem ) || [ "", "" ] )[ 1 ].toLowerCase(); + wrap = wrapMap[ tag ] || wrapMap._default; + tmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ]; + + // Descend through wrappers to the right content + j = wrap[ 0 ]; + while ( j-- ) { + tmp = tmp.lastChild; + } + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, tmp.childNodes ); + + // Remember the top-level container + tmp = fragment.firstChild; + + // Ensure the created nodes are orphaned (#12392) + tmp.textContent = ""; + } + } + } + + // Remove wrapper from fragment + fragment.textContent = ""; + + i = 0; + while ( ( elem = nodes[ i++ ] ) ) { + + // Skip elements already in the context collection (trac-4087) + if ( selection && jQuery.inArray( elem, selection ) > -1 ) { + if ( ignored ) { + ignored.push( elem ); + } + continue; + } + + attached = isAttached( elem ); + + // Append to fragment + tmp = getAll( fragment.appendChild( elem ), "script" ); + + // Preserve script evaluation history + if ( attached ) { + setGlobalEval( tmp ); + } + + // Capture executables + if ( scripts ) { + j = 0; + while ( ( elem = tmp[ j++ ] ) ) { + if ( rscriptType.test( elem.type || "" ) ) { + scripts.push( elem ); + } + } + } + } + + return fragment; +} + + +var rtypenamespace = /^([^.]*)(?:\.(.+)|)/; + +function returnTrue() { + return true; +} + +function returnFalse() { + return false; +} + +// Support: IE <=9 - 11+ +// focus() and blur() are asynchronous, except when they are no-op. +// So expect focus to be synchronous when the element is already active, +// and blur to be synchronous when the element is not already active. +// (focus and blur are always synchronous in other supported browsers, +// this just defines when we can count on it). +function expectSync( elem, type ) { + return ( elem === safeActiveElement() ) === ( type === "focus" ); +} + +// Support: IE <=9 only +// Accessing document.activeElement can throw unexpectedly +// https://bugs.jquery.com/ticket/13393 +function safeActiveElement() { + try { + return document.activeElement; + } catch ( err ) { } +} + +function on( elem, types, selector, data, fn, one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { + + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for ( type in types ) { + on( elem, type, selector, data, types[ type ], one ); + } + return elem; + } + + if ( data == null && fn == null ) { + + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return elem; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return elem.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + } ); +} + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + global: {}, + + add: function( elem, types, handler, data, selector ) { + + var handleObjIn, eventHandle, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.get( elem ); + + // Only attach events to objects that accept data + if ( !acceptData( elem ) ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + selector = handleObjIn.selector; + } + + // Ensure that invalid selectors throw exceptions at attach time + // Evaluate against documentElement in case elem is a non-element node (e.g., document) + if ( selector ) { + jQuery.find.matchesSelector( documentElement, selector ); + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + if ( !( events = elemData.events ) ) { + events = elemData.events = Object.create( null ); + } + if ( !( eventHandle = elemData.handle ) ) { + eventHandle = elemData.handle = function( e ) { + + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ? + jQuery.event.dispatch.apply( elem, arguments ) : undefined; + }; + } + + // Handle multiple events separated by a space + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // There *must* be a type, no attaching namespace-only handlers + if ( !type ) { + continue; + } + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend( { + type: type, + origType: origType, + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + needsContext: selector && jQuery.expr.match.needsContext.test( selector ), + namespace: namespaces.join( "." ) + }, handleObjIn ); + + // Init the event handler queue if we're the first + if ( !( handlers = events[ type ] ) ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener if the special events handler returns false + if ( !special.setup || + special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + }, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var j, origCount, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.hasData( elem ) && dataPriv.get( elem ); + + if ( !elemData || !( events = elemData.events ) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector ? special.delegateType : special.bindType ) || type; + handlers = events[ type ] || []; + tmp = tmp[ 2 ] && + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ); + + // Remove matching events + origCount = j = handlers.length; + while ( j-- ) { + handleObj = handlers[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !tmp || tmp.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || + selector === "**" && handleObj.selector ) ) { + handlers.splice( j, 1 ); + + if ( handleObj.selector ) { + handlers.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( origCount && !handlers.length ) { + if ( !special.teardown || + special.teardown.call( elem, namespaces, elemData.handle ) === false ) { + + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove data and the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + dataPriv.remove( elem, "handle events" ); + } + }, + + dispatch: function( nativeEvent ) { + + var i, j, ret, matched, handleObj, handlerQueue, + args = new Array( arguments.length ), + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix( nativeEvent ), + + handlers = ( + dataPriv.get( this, "events" ) || Object.create( null ) + )[ event.type ] || [], + special = jQuery.event.special[ event.type ] || {}; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[ 0 ] = event; + + for ( i = 1; i < arguments.length; i++ ) { + args[ i ] = arguments[ i ]; + } + + event.delegateTarget = this; + + // Call the preDispatch hook for the mapped type, and let it bail if desired + if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { + return; + } + + // Determine handlers + handlerQueue = jQuery.event.handlers.call( this, event, handlers ); + + // Run delegates first; they may want to stop propagation beneath us + i = 0; + while ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) { + event.currentTarget = matched.elem; + + j = 0; + while ( ( handleObj = matched.handlers[ j++ ] ) && + !event.isImmediatePropagationStopped() ) { + + // If the event is namespaced, then each handler is only invoked if it is + // specially universal or its namespaces are a superset of the event's. + if ( !event.rnamespace || handleObj.namespace === false || + event.rnamespace.test( handleObj.namespace ) ) { + + event.handleObj = handleObj; + event.data = handleObj.data; + + ret = ( ( jQuery.event.special[ handleObj.origType ] || {} ).handle || + handleObj.handler ).apply( matched.elem, args ); + + if ( ret !== undefined ) { + if ( ( event.result = ret ) === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } + + return event.result; + }, + + handlers: function( event, handlers ) { + var i, handleObj, sel, matchedHandlers, matchedSelectors, + handlerQueue = [], + delegateCount = handlers.delegateCount, + cur = event.target; + + // Find delegate handlers + if ( delegateCount && + + // Support: IE <=9 + // Black-hole SVG instance trees (trac-13180) + cur.nodeType && + + // Support: Firefox <=42 + // Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861) + // https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click + // Support: IE 11 only + // ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343) + !( event.type === "click" && event.button >= 1 ) ) { + + for ( ; cur !== this; cur = cur.parentNode || this ) { + + // Don't check non-elements (#13208) + // Don't process clicks on disabled elements (#6911, #8165, #11382, #11764) + if ( cur.nodeType === 1 && !( event.type === "click" && cur.disabled === true ) ) { + matchedHandlers = []; + matchedSelectors = {}; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + + // Don't conflict with Object.prototype properties (#13203) + sel = handleObj.selector + " "; + + if ( matchedSelectors[ sel ] === undefined ) { + matchedSelectors[ sel ] = handleObj.needsContext ? + jQuery( sel, this ).index( cur ) > -1 : + jQuery.find( sel, this, null, [ cur ] ).length; + } + if ( matchedSelectors[ sel ] ) { + matchedHandlers.push( handleObj ); + } + } + if ( matchedHandlers.length ) { + handlerQueue.push( { elem: cur, handlers: matchedHandlers } ); + } + } + } + } + + // Add the remaining (directly-bound) handlers + cur = this; + if ( delegateCount < handlers.length ) { + handlerQueue.push( { elem: cur, handlers: handlers.slice( delegateCount ) } ); + } + + return handlerQueue; + }, + + addProp: function( name, hook ) { + Object.defineProperty( jQuery.Event.prototype, name, { + enumerable: true, + configurable: true, + + get: isFunction( hook ) ? + function() { + if ( this.originalEvent ) { + return hook( this.originalEvent ); + } + } : + function() { + if ( this.originalEvent ) { + return this.originalEvent[ name ]; + } + }, + + set: function( value ) { + Object.defineProperty( this, name, { + enumerable: true, + configurable: true, + writable: true, + value: value + } ); + } + } ); + }, + + fix: function( originalEvent ) { + return originalEvent[ jQuery.expando ] ? + originalEvent : + new jQuery.Event( originalEvent ); + }, + + special: { + load: { + + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + click: { + + // Utilize native event to ensure correct state for checkable inputs + setup: function( data ) { + + // For mutual compressibility with _default, replace `this` access with a local var. + // `|| data` is dead code meant only to preserve the variable through minification. + var el = this || data; + + // Claim the first handler + if ( rcheckableType.test( el.type ) && + el.click && nodeName( el, "input" ) ) { + + // dataPriv.set( el, "click", ... ) + leverageNative( el, "click", returnTrue ); + } + + // Return false to allow normal processing in the caller + return false; + }, + trigger: function( data ) { + + // For mutual compressibility with _default, replace `this` access with a local var. + // `|| data` is dead code meant only to preserve the variable through minification. + var el = this || data; + + // Force setup before triggering a click + if ( rcheckableType.test( el.type ) && + el.click && nodeName( el, "input" ) ) { + + leverageNative( el, "click" ); + } + + // Return non-false to allow normal event-path propagation + return true; + }, + + // For cross-browser consistency, suppress native .click() on links + // Also prevent it if we're currently inside a leveraged native-event stack + _default: function( event ) { + var target = event.target; + return rcheckableType.test( target.type ) && + target.click && nodeName( target, "input" ) && + dataPriv.get( target, "click" ) || + nodeName( target, "a" ); + } + }, + + beforeunload: { + postDispatch: function( event ) { + + // Support: Firefox 20+ + // Firefox doesn't alert if the returnValue field is not set. + if ( event.result !== undefined && event.originalEvent ) { + event.originalEvent.returnValue = event.result; + } + } + } + } +}; + +// Ensure the presence of an event listener that handles manually-triggered +// synthetic events by interrupting progress until reinvoked in response to +// *native* events that it fires directly, ensuring that state changes have +// already occurred before other listeners are invoked. +function leverageNative( el, type, expectSync ) { + + // Missing expectSync indicates a trigger call, which must force setup through jQuery.event.add + if ( !expectSync ) { + if ( dataPriv.get( el, type ) === undefined ) { + jQuery.event.add( el, type, returnTrue ); + } + return; + } + + // Register the controller as a special universal handler for all event namespaces + dataPriv.set( el, type, false ); + jQuery.event.add( el, type, { + namespace: false, + handler: function( event ) { + var notAsync, result, + saved = dataPriv.get( this, type ); + + if ( ( event.isTrigger & 1 ) && this[ type ] ) { + + // Interrupt processing of the outer synthetic .trigger()ed event + // Saved data should be false in such cases, but might be a leftover capture object + // from an async native handler (gh-4350) + if ( !saved.length ) { + + // Store arguments for use when handling the inner native event + // There will always be at least one argument (an event object), so this array + // will not be confused with a leftover capture object. + saved = slice.call( arguments ); + dataPriv.set( this, type, saved ); + + // Trigger the native event and capture its result + // Support: IE <=9 - 11+ + // focus() and blur() are asynchronous + notAsync = expectSync( this, type ); + this[ type ](); + result = dataPriv.get( this, type ); + if ( saved !== result || notAsync ) { + dataPriv.set( this, type, false ); + } else { + result = {}; + } + if ( saved !== result ) { + + // Cancel the outer synthetic event + event.stopImmediatePropagation(); + event.preventDefault(); + + // Support: Chrome 86+ + // In Chrome, if an element having a focusout handler is blurred by + // clicking outside of it, it invokes the handler synchronously. If + // that handler calls `.remove()` on the element, the data is cleared, + // leaving `result` undefined. We need to guard against this. + return result && result.value; + } + + // If this is an inner synthetic event for an event with a bubbling surrogate + // (focus or blur), assume that the surrogate already propagated from triggering the + // native event and prevent that from happening again here. + // This technically gets the ordering wrong w.r.t. to `.trigger()` (in which the + // bubbling surrogate propagates *after* the non-bubbling base), but that seems + // less bad than duplication. + } else if ( ( jQuery.event.special[ type ] || {} ).delegateType ) { + event.stopPropagation(); + } + + // If this is a native event triggered above, everything is now in order + // Fire an inner synthetic event with the original arguments + } else if ( saved.length ) { + + // ...and capture the result + dataPriv.set( this, type, { + value: jQuery.event.trigger( + + // Support: IE <=9 - 11+ + // Extend with the prototype to reset the above stopImmediatePropagation() + jQuery.extend( saved[ 0 ], jQuery.Event.prototype ), + saved.slice( 1 ), + this + ) + } ); + + // Abort handling of the native event + event.stopImmediatePropagation(); + } + } + } ); +} + +jQuery.removeEvent = function( elem, type, handle ) { + + // This "if" is needed for plain objects + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle ); + } +}; + +jQuery.Event = function( src, props ) { + + // Allow instantiation without the 'new' keyword + if ( !( this instanceof jQuery.Event ) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = src.defaultPrevented || + src.defaultPrevented === undefined && + + // Support: Android <=2.3 only + src.returnValue === false ? + returnTrue : + returnFalse; + + // Create target properties + // Support: Safari <=6 - 7 only + // Target should not be a text node (#504, #13143) + this.target = ( src.target && src.target.nodeType === 3 ) ? + src.target.parentNode : + src.target; + + this.currentTarget = src.currentTarget; + this.relatedTarget = src.relatedTarget; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || Date.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + constructor: jQuery.Event, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse, + isSimulated: false, + + preventDefault: function() { + var e = this.originalEvent; + + this.isDefaultPrevented = returnTrue; + + if ( e && !this.isSimulated ) { + e.preventDefault(); + } + }, + stopPropagation: function() { + var e = this.originalEvent; + + this.isPropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopPropagation(); + } + }, + stopImmediatePropagation: function() { + var e = this.originalEvent; + + this.isImmediatePropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopImmediatePropagation(); + } + + this.stopPropagation(); + } +}; + +// Includes all common event props including KeyEvent and MouseEvent specific props +jQuery.each( { + altKey: true, + bubbles: true, + cancelable: true, + changedTouches: true, + ctrlKey: true, + detail: true, + eventPhase: true, + metaKey: true, + pageX: true, + pageY: true, + shiftKey: true, + view: true, + "char": true, + code: true, + charCode: true, + key: true, + keyCode: true, + button: true, + buttons: true, + clientX: true, + clientY: true, + offsetX: true, + offsetY: true, + pointerId: true, + pointerType: true, + screenX: true, + screenY: true, + targetTouches: true, + toElement: true, + touches: true, + which: true +}, jQuery.event.addProp ); + +jQuery.each( { focus: "focusin", blur: "focusout" }, function( type, delegateType ) { + jQuery.event.special[ type ] = { + + // Utilize native event if possible so blur/focus sequence is correct + setup: function() { + + // Claim the first handler + // dataPriv.set( this, "focus", ... ) + // dataPriv.set( this, "blur", ... ) + leverageNative( this, type, expectSync ); + + // Return false to allow normal processing in the caller + return false; + }, + trigger: function() { + + // Force setup before trigger + leverageNative( this, type ); + + // Return non-false to allow normal event-path propagation + return true; + }, + + // Suppress native focus or blur as it's already being fired + // in leverageNative. + _default: function() { + return true; + }, + + delegateType: delegateType + }; +} ); + +// Create mouseenter/leave events using mouseover/out and event-time checks +// so that event delegation works in jQuery. +// Do the same for pointerenter/pointerleave and pointerover/pointerout +// +// Support: Safari 7 only +// Safari sends mouseenter too often; see: +// https://bugs.chromium.org/p/chromium/issues/detail?id=470258 +// for the description of the bug (it existed in older Chrome versions as well). +jQuery.each( { + mouseenter: "mouseover", + mouseleave: "mouseout", + pointerenter: "pointerover", + pointerleave: "pointerout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj; + + // For mouseenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || ( related !== target && !jQuery.contains( target, related ) ) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +} ); + +jQuery.fn.extend( { + + on: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn ); + }, + one: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + var handleObj, type; + if ( types && types.preventDefault && types.handleObj ) { + + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace ? + handleObj.origType + "." + handleObj.namespace : + handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each( function() { + jQuery.event.remove( this, types, fn, selector ); + } ); + } +} ); + + +var + + // Support: IE <=10 - 11, Edge 12 - 13 only + // In IE/Edge using regex groups here causes severe slowdowns. + // See https://connect.microsoft.com/IE/feedback/details/1736512/ + rnoInnerhtml = /\s*$/g; + +// Prefer a tbody over its parent table for containing new rows +function manipulationTarget( elem, content ) { + if ( nodeName( elem, "table" ) && + nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ) { + + return jQuery( elem ).children( "tbody" )[ 0 ] || elem; + } + + return elem; +} + +// Replace/restore the type attribute of script elements for safe DOM manipulation +function disableScript( elem ) { + elem.type = ( elem.getAttribute( "type" ) !== null ) + "/" + elem.type; + return elem; +} +function restoreScript( elem ) { + if ( ( elem.type || "" ).slice( 0, 5 ) === "true/" ) { + elem.type = elem.type.slice( 5 ); + } else { + elem.removeAttribute( "type" ); + } + + return elem; +} + +function cloneCopyEvent( src, dest ) { + var i, l, type, pdataOld, udataOld, udataCur, events; + + if ( dest.nodeType !== 1 ) { + return; + } + + // 1. Copy private data: events, handlers, etc. + if ( dataPriv.hasData( src ) ) { + pdataOld = dataPriv.get( src ); + events = pdataOld.events; + + if ( events ) { + dataPriv.remove( dest, "handle events" ); + + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type, events[ type ][ i ] ); + } + } + } + } + + // 2. Copy user data + if ( dataUser.hasData( src ) ) { + udataOld = dataUser.access( src ); + udataCur = jQuery.extend( {}, udataOld ); + + dataUser.set( dest, udataCur ); + } +} + +// Fix IE bugs, see support tests +function fixInput( src, dest ) { + var nodeName = dest.nodeName.toLowerCase(); + + // Fails to persist the checked state of a cloned checkbox or radio button. + if ( nodeName === "input" && rcheckableType.test( src.type ) ) { + dest.checked = src.checked; + + // Fails to return the selected option to the default selected state when cloning options + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + } +} + +function domManip( collection, args, callback, ignored ) { + + // Flatten any nested arrays + args = flat( args ); + + var fragment, first, scripts, hasScripts, node, doc, + i = 0, + l = collection.length, + iNoClone = l - 1, + value = args[ 0 ], + valueIsFunction = isFunction( value ); + + // We can't cloneNode fragments that contain checked, in WebKit + if ( valueIsFunction || + ( l > 1 && typeof value === "string" && + !support.checkClone && rchecked.test( value ) ) ) { + return collection.each( function( index ) { + var self = collection.eq( index ); + if ( valueIsFunction ) { + args[ 0 ] = value.call( this, index, self.html() ); + } + domManip( self, args, callback, ignored ); + } ); + } + + if ( l ) { + fragment = buildFragment( args, collection[ 0 ].ownerDocument, false, collection, ignored ); + first = fragment.firstChild; + + if ( fragment.childNodes.length === 1 ) { + fragment = first; + } + + // Require either new content or an interest in ignored elements to invoke the callback + if ( first || ignored ) { + scripts = jQuery.map( getAll( fragment, "script" ), disableScript ); + hasScripts = scripts.length; + + // Use the original fragment for the last item + // instead of the first because it can end up + // being emptied incorrectly in certain situations (#8070). + for ( ; i < l; i++ ) { + node = fragment; + + if ( i !== iNoClone ) { + node = jQuery.clone( node, true, true ); + + // Keep references to cloned scripts for later restoration + if ( hasScripts ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( scripts, getAll( node, "script" ) ); + } + } + + callback.call( collection[ i ], node, i ); + } + + if ( hasScripts ) { + doc = scripts[ scripts.length - 1 ].ownerDocument; + + // Reenable scripts + jQuery.map( scripts, restoreScript ); + + // Evaluate executable scripts on first document insertion + for ( i = 0; i < hasScripts; i++ ) { + node = scripts[ i ]; + if ( rscriptType.test( node.type || "" ) && + !dataPriv.access( node, "globalEval" ) && + jQuery.contains( doc, node ) ) { + + if ( node.src && ( node.type || "" ).toLowerCase() !== "module" ) { + + // Optional AJAX dependency, but won't run scripts if not present + if ( jQuery._evalUrl && !node.noModule ) { + jQuery._evalUrl( node.src, { + nonce: node.nonce || node.getAttribute( "nonce" ) + }, doc ); + } + } else { + DOMEval( node.textContent.replace( rcleanScript, "" ), node, doc ); + } + } + } + } + } + } + + return collection; +} + +function remove( elem, selector, keepData ) { + var node, + nodes = selector ? jQuery.filter( selector, elem ) : elem, + i = 0; + + for ( ; ( node = nodes[ i ] ) != null; i++ ) { + if ( !keepData && node.nodeType === 1 ) { + jQuery.cleanData( getAll( node ) ); + } + + if ( node.parentNode ) { + if ( keepData && isAttached( node ) ) { + setGlobalEval( getAll( node, "script" ) ); + } + node.parentNode.removeChild( node ); + } + } + + return elem; +} + +jQuery.extend( { + htmlPrefilter: function( html ) { + return html; + }, + + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var i, l, srcElements, destElements, + clone = elem.cloneNode( true ), + inPage = isAttached( elem ); + + // Fix IE cloning issues + if ( !support.noCloneChecked && ( elem.nodeType === 1 || elem.nodeType === 11 ) && + !jQuery.isXMLDoc( elem ) ) { + + // We eschew Sizzle here for performance reasons: https://jsperf.com/getall-vs-sizzle/2 + destElements = getAll( clone ); + srcElements = getAll( elem ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + fixInput( srcElements[ i ], destElements[ i ] ); + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + if ( deepDataAndEvents ) { + srcElements = srcElements || getAll( elem ); + destElements = destElements || getAll( clone ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + cloneCopyEvent( srcElements[ i ], destElements[ i ] ); + } + } else { + cloneCopyEvent( elem, clone ); + } + } + + // Preserve script evaluation history + destElements = getAll( clone, "script" ); + if ( destElements.length > 0 ) { + setGlobalEval( destElements, !inPage && getAll( elem, "script" ) ); + } + + // Return the cloned set + return clone; + }, + + cleanData: function( elems ) { + var data, elem, type, + special = jQuery.event.special, + i = 0; + + for ( ; ( elem = elems[ i ] ) !== undefined; i++ ) { + if ( acceptData( elem ) ) { + if ( ( data = elem[ dataPriv.expando ] ) ) { + if ( data.events ) { + for ( type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataPriv.expando ] = undefined; + } + if ( elem[ dataUser.expando ] ) { + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataUser.expando ] = undefined; + } + } + } + } +} ); + +jQuery.fn.extend( { + detach: function( selector ) { + return remove( this, selector, true ); + }, + + remove: function( selector ) { + return remove( this, selector ); + }, + + text: function( value ) { + return access( this, function( value ) { + return value === undefined ? + jQuery.text( this ) : + this.empty().each( function() { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + this.textContent = value; + } + } ); + }, null, value, arguments.length ); + }, + + append: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.appendChild( elem ); + } + } ); + }, + + prepend: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.insertBefore( elem, target.firstChild ); + } + } ); + }, + + before: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this ); + } + } ); + }, + + after: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + } + } ); + }, + + empty: function() { + var elem, + i = 0; + + for ( ; ( elem = this[ i ] ) != null; i++ ) { + if ( elem.nodeType === 1 ) { + + // Prevent memory leaks + jQuery.cleanData( getAll( elem, false ) ); + + // Remove any remaining nodes + elem.textContent = ""; + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function() { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + } ); + }, + + html: function( value ) { + return access( this, function( value ) { + var elem = this[ 0 ] || {}, + i = 0, + l = this.length; + + if ( value === undefined && elem.nodeType === 1 ) { + return elem.innerHTML; + } + + // See if we can take a shortcut and just use innerHTML + if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + !wrapMap[ ( rtagName.exec( value ) || [ "", "" ] )[ 1 ].toLowerCase() ] ) { + + value = jQuery.htmlPrefilter( value ); + + try { + for ( ; i < l; i++ ) { + elem = this[ i ] || {}; + + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( getAll( elem, false ) ); + elem.innerHTML = value; + } + } + + elem = 0; + + // If using innerHTML throws an exception, use the fallback method + } catch ( e ) {} + } + + if ( elem ) { + this.empty().append( value ); + } + }, null, value, arguments.length ); + }, + + replaceWith: function() { + var ignored = []; + + // Make the changes, replacing each non-ignored context element with the new content + return domManip( this, arguments, function( elem ) { + var parent = this.parentNode; + + if ( jQuery.inArray( this, ignored ) < 0 ) { + jQuery.cleanData( getAll( this ) ); + if ( parent ) { + parent.replaceChild( elem, this ); + } + } + + // Force callback invocation + }, ignored ); + } +} ); + +jQuery.each( { + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var elems, + ret = [], + insert = jQuery( selector ), + last = insert.length - 1, + i = 0; + + for ( ; i <= last; i++ ) { + elems = i === last ? this : this.clone( true ); + jQuery( insert[ i ] )[ original ]( elems ); + + // Support: Android <=4.0 only, PhantomJS 1 only + // .get() because push.apply(_, arraylike) throws on ancient WebKit + push.apply( ret, elems.get() ); + } + + return this.pushStack( ret ); + }; +} ); +var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" ); + +var getStyles = function( elem ) { + + // Support: IE <=11 only, Firefox <=30 (#15098, #14150) + // IE throws on elements created in popups + // FF meanwhile throws on frame elements through "defaultView.getComputedStyle" + var view = elem.ownerDocument.defaultView; + + if ( !view || !view.opener ) { + view = window; + } + + return view.getComputedStyle( elem ); + }; + +var swap = function( elem, options, callback ) { + var ret, name, + old = {}; + + // Remember the old values, and insert the new ones + for ( name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + ret = callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + + return ret; +}; + + +var rboxStyle = new RegExp( cssExpand.join( "|" ), "i" ); + + + +( function() { + + // Executing both pixelPosition & boxSizingReliable tests require only one layout + // so they're executed at the same time to save the second computation. + function computeStyleTests() { + + // This is a singleton, we need to execute it only once + if ( !div ) { + return; + } + + container.style.cssText = "position:absolute;left:-11111px;width:60px;" + + "margin-top:1px;padding:0;border:0"; + div.style.cssText = + "position:relative;display:block;box-sizing:border-box;overflow:scroll;" + + "margin:auto;border:1px;padding:1px;" + + "width:60%;top:1%"; + documentElement.appendChild( container ).appendChild( div ); + + var divStyle = window.getComputedStyle( div ); + pixelPositionVal = divStyle.top !== "1%"; + + // Support: Android 4.0 - 4.3 only, Firefox <=3 - 44 + reliableMarginLeftVal = roundPixelMeasures( divStyle.marginLeft ) === 12; + + // Support: Android 4.0 - 4.3 only, Safari <=9.1 - 10.1, iOS <=7.0 - 9.3 + // Some styles come back with percentage values, even though they shouldn't + div.style.right = "60%"; + pixelBoxStylesVal = roundPixelMeasures( divStyle.right ) === 36; + + // Support: IE 9 - 11 only + // Detect misreporting of content dimensions for box-sizing:border-box elements + boxSizingReliableVal = roundPixelMeasures( divStyle.width ) === 36; + + // Support: IE 9 only + // Detect overflow:scroll screwiness (gh-3699) + // Support: Chrome <=64 + // Don't get tricked when zoom affects offsetWidth (gh-4029) + div.style.position = "absolute"; + scrollboxSizeVal = roundPixelMeasures( div.offsetWidth / 3 ) === 12; + + documentElement.removeChild( container ); + + // Nullify the div so it wouldn't be stored in the memory and + // it will also be a sign that checks already performed + div = null; + } + + function roundPixelMeasures( measure ) { + return Math.round( parseFloat( measure ) ); + } + + var pixelPositionVal, boxSizingReliableVal, scrollboxSizeVal, pixelBoxStylesVal, + reliableTrDimensionsVal, reliableMarginLeftVal, + container = document.createElement( "div" ), + div = document.createElement( "div" ); + + // Finish early in limited (non-browser) environments + if ( !div.style ) { + return; + } + + // Support: IE <=9 - 11 only + // Style of cloned element affects source element cloned (#8908) + div.style.backgroundClip = "content-box"; + div.cloneNode( true ).style.backgroundClip = ""; + support.clearCloneStyle = div.style.backgroundClip === "content-box"; + + jQuery.extend( support, { + boxSizingReliable: function() { + computeStyleTests(); + return boxSizingReliableVal; + }, + pixelBoxStyles: function() { + computeStyleTests(); + return pixelBoxStylesVal; + }, + pixelPosition: function() { + computeStyleTests(); + return pixelPositionVal; + }, + reliableMarginLeft: function() { + computeStyleTests(); + return reliableMarginLeftVal; + }, + scrollboxSize: function() { + computeStyleTests(); + return scrollboxSizeVal; + }, + + // Support: IE 9 - 11+, Edge 15 - 18+ + // IE/Edge misreport `getComputedStyle` of table rows with width/height + // set in CSS while `offset*` properties report correct values. + // Behavior in IE 9 is more subtle than in newer versions & it passes + // some versions of this test; make sure not to make it pass there! + // + // Support: Firefox 70+ + // Only Firefox includes border widths + // in computed dimensions. (gh-4529) + reliableTrDimensions: function() { + var table, tr, trChild, trStyle; + if ( reliableTrDimensionsVal == null ) { + table = document.createElement( "table" ); + tr = document.createElement( "tr" ); + trChild = document.createElement( "div" ); + + table.style.cssText = "position:absolute;left:-11111px;border-collapse:separate"; + tr.style.cssText = "border:1px solid"; + + // Support: Chrome 86+ + // Height set through cssText does not get applied. + // Computed height then comes back as 0. + tr.style.height = "1px"; + trChild.style.height = "9px"; + + // Support: Android 8 Chrome 86+ + // In our bodyBackground.html iframe, + // display for all div elements is set to "inline", + // which causes a problem only in Android 8 Chrome 86. + // Ensuring the div is display: block + // gets around this issue. + trChild.style.display = "block"; + + documentElement + .appendChild( table ) + .appendChild( tr ) + .appendChild( trChild ); + + trStyle = window.getComputedStyle( tr ); + reliableTrDimensionsVal = ( parseInt( trStyle.height, 10 ) + + parseInt( trStyle.borderTopWidth, 10 ) + + parseInt( trStyle.borderBottomWidth, 10 ) ) === tr.offsetHeight; + + documentElement.removeChild( table ); + } + return reliableTrDimensionsVal; + } + } ); +} )(); + + +function curCSS( elem, name, computed ) { + var width, minWidth, maxWidth, ret, + + // Support: Firefox 51+ + // Retrieving style before computed somehow + // fixes an issue with getting wrong values + // on detached elements + style = elem.style; + + computed = computed || getStyles( elem ); + + // getPropertyValue is needed for: + // .css('filter') (IE 9 only, #12537) + // .css('--customProperty) (#3144) + if ( computed ) { + ret = computed.getPropertyValue( name ) || computed[ name ]; + + if ( ret === "" && !isAttached( elem ) ) { + ret = jQuery.style( elem, name ); + } + + // A tribute to the "awesome hack by Dean Edwards" + // Android Browser returns percentage for some values, + // but width seems to be reliably pixels. + // This is against the CSSOM draft spec: + // https://drafts.csswg.org/cssom/#resolved-values + if ( !support.pixelBoxStyles() && rnumnonpx.test( ret ) && rboxStyle.test( name ) ) { + + // Remember the original values + width = style.width; + minWidth = style.minWidth; + maxWidth = style.maxWidth; + + // Put in the new values to get a computed value out + style.minWidth = style.maxWidth = style.width = ret; + ret = computed.width; + + // Revert the changed values + style.width = width; + style.minWidth = minWidth; + style.maxWidth = maxWidth; + } + } + + return ret !== undefined ? + + // Support: IE <=9 - 11 only + // IE returns zIndex value as an integer. + ret + "" : + ret; +} + + +function addGetHookIf( conditionFn, hookFn ) { + + // Define the hook, we'll check on the first run if it's really needed. + return { + get: function() { + if ( conditionFn() ) { + + // Hook not needed (or it's not possible to use it due + // to missing dependency), remove it. + delete this.get; + return; + } + + // Hook needed; redefine it so that the support test is not executed again. + return ( this.get = hookFn ).apply( this, arguments ); + } + }; +} + + +var cssPrefixes = [ "Webkit", "Moz", "ms" ], + emptyStyle = document.createElement( "div" ).style, + vendorProps = {}; + +// Return a vendor-prefixed property or undefined +function vendorPropName( name ) { + + // Check for vendor prefixed names + var capName = name[ 0 ].toUpperCase() + name.slice( 1 ), + i = cssPrefixes.length; + + while ( i-- ) { + name = cssPrefixes[ i ] + capName; + if ( name in emptyStyle ) { + return name; + } + } +} + +// Return a potentially-mapped jQuery.cssProps or vendor prefixed property +function finalPropName( name ) { + var final = jQuery.cssProps[ name ] || vendorProps[ name ]; + + if ( final ) { + return final; + } + if ( name in emptyStyle ) { + return name; + } + return vendorProps[ name ] = vendorPropName( name ) || name; +} + + +var + + // Swappable if display is none or starts with table + // except "table", "table-cell", or "table-caption" + // See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display + rdisplayswap = /^(none|table(?!-c[ea]).+)/, + rcustomProp = /^--/, + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssNormalTransform = { + letterSpacing: "0", + fontWeight: "400" + }; + +function setPositiveNumber( _elem, value, subtract ) { + + // Any relative (+/-) values have already been + // normalized at this point + var matches = rcssNum.exec( value ); + return matches ? + + // Guard against undefined "subtract", e.g., when used as in cssHooks + Math.max( 0, matches[ 2 ] - ( subtract || 0 ) ) + ( matches[ 3 ] || "px" ) : + value; +} + +function boxModelAdjustment( elem, dimension, box, isBorderBox, styles, computedVal ) { + var i = dimension === "width" ? 1 : 0, + extra = 0, + delta = 0; + + // Adjustment may not be necessary + if ( box === ( isBorderBox ? "border" : "content" ) ) { + return 0; + } + + for ( ; i < 4; i += 2 ) { + + // Both box models exclude margin + if ( box === "margin" ) { + delta += jQuery.css( elem, box + cssExpand[ i ], true, styles ); + } + + // If we get here with a content-box, we're seeking "padding" or "border" or "margin" + if ( !isBorderBox ) { + + // Add padding + delta += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + + // For "border" or "margin", add border + if ( box !== "padding" ) { + delta += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + + // But still keep track of it otherwise + } else { + extra += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + + // If we get here with a border-box (content + padding + border), we're seeking "content" or + // "padding" or "margin" + } else { + + // For "content", subtract padding + if ( box === "content" ) { + delta -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + } + + // For "content" or "padding", subtract border + if ( box !== "margin" ) { + delta -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + } + } + + // Account for positive content-box scroll gutter when requested by providing computedVal + if ( !isBorderBox && computedVal >= 0 ) { + + // offsetWidth/offsetHeight is a rounded sum of content, padding, scroll gutter, and border + // Assuming integer scroll gutter, subtract the rest and round down + delta += Math.max( 0, Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + computedVal - + delta - + extra - + 0.5 + + // If offsetWidth/offsetHeight is unknown, then we can't determine content-box scroll gutter + // Use an explicit zero to avoid NaN (gh-3964) + ) ) || 0; + } + + return delta; +} + +function getWidthOrHeight( elem, dimension, extra ) { + + // Start with computed style + var styles = getStyles( elem ), + + // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-4322). + // Fake content-box until we know it's needed to know the true value. + boxSizingNeeded = !support.boxSizingReliable() || extra, + isBorderBox = boxSizingNeeded && + jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + valueIsBorderBox = isBorderBox, + + val = curCSS( elem, dimension, styles ), + offsetProp = "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ); + + // Support: Firefox <=54 + // Return a confounding non-pixel value or feign ignorance, as appropriate. + if ( rnumnonpx.test( val ) ) { + if ( !extra ) { + return val; + } + val = "auto"; + } + + + // Support: IE 9 - 11 only + // Use offsetWidth/offsetHeight for when box sizing is unreliable. + // In those cases, the computed value can be trusted to be border-box. + if ( ( !support.boxSizingReliable() && isBorderBox || + + // Support: IE 10 - 11+, Edge 15 - 18+ + // IE/Edge misreport `getComputedStyle` of table rows with width/height + // set in CSS while `offset*` properties report correct values. + // Interestingly, in some cases IE 9 doesn't suffer from this issue. + !support.reliableTrDimensions() && nodeName( elem, "tr" ) || + + // Fall back to offsetWidth/offsetHeight when value is "auto" + // This happens for inline elements with no explicit setting (gh-3571) + val === "auto" || + + // Support: Android <=4.1 - 4.3 only + // Also use offsetWidth/offsetHeight for misreported inline dimensions (gh-3602) + !parseFloat( val ) && jQuery.css( elem, "display", false, styles ) === "inline" ) && + + // Make sure the element is visible & connected + elem.getClientRects().length ) { + + isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box"; + + // Where available, offsetWidth/offsetHeight approximate border box dimensions. + // Where not available (e.g., SVG), assume unreliable box-sizing and interpret the + // retrieved value as a content box dimension. + valueIsBorderBox = offsetProp in elem; + if ( valueIsBorderBox ) { + val = elem[ offsetProp ]; + } + } + + // Normalize "" and auto + val = parseFloat( val ) || 0; + + // Adjust for the element's box model + return ( val + + boxModelAdjustment( + elem, + dimension, + extra || ( isBorderBox ? "border" : "content" ), + valueIsBorderBox, + styles, + + // Provide the current computed size to request scroll gutter calculation (gh-3589) + val + ) + ) + "px"; +} + +jQuery.extend( { + + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity" ); + return ret === "" ? "1" : ret; + } + } + } + }, + + // Don't automatically add "px" to these possibly-unitless properties + cssNumber: { + "animationIterationCount": true, + "columnCount": true, + "fillOpacity": true, + "flexGrow": true, + "flexShrink": true, + "fontWeight": true, + "gridArea": true, + "gridColumn": true, + "gridColumnEnd": true, + "gridColumnStart": true, + "gridRow": true, + "gridRowEnd": true, + "gridRowStart": true, + "lineHeight": true, + "opacity": true, + "order": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: {}, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ), + style = elem.style; + + // Make sure that we're working with the right name. We don't + // want to query the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Gets hook for the prefixed version, then unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // Convert "+=" or "-=" to relative numbers (#7345) + if ( type === "string" && ( ret = rcssNum.exec( value ) ) && ret[ 1 ] ) { + value = adjustCSS( elem, name, ret ); + + // Fixes bug #9237 + type = "number"; + } + + // Make sure that null and NaN values aren't set (#7116) + if ( value == null || value !== value ) { + return; + } + + // If a number was passed in, add the unit (except for certain CSS properties) + // The isCustomProp check can be removed in jQuery 4.0 when we only auto-append + // "px" to a few hardcoded values. + if ( type === "number" && !isCustomProp ) { + value += ret && ret[ 3 ] || ( jQuery.cssNumber[ origName ] ? "" : "px" ); + } + + // background-* props affect original clone's values + if ( !support.clearCloneStyle && value === "" && name.indexOf( "background" ) === 0 ) { + style[ name ] = "inherit"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !( "set" in hooks ) || + ( value = hooks.set( elem, value, extra ) ) !== undefined ) { + + if ( isCustomProp ) { + style.setProperty( name, value ); + } else { + style[ name ] = value; + } + } + + } else { + + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && + ( ret = hooks.get( elem, false, extra ) ) !== undefined ) { + + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra, styles ) { + var val, num, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ); + + // Make sure that we're working with the right name. We don't + // want to modify the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Try prefixed name followed by the unprefixed name + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks ) { + val = hooks.get( elem, true, extra ); + } + + // Otherwise, if a way to get the computed value exists, use that + if ( val === undefined ) { + val = curCSS( elem, name, styles ); + } + + // Convert "normal" to computed value + if ( val === "normal" && name in cssNormalTransform ) { + val = cssNormalTransform[ name ]; + } + + // Make numeric if forced or a qualifier was provided and val looks numeric + if ( extra === "" || extra ) { + num = parseFloat( val ); + return extra === true || isFinite( num ) ? num || 0 : val; + } + + return val; + } +} ); + +jQuery.each( [ "height", "width" ], function( _i, dimension ) { + jQuery.cssHooks[ dimension ] = { + get: function( elem, computed, extra ) { + if ( computed ) { + + // Certain elements can have dimension info if we invisibly show them + // but it must have a current display style that would benefit + return rdisplayswap.test( jQuery.css( elem, "display" ) ) && + + // Support: Safari 8+ + // Table columns in Safari have non-zero offsetWidth & zero + // getBoundingClientRect().width unless display is changed. + // Support: IE <=11 only + // Running getBoundingClientRect on a disconnected node + // in IE throws an error. + ( !elem.getClientRects().length || !elem.getBoundingClientRect().width ) ? + swap( elem, cssShow, function() { + return getWidthOrHeight( elem, dimension, extra ); + } ) : + getWidthOrHeight( elem, dimension, extra ); + } + }, + + set: function( elem, value, extra ) { + var matches, + styles = getStyles( elem ), + + // Only read styles.position if the test has a chance to fail + // to avoid forcing a reflow. + scrollboxSizeBuggy = !support.scrollboxSize() && + styles.position === "absolute", + + // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-3991) + boxSizingNeeded = scrollboxSizeBuggy || extra, + isBorderBox = boxSizingNeeded && + jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + subtract = extra ? + boxModelAdjustment( + elem, + dimension, + extra, + isBorderBox, + styles + ) : + 0; + + // Account for unreliable border-box dimensions by comparing offset* to computed and + // faking a content-box to get border and padding (gh-3699) + if ( isBorderBox && scrollboxSizeBuggy ) { + subtract -= Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + parseFloat( styles[ dimension ] ) - + boxModelAdjustment( elem, dimension, "border", false, styles ) - + 0.5 + ); + } + + // Convert to pixels if value adjustment is needed + if ( subtract && ( matches = rcssNum.exec( value ) ) && + ( matches[ 3 ] || "px" ) !== "px" ) { + + elem.style[ dimension ] = value; + value = jQuery.css( elem, dimension ); + } + + return setPositiveNumber( elem, value, subtract ); + } + }; +} ); + +jQuery.cssHooks.marginLeft = addGetHookIf( support.reliableMarginLeft, + function( elem, computed ) { + if ( computed ) { + return ( parseFloat( curCSS( elem, "marginLeft" ) ) || + elem.getBoundingClientRect().left - + swap( elem, { marginLeft: 0 }, function() { + return elem.getBoundingClientRect().left; + } ) + ) + "px"; + } + } +); + +// These hooks are used by animate to expand properties +jQuery.each( { + margin: "", + padding: "", + border: "Width" +}, function( prefix, suffix ) { + jQuery.cssHooks[ prefix + suffix ] = { + expand: function( value ) { + var i = 0, + expanded = {}, + + // Assumes a single number if not a string + parts = typeof value === "string" ? value.split( " " ) : [ value ]; + + for ( ; i < 4; i++ ) { + expanded[ prefix + cssExpand[ i ] + suffix ] = + parts[ i ] || parts[ i - 2 ] || parts[ 0 ]; + } + + return expanded; + } + }; + + if ( prefix !== "margin" ) { + jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber; + } +} ); + +jQuery.fn.extend( { + css: function( name, value ) { + return access( this, function( elem, name, value ) { + var styles, len, + map = {}, + i = 0; + + if ( Array.isArray( name ) ) { + styles = getStyles( elem ); + len = name.length; + + for ( ; i < len; i++ ) { + map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles ); + } + + return map; + } + + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }, name, value, arguments.length > 1 ); + } +} ); + + +function Tween( elem, options, prop, end, easing ) { + return new Tween.prototype.init( elem, options, prop, end, easing ); +} +jQuery.Tween = Tween; + +Tween.prototype = { + constructor: Tween, + init: function( elem, options, prop, end, easing, unit ) { + this.elem = elem; + this.prop = prop; + this.easing = easing || jQuery.easing._default; + this.options = options; + this.start = this.now = this.cur(); + this.end = end; + this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + }, + cur: function() { + var hooks = Tween.propHooks[ this.prop ]; + + return hooks && hooks.get ? + hooks.get( this ) : + Tween.propHooks._default.get( this ); + }, + run: function( percent ) { + var eased, + hooks = Tween.propHooks[ this.prop ]; + + if ( this.options.duration ) { + this.pos = eased = jQuery.easing[ this.easing ]( + percent, this.options.duration * percent, 0, 1, this.options.duration + ); + } else { + this.pos = eased = percent; + } + this.now = ( this.end - this.start ) * eased + this.start; + + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + if ( hooks && hooks.set ) { + hooks.set( this ); + } else { + Tween.propHooks._default.set( this ); + } + return this; + } +}; + +Tween.prototype.init.prototype = Tween.prototype; + +Tween.propHooks = { + _default: { + get: function( tween ) { + var result; + + // Use a property on the element directly when it is not a DOM element, + // or when there is no matching style property that exists. + if ( tween.elem.nodeType !== 1 || + tween.elem[ tween.prop ] != null && tween.elem.style[ tween.prop ] == null ) { + return tween.elem[ tween.prop ]; + } + + // Passing an empty string as a 3rd parameter to .css will automatically + // attempt a parseFloat and fallback to a string if the parse fails. + // Simple values such as "10px" are parsed to Float; + // complex values such as "rotate(1rad)" are returned as-is. + result = jQuery.css( tween.elem, tween.prop, "" ); + + // Empty strings, null, undefined and "auto" are converted to 0. + return !result || result === "auto" ? 0 : result; + }, + set: function( tween ) { + + // Use step hook for back compat. + // Use cssHook if its there. + // Use .style if available and use plain properties where available. + if ( jQuery.fx.step[ tween.prop ] ) { + jQuery.fx.step[ tween.prop ]( tween ); + } else if ( tween.elem.nodeType === 1 && ( + jQuery.cssHooks[ tween.prop ] || + tween.elem.style[ finalPropName( tween.prop ) ] != null ) ) { + jQuery.style( tween.elem, tween.prop, tween.now + tween.unit ); + } else { + tween.elem[ tween.prop ] = tween.now; + } + } + } +}; + +// Support: IE <=9 only +// Panic based approach to setting things on disconnected nodes +Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = { + set: function( tween ) { + if ( tween.elem.nodeType && tween.elem.parentNode ) { + tween.elem[ tween.prop ] = tween.now; + } + } +}; + +jQuery.easing = { + linear: function( p ) { + return p; + }, + swing: function( p ) { + return 0.5 - Math.cos( p * Math.PI ) / 2; + }, + _default: "swing" +}; + +jQuery.fx = Tween.prototype.init; + +// Back compat <1.8 extension point +jQuery.fx.step = {}; + + + + +var + fxNow, inProgress, + rfxtypes = /^(?:toggle|show|hide)$/, + rrun = /queueHooks$/; + +function schedule() { + if ( inProgress ) { + if ( document.hidden === false && window.requestAnimationFrame ) { + window.requestAnimationFrame( schedule ); + } else { + window.setTimeout( schedule, jQuery.fx.interval ); + } + + jQuery.fx.tick(); + } +} + +// Animations created synchronously will run synchronously +function createFxNow() { + window.setTimeout( function() { + fxNow = undefined; + } ); + return ( fxNow = Date.now() ); +} + +// Generate parameters to create a standard animation +function genFx( type, includeWidth ) { + var which, + i = 0, + attrs = { height: type }; + + // If we include width, step value is 1 to do all cssExpand values, + // otherwise step value is 2 to skip over Left and Right + includeWidth = includeWidth ? 1 : 0; + for ( ; i < 4; i += 2 - includeWidth ) { + which = cssExpand[ i ]; + attrs[ "margin" + which ] = attrs[ "padding" + which ] = type; + } + + if ( includeWidth ) { + attrs.opacity = attrs.width = type; + } + + return attrs; +} + +function createTween( value, prop, animation ) { + var tween, + collection = ( Animation.tweeners[ prop ] || [] ).concat( Animation.tweeners[ "*" ] ), + index = 0, + length = collection.length; + for ( ; index < length; index++ ) { + if ( ( tween = collection[ index ].call( animation, prop, value ) ) ) { + + // We're done with this property + return tween; + } + } +} + +function defaultPrefilter( elem, props, opts ) { + var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display, + isBox = "width" in props || "height" in props, + anim = this, + orig = {}, + style = elem.style, + hidden = elem.nodeType && isHiddenWithinTree( elem ), + dataShow = dataPriv.get( elem, "fxshow" ); + + // Queue-skipping animations hijack the fx hooks + if ( !opts.queue ) { + hooks = jQuery._queueHooks( elem, "fx" ); + if ( hooks.unqueued == null ) { + hooks.unqueued = 0; + oldfire = hooks.empty.fire; + hooks.empty.fire = function() { + if ( !hooks.unqueued ) { + oldfire(); + } + }; + } + hooks.unqueued++; + + anim.always( function() { + + // Ensure the complete handler is called before this completes + anim.always( function() { + hooks.unqueued--; + if ( !jQuery.queue( elem, "fx" ).length ) { + hooks.empty.fire(); + } + } ); + } ); + } + + // Detect show/hide animations + for ( prop in props ) { + value = props[ prop ]; + if ( rfxtypes.test( value ) ) { + delete props[ prop ]; + toggle = toggle || value === "toggle"; + if ( value === ( hidden ? "hide" : "show" ) ) { + + // Pretend to be hidden if this is a "show" and + // there is still data from a stopped show/hide + if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) { + hidden = true; + + // Ignore all other no-op show/hide data + } else { + continue; + } + } + orig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop ); + } + } + + // Bail out if this is a no-op like .hide().hide() + propTween = !jQuery.isEmptyObject( props ); + if ( !propTween && jQuery.isEmptyObject( orig ) ) { + return; + } + + // Restrict "overflow" and "display" styles during box animations + if ( isBox && elem.nodeType === 1 ) { + + // Support: IE <=9 - 11, Edge 12 - 15 + // Record all 3 overflow attributes because IE does not infer the shorthand + // from identically-valued overflowX and overflowY and Edge just mirrors + // the overflowX value there. + opts.overflow = [ style.overflow, style.overflowX, style.overflowY ]; + + // Identify a display type, preferring old show/hide data over the CSS cascade + restoreDisplay = dataShow && dataShow.display; + if ( restoreDisplay == null ) { + restoreDisplay = dataPriv.get( elem, "display" ); + } + display = jQuery.css( elem, "display" ); + if ( display === "none" ) { + if ( restoreDisplay ) { + display = restoreDisplay; + } else { + + // Get nonempty value(s) by temporarily forcing visibility + showHide( [ elem ], true ); + restoreDisplay = elem.style.display || restoreDisplay; + display = jQuery.css( elem, "display" ); + showHide( [ elem ] ); + } + } + + // Animate inline elements as inline-block + if ( display === "inline" || display === "inline-block" && restoreDisplay != null ) { + if ( jQuery.css( elem, "float" ) === "none" ) { + + // Restore the original display value at the end of pure show/hide animations + if ( !propTween ) { + anim.done( function() { + style.display = restoreDisplay; + } ); + if ( restoreDisplay == null ) { + display = style.display; + restoreDisplay = display === "none" ? "" : display; + } + } + style.display = "inline-block"; + } + } + } + + if ( opts.overflow ) { + style.overflow = "hidden"; + anim.always( function() { + style.overflow = opts.overflow[ 0 ]; + style.overflowX = opts.overflow[ 1 ]; + style.overflowY = opts.overflow[ 2 ]; + } ); + } + + // Implement show/hide animations + propTween = false; + for ( prop in orig ) { + + // General show/hide setup for this element animation + if ( !propTween ) { + if ( dataShow ) { + if ( "hidden" in dataShow ) { + hidden = dataShow.hidden; + } + } else { + dataShow = dataPriv.access( elem, "fxshow", { display: restoreDisplay } ); + } + + // Store hidden/visible for toggle so `.stop().toggle()` "reverses" + if ( toggle ) { + dataShow.hidden = !hidden; + } + + // Show elements before animating them + if ( hidden ) { + showHide( [ elem ], true ); + } + + /* eslint-disable no-loop-func */ + + anim.done( function() { + + /* eslint-enable no-loop-func */ + + // The final step of a "hide" animation is actually hiding the element + if ( !hidden ) { + showHide( [ elem ] ); + } + dataPriv.remove( elem, "fxshow" ); + for ( prop in orig ) { + jQuery.style( elem, prop, orig[ prop ] ); + } + } ); + } + + // Per-property setup + propTween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim ); + if ( !( prop in dataShow ) ) { + dataShow[ prop ] = propTween.start; + if ( hidden ) { + propTween.end = propTween.start; + propTween.start = 0; + } + } + } +} + +function propFilter( props, specialEasing ) { + var index, name, easing, value, hooks; + + // camelCase, specialEasing and expand cssHook pass + for ( index in props ) { + name = camelCase( index ); + easing = specialEasing[ name ]; + value = props[ index ]; + if ( Array.isArray( value ) ) { + easing = value[ 1 ]; + value = props[ index ] = value[ 0 ]; + } + + if ( index !== name ) { + props[ name ] = value; + delete props[ index ]; + } + + hooks = jQuery.cssHooks[ name ]; + if ( hooks && "expand" in hooks ) { + value = hooks.expand( value ); + delete props[ name ]; + + // Not quite $.extend, this won't overwrite existing keys. + // Reusing 'index' because we have the correct "name" + for ( index in value ) { + if ( !( index in props ) ) { + props[ index ] = value[ index ]; + specialEasing[ index ] = easing; + } + } + } else { + specialEasing[ name ] = easing; + } + } +} + +function Animation( elem, properties, options ) { + var result, + stopped, + index = 0, + length = Animation.prefilters.length, + deferred = jQuery.Deferred().always( function() { + + // Don't match elem in the :animated selector + delete tick.elem; + } ), + tick = function() { + if ( stopped ) { + return false; + } + var currentTime = fxNow || createFxNow(), + remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ), + + // Support: Android 2.3 only + // Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (#12497) + temp = remaining / animation.duration || 0, + percent = 1 - temp, + index = 0, + length = animation.tweens.length; + + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( percent ); + } + + deferred.notifyWith( elem, [ animation, percent, remaining ] ); + + // If there's more to do, yield + if ( percent < 1 && length ) { + return remaining; + } + + // If this was an empty animation, synthesize a final progress notification + if ( !length ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + } + + // Resolve the animation and report its conclusion + deferred.resolveWith( elem, [ animation ] ); + return false; + }, + animation = deferred.promise( { + elem: elem, + props: jQuery.extend( {}, properties ), + opts: jQuery.extend( true, { + specialEasing: {}, + easing: jQuery.easing._default + }, options ), + originalProperties: properties, + originalOptions: options, + startTime: fxNow || createFxNow(), + duration: options.duration, + tweens: [], + createTween: function( prop, end ) { + var tween = jQuery.Tween( elem, animation.opts, prop, end, + animation.opts.specialEasing[ prop ] || animation.opts.easing ); + animation.tweens.push( tween ); + return tween; + }, + stop: function( gotoEnd ) { + var index = 0, + + // If we are going to the end, we want to run all the tweens + // otherwise we skip this part + length = gotoEnd ? animation.tweens.length : 0; + if ( stopped ) { + return this; + } + stopped = true; + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( 1 ); + } + + // Resolve when we played the last frame; otherwise, reject + if ( gotoEnd ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + deferred.resolveWith( elem, [ animation, gotoEnd ] ); + } else { + deferred.rejectWith( elem, [ animation, gotoEnd ] ); + } + return this; + } + } ), + props = animation.props; + + propFilter( props, animation.opts.specialEasing ); + + for ( ; index < length; index++ ) { + result = Animation.prefilters[ index ].call( animation, elem, props, animation.opts ); + if ( result ) { + if ( isFunction( result.stop ) ) { + jQuery._queueHooks( animation.elem, animation.opts.queue ).stop = + result.stop.bind( result ); + } + return result; + } + } + + jQuery.map( props, createTween, animation ); + + if ( isFunction( animation.opts.start ) ) { + animation.opts.start.call( elem, animation ); + } + + // Attach callbacks from options + animation + .progress( animation.opts.progress ) + .done( animation.opts.done, animation.opts.complete ) + .fail( animation.opts.fail ) + .always( animation.opts.always ); + + jQuery.fx.timer( + jQuery.extend( tick, { + elem: elem, + anim: animation, + queue: animation.opts.queue + } ) + ); + + return animation; +} + +jQuery.Animation = jQuery.extend( Animation, { + + tweeners: { + "*": [ function( prop, value ) { + var tween = this.createTween( prop, value ); + adjustCSS( tween.elem, prop, rcssNum.exec( value ), tween ); + return tween; + } ] + }, + + tweener: function( props, callback ) { + if ( isFunction( props ) ) { + callback = props; + props = [ "*" ]; + } else { + props = props.match( rnothtmlwhite ); + } + + var prop, + index = 0, + length = props.length; + + for ( ; index < length; index++ ) { + prop = props[ index ]; + Animation.tweeners[ prop ] = Animation.tweeners[ prop ] || []; + Animation.tweeners[ prop ].unshift( callback ); + } + }, + + prefilters: [ defaultPrefilter ], + + prefilter: function( callback, prepend ) { + if ( prepend ) { + Animation.prefilters.unshift( callback ); + } else { + Animation.prefilters.push( callback ); + } + } +} ); + +jQuery.speed = function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { + complete: fn || !fn && easing || + isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !isFunction( easing ) && easing + }; + + // Go to the end state if fx are off + if ( jQuery.fx.off ) { + opt.duration = 0; + + } else { + if ( typeof opt.duration !== "number" ) { + if ( opt.duration in jQuery.fx.speeds ) { + opt.duration = jQuery.fx.speeds[ opt.duration ]; + + } else { + opt.duration = jQuery.fx.speeds._default; + } + } + } + + // Normalize opt.queue - true/undefined/null -> "fx" + if ( opt.queue == null || opt.queue === true ) { + opt.queue = "fx"; + } + + // Queueing + opt.old = opt.complete; + + opt.complete = function() { + if ( isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue ) { + jQuery.dequeue( this, opt.queue ); + } + }; + + return opt; +}; + +jQuery.fn.extend( { + fadeTo: function( speed, to, easing, callback ) { + + // Show any hidden elements after setting opacity to 0 + return this.filter( isHiddenWithinTree ).css( "opacity", 0 ).show() + + // Animate to the value specified + .end().animate( { opacity: to }, speed, easing, callback ); + }, + animate: function( prop, speed, easing, callback ) { + var empty = jQuery.isEmptyObject( prop ), + optall = jQuery.speed( speed, easing, callback ), + doAnimation = function() { + + // Operate on a copy of prop so per-property easing won't be lost + var anim = Animation( this, jQuery.extend( {}, prop ), optall ); + + // Empty animations, or finishing resolves immediately + if ( empty || dataPriv.get( this, "finish" ) ) { + anim.stop( true ); + } + }; + + doAnimation.finish = doAnimation; + + return empty || optall.queue === false ? + this.each( doAnimation ) : + this.queue( optall.queue, doAnimation ); + }, + stop: function( type, clearQueue, gotoEnd ) { + var stopQueue = function( hooks ) { + var stop = hooks.stop; + delete hooks.stop; + stop( gotoEnd ); + }; + + if ( typeof type !== "string" ) { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if ( clearQueue ) { + this.queue( type || "fx", [] ); + } + + return this.each( function() { + var dequeue = true, + index = type != null && type + "queueHooks", + timers = jQuery.timers, + data = dataPriv.get( this ); + + if ( index ) { + if ( data[ index ] && data[ index ].stop ) { + stopQueue( data[ index ] ); + } + } else { + for ( index in data ) { + if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) { + stopQueue( data[ index ] ); + } + } + } + + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && + ( type == null || timers[ index ].queue === type ) ) { + + timers[ index ].anim.stop( gotoEnd ); + dequeue = false; + timers.splice( index, 1 ); + } + } + + // Start the next in the queue if the last step wasn't forced. + // Timers currently will call their complete callbacks, which + // will dequeue but only if they were gotoEnd. + if ( dequeue || !gotoEnd ) { + jQuery.dequeue( this, type ); + } + } ); + }, + finish: function( type ) { + if ( type !== false ) { + type = type || "fx"; + } + return this.each( function() { + var index, + data = dataPriv.get( this ), + queue = data[ type + "queue" ], + hooks = data[ type + "queueHooks" ], + timers = jQuery.timers, + length = queue ? queue.length : 0; + + // Enable finishing flag on private data + data.finish = true; + + // Empty the queue first + jQuery.queue( this, type, [] ); + + if ( hooks && hooks.stop ) { + hooks.stop.call( this, true ); + } + + // Look for any active animations, and finish them + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && timers[ index ].queue === type ) { + timers[ index ].anim.stop( true ); + timers.splice( index, 1 ); + } + } + + // Look for any animations in the old queue and finish them + for ( index = 0; index < length; index++ ) { + if ( queue[ index ] && queue[ index ].finish ) { + queue[ index ].finish.call( this ); + } + } + + // Turn off finishing flag + delete data.finish; + } ); + } +} ); + +jQuery.each( [ "toggle", "show", "hide" ], function( _i, name ) { + var cssFn = jQuery.fn[ name ]; + jQuery.fn[ name ] = function( speed, easing, callback ) { + return speed == null || typeof speed === "boolean" ? + cssFn.apply( this, arguments ) : + this.animate( genFx( name, true ), speed, easing, callback ); + }; +} ); + +// Generate shortcuts for custom animations +jQuery.each( { + slideDown: genFx( "show" ), + slideUp: genFx( "hide" ), + slideToggle: genFx( "toggle" ), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +} ); + +jQuery.timers = []; +jQuery.fx.tick = function() { + var timer, + i = 0, + timers = jQuery.timers; + + fxNow = Date.now(); + + for ( ; i < timers.length; i++ ) { + timer = timers[ i ]; + + // Run the timer and safely remove it when done (allowing for external removal) + if ( !timer() && timers[ i ] === timer ) { + timers.splice( i--, 1 ); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + fxNow = undefined; +}; + +jQuery.fx.timer = function( timer ) { + jQuery.timers.push( timer ); + jQuery.fx.start(); +}; + +jQuery.fx.interval = 13; +jQuery.fx.start = function() { + if ( inProgress ) { + return; + } + + inProgress = true; + schedule(); +}; + +jQuery.fx.stop = function() { + inProgress = null; +}; + +jQuery.fx.speeds = { + slow: 600, + fast: 200, + + // Default speed + _default: 400 +}; + + +// Based off of the plugin by Clint Helfers, with permission. +// https://web.archive.org/web/20100324014747/http://blindsignals.com/index.php/2009/07/jquery-delay/ +jQuery.fn.delay = function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = window.setTimeout( next, time ); + hooks.stop = function() { + window.clearTimeout( timeout ); + }; + } ); +}; + + +( function() { + var input = document.createElement( "input" ), + select = document.createElement( "select" ), + opt = select.appendChild( document.createElement( "option" ) ); + + input.type = "checkbox"; + + // Support: Android <=4.3 only + // Default value for a checkbox should be "on" + support.checkOn = input.value !== ""; + + // Support: IE <=11 only + // Must access selectedIndex to make default options select + support.optSelected = opt.selected; + + // Support: IE <=11 only + // An input loses its value after becoming a radio + input = document.createElement( "input" ); + input.value = "t"; + input.type = "radio"; + support.radioValue = input.value === "t"; +} )(); + + +var boolHook, + attrHandle = jQuery.expr.attrHandle; + +jQuery.fn.extend( { + attr: function( name, value ) { + return access( this, jQuery.attr, name, value, arguments.length > 1 ); + }, + + removeAttr: function( name ) { + return this.each( function() { + jQuery.removeAttr( this, name ); + } ); + } +} ); + +jQuery.extend( { + attr: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set attributes on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + // Attribute hooks are determined by the lowercase version + // Grab necessary hook if one is defined + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + hooks = jQuery.attrHooks[ name.toLowerCase() ] || + ( jQuery.expr.match.bool.test( name ) ? boolHook : undefined ); + } + + if ( value !== undefined ) { + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + } + + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + elem.setAttribute( name, value + "" ); + return value; + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + ret = jQuery.find.attr( elem, name ); + + // Non-existent attributes return null, we normalize to undefined + return ret == null ? undefined : ret; + }, + + attrHooks: { + type: { + set: function( elem, value ) { + if ( !support.radioValue && value === "radio" && + nodeName( elem, "input" ) ) { + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + } + }, + + removeAttr: function( elem, value ) { + var name, + i = 0, + + // Attribute names can contain non-HTML whitespace characters + // https://html.spec.whatwg.org/multipage/syntax.html#attributes-2 + attrNames = value && value.match( rnothtmlwhite ); + + if ( attrNames && elem.nodeType === 1 ) { + while ( ( name = attrNames[ i++ ] ) ) { + elem.removeAttribute( name ); + } + } + } +} ); + +// Hooks for boolean attributes +boolHook = { + set: function( elem, value, name ) { + if ( value === false ) { + + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + elem.setAttribute( name, name ); + } + return name; + } +}; + +jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( _i, name ) { + var getter = attrHandle[ name ] || jQuery.find.attr; + + attrHandle[ name ] = function( elem, name, isXML ) { + var ret, handle, + lowercaseName = name.toLowerCase(); + + if ( !isXML ) { + + // Avoid an infinite loop by temporarily removing this function from the getter + handle = attrHandle[ lowercaseName ]; + attrHandle[ lowercaseName ] = ret; + ret = getter( elem, name, isXML ) != null ? + lowercaseName : + null; + attrHandle[ lowercaseName ] = handle; + } + return ret; + }; +} ); + + + + +var rfocusable = /^(?:input|select|textarea|button)$/i, + rclickable = /^(?:a|area)$/i; + +jQuery.fn.extend( { + prop: function( name, value ) { + return access( this, jQuery.prop, name, value, arguments.length > 1 ); + }, + + removeProp: function( name ) { + return this.each( function() { + delete this[ jQuery.propFix[ name ] || name ]; + } ); + } +} ); + +jQuery.extend( { + prop: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set properties on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + return ( elem[ name ] = value ); + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + return elem[ name ]; + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + + // Support: IE <=9 - 11 only + // elem.tabIndex doesn't always return the + // correct value when it hasn't been explicitly set + // https://web.archive.org/web/20141116233347/http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + // Use proper attribute retrieval(#12072) + var tabindex = jQuery.find.attr( elem, "tabindex" ); + + if ( tabindex ) { + return parseInt( tabindex, 10 ); + } + + if ( + rfocusable.test( elem.nodeName ) || + rclickable.test( elem.nodeName ) && + elem.href + ) { + return 0; + } + + return -1; + } + } + }, + + propFix: { + "for": "htmlFor", + "class": "className" + } +} ); + +// Support: IE <=11 only +// Accessing the selectedIndex property +// forces the browser to respect setting selected +// on the option +// The getter ensures a default option is selected +// when in an optgroup +// eslint rule "no-unused-expressions" is disabled for this code +// since it considers such accessions noop +if ( !support.optSelected ) { + jQuery.propHooks.selected = { + get: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent && parent.parentNode ) { + parent.parentNode.selectedIndex; + } + return null; + }, + set: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent ) { + parent.selectedIndex; + + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + } + }; +} + +jQuery.each( [ + "tabIndex", + "readOnly", + "maxLength", + "cellSpacing", + "cellPadding", + "rowSpan", + "colSpan", + "useMap", + "frameBorder", + "contentEditable" +], function() { + jQuery.propFix[ this.toLowerCase() ] = this; +} ); + + + + + // Strip and collapse whitespace according to HTML spec + // https://infra.spec.whatwg.org/#strip-and-collapse-ascii-whitespace + function stripAndCollapse( value ) { + var tokens = value.match( rnothtmlwhite ) || []; + return tokens.join( " " ); + } + + +function getClass( elem ) { + return elem.getAttribute && elem.getAttribute( "class" ) || ""; +} + +function classesToArray( value ) { + if ( Array.isArray( value ) ) { + return value; + } + if ( typeof value === "string" ) { + return value.match( rnothtmlwhite ) || []; + } + return []; +} + +jQuery.fn.extend( { + addClass: function( value ) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).addClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + classes = classesToArray( value ); + + if ( classes.length ) { + while ( ( elem = this[ i++ ] ) ) { + curValue = getClass( elem ); + cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + j = 0; + while ( ( clazz = classes[ j++ ] ) ) { + if ( cur.indexOf( " " + clazz + " " ) < 0 ) { + cur += clazz + " "; + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + elem.setAttribute( "class", finalValue ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).removeClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + if ( !arguments.length ) { + return this.attr( "class", "" ); + } + + classes = classesToArray( value ); + + if ( classes.length ) { + while ( ( elem = this[ i++ ] ) ) { + curValue = getClass( elem ); + + // This expression is here for better compressibility (see addClass) + cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + j = 0; + while ( ( clazz = classes[ j++ ] ) ) { + + // Remove *all* instances + while ( cur.indexOf( " " + clazz + " " ) > -1 ) { + cur = cur.replace( " " + clazz + " ", " " ); + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + elem.setAttribute( "class", finalValue ); + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isValidValue = type === "string" || Array.isArray( value ); + + if ( typeof stateVal === "boolean" && isValidValue ) { + return stateVal ? this.addClass( value ) : this.removeClass( value ); + } + + if ( isFunction( value ) ) { + return this.each( function( i ) { + jQuery( this ).toggleClass( + value.call( this, i, getClass( this ), stateVal ), + stateVal + ); + } ); + } + + return this.each( function() { + var className, i, self, classNames; + + if ( isValidValue ) { + + // Toggle individual class names + i = 0; + self = jQuery( this ); + classNames = classesToArray( value ); + + while ( ( className = classNames[ i++ ] ) ) { + + // Check each className given, space separated list + if ( self.hasClass( className ) ) { + self.removeClass( className ); + } else { + self.addClass( className ); + } + } + + // Toggle whole class name + } else if ( value === undefined || type === "boolean" ) { + className = getClass( this ); + if ( className ) { + + // Store className if set + dataPriv.set( this, "__className__", className ); + } + + // If the element has a class name or if we're passed `false`, + // then remove the whole classname (if there was one, the above saved it). + // Otherwise bring back whatever was previously saved (if anything), + // falling back to the empty string if nothing was stored. + if ( this.setAttribute ) { + this.setAttribute( "class", + className || value === false ? + "" : + dataPriv.get( this, "__className__" ) || "" + ); + } + } + } ); + }, + + hasClass: function( selector ) { + var className, elem, + i = 0; + + className = " " + selector + " "; + while ( ( elem = this[ i++ ] ) ) { + if ( elem.nodeType === 1 && + ( " " + stripAndCollapse( getClass( elem ) ) + " " ).indexOf( className ) > -1 ) { + return true; + } + } + + return false; + } +} ); + + + + +var rreturn = /\r/g; + +jQuery.fn.extend( { + val: function( value ) { + var hooks, ret, valueIsFunction, + elem = this[ 0 ]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.type ] || + jQuery.valHooks[ elem.nodeName.toLowerCase() ]; + + if ( hooks && + "get" in hooks && + ( ret = hooks.get( elem, "value" ) ) !== undefined + ) { + return ret; + } + + ret = elem.value; + + // Handle most common string cases + if ( typeof ret === "string" ) { + return ret.replace( rreturn, "" ); + } + + // Handle cases where value is null/undef or number + return ret == null ? "" : ret; + } + + return; + } + + valueIsFunction = isFunction( value ); + + return this.each( function( i ) { + var val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( valueIsFunction ) { + val = value.call( this, i, jQuery( this ).val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + + } else if ( typeof val === "number" ) { + val += ""; + + } else if ( Array.isArray( val ) ) { + val = jQuery.map( val, function( value ) { + return value == null ? "" : value + ""; + } ); + } + + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !( "set" in hooks ) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + } ); + } +} ); + +jQuery.extend( { + valHooks: { + option: { + get: function( elem ) { + + var val = jQuery.find.attr( elem, "value" ); + return val != null ? + val : + + // Support: IE <=10 - 11 only + // option.text throws exceptions (#14686, #14858) + // Strip and collapse whitespace + // https://html.spec.whatwg.org/#strip-and-collapse-whitespace + stripAndCollapse( jQuery.text( elem ) ); + } + }, + select: { + get: function( elem ) { + var value, option, i, + options = elem.options, + index = elem.selectedIndex, + one = elem.type === "select-one", + values = one ? null : [], + max = one ? index + 1 : options.length; + + if ( index < 0 ) { + i = max; + + } else { + i = one ? index : 0; + } + + // Loop through all the selected options + for ( ; i < max; i++ ) { + option = options[ i ]; + + // Support: IE <=9 only + // IE8-9 doesn't update selected after form reset (#2551) + if ( ( option.selected || i === index ) && + + // Don't return options that are disabled or in a disabled optgroup + !option.disabled && + ( !option.parentNode.disabled || + !nodeName( option.parentNode, "optgroup" ) ) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + }, + + set: function( elem, value ) { + var optionSet, option, + options = elem.options, + values = jQuery.makeArray( value ), + i = options.length; + + while ( i-- ) { + option = options[ i ]; + + /* eslint-disable no-cond-assign */ + + if ( option.selected = + jQuery.inArray( jQuery.valHooks.option.get( option ), values ) > -1 + ) { + optionSet = true; + } + + /* eslint-enable no-cond-assign */ + } + + // Force browsers to behave consistently when non-matching value is set + if ( !optionSet ) { + elem.selectedIndex = -1; + } + return values; + } + } + } +} ); + +// Radios and checkboxes getter/setter +jQuery.each( [ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + set: function( elem, value ) { + if ( Array.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery( elem ).val(), value ) > -1 ); + } + } + }; + if ( !support.checkOn ) { + jQuery.valHooks[ this ].get = function( elem ) { + return elem.getAttribute( "value" ) === null ? "on" : elem.value; + }; + } +} ); + + + + +// Return jQuery for attributes-only inclusion + + +support.focusin = "onfocusin" in window; + + +var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + stopPropagationCallback = function( e ) { + e.stopPropagation(); + }; + +jQuery.extend( jQuery.event, { + + trigger: function( event, data, elem, onlyHandlers ) { + + var i, cur, tmp, bubbleType, ontype, handle, special, lastElement, + eventPath = [ elem || document ], + type = hasOwn.call( event, "type" ) ? event.type : event, + namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split( "." ) : []; + + cur = lastElement = tmp = elem = elem || document; + + // Don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "." ) > -1 ) { + + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split( "." ); + type = namespaces.shift(); + namespaces.sort(); + } + ontype = type.indexOf( ":" ) < 0 && "on" + type; + + // Caller can pass in a jQuery.Event object, Object, or just an event type string + event = event[ jQuery.expando ] ? + event : + new jQuery.Event( type, typeof event === "object" && event ); + + // Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true) + event.isTrigger = onlyHandlers ? 2 : 3; + event.namespace = namespaces.join( "." ); + event.rnamespace = event.namespace ? + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ) : + null; + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data == null ? + [ event ] : + jQuery.makeArray( data, [ event ] ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + if ( !onlyHandlers && !special.noBubble && !isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + if ( !rfocusMorph.test( bubbleType + type ) ) { + cur = cur.parentNode; + } + for ( ; cur; cur = cur.parentNode ) { + eventPath.push( cur ); + tmp = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( tmp === ( elem.ownerDocument || document ) ) { + eventPath.push( tmp.defaultView || tmp.parentWindow || window ); + } + } + + // Fire handlers on the event path + i = 0; + while ( ( cur = eventPath[ i++ ] ) && !event.isPropagationStopped() ) { + lastElement = cur; + event.type = i > 1 ? + bubbleType : + special.bindType || type; + + // jQuery handler + handle = ( dataPriv.get( cur, "events" ) || Object.create( null ) )[ event.type ] && + dataPriv.get( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + + // Native handler + handle = ontype && cur[ ontype ]; + if ( handle && handle.apply && acceptData( cur ) ) { + event.result = handle.apply( cur, data ); + if ( event.result === false ) { + event.preventDefault(); + } + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( ( !special._default || + special._default.apply( eventPath.pop(), data ) === false ) && + acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name as the event. + // Don't do default actions on window, that's where global variables be (#6170) + if ( ontype && isFunction( elem[ type ] ) && !isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + tmp = elem[ ontype ]; + + if ( tmp ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + + if ( event.isPropagationStopped() ) { + lastElement.addEventListener( type, stopPropagationCallback ); + } + + elem[ type ](); + + if ( event.isPropagationStopped() ) { + lastElement.removeEventListener( type, stopPropagationCallback ); + } + + jQuery.event.triggered = undefined; + + if ( tmp ) { + elem[ ontype ] = tmp; + } + } + } + } + + return event.result; + }, + + // Piggyback on a donor event to simulate a different one + // Used only for `focus(in | out)` events + simulate: function( type, elem, event ) { + var e = jQuery.extend( + new jQuery.Event(), + event, + { + type: type, + isSimulated: true + } + ); + + jQuery.event.trigger( e, null, elem ); + } + +} ); + +jQuery.fn.extend( { + + trigger: function( type, data ) { + return this.each( function() { + jQuery.event.trigger( type, data, this ); + } ); + }, + triggerHandler: function( type, data ) { + var elem = this[ 0 ]; + if ( elem ) { + return jQuery.event.trigger( type, data, elem, true ); + } + } +} ); + + +// Support: Firefox <=44 +// Firefox doesn't have focus(in | out) events +// Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787 +// +// Support: Chrome <=48 - 49, Safari <=9.0 - 9.1 +// focus(in | out) events fire after focus & blur events, +// which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order +// Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857 +if ( !support.focusin ) { + jQuery.each( { focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler on the document while someone wants focusin/focusout + var handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ) ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + + // Handle: regular nodes (via `this.ownerDocument`), window + // (via `this.document`) & document (via `this`). + var doc = this.ownerDocument || this.document || this, + attaches = dataPriv.access( doc, fix ); + + if ( !attaches ) { + doc.addEventListener( orig, handler, true ); + } + dataPriv.access( doc, fix, ( attaches || 0 ) + 1 ); + }, + teardown: function() { + var doc = this.ownerDocument || this.document || this, + attaches = dataPriv.access( doc, fix ) - 1; + + if ( !attaches ) { + doc.removeEventListener( orig, handler, true ); + dataPriv.remove( doc, fix ); + + } else { + dataPriv.access( doc, fix, attaches ); + } + } + }; + } ); +} +var location = window.location; + +var nonce = { guid: Date.now() }; + +var rquery = ( /\?/ ); + + + +// Cross-browser xml parsing +jQuery.parseXML = function( data ) { + var xml, parserErrorElem; + if ( !data || typeof data !== "string" ) { + return null; + } + + // Support: IE 9 - 11 only + // IE throws on parseFromString with invalid input. + try { + xml = ( new window.DOMParser() ).parseFromString( data, "text/xml" ); + } catch ( e ) {} + + parserErrorElem = xml && xml.getElementsByTagName( "parsererror" )[ 0 ]; + if ( !xml || parserErrorElem ) { + jQuery.error( "Invalid XML: " + ( + parserErrorElem ? + jQuery.map( parserErrorElem.childNodes, function( el ) { + return el.textContent; + } ).join( "\n" ) : + data + ) ); + } + return xml; +}; + + +var + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i, + rsubmittable = /^(?:input|select|textarea|keygen)/i; + +function buildParams( prefix, obj, traditional, add ) { + var name; + + if ( Array.isArray( obj ) ) { + + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + + // Item is non-scalar (array or object), encode its numeric index. + buildParams( + prefix + "[" + ( typeof v === "object" && v != null ? i : "" ) + "]", + v, + traditional, + add + ); + } + } ); + + } else if ( !traditional && toType( obj ) === "object" ) { + + // Serialize object item. + for ( name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + + // Serialize scalar item. + add( prefix, obj ); + } +} + +// Serialize an array of form elements or a set of +// key/values into a query string +jQuery.param = function( a, traditional ) { + var prefix, + s = [], + add = function( key, valueOrFunction ) { + + // If value is a function, invoke it and use its return value + var value = isFunction( valueOrFunction ) ? + valueOrFunction() : + valueOrFunction; + + s[ s.length ] = encodeURIComponent( key ) + "=" + + encodeURIComponent( value == null ? "" : value ); + }; + + if ( a == null ) { + return ""; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( Array.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + } ); + + } else { + + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ); +}; + +jQuery.fn.extend( { + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + serializeArray: function() { + return this.map( function() { + + // Can add propHook for "elements" to filter or add form elements + var elements = jQuery.prop( this, "elements" ); + return elements ? jQuery.makeArray( elements ) : this; + } ).filter( function() { + var type = this.type; + + // Use .is( ":disabled" ) so that fieldset[disabled] works + return this.name && !jQuery( this ).is( ":disabled" ) && + rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) && + ( this.checked || !rcheckableType.test( type ) ); + } ).map( function( _i, elem ) { + var val = jQuery( this ).val(); + + if ( val == null ) { + return null; + } + + if ( Array.isArray( val ) ) { + return jQuery.map( val, function( val ) { + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ); + } + + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ).get(); + } +} ); + + +var + r20 = /%20/g, + rhash = /#.*$/, + rantiCache = /([?&])_=[^&]*/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg, + + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression + allTypes = "*/".concat( "*" ), + + // Anchor tag for parsing the document origin + originAnchor = document.createElement( "a" ); + +originAnchor.href = location.href; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + var dataType, + i = 0, + dataTypes = dataTypeExpression.toLowerCase().match( rnothtmlwhite ) || []; + + if ( isFunction( func ) ) { + + // For each dataType in the dataTypeExpression + while ( ( dataType = dataTypes[ i++ ] ) ) { + + // Prepend if requested + if ( dataType[ 0 ] === "+" ) { + dataType = dataType.slice( 1 ) || "*"; + ( structure[ dataType ] = structure[ dataType ] || [] ).unshift( func ); + + // Otherwise append + } else { + ( structure[ dataType ] = structure[ dataType ] || [] ).push( func ); + } + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) { + + var inspected = {}, + seekingTransport = ( structure === transports ); + + function inspect( dataType ) { + var selected; + inspected[ dataType ] = true; + jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) { + var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR ); + if ( typeof dataTypeOrTransport === "string" && + !seekingTransport && !inspected[ dataTypeOrTransport ] ) { + + options.dataTypes.unshift( dataTypeOrTransport ); + inspect( dataTypeOrTransport ); + return false; + } else if ( seekingTransport ) { + return !( selected = dataTypeOrTransport ); + } + } ); + return selected; + } + + return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" ); +} + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes #9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + + for ( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } + + return target; +} + +/* Handles responses to an ajax request: + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var ct, type, finalDataType, firstDataType, + contents = s.contents, + dataTypes = s.dataTypes; + + // Remove auto dataType and get content-type in the process + while ( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "Content-Type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[ 0 ] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +/* Chain conversions given the request and the original response + * Also sets the responseXXX fields on the jqXHR instance + */ +function ajaxConvert( s, response, jqXHR, isSuccess ) { + var conv2, current, conv, tmp, prev, + converters = {}, + + // Work with a copy of dataTypes in case we need to modify it for conversion + dataTypes = s.dataTypes.slice(); + + // Create converters map with lowercased keys + if ( dataTypes[ 1 ] ) { + for ( conv in s.converters ) { + converters[ conv.toLowerCase() ] = s.converters[ conv ]; + } + } + + current = dataTypes.shift(); + + // Convert to each sequential dataType + while ( current ) { + + if ( s.responseFields[ current ] ) { + jqXHR[ s.responseFields[ current ] ] = response; + } + + // Apply the dataFilter if provided + if ( !prev && isSuccess && s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + prev = current; + current = dataTypes.shift(); + + if ( current ) { + + // There's only work to do if current dataType is non-auto + if ( current === "*" ) { + + current = prev; + + // Convert response if prev dataType is non-auto and differs from current + } else if ( prev !== "*" && prev !== current ) { + + // Seek a direct converter + conv = converters[ prev + " " + current ] || converters[ "* " + current ]; + + // If none found, seek a pair + if ( !conv ) { + for ( conv2 in converters ) { + + // If conv2 outputs current + tmp = conv2.split( " " ); + if ( tmp[ 1 ] === current ) { + + // If prev can be converted to accepted input + conv = converters[ prev + " " + tmp[ 0 ] ] || + converters[ "* " + tmp[ 0 ] ]; + if ( conv ) { + + // Condense equivalence converters + if ( conv === true ) { + conv = converters[ conv2 ]; + + // Otherwise, insert the intermediate dataType + } else if ( converters[ conv2 ] !== true ) { + current = tmp[ 0 ]; + dataTypes.unshift( tmp[ 1 ] ); + } + break; + } + } + } + } + + // Apply converter (if not an equivalence) + if ( conv !== true ) { + + // Unless errors are allowed to bubble, catch and return them + if ( conv && s.throws ) { + response = conv( response ); + } else { + try { + response = conv( response ); + } catch ( e ) { + return { + state: "parsererror", + error: conv ? e : "No conversion from " + prev + " to " + current + }; + } + } + } + } + } + } + + return { state: "success", data: response }; +} + +jQuery.extend( { + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {}, + + ajaxSettings: { + url: location.href, + type: "GET", + isLocal: rlocalProtocol.test( location.protocol ), + global: true, + processData: true, + async: true, + contentType: "application/x-www-form-urlencoded; charset=UTF-8", + + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + throws: false, + traditional: false, + headers: {}, + */ + + accepts: { + "*": allTypes, + text: "text/plain", + html: "text/html", + xml: "application/xml, text/xml", + json: "application/json, text/javascript" + }, + + contents: { + xml: /\bxml\b/, + html: /\bhtml/, + json: /\bjson\b/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText", + json: "responseJSON" + }, + + // Data converters + // Keys separate source (or catchall "*") and destination types with a single space + converters: { + + // Convert anything to text + "* text": String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": JSON.parse, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + url: true, + context: true + } + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + return settings ? + + // Building a settings object + ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) : + + // Extending ajaxSettings + ajaxExtend( jQuery.ajaxSettings, target ); + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var transport, + + // URL without anti-cache param + cacheURL, + + // Response headers + responseHeadersString, + responseHeaders, + + // timeout handle + timeoutTimer, + + // Url cleanup var + urlAnchor, + + // Request state (becomes false upon send and true upon completion) + completed, + + // To know if global events are to be dispatched + fireGlobals, + + // Loop variable + i, + + // uncached part of the url + uncached, + + // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + + // Callbacks context + callbackContext = s.context || s, + + // Context for global events is callbackContext if it is a DOM node or jQuery collection + globalEventContext = s.context && + ( callbackContext.nodeType || callbackContext.jquery ) ? + jQuery( callbackContext ) : + jQuery.event, + + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery.Callbacks( "once memory" ), + + // Status-dependent callbacks + statusCode = s.statusCode || {}, + + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + + // Default abort message + strAbort = "canceled", + + // Fake xhr + jqXHR = { + readyState: 0, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( completed ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while ( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[ 1 ].toLowerCase() + " " ] = + ( responseHeaders[ match[ 1 ].toLowerCase() + " " ] || [] ) + .concat( match[ 2 ] ); + } + } + match = responseHeaders[ key.toLowerCase() + " " ]; + } + return match == null ? null : match.join( ", " ); + }, + + // Raw string + getAllResponseHeaders: function() { + return completed ? responseHeadersString : null; + }, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( completed == null ) { + name = requestHeadersNames[ name.toLowerCase() ] = + requestHeadersNames[ name.toLowerCase() ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( completed == null ) { + s.mimeType = type; + } + return this; + }, + + // Status-dependent callbacks + statusCode: function( map ) { + var code; + if ( map ) { + if ( completed ) { + + // Execute the appropriate callbacks + jqXHR.always( map[ jqXHR.status ] ); + } else { + + // Lazy-add the new callbacks in a way that preserves old ones + for ( code in map ) { + statusCode[ code ] = [ statusCode[ code ], map[ code ] ]; + } + } + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + var finalText = statusText || strAbort; + if ( transport ) { + transport.abort( finalText ); + } + done( 0, finalText ); + return this; + } + }; + + // Attach deferreds + deferred.promise( jqXHR ); + + // Add protocol if not provided (prefilters might expect it) + // Handle falsy url in the settings object (#10093: consistency with old signature) + // We also use the url parameter if available + s.url = ( ( url || s.url || location.href ) + "" ) + .replace( rprotocol, location.protocol + "//" ); + + // Alias method option to type as per ticket #12004 + s.type = options.method || options.type || s.method || s.type; + + // Extract dataTypes list + s.dataTypes = ( s.dataType || "*" ).toLowerCase().match( rnothtmlwhite ) || [ "" ]; + + // A cross-domain request is in order when the origin doesn't match the current origin. + if ( s.crossDomain == null ) { + urlAnchor = document.createElement( "a" ); + + // Support: IE <=8 - 11, Edge 12 - 15 + // IE throws exception on accessing the href property if url is malformed, + // e.g. http://example.com:80x/ + try { + urlAnchor.href = s.url; + + // Support: IE <=8 - 11 only + // Anchor's host property isn't correctly set when s.url is relative + urlAnchor.href = urlAnchor.href; + s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !== + urlAnchor.protocol + "//" + urlAnchor.host; + } catch ( e ) { + + // If there is an error parsing the URL, assume it is crossDomain, + // it can be rejected by the transport if it is invalid + s.crossDomain = true; + } + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefilter, stop there + if ( completed ) { + return jqXHR; + } + + // We can fire global events as of now if asked to + // Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118) + fireGlobals = jQuery.event && s.global; + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Save the URL in case we're toying with the If-Modified-Since + // and/or If-None-Match header later on + // Remove hash to simplify url manipulation + cacheURL = s.url.replace( rhash, "" ); + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // Remember the hash so we can put it back + uncached = s.url.slice( cacheURL.length ); + + // If data is available and should be processed, append data to url + if ( s.data && ( s.processData || typeof s.data === "string" ) ) { + cacheURL += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data; + + // #9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Add or update anti-cache param if needed + if ( s.cache === false ) { + cacheURL = cacheURL.replace( rantiCache, "$1" ); + uncached = ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + ( nonce.guid++ ) + + uncached; + } + + // Put hash and anti-cache on the URL that will be requested (gh-1732) + s.url = cacheURL + uncached; + + // Change '%20' to '+' if this is encoded form body content (gh-2658) + } else if ( s.data && s.processData && + ( s.contentType || "" ).indexOf( "application/x-www-form-urlencoded" ) === 0 ) { + s.data = s.data.replace( r20, "+" ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + if ( jQuery.lastModified[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] ); + } + if ( jQuery.etag[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[ 0 ] ] ? + s.accepts[ s.dataTypes[ 0 ] ] + + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && + ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || completed ) ) { + + // Abort if not done already and return + return jqXHR.abort(); + } + + // Aborting is no longer a cancellation + strAbort = "abort"; + + // Install callbacks on deferreds + completeDeferred.add( s.complete ); + jqXHR.done( s.success ); + jqXHR.fail( s.error ); + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + + // If request was aborted inside ajaxSend, stop there + if ( completed ) { + return jqXHR; + } + + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = window.setTimeout( function() { + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + completed = false; + transport.send( requestHeaders, done ); + } catch ( e ) { + + // Rethrow post-completion exceptions + if ( completed ) { + throw e; + } + + // Propagate others as results + done( -1, e ); + } + } + + // Callback for when everything is done + function done( status, nativeStatusText, responses, headers ) { + var isSuccess, success, error, response, modified, + statusText = nativeStatusText; + + // Ignore repeat invocations + if ( completed ) { + return; + } + + completed = true; + + // Clear timeout if it exists + if ( timeoutTimer ) { + window.clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + // Determine if successful + isSuccess = status >= 200 && status < 300 || status === 304; + + // Get response data + if ( responses ) { + response = ajaxHandleResponses( s, jqXHR, responses ); + } + + // Use a noop converter for missing script but not if jsonp + if ( !isSuccess && + jQuery.inArray( "script", s.dataTypes ) > -1 && + jQuery.inArray( "json", s.dataTypes ) < 0 ) { + s.converters[ "text script" ] = function() {}; + } + + // Convert no matter what (that way responseXXX fields are always set) + response = ajaxConvert( s, response, jqXHR, isSuccess ); + + // If successful, handle type chaining + if ( isSuccess ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + modified = jqXHR.getResponseHeader( "Last-Modified" ); + if ( modified ) { + jQuery.lastModified[ cacheURL ] = modified; + } + modified = jqXHR.getResponseHeader( "etag" ); + if ( modified ) { + jQuery.etag[ cacheURL ] = modified; + } + } + + // if no content + if ( status === 204 || s.type === "HEAD" ) { + statusText = "nocontent"; + + // if not modified + } else if ( status === 304 ) { + statusText = "notmodified"; + + // If we have data, let's convert it + } else { + statusText = response.state; + success = response.data; + error = response.error; + isSuccess = !error; + } + } else { + + // Extract error from statusText and normalize for non-aborts + error = statusText; + if ( status || !statusText ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = ( nativeStatusText || statusText ) + ""; + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError", + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); + + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + return jqXHR; + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + } +} ); + +jQuery.each( [ "get", "post" ], function( _i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + + // Shift arguments if data argument was omitted + if ( isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + // The url can be an options object (which then must have .url) + return jQuery.ajax( jQuery.extend( { + url: url, + type: method, + dataType: type, + data: data, + success: callback + }, jQuery.isPlainObject( url ) && url ) ); + }; +} ); + +jQuery.ajaxPrefilter( function( s ) { + var i; + for ( i in s.headers ) { + if ( i.toLowerCase() === "content-type" ) { + s.contentType = s.headers[ i ] || ""; + } + } +} ); + + +jQuery._evalUrl = function( url, options, doc ) { + return jQuery.ajax( { + url: url, + + // Make this explicit, since user can override this through ajaxSetup (#11264) + type: "GET", + dataType: "script", + cache: true, + async: false, + global: false, + + // Only evaluate the response if it is successful (gh-4126) + // dataFilter is not invoked for failure responses, so using it instead + // of the default converter is kludgy but it works. + converters: { + "text script": function() {} + }, + dataFilter: function( response ) { + jQuery.globalEval( response, options, doc ); + } + } ); +}; + + +jQuery.fn.extend( { + wrapAll: function( html ) { + var wrap; + + if ( this[ 0 ] ) { + if ( isFunction( html ) ) { + html = html.call( this[ 0 ] ); + } + + // The elements to wrap the target around + wrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true ); + + if ( this[ 0 ].parentNode ) { + wrap.insertBefore( this[ 0 ] ); + } + + wrap.map( function() { + var elem = this; + + while ( elem.firstElementChild ) { + elem = elem.firstElementChild; + } + + return elem; + } ).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( isFunction( html ) ) { + return this.each( function( i ) { + jQuery( this ).wrapInner( html.call( this, i ) ); + } ); + } + + return this.each( function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + } ); + }, + + wrap: function( html ) { + var htmlIsFunction = isFunction( html ); + + return this.each( function( i ) { + jQuery( this ).wrapAll( htmlIsFunction ? html.call( this, i ) : html ); + } ); + }, + + unwrap: function( selector ) { + this.parent( selector ).not( "body" ).each( function() { + jQuery( this ).replaceWith( this.childNodes ); + } ); + return this; + } +} ); + + +jQuery.expr.pseudos.hidden = function( elem ) { + return !jQuery.expr.pseudos.visible( elem ); +}; +jQuery.expr.pseudos.visible = function( elem ) { + return !!( elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length ); +}; + + + + +jQuery.ajaxSettings.xhr = function() { + try { + return new window.XMLHttpRequest(); + } catch ( e ) {} +}; + +var xhrSuccessStatus = { + + // File protocol always yields status code 0, assume 200 + 0: 200, + + // Support: IE <=9 only + // #1450: sometimes IE returns 1223 when it should be 204 + 1223: 204 + }, + xhrSupported = jQuery.ajaxSettings.xhr(); + +support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported ); +support.ajax = xhrSupported = !!xhrSupported; + +jQuery.ajaxTransport( function( options ) { + var callback, errorCallback; + + // Cross domain only allowed if supported through XMLHttpRequest + if ( support.cors || xhrSupported && !options.crossDomain ) { + return { + send: function( headers, complete ) { + var i, + xhr = options.xhr(); + + xhr.open( + options.type, + options.url, + options.async, + options.username, + options.password + ); + + // Apply custom fields if provided + if ( options.xhrFields ) { + for ( i in options.xhrFields ) { + xhr[ i ] = options.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( options.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( options.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !options.crossDomain && !headers[ "X-Requested-With" ] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Set headers + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + + // Callback + callback = function( type ) { + return function() { + if ( callback ) { + callback = errorCallback = xhr.onload = + xhr.onerror = xhr.onabort = xhr.ontimeout = + xhr.onreadystatechange = null; + + if ( type === "abort" ) { + xhr.abort(); + } else if ( type === "error" ) { + + // Support: IE <=9 only + // On a manual native abort, IE9 throws + // errors on any property access that is not readyState + if ( typeof xhr.status !== "number" ) { + complete( 0, "error" ); + } else { + complete( + + // File: protocol always yields status 0; see #8605, #14207 + xhr.status, + xhr.statusText + ); + } + } else { + complete( + xhrSuccessStatus[ xhr.status ] || xhr.status, + xhr.statusText, + + // Support: IE <=9 only + // IE9 has no XHR2 but throws on binary (trac-11426) + // For XHR2 non-text, let the caller handle it (gh-2498) + ( xhr.responseType || "text" ) !== "text" || + typeof xhr.responseText !== "string" ? + { binary: xhr.response } : + { text: xhr.responseText }, + xhr.getAllResponseHeaders() + ); + } + } + }; + }; + + // Listen to events + xhr.onload = callback(); + errorCallback = xhr.onerror = xhr.ontimeout = callback( "error" ); + + // Support: IE 9 only + // Use onreadystatechange to replace onabort + // to handle uncaught aborts + if ( xhr.onabort !== undefined ) { + xhr.onabort = errorCallback; + } else { + xhr.onreadystatechange = function() { + + // Check readyState before timeout as it changes + if ( xhr.readyState === 4 ) { + + // Allow onerror to be called first, + // but that will not handle a native abort + // Also, save errorCallback to a variable + // as xhr.onerror cannot be accessed + window.setTimeout( function() { + if ( callback ) { + errorCallback(); + } + } ); + } + }; + } + + // Create the abort callback + callback = callback( "abort" ); + + try { + + // Do send the request (this may raise an exception) + xhr.send( options.hasContent && options.data || null ); + } catch ( e ) { + + // #14683: Only rethrow if this hasn't been notified as an error yet + if ( callback ) { + throw e; + } + } + }, + + abort: function() { + if ( callback ) { + callback(); + } + } + }; + } +} ); + + + + +// Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432) +jQuery.ajaxPrefilter( function( s ) { + if ( s.crossDomain ) { + s.contents.script = false; + } +} ); + +// Install script dataType +jQuery.ajaxSetup( { + accepts: { + script: "text/javascript, application/javascript, " + + "application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /\b(?:java|ecma)script\b/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +} ); + +// Handle cache's special case and crossDomain +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + } +} ); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function( s ) { + + // This transport only deals with cross domain or forced-by-attrs requests + if ( s.crossDomain || s.scriptAttrs ) { + var script, callback; + return { + send: function( _, complete ) { + script = jQuery( " +{% endmacro %} diff --git a/_static/scripts/bootstrap.js b/_static/scripts/bootstrap.js new file mode 100644 index 0000000..766173a --- /dev/null +++ b/_static/scripts/bootstrap.js @@ -0,0 +1,3 @@ +/*! For license information please see bootstrap.js.LICENSE.txt */ +(()=>{"use strict";var t={d:(e,i)=>{for(var n in i)t.o(i,n)&&!t.o(e,n)&&Object.defineProperty(e,n,{enumerable:!0,get:i[n]})},o:(t,e)=>Object.prototype.hasOwnProperty.call(t,e),r:t=>{"undefined"!=typeof Symbol&&Symbol.toStringTag&&Object.defineProperty(t,Symbol.toStringTag,{value:"Module"}),Object.defineProperty(t,"__esModule",{value:!0})}},e={};t.r(e),t.d(e,{afterMain:()=>w,afterRead:()=>b,afterWrite:()=>C,applyStyles:()=>$,arrow:()=>G,auto:()=>r,basePlacements:()=>a,beforeMain:()=>v,beforeRead:()=>m,beforeWrite:()=>A,bottom:()=>n,clippingParents:()=>h,computeStyles:()=>et,createPopper:()=>Dt,createPopperBase:()=>Lt,createPopperLite:()=>$t,detectOverflow:()=>mt,end:()=>c,eventListeners:()=>nt,flip:()=>_t,hide:()=>yt,left:()=>o,main:()=>y,modifierPhases:()=>T,offset:()=>wt,placements:()=>g,popper:()=>d,popperGenerator:()=>kt,popperOffsets:()=>At,preventOverflow:()=>Et,read:()=>_,reference:()=>f,right:()=>s,start:()=>l,top:()=>i,variationPlacements:()=>p,viewport:()=>u,write:()=>E});var i="top",n="bottom",s="right",o="left",r="auto",a=[i,n,s,o],l="start",c="end",h="clippingParents",u="viewport",d="popper",f="reference",p=a.reduce((function(t,e){return t.concat([e+"-"+l,e+"-"+c])}),[]),g=[].concat(a,[r]).reduce((function(t,e){return t.concat([e,e+"-"+l,e+"-"+c])}),[]),m="beforeRead",_="read",b="afterRead",v="beforeMain",y="main",w="afterMain",A="beforeWrite",E="write",C="afterWrite",T=[m,_,b,v,y,w,A,E,C];function O(t){return t?(t.nodeName||"").toLowerCase():null}function x(t){if(null==t)return window;if("[object Window]"!==t.toString()){var e=t.ownerDocument;return e&&e.defaultView||window}return t}function k(t){return t instanceof x(t).Element||t instanceof Element}function L(t){return t instanceof x(t).HTMLElement||t instanceof HTMLElement}function D(t){return"undefined"!=typeof ShadowRoot&&(t instanceof x(t).ShadowRoot||t instanceof ShadowRoot)}const $={name:"applyStyles",enabled:!0,phase:"write",fn:function(t){var e=t.state;Object.keys(e.elements).forEach((function(t){var i=e.styles[t]||{},n=e.attributes[t]||{},s=e.elements[t];L(s)&&O(s)&&(Object.assign(s.style,i),Object.keys(n).forEach((function(t){var e=n[t];!1===e?s.removeAttribute(t):s.setAttribute(t,!0===e?"":e)})))}))},effect:function(t){var e=t.state,i={popper:{position:e.options.strategy,left:"0",top:"0",margin:"0"},arrow:{position:"absolute"},reference:{}};return Object.assign(e.elements.popper.style,i.popper),e.styles=i,e.elements.arrow&&Object.assign(e.elements.arrow.style,i.arrow),function(){Object.keys(e.elements).forEach((function(t){var n=e.elements[t],s=e.attributes[t]||{},o=Object.keys(e.styles.hasOwnProperty(t)?e.styles[t]:i[t]).reduce((function(t,e){return t[e]="",t}),{});L(n)&&O(n)&&(Object.assign(n.style,o),Object.keys(s).forEach((function(t){n.removeAttribute(t)})))}))}},requires:["computeStyles"]};function S(t){return t.split("-")[0]}var I=Math.max,N=Math.min,P=Math.round;function j(){var t=navigator.userAgentData;return null!=t&&t.brands&&Array.isArray(t.brands)?t.brands.map((function(t){return t.brand+"/"+t.version})).join(" "):navigator.userAgent}function M(){return!/^((?!chrome|android).)*safari/i.test(j())}function H(t,e,i){void 0===e&&(e=!1),void 0===i&&(i=!1);var n=t.getBoundingClientRect(),s=1,o=1;e&&L(t)&&(s=t.offsetWidth>0&&P(n.width)/t.offsetWidth||1,o=t.offsetHeight>0&&P(n.height)/t.offsetHeight||1);var r=(k(t)?x(t):window).visualViewport,a=!M()&&i,l=(n.left+(a&&r?r.offsetLeft:0))/s,c=(n.top+(a&&r?r.offsetTop:0))/o,h=n.width/s,u=n.height/o;return{width:h,height:u,top:c,right:l+h,bottom:c+u,left:l,x:l,y:c}}function W(t){var e=H(t),i=t.offsetWidth,n=t.offsetHeight;return Math.abs(e.width-i)<=1&&(i=e.width),Math.abs(e.height-n)<=1&&(n=e.height),{x:t.offsetLeft,y:t.offsetTop,width:i,height:n}}function F(t,e){var i=e.getRootNode&&e.getRootNode();if(t.contains(e))return!0;if(i&&D(i)){var n=e;do{if(n&&t.isSameNode(n))return!0;n=n.parentNode||n.host}while(n)}return!1}function B(t){return x(t).getComputedStyle(t)}function z(t){return["table","td","th"].indexOf(O(t))>=0}function q(t){return((k(t)?t.ownerDocument:t.document)||window.document).documentElement}function R(t){return"html"===O(t)?t:t.assignedSlot||t.parentNode||(D(t)?t.host:null)||q(t)}function V(t){return L(t)&&"fixed"!==B(t).position?t.offsetParent:null}function K(t){for(var e=x(t),i=V(t);i&&z(i)&&"static"===B(i).position;)i=V(i);return i&&("html"===O(i)||"body"===O(i)&&"static"===B(i).position)?e:i||function(t){var e=/firefox/i.test(j());if(/Trident/i.test(j())&&L(t)&&"fixed"===B(t).position)return null;var i=R(t);for(D(i)&&(i=i.host);L(i)&&["html","body"].indexOf(O(i))<0;){var n=B(i);if("none"!==n.transform||"none"!==n.perspective||"paint"===n.contain||-1!==["transform","perspective"].indexOf(n.willChange)||e&&"filter"===n.willChange||e&&n.filter&&"none"!==n.filter)return i;i=i.parentNode}return null}(t)||e}function Q(t){return["top","bottom"].indexOf(t)>=0?"x":"y"}function X(t,e,i){return I(t,N(e,i))}function Y(t){return Object.assign({},{top:0,right:0,bottom:0,left:0},t)}function U(t,e){return e.reduce((function(e,i){return e[i]=t,e}),{})}const G={name:"arrow",enabled:!0,phase:"main",fn:function(t){var e,r=t.state,l=t.name,c=t.options,h=r.elements.arrow,u=r.modifiersData.popperOffsets,d=S(r.placement),f=Q(d),p=[o,s].indexOf(d)>=0?"height":"width";if(h&&u){var g=function(t,e){return Y("number"!=typeof(t="function"==typeof t?t(Object.assign({},e.rects,{placement:e.placement})):t)?t:U(t,a))}(c.padding,r),m=W(h),_="y"===f?i:o,b="y"===f?n:s,v=r.rects.reference[p]+r.rects.reference[f]-u[f]-r.rects.popper[p],y=u[f]-r.rects.reference[f],w=K(h),A=w?"y"===f?w.clientHeight||0:w.clientWidth||0:0,E=v/2-y/2,C=g[_],T=A-m[p]-g[b],O=A/2-m[p]/2+E,x=X(C,O,T),k=f;r.modifiersData[l]=((e={})[k]=x,e.centerOffset=x-O,e)}},effect:function(t){var e=t.state,i=t.options.element,n=void 0===i?"[data-popper-arrow]":i;null!=n&&("string"!=typeof n||(n=e.elements.popper.querySelector(n)))&&F(e.elements.popper,n)&&(e.elements.arrow=n)},requires:["popperOffsets"],requiresIfExists:["preventOverflow"]};function J(t){return t.split("-")[1]}var Z={top:"auto",right:"auto",bottom:"auto",left:"auto"};function tt(t){var e,r=t.popper,a=t.popperRect,l=t.placement,h=t.variation,u=t.offsets,d=t.position,f=t.gpuAcceleration,p=t.adaptive,g=t.roundOffsets,m=t.isFixed,_=u.x,b=void 0===_?0:_,v=u.y,y=void 0===v?0:v,w="function"==typeof g?g({x:b,y}):{x:b,y};b=w.x,y=w.y;var A=u.hasOwnProperty("x"),E=u.hasOwnProperty("y"),C=o,T=i,O=window;if(p){var k=K(r),L="clientHeight",D="clientWidth";k===x(r)&&"static"!==B(k=q(r)).position&&"absolute"===d&&(L="scrollHeight",D="scrollWidth"),(l===i||(l===o||l===s)&&h===c)&&(T=n,y-=(m&&k===O&&O.visualViewport?O.visualViewport.height:k[L])-a.height,y*=f?1:-1),l!==o&&(l!==i&&l!==n||h!==c)||(C=s,b-=(m&&k===O&&O.visualViewport?O.visualViewport.width:k[D])-a.width,b*=f?1:-1)}var $,S=Object.assign({position:d},p&&Z),I=!0===g?function(t,e){var i=t.x,n=t.y,s=e.devicePixelRatio||1;return{x:P(i*s)/s||0,y:P(n*s)/s||0}}({x:b,y},x(r)):{x:b,y};return b=I.x,y=I.y,f?Object.assign({},S,(($={})[T]=E?"0":"",$[C]=A?"0":"",$.transform=(O.devicePixelRatio||1)<=1?"translate("+b+"px, "+y+"px)":"translate3d("+b+"px, "+y+"px, 0)",$)):Object.assign({},S,((e={})[T]=E?y+"px":"",e[C]=A?b+"px":"",e.transform="",e))}const et={name:"computeStyles",enabled:!0,phase:"beforeWrite",fn:function(t){var e=t.state,i=t.options,n=i.gpuAcceleration,s=void 0===n||n,o=i.adaptive,r=void 0===o||o,a=i.roundOffsets,l=void 0===a||a,c={placement:S(e.placement),variation:J(e.placement),popper:e.elements.popper,popperRect:e.rects.popper,gpuAcceleration:s,isFixed:"fixed"===e.options.strategy};null!=e.modifiersData.popperOffsets&&(e.styles.popper=Object.assign({},e.styles.popper,tt(Object.assign({},c,{offsets:e.modifiersData.popperOffsets,position:e.options.strategy,adaptive:r,roundOffsets:l})))),null!=e.modifiersData.arrow&&(e.styles.arrow=Object.assign({},e.styles.arrow,tt(Object.assign({},c,{offsets:e.modifiersData.arrow,position:"absolute",adaptive:!1,roundOffsets:l})))),e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-placement":e.placement})},data:{}};var it={passive:!0};const nt={name:"eventListeners",enabled:!0,phase:"write",fn:function(){},effect:function(t){var e=t.state,i=t.instance,n=t.options,s=n.scroll,o=void 0===s||s,r=n.resize,a=void 0===r||r,l=x(e.elements.popper),c=[].concat(e.scrollParents.reference,e.scrollParents.popper);return o&&c.forEach((function(t){t.addEventListener("scroll",i.update,it)})),a&&l.addEventListener("resize",i.update,it),function(){o&&c.forEach((function(t){t.removeEventListener("scroll",i.update,it)})),a&&l.removeEventListener("resize",i.update,it)}},data:{}};var st={left:"right",right:"left",bottom:"top",top:"bottom"};function ot(t){return t.replace(/left|right|bottom|top/g,(function(t){return st[t]}))}var rt={start:"end",end:"start"};function at(t){return t.replace(/start|end/g,(function(t){return rt[t]}))}function lt(t){var e=x(t);return{scrollLeft:e.pageXOffset,scrollTop:e.pageYOffset}}function ct(t){return H(q(t)).left+lt(t).scrollLeft}function ht(t){var e=B(t),i=e.overflow,n=e.overflowX,s=e.overflowY;return/auto|scroll|overlay|hidden/.test(i+s+n)}function ut(t){return["html","body","#document"].indexOf(O(t))>=0?t.ownerDocument.body:L(t)&&ht(t)?t:ut(R(t))}function dt(t,e){var i;void 0===e&&(e=[]);var n=ut(t),s=n===(null==(i=t.ownerDocument)?void 0:i.body),o=x(n),r=s?[o].concat(o.visualViewport||[],ht(n)?n:[]):n,a=e.concat(r);return s?a:a.concat(dt(R(r)))}function ft(t){return Object.assign({},t,{left:t.x,top:t.y,right:t.x+t.width,bottom:t.y+t.height})}function pt(t,e,i){return e===u?ft(function(t,e){var i=x(t),n=q(t),s=i.visualViewport,o=n.clientWidth,r=n.clientHeight,a=0,l=0;if(s){o=s.width,r=s.height;var c=M();(c||!c&&"fixed"===e)&&(a=s.offsetLeft,l=s.offsetTop)}return{width:o,height:r,x:a+ct(t),y:l}}(t,i)):k(e)?function(t,e){var i=H(t,!1,"fixed"===e);return i.top=i.top+t.clientTop,i.left=i.left+t.clientLeft,i.bottom=i.top+t.clientHeight,i.right=i.left+t.clientWidth,i.width=t.clientWidth,i.height=t.clientHeight,i.x=i.left,i.y=i.top,i}(e,i):ft(function(t){var e,i=q(t),n=lt(t),s=null==(e=t.ownerDocument)?void 0:e.body,o=I(i.scrollWidth,i.clientWidth,s?s.scrollWidth:0,s?s.clientWidth:0),r=I(i.scrollHeight,i.clientHeight,s?s.scrollHeight:0,s?s.clientHeight:0),a=-n.scrollLeft+ct(t),l=-n.scrollTop;return"rtl"===B(s||i).direction&&(a+=I(i.clientWidth,s?s.clientWidth:0)-o),{width:o,height:r,x:a,y:l}}(q(t)))}function gt(t){var e,r=t.reference,a=t.element,h=t.placement,u=h?S(h):null,d=h?J(h):null,f=r.x+r.width/2-a.width/2,p=r.y+r.height/2-a.height/2;switch(u){case i:e={x:f,y:r.y-a.height};break;case n:e={x:f,y:r.y+r.height};break;case s:e={x:r.x+r.width,y:p};break;case o:e={x:r.x-a.width,y:p};break;default:e={x:r.x,y:r.y}}var g=u?Q(u):null;if(null!=g){var m="y"===g?"height":"width";switch(d){case l:e[g]=e[g]-(r[m]/2-a[m]/2);break;case c:e[g]=e[g]+(r[m]/2-a[m]/2)}}return e}function mt(t,e){void 0===e&&(e={});var o=e,r=o.placement,l=void 0===r?t.placement:r,c=o.strategy,p=void 0===c?t.strategy:c,g=o.boundary,m=void 0===g?h:g,_=o.rootBoundary,b=void 0===_?u:_,v=o.elementContext,y=void 0===v?d:v,w=o.altBoundary,A=void 0!==w&&w,E=o.padding,C=void 0===E?0:E,T=Y("number"!=typeof C?C:U(C,a)),x=y===d?f:d,D=t.rects.popper,$=t.elements[A?x:y],S=function(t,e,i,n){var s="clippingParents"===e?function(t){var e=dt(R(t)),i=["absolute","fixed"].indexOf(B(t).position)>=0&&L(t)?K(t):t;return k(i)?e.filter((function(t){return k(t)&&F(t,i)&&"body"!==O(t)})):[]}(t):[].concat(e),o=[].concat(s,[i]),r=o[0],a=o.reduce((function(e,i){var s=pt(t,i,n);return e.top=I(s.top,e.top),e.right=N(s.right,e.right),e.bottom=N(s.bottom,e.bottom),e.left=I(s.left,e.left),e}),pt(t,r,n));return a.width=a.right-a.left,a.height=a.bottom-a.top,a.x=a.left,a.y=a.top,a}(k($)?$:$.contextElement||q(t.elements.popper),m,b,p),P=H(t.elements.reference),j=gt({reference:P,element:D,strategy:"absolute",placement:l}),M=ft(Object.assign({},D,j)),W=y===d?M:P,z={top:S.top-W.top+T.top,bottom:W.bottom-S.bottom+T.bottom,left:S.left-W.left+T.left,right:W.right-S.right+T.right},V=t.modifiersData.offset;if(y===d&&V){var Q=V[l];Object.keys(z).forEach((function(t){var e=[s,n].indexOf(t)>=0?1:-1,o=[i,n].indexOf(t)>=0?"y":"x";z[t]+=Q[o]*e}))}return z}const _t={name:"flip",enabled:!0,phase:"main",fn:function(t){var e=t.state,c=t.options,h=t.name;if(!e.modifiersData[h]._skip){for(var u=c.mainAxis,d=void 0===u||u,f=c.altAxis,m=void 0===f||f,_=c.fallbackPlacements,b=c.padding,v=c.boundary,y=c.rootBoundary,w=c.altBoundary,A=c.flipVariations,E=void 0===A||A,C=c.allowedAutoPlacements,T=e.options.placement,O=S(T),x=_||(O!==T&&E?function(t){if(S(t)===r)return[];var e=ot(t);return[at(t),e,at(e)]}(T):[ot(T)]),k=[T].concat(x).reduce((function(t,i){return t.concat(S(i)===r?function(t,e){void 0===e&&(e={});var i=e,n=i.placement,s=i.boundary,o=i.rootBoundary,r=i.padding,l=i.flipVariations,c=i.allowedAutoPlacements,h=void 0===c?g:c,u=J(n),d=u?l?p:p.filter((function(t){return J(t)===u})):a,f=d.filter((function(t){return h.indexOf(t)>=0}));0===f.length&&(f=d);var m=f.reduce((function(e,i){return e[i]=mt(t,{placement:i,boundary:s,rootBoundary:o,padding:r})[S(i)],e}),{});return Object.keys(m).sort((function(t,e){return m[t]-m[e]}))}(e,{placement:i,boundary:v,rootBoundary:y,padding:b,flipVariations:E,allowedAutoPlacements:C}):i)}),[]),L=e.rects.reference,D=e.rects.popper,$=new Map,I=!0,N=k[0],P=0;P=0,F=W?"width":"height",B=mt(e,{placement:j,boundary:v,rootBoundary:y,altBoundary:w,padding:b}),z=W?H?s:o:H?n:i;L[F]>D[F]&&(z=ot(z));var q=ot(z),R=[];if(d&&R.push(B[M]<=0),m&&R.push(B[z]<=0,B[q]<=0),R.every((function(t){return t}))){N=j,I=!1;break}$.set(j,R)}if(I)for(var V=function(t){var e=k.find((function(e){var i=$.get(e);if(i)return i.slice(0,t).every((function(t){return t}))}));if(e)return N=e,"break"},K=E?3:1;K>0&&"break"!==V(K);K--);e.placement!==N&&(e.modifiersData[h]._skip=!0,e.placement=N,e.reset=!0)}},requiresIfExists:["offset"],data:{_skip:!1}};function bt(t,e,i){return void 0===i&&(i={x:0,y:0}),{top:t.top-e.height-i.y,right:t.right-e.width+i.x,bottom:t.bottom-e.height+i.y,left:t.left-e.width-i.x}}function vt(t){return[i,s,n,o].some((function(e){return t[e]>=0}))}const yt={name:"hide",enabled:!0,phase:"main",requiresIfExists:["preventOverflow"],fn:function(t){var e=t.state,i=t.name,n=e.rects.reference,s=e.rects.popper,o=e.modifiersData.preventOverflow,r=mt(e,{elementContext:"reference"}),a=mt(e,{altBoundary:!0}),l=bt(r,n),c=bt(a,s,o),h=vt(l),u=vt(c);e.modifiersData[i]={referenceClippingOffsets:l,popperEscapeOffsets:c,isReferenceHidden:h,hasPopperEscaped:u},e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-reference-hidden":h,"data-popper-escaped":u})}},wt={name:"offset",enabled:!0,phase:"main",requires:["popperOffsets"],fn:function(t){var e=t.state,n=t.options,r=t.name,a=n.offset,l=void 0===a?[0,0]:a,c=g.reduce((function(t,n){return t[n]=function(t,e,n){var r=S(t),a=[o,i].indexOf(r)>=0?-1:1,l="function"==typeof n?n(Object.assign({},e,{placement:t})):n,c=l[0],h=l[1];return c=c||0,h=(h||0)*a,[o,s].indexOf(r)>=0?{x:h,y:c}:{x:c,y:h}}(n,e.rects,l),t}),{}),h=c[e.placement],u=h.x,d=h.y;null!=e.modifiersData.popperOffsets&&(e.modifiersData.popperOffsets.x+=u,e.modifiersData.popperOffsets.y+=d),e.modifiersData[r]=c}},At={name:"popperOffsets",enabled:!0,phase:"read",fn:function(t){var e=t.state,i=t.name;e.modifiersData[i]=gt({reference:e.rects.reference,element:e.rects.popper,strategy:"absolute",placement:e.placement})},data:{}},Et={name:"preventOverflow",enabled:!0,phase:"main",fn:function(t){var e=t.state,r=t.options,a=t.name,c=r.mainAxis,h=void 0===c||c,u=r.altAxis,d=void 0!==u&&u,f=r.boundary,p=r.rootBoundary,g=r.altBoundary,m=r.padding,_=r.tether,b=void 0===_||_,v=r.tetherOffset,y=void 0===v?0:v,w=mt(e,{boundary:f,rootBoundary:p,padding:m,altBoundary:g}),A=S(e.placement),E=J(e.placement),C=!E,T=Q(A),O="x"===T?"y":"x",x=e.modifiersData.popperOffsets,k=e.rects.reference,L=e.rects.popper,D="function"==typeof y?y(Object.assign({},e.rects,{placement:e.placement})):y,$="number"==typeof D?{mainAxis:D,altAxis:D}:Object.assign({mainAxis:0,altAxis:0},D),P=e.modifiersData.offset?e.modifiersData.offset[e.placement]:null,j={x:0,y:0};if(x){if(h){var M,H="y"===T?i:o,F="y"===T?n:s,B="y"===T?"height":"width",z=x[T],q=z+w[H],R=z-w[F],V=b?-L[B]/2:0,Y=E===l?k[B]:L[B],U=E===l?-L[B]:-k[B],G=e.elements.arrow,Z=b&&G?W(G):{width:0,height:0},tt=e.modifiersData["arrow#persistent"]?e.modifiersData["arrow#persistent"].padding:{top:0,right:0,bottom:0,left:0},et=tt[H],it=tt[F],nt=X(0,k[B],Z[B]),st=C?k[B]/2-V-nt-et-$.mainAxis:Y-nt-et-$.mainAxis,ot=C?-k[B]/2+V+nt+it+$.mainAxis:U+nt+it+$.mainAxis,rt=e.elements.arrow&&K(e.elements.arrow),at=rt?"y"===T?rt.clientTop||0:rt.clientLeft||0:0,lt=null!=(M=null==P?void 0:P[T])?M:0,ct=z+ot-lt,ht=X(b?N(q,z+st-lt-at):q,z,b?I(R,ct):R);x[T]=ht,j[T]=ht-z}if(d){var ut,dt="x"===T?i:o,ft="x"===T?n:s,pt=x[O],gt="y"===O?"height":"width",_t=pt+w[dt],bt=pt-w[ft],vt=-1!==[i,o].indexOf(A),yt=null!=(ut=null==P?void 0:P[O])?ut:0,wt=vt?_t:pt-k[gt]-L[gt]-yt+$.altAxis,At=vt?pt+k[gt]+L[gt]-yt-$.altAxis:bt,Et=b&&vt?function(t,e,i){var n=X(t,e,i);return n>i?i:n}(wt,pt,At):X(b?wt:_t,pt,b?At:bt);x[O]=Et,j[O]=Et-pt}e.modifiersData[a]=j}},requiresIfExists:["offset"]};function Ct(t,e,i){void 0===i&&(i=!1);var n,s,o=L(e),r=L(e)&&function(t){var e=t.getBoundingClientRect(),i=P(e.width)/t.offsetWidth||1,n=P(e.height)/t.offsetHeight||1;return 1!==i||1!==n}(e),a=q(e),l=H(t,r,i),c={scrollLeft:0,scrollTop:0},h={x:0,y:0};return(o||!o&&!i)&&(("body"!==O(e)||ht(a))&&(c=(n=e)!==x(n)&&L(n)?{scrollLeft:(s=n).scrollLeft,scrollTop:s.scrollTop}:lt(n)),L(e)?((h=H(e,!0)).x+=e.clientLeft,h.y+=e.clientTop):a&&(h.x=ct(a))),{x:l.left+c.scrollLeft-h.x,y:l.top+c.scrollTop-h.y,width:l.width,height:l.height}}function Tt(t){var e=new Map,i=new Set,n=[];function s(t){i.add(t.name),[].concat(t.requires||[],t.requiresIfExists||[]).forEach((function(t){if(!i.has(t)){var n=e.get(t);n&&s(n)}})),n.push(t)}return t.forEach((function(t){e.set(t.name,t)})),t.forEach((function(t){i.has(t.name)||s(t)})),n}var Ot={placement:"bottom",modifiers:[],strategy:"absolute"};function xt(){for(var t=arguments.length,e=new Array(t),i=0;i{let e=t.getAttribute("data-bs-target");if(!e||"#"===e){let i=t.getAttribute("href");if(!i||!i.includes("#")&&!i.startsWith("."))return null;i.includes("#")&&!i.startsWith("#")&&(i=`#${i.split("#")[1]}`),e=i&&"#"!==i?i.trim():null}return e},Nt=t=>{const e=It(t);return e&&document.querySelector(e)?e:null},Pt=t=>{const e=It(t);return e?document.querySelector(e):null},jt=t=>{t.dispatchEvent(new Event(St))},Mt=t=>!(!t||"object"!=typeof t)&&(void 0!==t.jquery&&(t=t[0]),void 0!==t.nodeType),Ht=t=>Mt(t)?t.jquery?t[0]:t:"string"==typeof t&&t.length>0?document.querySelector(t):null,Wt=t=>{if(!Mt(t)||0===t.getClientRects().length)return!1;const e="visible"===getComputedStyle(t).getPropertyValue("visibility"),i=t.closest("details:not([open])");if(!i)return e;if(i!==t){const e=t.closest("summary");if(e&&e.parentNode!==i)return!1;if(null===e)return!1}return e},Ft=t=>!t||t.nodeType!==Node.ELEMENT_NODE||!!t.classList.contains("disabled")||(void 0!==t.disabled?t.disabled:t.hasAttribute("disabled")&&"false"!==t.getAttribute("disabled")),Bt=t=>{if(!document.documentElement.attachShadow)return null;if("function"==typeof t.getRootNode){const e=t.getRootNode();return e instanceof ShadowRoot?e:null}return t instanceof ShadowRoot?t:t.parentNode?Bt(t.parentNode):null},zt=()=>{},qt=t=>{t.offsetHeight},Rt=()=>window.jQuery&&!document.body.hasAttribute("data-bs-no-jquery")?window.jQuery:null,Vt=[],Kt=()=>"rtl"===document.documentElement.dir,Qt=t=>{var e;e=()=>{const e=Rt();if(e){const i=t.NAME,n=e.fn[i];e.fn[i]=t.jQueryInterface,e.fn[i].Constructor=t,e.fn[i].noConflict=()=>(e.fn[i]=n,t.jQueryInterface)}},"loading"===document.readyState?(Vt.length||document.addEventListener("DOMContentLoaded",(()=>{for(const t of Vt)t()})),Vt.push(e)):e()},Xt=t=>{"function"==typeof t&&t()},Yt=(t,e,i=!0)=>{if(!i)return void Xt(t);const n=(t=>{if(!t)return 0;let{transitionDuration:e,transitionDelay:i}=window.getComputedStyle(t);const n=Number.parseFloat(e),s=Number.parseFloat(i);return n||s?(e=e.split(",")[0],i=i.split(",")[0],1e3*(Number.parseFloat(e)+Number.parseFloat(i))):0})(e)+5;let s=!1;const o=({target:i})=>{i===e&&(s=!0,e.removeEventListener(St,o),Xt(t))};e.addEventListener(St,o),setTimeout((()=>{s||jt(e)}),n)},Ut=(t,e,i,n)=>{const s=t.length;let o=t.indexOf(e);return-1===o?!i&&n?t[s-1]:t[0]:(o+=i?1:-1,n&&(o=(o+s)%s),t[Math.max(0,Math.min(o,s-1))])},Gt=/[^.]*(?=\..*)\.|.*/,Jt=/\..*/,Zt=/::\d+$/,te={};let ee=1;const ie={mouseenter:"mouseover",mouseleave:"mouseout"},ne=new Set(["click","dblclick","mouseup","mousedown","contextmenu","mousewheel","DOMMouseScroll","mouseover","mouseout","mousemove","selectstart","selectend","keydown","keypress","keyup","orientationchange","touchstart","touchmove","touchend","touchcancel","pointerdown","pointermove","pointerup","pointerleave","pointercancel","gesturestart","gesturechange","gestureend","focus","blur","change","reset","select","submit","focusin","focusout","load","unload","beforeunload","resize","move","DOMContentLoaded","readystatechange","error","abort","scroll"]);function se(t,e){return e&&`${e}::${ee++}`||t.uidEvent||ee++}function oe(t){const e=se(t);return t.uidEvent=e,te[e]=te[e]||{},te[e]}function re(t,e,i=null){return Object.values(t).find((t=>t.callable===e&&t.delegationSelector===i))}function ae(t,e,i){const n="string"==typeof e,s=n?i:e||i;let o=ue(t);return ne.has(o)||(o=t),[n,s,o]}function le(t,e,i,n,s){if("string"!=typeof e||!t)return;let[o,r,a]=ae(e,i,n);if(e in ie){const t=t=>function(e){if(!e.relatedTarget||e.relatedTarget!==e.delegateTarget&&!e.delegateTarget.contains(e.relatedTarget))return t.call(this,e)};r=t(r)}const l=oe(t),c=l[a]||(l[a]={}),h=re(c,r,o?i:null);if(h)return void(h.oneOff=h.oneOff&&s);const u=se(r,e.replace(Gt,"")),d=o?function(t,e,i){return function n(s){const o=t.querySelectorAll(e);for(let{target:r}=s;r&&r!==this;r=r.parentNode)for(const a of o)if(a===r)return fe(s,{delegateTarget:r}),n.oneOff&&de.off(t,s.type,e,i),i.apply(r,[s])}}(t,i,r):function(t,e){return function i(n){return fe(n,{delegateTarget:t}),i.oneOff&&de.off(t,n.type,e),e.apply(t,[n])}}(t,r);d.delegationSelector=o?i:null,d.callable=r,d.oneOff=s,d.uidEvent=u,c[u]=d,t.addEventListener(a,d,o)}function ce(t,e,i,n,s){const o=re(e[i],n,s);o&&(t.removeEventListener(i,o,Boolean(s)),delete e[i][o.uidEvent])}function he(t,e,i,n){const s=e[i]||{};for(const o of Object.keys(s))if(o.includes(n)){const n=s[o];ce(t,e,i,n.callable,n.delegationSelector)}}function ue(t){return t=t.replace(Jt,""),ie[t]||t}const de={on(t,e,i,n){le(t,e,i,n,!1)},one(t,e,i,n){le(t,e,i,n,!0)},off(t,e,i,n){if("string"!=typeof e||!t)return;const[s,o,r]=ae(e,i,n),a=r!==e,l=oe(t),c=l[r]||{},h=e.startsWith(".");if(void 0===o){if(h)for(const i of Object.keys(l))he(t,l,i,e.slice(1));for(const i of Object.keys(c)){const n=i.replace(Zt,"");if(!a||e.includes(n)){const e=c[i];ce(t,l,r,e.callable,e.delegationSelector)}}}else{if(!Object.keys(c).length)return;ce(t,l,r,o,s?i:null)}},trigger(t,e,i){if("string"!=typeof e||!t)return null;const n=Rt();let s=null,o=!0,r=!0,a=!1;e!==ue(e)&&n&&(s=n.Event(e,i),n(t).trigger(s),o=!s.isPropagationStopped(),r=!s.isImmediatePropagationStopped(),a=s.isDefaultPrevented());let l=new Event(e,{bubbles:o,cancelable:!0});return l=fe(l,i),a&&l.preventDefault(),r&&t.dispatchEvent(l),l.defaultPrevented&&s&&s.preventDefault(),l}};function fe(t,e){for(const[i,n]of Object.entries(e||{}))try{t[i]=n}catch(e){Object.defineProperty(t,i,{configurable:!0,get:()=>n})}return t}const pe=new Map,ge={set(t,e,i){pe.has(t)||pe.set(t,new Map);const n=pe.get(t);n.has(e)||0===n.size?n.set(e,i):console.error(`Bootstrap doesn't allow more than one instance per element. Bound instance: ${Array.from(n.keys())[0]}.`)},get:(t,e)=>pe.has(t)&&pe.get(t).get(e)||null,remove(t,e){if(!pe.has(t))return;const i=pe.get(t);i.delete(e),0===i.size&&pe.delete(t)}};function me(t){if("true"===t)return!0;if("false"===t)return!1;if(t===Number(t).toString())return Number(t);if(""===t||"null"===t)return null;if("string"!=typeof t)return t;try{return JSON.parse(decodeURIComponent(t))}catch(e){return t}}function _e(t){return t.replace(/[A-Z]/g,(t=>`-${t.toLowerCase()}`))}const be={setDataAttribute(t,e,i){t.setAttribute(`data-bs-${_e(e)}`,i)},removeDataAttribute(t,e){t.removeAttribute(`data-bs-${_e(e)}`)},getDataAttributes(t){if(!t)return{};const e={},i=Object.keys(t.dataset).filter((t=>t.startsWith("bs")&&!t.startsWith("bsConfig")));for(const n of i){let i=n.replace(/^bs/,"");i=i.charAt(0).toLowerCase()+i.slice(1,i.length),e[i]=me(t.dataset[n])}return e},getDataAttribute:(t,e)=>me(t.getAttribute(`data-bs-${_e(e)}`))};class ve{static get Default(){return{}}static get DefaultType(){return{}}static get NAME(){throw new Error('You have to implement the static method "NAME", for each component!')}_getConfig(t){return t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t}_mergeConfigObj(t,e){const i=Mt(e)?be.getDataAttribute(e,"config"):{};return{...this.constructor.Default,..."object"==typeof i?i:{},...Mt(e)?be.getDataAttributes(e):{},..."object"==typeof t?t:{}}}_typeCheckConfig(t,e=this.constructor.DefaultType){for(const n of Object.keys(e)){const s=e[n],o=t[n],r=Mt(o)?"element":null==(i=o)?`${i}`:Object.prototype.toString.call(i).match(/\s([a-z]+)/i)[1].toLowerCase();if(!new RegExp(s).test(r))throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option "${n}" provided type "${r}" but expected type "${s}".`)}var i}}class ye extends ve{constructor(t,e){super(),(t=Ht(t))&&(this._element=t,this._config=this._getConfig(e),ge.set(this._element,this.constructor.DATA_KEY,this))}dispose(){ge.remove(this._element,this.constructor.DATA_KEY),de.off(this._element,this.constructor.EVENT_KEY);for(const t of Object.getOwnPropertyNames(this))this[t]=null}_queueCallback(t,e,i=!0){Yt(t,e,i)}_getConfig(t){return t=this._mergeConfigObj(t,this._element),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}static getInstance(t){return ge.get(Ht(t),this.DATA_KEY)}static getOrCreateInstance(t,e={}){return this.getInstance(t)||new this(t,"object"==typeof e?e:null)}static get VERSION(){return"5.2.3"}static get DATA_KEY(){return`bs.${this.NAME}`}static get EVENT_KEY(){return`.${this.DATA_KEY}`}static eventName(t){return`${t}${this.EVENT_KEY}`}}const we=(t,e="hide")=>{const i=`click.dismiss${t.EVENT_KEY}`,n=t.NAME;de.on(document,i,`[data-bs-dismiss="${n}"]`,(function(i){if(["A","AREA"].includes(this.tagName)&&i.preventDefault(),Ft(this))return;const s=Pt(this)||this.closest(`.${n}`);t.getOrCreateInstance(s)[e]()}))},Ae=".bs.alert",Ee=`close${Ae}`,Ce=`closed${Ae}`;class Te extends ye{static get NAME(){return"alert"}close(){if(de.trigger(this._element,Ee).defaultPrevented)return;this._element.classList.remove("show");const t=this._element.classList.contains("fade");this._queueCallback((()=>this._destroyElement()),this._element,t)}_destroyElement(){this._element.remove(),de.trigger(this._element,Ce),this.dispose()}static jQueryInterface(t){return this.each((function(){const e=Te.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}we(Te,"close"),Qt(Te);const Oe='[data-bs-toggle="button"]';class xe extends ye{static get NAME(){return"button"}toggle(){this._element.setAttribute("aria-pressed",this._element.classList.toggle("active"))}static jQueryInterface(t){return this.each((function(){const e=xe.getOrCreateInstance(this);"toggle"===t&&e[t]()}))}}de.on(document,"click.bs.button.data-api",Oe,(t=>{t.preventDefault();const e=t.target.closest(Oe);xe.getOrCreateInstance(e).toggle()})),Qt(xe);const ke={find:(t,e=document.documentElement)=>[].concat(...Element.prototype.querySelectorAll.call(e,t)),findOne:(t,e=document.documentElement)=>Element.prototype.querySelector.call(e,t),children:(t,e)=>[].concat(...t.children).filter((t=>t.matches(e))),parents(t,e){const i=[];let n=t.parentNode.closest(e);for(;n;)i.push(n),n=n.parentNode.closest(e);return i},prev(t,e){let i=t.previousElementSibling;for(;i;){if(i.matches(e))return[i];i=i.previousElementSibling}return[]},next(t,e){let i=t.nextElementSibling;for(;i;){if(i.matches(e))return[i];i=i.nextElementSibling}return[]},focusableChildren(t){const e=["a","button","input","textarea","select","details","[tabindex]",'[contenteditable="true"]'].map((t=>`${t}:not([tabindex^="-"])`)).join(",");return this.find(e,t).filter((t=>!Ft(t)&&Wt(t)))}},Le=".bs.swipe",De=`touchstart${Le}`,$e=`touchmove${Le}`,Se=`touchend${Le}`,Ie=`pointerdown${Le}`,Ne=`pointerup${Le}`,Pe={endCallback:null,leftCallback:null,rightCallback:null},je={endCallback:"(function|null)",leftCallback:"(function|null)",rightCallback:"(function|null)"};class Me extends ve{constructor(t,e){super(),this._element=t,t&&Me.isSupported()&&(this._config=this._getConfig(e),this._deltaX=0,this._supportPointerEvents=Boolean(window.PointerEvent),this._initEvents())}static get Default(){return Pe}static get DefaultType(){return je}static get NAME(){return"swipe"}dispose(){de.off(this._element,Le)}_start(t){this._supportPointerEvents?this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX):this._deltaX=t.touches[0].clientX}_end(t){this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX-this._deltaX),this._handleSwipe(),Xt(this._config.endCallback)}_move(t){this._deltaX=t.touches&&t.touches.length>1?0:t.touches[0].clientX-this._deltaX}_handleSwipe(){const t=Math.abs(this._deltaX);if(t<=40)return;const e=t/this._deltaX;this._deltaX=0,e&&Xt(e>0?this._config.rightCallback:this._config.leftCallback)}_initEvents(){this._supportPointerEvents?(de.on(this._element,Ie,(t=>this._start(t))),de.on(this._element,Ne,(t=>this._end(t))),this._element.classList.add("pointer-event")):(de.on(this._element,De,(t=>this._start(t))),de.on(this._element,$e,(t=>this._move(t))),de.on(this._element,Se,(t=>this._end(t))))}_eventIsPointerPenTouch(t){return this._supportPointerEvents&&("pen"===t.pointerType||"touch"===t.pointerType)}static isSupported(){return"ontouchstart"in document.documentElement||navigator.maxTouchPoints>0}}const He=".bs.carousel",We=".data-api",Fe="next",Be="prev",ze="left",qe="right",Re=`slide${He}`,Ve=`slid${He}`,Ke=`keydown${He}`,Qe=`mouseenter${He}`,Xe=`mouseleave${He}`,Ye=`dragstart${He}`,Ue=`load${He}${We}`,Ge=`click${He}${We}`,Je="carousel",Ze="active",ti=".active",ei=".carousel-item",ii=ti+ei,ni={ArrowLeft:qe,ArrowRight:ze},si={interval:5e3,keyboard:!0,pause:"hover",ride:!1,touch:!0,wrap:!0},oi={interval:"(number|boolean)",keyboard:"boolean",pause:"(string|boolean)",ride:"(boolean|string)",touch:"boolean",wrap:"boolean"};class ri extends ye{constructor(t,e){super(t,e),this._interval=null,this._activeElement=null,this._isSliding=!1,this.touchTimeout=null,this._swipeHelper=null,this._indicatorsElement=ke.findOne(".carousel-indicators",this._element),this._addEventListeners(),this._config.ride===Je&&this.cycle()}static get Default(){return si}static get DefaultType(){return oi}static get NAME(){return"carousel"}next(){this._slide(Fe)}nextWhenVisible(){!document.hidden&&Wt(this._element)&&this.next()}prev(){this._slide(Be)}pause(){this._isSliding&&jt(this._element),this._clearInterval()}cycle(){this._clearInterval(),this._updateInterval(),this._interval=setInterval((()=>this.nextWhenVisible()),this._config.interval)}_maybeEnableCycle(){this._config.ride&&(this._isSliding?de.one(this._element,Ve,(()=>this.cycle())):this.cycle())}to(t){const e=this._getItems();if(t>e.length-1||t<0)return;if(this._isSliding)return void de.one(this._element,Ve,(()=>this.to(t)));const i=this._getItemIndex(this._getActive());if(i===t)return;const n=t>i?Fe:Be;this._slide(n,e[t])}dispose(){this._swipeHelper&&this._swipeHelper.dispose(),super.dispose()}_configAfterMerge(t){return t.defaultInterval=t.interval,t}_addEventListeners(){this._config.keyboard&&de.on(this._element,Ke,(t=>this._keydown(t))),"hover"===this._config.pause&&(de.on(this._element,Qe,(()=>this.pause())),de.on(this._element,Xe,(()=>this._maybeEnableCycle()))),this._config.touch&&Me.isSupported()&&this._addTouchEventListeners()}_addTouchEventListeners(){for(const t of ke.find(".carousel-item img",this._element))de.on(t,Ye,(t=>t.preventDefault()));const t={leftCallback:()=>this._slide(this._directionToOrder(ze)),rightCallback:()=>this._slide(this._directionToOrder(qe)),endCallback:()=>{"hover"===this._config.pause&&(this.pause(),this.touchTimeout&&clearTimeout(this.touchTimeout),this.touchTimeout=setTimeout((()=>this._maybeEnableCycle()),500+this._config.interval))}};this._swipeHelper=new Me(this._element,t)}_keydown(t){if(/input|textarea/i.test(t.target.tagName))return;const e=ni[t.key];e&&(t.preventDefault(),this._slide(this._directionToOrder(e)))}_getItemIndex(t){return this._getItems().indexOf(t)}_setActiveIndicatorElement(t){if(!this._indicatorsElement)return;const e=ke.findOne(ti,this._indicatorsElement);e.classList.remove(Ze),e.removeAttribute("aria-current");const i=ke.findOne(`[data-bs-slide-to="${t}"]`,this._indicatorsElement);i&&(i.classList.add(Ze),i.setAttribute("aria-current","true"))}_updateInterval(){const t=this._activeElement||this._getActive();if(!t)return;const e=Number.parseInt(t.getAttribute("data-bs-interval"),10);this._config.interval=e||this._config.defaultInterval}_slide(t,e=null){if(this._isSliding)return;const i=this._getActive(),n=t===Fe,s=e||Ut(this._getItems(),i,n,this._config.wrap);if(s===i)return;const o=this._getItemIndex(s),r=e=>de.trigger(this._element,e,{relatedTarget:s,direction:this._orderToDirection(t),from:this._getItemIndex(i),to:o});if(r(Re).defaultPrevented)return;if(!i||!s)return;const a=Boolean(this._interval);this.pause(),this._isSliding=!0,this._setActiveIndicatorElement(o),this._activeElement=s;const l=n?"carousel-item-start":"carousel-item-end",c=n?"carousel-item-next":"carousel-item-prev";s.classList.add(c),qt(s),i.classList.add(l),s.classList.add(l),this._queueCallback((()=>{s.classList.remove(l,c),s.classList.add(Ze),i.classList.remove(Ze,c,l),this._isSliding=!1,r(Ve)}),i,this._isAnimated()),a&&this.cycle()}_isAnimated(){return this._element.classList.contains("slide")}_getActive(){return ke.findOne(ii,this._element)}_getItems(){return ke.find(ei,this._element)}_clearInterval(){this._interval&&(clearInterval(this._interval),this._interval=null)}_directionToOrder(t){return Kt()?t===ze?Be:Fe:t===ze?Fe:Be}_orderToDirection(t){return Kt()?t===Be?ze:qe:t===Be?qe:ze}static jQueryInterface(t){return this.each((function(){const e=ri.getOrCreateInstance(this,t);if("number"!=typeof t){if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}else e.to(t)}))}}de.on(document,Ge,"[data-bs-slide], [data-bs-slide-to]",(function(t){const e=Pt(this);if(!e||!e.classList.contains(Je))return;t.preventDefault();const i=ri.getOrCreateInstance(e),n=this.getAttribute("data-bs-slide-to");return n?(i.to(n),void i._maybeEnableCycle()):"next"===be.getDataAttribute(this,"slide")?(i.next(),void i._maybeEnableCycle()):(i.prev(),void i._maybeEnableCycle())})),de.on(window,Ue,(()=>{const t=ke.find('[data-bs-ride="carousel"]');for(const e of t)ri.getOrCreateInstance(e)})),Qt(ri);const ai=".bs.collapse",li=`show${ai}`,ci=`shown${ai}`,hi=`hide${ai}`,ui=`hidden${ai}`,di=`click${ai}.data-api`,fi="show",pi="collapse",gi="collapsing",mi=`:scope .${pi} .${pi}`,_i='[data-bs-toggle="collapse"]',bi={parent:null,toggle:!0},vi={parent:"(null|element)",toggle:"boolean"};class yi extends ye{constructor(t,e){super(t,e),this._isTransitioning=!1,this._triggerArray=[];const i=ke.find(_i);for(const t of i){const e=Nt(t),i=ke.find(e).filter((t=>t===this._element));null!==e&&i.length&&this._triggerArray.push(t)}this._initializeChildren(),this._config.parent||this._addAriaAndCollapsedClass(this._triggerArray,this._isShown()),this._config.toggle&&this.toggle()}static get Default(){return bi}static get DefaultType(){return vi}static get NAME(){return"collapse"}toggle(){this._isShown()?this.hide():this.show()}show(){if(this._isTransitioning||this._isShown())return;let t=[];if(this._config.parent&&(t=this._getFirstLevelChildren(".collapse.show, .collapse.collapsing").filter((t=>t!==this._element)).map((t=>yi.getOrCreateInstance(t,{toggle:!1})))),t.length&&t[0]._isTransitioning)return;if(de.trigger(this._element,li).defaultPrevented)return;for(const e of t)e.hide();const e=this._getDimension();this._element.classList.remove(pi),this._element.classList.add(gi),this._element.style[e]=0,this._addAriaAndCollapsedClass(this._triggerArray,!0),this._isTransitioning=!0;const i=`scroll${e[0].toUpperCase()+e.slice(1)}`;this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(gi),this._element.classList.add(pi,fi),this._element.style[e]="",de.trigger(this._element,ci)}),this._element,!0),this._element.style[e]=`${this._element[i]}px`}hide(){if(this._isTransitioning||!this._isShown())return;if(de.trigger(this._element,hi).defaultPrevented)return;const t=this._getDimension();this._element.style[t]=`${this._element.getBoundingClientRect()[t]}px`,qt(this._element),this._element.classList.add(gi),this._element.classList.remove(pi,fi);for(const t of this._triggerArray){const e=Pt(t);e&&!this._isShown(e)&&this._addAriaAndCollapsedClass([t],!1)}this._isTransitioning=!0,this._element.style[t]="",this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(gi),this._element.classList.add(pi),de.trigger(this._element,ui)}),this._element,!0)}_isShown(t=this._element){return t.classList.contains(fi)}_configAfterMerge(t){return t.toggle=Boolean(t.toggle),t.parent=Ht(t.parent),t}_getDimension(){return this._element.classList.contains("collapse-horizontal")?"width":"height"}_initializeChildren(){if(!this._config.parent)return;const t=this._getFirstLevelChildren(_i);for(const e of t){const t=Pt(e);t&&this._addAriaAndCollapsedClass([e],this._isShown(t))}}_getFirstLevelChildren(t){const e=ke.find(mi,this._config.parent);return ke.find(t,this._config.parent).filter((t=>!e.includes(t)))}_addAriaAndCollapsedClass(t,e){if(t.length)for(const i of t)i.classList.toggle("collapsed",!e),i.setAttribute("aria-expanded",e)}static jQueryInterface(t){const e={};return"string"==typeof t&&/show|hide/.test(t)&&(e.toggle=!1),this.each((function(){const i=yi.getOrCreateInstance(this,e);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t]()}}))}}de.on(document,di,_i,(function(t){("A"===t.target.tagName||t.delegateTarget&&"A"===t.delegateTarget.tagName)&&t.preventDefault();const e=Nt(this),i=ke.find(e);for(const t of i)yi.getOrCreateInstance(t,{toggle:!1}).toggle()})),Qt(yi);const wi="dropdown",Ai=".bs.dropdown",Ei=".data-api",Ci="ArrowUp",Ti="ArrowDown",Oi=`hide${Ai}`,xi=`hidden${Ai}`,ki=`show${Ai}`,Li=`shown${Ai}`,Di=`click${Ai}${Ei}`,$i=`keydown${Ai}${Ei}`,Si=`keyup${Ai}${Ei}`,Ii="show",Ni='[data-bs-toggle="dropdown"]:not(.disabled):not(:disabled)',Pi=`${Ni}.${Ii}`,ji=".dropdown-menu",Mi=Kt()?"top-end":"top-start",Hi=Kt()?"top-start":"top-end",Wi=Kt()?"bottom-end":"bottom-start",Fi=Kt()?"bottom-start":"bottom-end",Bi=Kt()?"left-start":"right-start",zi=Kt()?"right-start":"left-start",qi={autoClose:!0,boundary:"clippingParents",display:"dynamic",offset:[0,2],popperConfig:null,reference:"toggle"},Ri={autoClose:"(boolean|string)",boundary:"(string|element)",display:"string",offset:"(array|string|function)",popperConfig:"(null|object|function)",reference:"(string|element|object)"};class Vi extends ye{constructor(t,e){super(t,e),this._popper=null,this._parent=this._element.parentNode,this._menu=ke.next(this._element,ji)[0]||ke.prev(this._element,ji)[0]||ke.findOne(ji,this._parent),this._inNavbar=this._detectNavbar()}static get Default(){return qi}static get DefaultType(){return Ri}static get NAME(){return wi}toggle(){return this._isShown()?this.hide():this.show()}show(){if(Ft(this._element)||this._isShown())return;const t={relatedTarget:this._element};if(!de.trigger(this._element,ki,t).defaultPrevented){if(this._createPopper(),"ontouchstart"in document.documentElement&&!this._parent.closest(".navbar-nav"))for(const t of[].concat(...document.body.children))de.on(t,"mouseover",zt);this._element.focus(),this._element.setAttribute("aria-expanded",!0),this._menu.classList.add(Ii),this._element.classList.add(Ii),de.trigger(this._element,Li,t)}}hide(){if(Ft(this._element)||!this._isShown())return;const t={relatedTarget:this._element};this._completeHide(t)}dispose(){this._popper&&this._popper.destroy(),super.dispose()}update(){this._inNavbar=this._detectNavbar(),this._popper&&this._popper.update()}_completeHide(t){if(!de.trigger(this._element,Oi,t).defaultPrevented){if("ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))de.off(t,"mouseover",zt);this._popper&&this._popper.destroy(),this._menu.classList.remove(Ii),this._element.classList.remove(Ii),this._element.setAttribute("aria-expanded","false"),be.removeDataAttribute(this._menu,"popper"),de.trigger(this._element,xi,t)}}_getConfig(t){if("object"==typeof(t=super._getConfig(t)).reference&&!Mt(t.reference)&&"function"!=typeof t.reference.getBoundingClientRect)throw new TypeError(`${wi.toUpperCase()}: Option "reference" provided type "object" without a required "getBoundingClientRect" method.`);return t}_createPopper(){if(void 0===e)throw new TypeError("Bootstrap's dropdowns require Popper (https://popper.js.org)");let t=this._element;"parent"===this._config.reference?t=this._parent:Mt(this._config.reference)?t=Ht(this._config.reference):"object"==typeof this._config.reference&&(t=this._config.reference);const i=this._getPopperConfig();this._popper=Dt(t,this._menu,i)}_isShown(){return this._menu.classList.contains(Ii)}_getPlacement(){const t=this._parent;if(t.classList.contains("dropend"))return Bi;if(t.classList.contains("dropstart"))return zi;if(t.classList.contains("dropup-center"))return"top";if(t.classList.contains("dropdown-center"))return"bottom";const e="end"===getComputedStyle(this._menu).getPropertyValue("--bs-position").trim();return t.classList.contains("dropup")?e?Hi:Mi:e?Fi:Wi}_detectNavbar(){return null!==this._element.closest(".navbar")}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_getPopperConfig(){const t={placement:this._getPlacement(),modifiers:[{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"offset",options:{offset:this._getOffset()}}]};return(this._inNavbar||"static"===this._config.display)&&(be.setDataAttribute(this._menu,"popper","static"),t.modifiers=[{name:"applyStyles",enabled:!1}]),{...t,..."function"==typeof this._config.popperConfig?this._config.popperConfig(t):this._config.popperConfig}}_selectMenuItem({key:t,target:e}){const i=ke.find(".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",this._menu).filter((t=>Wt(t)));i.length&&Ut(i,e,t===Ti,!i.includes(e)).focus()}static jQueryInterface(t){return this.each((function(){const e=Vi.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}static clearMenus(t){if(2===t.button||"keyup"===t.type&&"Tab"!==t.key)return;const e=ke.find(Pi);for(const i of e){const e=Vi.getInstance(i);if(!e||!1===e._config.autoClose)continue;const n=t.composedPath(),s=n.includes(e._menu);if(n.includes(e._element)||"inside"===e._config.autoClose&&!s||"outside"===e._config.autoClose&&s)continue;if(e._menu.contains(t.target)&&("keyup"===t.type&&"Tab"===t.key||/input|select|option|textarea|form/i.test(t.target.tagName)))continue;const o={relatedTarget:e._element};"click"===t.type&&(o.clickEvent=t),e._completeHide(o)}}static dataApiKeydownHandler(t){const e=/input|textarea/i.test(t.target.tagName),i="Escape"===t.key,n=[Ci,Ti].includes(t.key);if(!n&&!i)return;if(e&&!i)return;t.preventDefault();const s=this.matches(Ni)?this:ke.prev(this,Ni)[0]||ke.next(this,Ni)[0]||ke.findOne(Ni,t.delegateTarget.parentNode),o=Vi.getOrCreateInstance(s);if(n)return t.stopPropagation(),o.show(),void o._selectMenuItem(t);o._isShown()&&(t.stopPropagation(),o.hide(),s.focus())}}de.on(document,$i,Ni,Vi.dataApiKeydownHandler),de.on(document,$i,ji,Vi.dataApiKeydownHandler),de.on(document,Di,Vi.clearMenus),de.on(document,Si,Vi.clearMenus),de.on(document,Di,Ni,(function(t){t.preventDefault(),Vi.getOrCreateInstance(this).toggle()})),Qt(Vi);const Ki=".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",Qi=".sticky-top",Xi="padding-right",Yi="margin-right";class Ui{constructor(){this._element=document.body}getWidth(){const t=document.documentElement.clientWidth;return Math.abs(window.innerWidth-t)}hide(){const t=this.getWidth();this._disableOverFlow(),this._setElementAttributes(this._element,Xi,(e=>e+t)),this._setElementAttributes(Ki,Xi,(e=>e+t)),this._setElementAttributes(Qi,Yi,(e=>e-t))}reset(){this._resetElementAttributes(this._element,"overflow"),this._resetElementAttributes(this._element,Xi),this._resetElementAttributes(Ki,Xi),this._resetElementAttributes(Qi,Yi)}isOverflowing(){return this.getWidth()>0}_disableOverFlow(){this._saveInitialAttribute(this._element,"overflow"),this._element.style.overflow="hidden"}_setElementAttributes(t,e,i){const n=this.getWidth();this._applyManipulationCallback(t,(t=>{if(t!==this._element&&window.innerWidth>t.clientWidth+n)return;this._saveInitialAttribute(t,e);const s=window.getComputedStyle(t).getPropertyValue(e);t.style.setProperty(e,`${i(Number.parseFloat(s))}px`)}))}_saveInitialAttribute(t,e){const i=t.style.getPropertyValue(e);i&&be.setDataAttribute(t,e,i)}_resetElementAttributes(t,e){this._applyManipulationCallback(t,(t=>{const i=be.getDataAttribute(t,e);null!==i?(be.removeDataAttribute(t,e),t.style.setProperty(e,i)):t.style.removeProperty(e)}))}_applyManipulationCallback(t,e){if(Mt(t))e(t);else for(const i of ke.find(t,this._element))e(i)}}const Gi="backdrop",Ji="show",Zi=`mousedown.bs.${Gi}`,tn={className:"modal-backdrop",clickCallback:null,isAnimated:!1,isVisible:!0,rootElement:"body"},en={className:"string",clickCallback:"(function|null)",isAnimated:"boolean",isVisible:"boolean",rootElement:"(element|string)"};class nn extends ve{constructor(t){super(),this._config=this._getConfig(t),this._isAppended=!1,this._element=null}static get Default(){return tn}static get DefaultType(){return en}static get NAME(){return Gi}show(t){if(!this._config.isVisible)return void Xt(t);this._append();const e=this._getElement();this._config.isAnimated&&qt(e),e.classList.add(Ji),this._emulateAnimation((()=>{Xt(t)}))}hide(t){this._config.isVisible?(this._getElement().classList.remove(Ji),this._emulateAnimation((()=>{this.dispose(),Xt(t)}))):Xt(t)}dispose(){this._isAppended&&(de.off(this._element,Zi),this._element.remove(),this._isAppended=!1)}_getElement(){if(!this._element){const t=document.createElement("div");t.className=this._config.className,this._config.isAnimated&&t.classList.add("fade"),this._element=t}return this._element}_configAfterMerge(t){return t.rootElement=Ht(t.rootElement),t}_append(){if(this._isAppended)return;const t=this._getElement();this._config.rootElement.append(t),de.on(t,Zi,(()=>{Xt(this._config.clickCallback)})),this._isAppended=!0}_emulateAnimation(t){Yt(t,this._getElement(),this._config.isAnimated)}}const sn=".bs.focustrap",on=`focusin${sn}`,rn=`keydown.tab${sn}`,an="backward",ln={autofocus:!0,trapElement:null},cn={autofocus:"boolean",trapElement:"element"};class hn extends ve{constructor(t){super(),this._config=this._getConfig(t),this._isActive=!1,this._lastTabNavDirection=null}static get Default(){return ln}static get DefaultType(){return cn}static get NAME(){return"focustrap"}activate(){this._isActive||(this._config.autofocus&&this._config.trapElement.focus(),de.off(document,sn),de.on(document,on,(t=>this._handleFocusin(t))),de.on(document,rn,(t=>this._handleKeydown(t))),this._isActive=!0)}deactivate(){this._isActive&&(this._isActive=!1,de.off(document,sn))}_handleFocusin(t){const{trapElement:e}=this._config;if(t.target===document||t.target===e||e.contains(t.target))return;const i=ke.focusableChildren(e);0===i.length?e.focus():this._lastTabNavDirection===an?i[i.length-1].focus():i[0].focus()}_handleKeydown(t){"Tab"===t.key&&(this._lastTabNavDirection=t.shiftKey?an:"forward")}}const un=".bs.modal",dn=`hide${un}`,fn=`hidePrevented${un}`,pn=`hidden${un}`,gn=`show${un}`,mn=`shown${un}`,_n=`resize${un}`,bn=`click.dismiss${un}`,vn=`mousedown.dismiss${un}`,yn=`keydown.dismiss${un}`,wn=`click${un}.data-api`,An="modal-open",En="show",Cn="modal-static",Tn={backdrop:!0,focus:!0,keyboard:!0},On={backdrop:"(boolean|string)",focus:"boolean",keyboard:"boolean"};class xn extends ye{constructor(t,e){super(t,e),this._dialog=ke.findOne(".modal-dialog",this._element),this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._isShown=!1,this._isTransitioning=!1,this._scrollBar=new Ui,this._addEventListeners()}static get Default(){return Tn}static get DefaultType(){return On}static get NAME(){return"modal"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||this._isTransitioning||de.trigger(this._element,gn,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._isTransitioning=!0,this._scrollBar.hide(),document.body.classList.add(An),this._adjustDialog(),this._backdrop.show((()=>this._showElement(t))))}hide(){this._isShown&&!this._isTransitioning&&(de.trigger(this._element,dn).defaultPrevented||(this._isShown=!1,this._isTransitioning=!0,this._focustrap.deactivate(),this._element.classList.remove(En),this._queueCallback((()=>this._hideModal()),this._element,this._isAnimated())))}dispose(){for(const t of[window,this._dialog])de.off(t,un);this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}handleUpdate(){this._adjustDialog()}_initializeBackDrop(){return new nn({isVisible:Boolean(this._config.backdrop),isAnimated:this._isAnimated()})}_initializeFocusTrap(){return new hn({trapElement:this._element})}_showElement(t){document.body.contains(this._element)||document.body.append(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.scrollTop=0;const e=ke.findOne(".modal-body",this._dialog);e&&(e.scrollTop=0),qt(this._element),this._element.classList.add(En),this._queueCallback((()=>{this._config.focus&&this._focustrap.activate(),this._isTransitioning=!1,de.trigger(this._element,mn,{relatedTarget:t})}),this._dialog,this._isAnimated())}_addEventListeners(){de.on(this._element,yn,(t=>{if("Escape"===t.key)return this._config.keyboard?(t.preventDefault(),void this.hide()):void this._triggerBackdropTransition()})),de.on(window,_n,(()=>{this._isShown&&!this._isTransitioning&&this._adjustDialog()})),de.on(this._element,vn,(t=>{de.one(this._element,bn,(e=>{this._element===t.target&&this._element===e.target&&("static"!==this._config.backdrop?this._config.backdrop&&this.hide():this._triggerBackdropTransition())}))}))}_hideModal(){this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._isTransitioning=!1,this._backdrop.hide((()=>{document.body.classList.remove(An),this._resetAdjustments(),this._scrollBar.reset(),de.trigger(this._element,pn)}))}_isAnimated(){return this._element.classList.contains("fade")}_triggerBackdropTransition(){if(de.trigger(this._element,fn).defaultPrevented)return;const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._element.style.overflowY;"hidden"===e||this._element.classList.contains(Cn)||(t||(this._element.style.overflowY="hidden"),this._element.classList.add(Cn),this._queueCallback((()=>{this._element.classList.remove(Cn),this._queueCallback((()=>{this._element.style.overflowY=e}),this._dialog)}),this._dialog),this._element.focus())}_adjustDialog(){const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._scrollBar.getWidth(),i=e>0;if(i&&!t){const t=Kt()?"paddingLeft":"paddingRight";this._element.style[t]=`${e}px`}if(!i&&t){const t=Kt()?"paddingRight":"paddingLeft";this._element.style[t]=`${e}px`}}_resetAdjustments(){this._element.style.paddingLeft="",this._element.style.paddingRight=""}static jQueryInterface(t,e){return this.each((function(){const i=xn.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t](e)}}))}}de.on(document,wn,'[data-bs-toggle="modal"]',(function(t){const e=Pt(this);["A","AREA"].includes(this.tagName)&&t.preventDefault(),de.one(e,gn,(t=>{t.defaultPrevented||de.one(e,pn,(()=>{Wt(this)&&this.focus()}))}));const i=ke.findOne(".modal.show");i&&xn.getInstance(i).hide(),xn.getOrCreateInstance(e).toggle(this)})),we(xn),Qt(xn);const kn=".bs.offcanvas",Ln=".data-api",Dn=`load${kn}${Ln}`,$n="show",Sn="showing",In="hiding",Nn=".offcanvas.show",Pn=`show${kn}`,jn=`shown${kn}`,Mn=`hide${kn}`,Hn=`hidePrevented${kn}`,Wn=`hidden${kn}`,Fn=`resize${kn}`,Bn=`click${kn}${Ln}`,zn=`keydown.dismiss${kn}`,qn={backdrop:!0,keyboard:!0,scroll:!1},Rn={backdrop:"(boolean|string)",keyboard:"boolean",scroll:"boolean"};class Vn extends ye{constructor(t,e){super(t,e),this._isShown=!1,this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._addEventListeners()}static get Default(){return qn}static get DefaultType(){return Rn}static get NAME(){return"offcanvas"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||de.trigger(this._element,Pn,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._backdrop.show(),this._config.scroll||(new Ui).hide(),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.classList.add(Sn),this._queueCallback((()=>{this._config.scroll&&!this._config.backdrop||this._focustrap.activate(),this._element.classList.add($n),this._element.classList.remove(Sn),de.trigger(this._element,jn,{relatedTarget:t})}),this._element,!0))}hide(){this._isShown&&(de.trigger(this._element,Mn).defaultPrevented||(this._focustrap.deactivate(),this._element.blur(),this._isShown=!1,this._element.classList.add(In),this._backdrop.hide(),this._queueCallback((()=>{this._element.classList.remove($n,In),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._config.scroll||(new Ui).reset(),de.trigger(this._element,Wn)}),this._element,!0)))}dispose(){this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}_initializeBackDrop(){const t=Boolean(this._config.backdrop);return new nn({className:"offcanvas-backdrop",isVisible:t,isAnimated:!0,rootElement:this._element.parentNode,clickCallback:t?()=>{"static"!==this._config.backdrop?this.hide():de.trigger(this._element,Hn)}:null})}_initializeFocusTrap(){return new hn({trapElement:this._element})}_addEventListeners(){de.on(this._element,zn,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():de.trigger(this._element,Hn))}))}static jQueryInterface(t){return this.each((function(){const e=Vn.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}de.on(document,Bn,'[data-bs-toggle="offcanvas"]',(function(t){const e=Pt(this);if(["A","AREA"].includes(this.tagName)&&t.preventDefault(),Ft(this))return;de.one(e,Wn,(()=>{Wt(this)&&this.focus()}));const i=ke.findOne(Nn);i&&i!==e&&Vn.getInstance(i).hide(),Vn.getOrCreateInstance(e).toggle(this)})),de.on(window,Dn,(()=>{for(const t of ke.find(Nn))Vn.getOrCreateInstance(t).show()})),de.on(window,Fn,(()=>{for(const t of ke.find("[aria-modal][class*=show][class*=offcanvas-]"))"fixed"!==getComputedStyle(t).position&&Vn.getOrCreateInstance(t).hide()})),we(Vn),Qt(Vn);const Kn=new Set(["background","cite","href","itemtype","longdesc","poster","src","xlink:href"]),Qn=/^(?:(?:https?|mailto|ftp|tel|file|sms):|[^#&/:?]*(?:[#/?]|$))/i,Xn=/^data:(?:image\/(?:bmp|gif|jpeg|jpg|png|tiff|webp)|video\/(?:mpeg|mp4|ogg|webm)|audio\/(?:mp3|oga|ogg|opus));base64,[\d+/a-z]+=*$/i,Yn=(t,e)=>{const i=t.nodeName.toLowerCase();return e.includes(i)?!Kn.has(i)||Boolean(Qn.test(t.nodeValue)||Xn.test(t.nodeValue)):e.filter((t=>t instanceof RegExp)).some((t=>t.test(i)))},Un={"*":["class","dir","id","lang","role",/^aria-[\w-]*$/i],a:["target","href","title","rel"],area:[],b:[],br:[],col:[],code:[],div:[],em:[],hr:[],h1:[],h2:[],h3:[],h4:[],h5:[],h6:[],i:[],img:["src","srcset","alt","title","width","height"],li:[],ol:[],p:[],pre:[],s:[],small:[],span:[],sub:[],sup:[],strong:[],u:[],ul:[]},Gn={allowList:Un,content:{},extraClass:"",html:!1,sanitize:!0,sanitizeFn:null,template:"
"},Jn={allowList:"object",content:"object",extraClass:"(string|function)",html:"boolean",sanitize:"boolean",sanitizeFn:"(null|function)",template:"string"},Zn={entry:"(string|element|function|null)",selector:"(string|element)"};class ts extends ve{constructor(t){super(),this._config=this._getConfig(t)}static get Default(){return Gn}static get DefaultType(){return Jn}static get NAME(){return"TemplateFactory"}getContent(){return Object.values(this._config.content).map((t=>this._resolvePossibleFunction(t))).filter(Boolean)}hasContent(){return this.getContent().length>0}changeContent(t){return this._checkContent(t),this._config.content={...this._config.content,...t},this}toHtml(){const t=document.createElement("div");t.innerHTML=this._maybeSanitize(this._config.template);for(const[e,i]of Object.entries(this._config.content))this._setContent(t,i,e);const e=t.children[0],i=this._resolvePossibleFunction(this._config.extraClass);return i&&e.classList.add(...i.split(" ")),e}_typeCheckConfig(t){super._typeCheckConfig(t),this._checkContent(t.content)}_checkContent(t){for(const[e,i]of Object.entries(t))super._typeCheckConfig({selector:e,entry:i},Zn)}_setContent(t,e,i){const n=ke.findOne(i,t);n&&((e=this._resolvePossibleFunction(e))?Mt(e)?this._putElementInTemplate(Ht(e),n):this._config.html?n.innerHTML=this._maybeSanitize(e):n.textContent=e:n.remove())}_maybeSanitize(t){return this._config.sanitize?function(t,e,i){if(!t.length)return t;if(i&&"function"==typeof i)return i(t);const n=(new window.DOMParser).parseFromString(t,"text/html"),s=[].concat(...n.body.querySelectorAll("*"));for(const t of s){const i=t.nodeName.toLowerCase();if(!Object.keys(e).includes(i)){t.remove();continue}const n=[].concat(...t.attributes),s=[].concat(e["*"]||[],e[i]||[]);for(const e of n)Yn(e,s)||t.removeAttribute(e.nodeName)}return n.body.innerHTML}(t,this._config.allowList,this._config.sanitizeFn):t}_resolvePossibleFunction(t){return"function"==typeof t?t(this):t}_putElementInTemplate(t,e){if(this._config.html)return e.innerHTML="",void e.append(t);e.textContent=t.textContent}}const es=new Set(["sanitize","allowList","sanitizeFn"]),is="fade",ns="show",ss=".modal",os="hide.bs.modal",rs="hover",as="focus",ls={AUTO:"auto",TOP:"top",RIGHT:Kt()?"left":"right",BOTTOM:"bottom",LEFT:Kt()?"right":"left"},cs={allowList:Un,animation:!0,boundary:"clippingParents",container:!1,customClass:"",delay:0,fallbackPlacements:["top","right","bottom","left"],html:!1,offset:[0,0],placement:"top",popperConfig:null,sanitize:!0,sanitizeFn:null,selector:!1,template:'',title:"",trigger:"hover focus"},hs={allowList:"object",animation:"boolean",boundary:"(string|element)",container:"(string|element|boolean)",customClass:"(string|function)",delay:"(number|object)",fallbackPlacements:"array",html:"boolean",offset:"(array|string|function)",placement:"(string|function)",popperConfig:"(null|object|function)",sanitize:"boolean",sanitizeFn:"(null|function)",selector:"(string|boolean)",template:"string",title:"(string|element|function)",trigger:"string"};class us extends ye{constructor(t,i){if(void 0===e)throw new TypeError("Bootstrap's tooltips require Popper (https://popper.js.org)");super(t,i),this._isEnabled=!0,this._timeout=0,this._isHovered=null,this._activeTrigger={},this._popper=null,this._templateFactory=null,this._newContent=null,this.tip=null,this._setListeners(),this._config.selector||this._fixTitle()}static get Default(){return cs}static get DefaultType(){return hs}static get NAME(){return"tooltip"}enable(){this._isEnabled=!0}disable(){this._isEnabled=!1}toggleEnabled(){this._isEnabled=!this._isEnabled}toggle(){this._isEnabled&&(this._activeTrigger.click=!this._activeTrigger.click,this._isShown()?this._leave():this._enter())}dispose(){clearTimeout(this._timeout),de.off(this._element.closest(ss),os,this._hideModalHandler),this._element.getAttribute("data-bs-original-title")&&this._element.setAttribute("title",this._element.getAttribute("data-bs-original-title")),this._disposePopper(),super.dispose()}show(){if("none"===this._element.style.display)throw new Error("Please use show on visible elements");if(!this._isWithContent()||!this._isEnabled)return;const t=de.trigger(this._element,this.constructor.eventName("show")),e=(Bt(this._element)||this._element.ownerDocument.documentElement).contains(this._element);if(t.defaultPrevented||!e)return;this._disposePopper();const i=this._getTipElement();this._element.setAttribute("aria-describedby",i.getAttribute("id"));const{container:n}=this._config;if(this._element.ownerDocument.documentElement.contains(this.tip)||(n.append(i),de.trigger(this._element,this.constructor.eventName("inserted"))),this._popper=this._createPopper(i),i.classList.add(ns),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))de.on(t,"mouseover",zt);this._queueCallback((()=>{de.trigger(this._element,this.constructor.eventName("shown")),!1===this._isHovered&&this._leave(),this._isHovered=!1}),this.tip,this._isAnimated())}hide(){if(this._isShown()&&!de.trigger(this._element,this.constructor.eventName("hide")).defaultPrevented){if(this._getTipElement().classList.remove(ns),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))de.off(t,"mouseover",zt);this._activeTrigger.click=!1,this._activeTrigger[as]=!1,this._activeTrigger[rs]=!1,this._isHovered=null,this._queueCallback((()=>{this._isWithActiveTrigger()||(this._isHovered||this._disposePopper(),this._element.removeAttribute("aria-describedby"),de.trigger(this._element,this.constructor.eventName("hidden")))}),this.tip,this._isAnimated())}}update(){this._popper&&this._popper.update()}_isWithContent(){return Boolean(this._getTitle())}_getTipElement(){return this.tip||(this.tip=this._createTipElement(this._newContent||this._getContentForTemplate())),this.tip}_createTipElement(t){const e=this._getTemplateFactory(t).toHtml();if(!e)return null;e.classList.remove(is,ns),e.classList.add(`bs-${this.constructor.NAME}-auto`);const i=(t=>{do{t+=Math.floor(1e6*Math.random())}while(document.getElementById(t));return t})(this.constructor.NAME).toString();return e.setAttribute("id",i),this._isAnimated()&&e.classList.add(is),e}setContent(t){this._newContent=t,this._isShown()&&(this._disposePopper(),this.show())}_getTemplateFactory(t){return this._templateFactory?this._templateFactory.changeContent(t):this._templateFactory=new ts({...this._config,content:t,extraClass:this._resolvePossibleFunction(this._config.customClass)}),this._templateFactory}_getContentForTemplate(){return{".tooltip-inner":this._getTitle()}}_getTitle(){return this._resolvePossibleFunction(this._config.title)||this._element.getAttribute("data-bs-original-title")}_initializeOnDelegatedTarget(t){return this.constructor.getOrCreateInstance(t.delegateTarget,this._getDelegateConfig())}_isAnimated(){return this._config.animation||this.tip&&this.tip.classList.contains(is)}_isShown(){return this.tip&&this.tip.classList.contains(ns)}_createPopper(t){const e="function"==typeof this._config.placement?this._config.placement.call(this,t,this._element):this._config.placement,i=ls[e.toUpperCase()];return Dt(this._element,t,this._getPopperConfig(i))}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_resolvePossibleFunction(t){return"function"==typeof t?t.call(this._element):t}_getPopperConfig(t){const e={placement:t,modifiers:[{name:"flip",options:{fallbackPlacements:this._config.fallbackPlacements}},{name:"offset",options:{offset:this._getOffset()}},{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"arrow",options:{element:`.${this.constructor.NAME}-arrow`}},{name:"preSetPlacement",enabled:!0,phase:"beforeMain",fn:t=>{this._getTipElement().setAttribute("data-popper-placement",t.state.placement)}}]};return{...e,..."function"==typeof this._config.popperConfig?this._config.popperConfig(e):this._config.popperConfig}}_setListeners(){const t=this._config.trigger.split(" ");for(const e of t)if("click"===e)de.on(this._element,this.constructor.eventName("click"),this._config.selector,(t=>{this._initializeOnDelegatedTarget(t).toggle()}));else if("manual"!==e){const t=e===rs?this.constructor.eventName("mouseenter"):this.constructor.eventName("focusin"),i=e===rs?this.constructor.eventName("mouseleave"):this.constructor.eventName("focusout");de.on(this._element,t,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusin"===t.type?as:rs]=!0,e._enter()})),de.on(this._element,i,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusout"===t.type?as:rs]=e._element.contains(t.relatedTarget),e._leave()}))}this._hideModalHandler=()=>{this._element&&this.hide()},de.on(this._element.closest(ss),os,this._hideModalHandler)}_fixTitle(){const t=this._element.getAttribute("title");t&&(this._element.getAttribute("aria-label")||this._element.textContent.trim()||this._element.setAttribute("aria-label",t),this._element.setAttribute("data-bs-original-title",t),this._element.removeAttribute("title"))}_enter(){this._isShown()||this._isHovered?this._isHovered=!0:(this._isHovered=!0,this._setTimeout((()=>{this._isHovered&&this.show()}),this._config.delay.show))}_leave(){this._isWithActiveTrigger()||(this._isHovered=!1,this._setTimeout((()=>{this._isHovered||this.hide()}),this._config.delay.hide))}_setTimeout(t,e){clearTimeout(this._timeout),this._timeout=setTimeout(t,e)}_isWithActiveTrigger(){return Object.values(this._activeTrigger).includes(!0)}_getConfig(t){const e=be.getDataAttributes(this._element);for(const t of Object.keys(e))es.has(t)&&delete e[t];return t={...e,..."object"==typeof t&&t?t:{}},t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t.container=!1===t.container?document.body:Ht(t.container),"number"==typeof t.delay&&(t.delay={show:t.delay,hide:t.delay}),"number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),t}_getDelegateConfig(){const t={};for(const e in this._config)this.constructor.Default[e]!==this._config[e]&&(t[e]=this._config[e]);return t.selector=!1,t.trigger="manual",t}_disposePopper(){this._popper&&(this._popper.destroy(),this._popper=null),this.tip&&(this.tip.remove(),this.tip=null)}static jQueryInterface(t){return this.each((function(){const e=us.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}Qt(us);const ds={...us.Default,content:"",offset:[0,8],placement:"right",template:'',trigger:"click"},fs={...us.DefaultType,content:"(null|string|element|function)"};class ps extends us{static get Default(){return ds}static get DefaultType(){return fs}static get NAME(){return"popover"}_isWithContent(){return this._getTitle()||this._getContent()}_getContentForTemplate(){return{".popover-header":this._getTitle(),".popover-body":this._getContent()}}_getContent(){return this._resolvePossibleFunction(this._config.content)}static jQueryInterface(t){return this.each((function(){const e=ps.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}Qt(ps);const gs=".bs.scrollspy",ms=`activate${gs}`,_s=`click${gs}`,bs=`load${gs}.data-api`,vs="active",ys="[href]",ws=".nav-link",As=`${ws}, .nav-item > ${ws}, .list-group-item`,Es={offset:null,rootMargin:"0px 0px -25%",smoothScroll:!1,target:null,threshold:[.1,.5,1]},Cs={offset:"(number|null)",rootMargin:"string",smoothScroll:"boolean",target:"element",threshold:"array"};class Ts extends ye{constructor(t,e){super(t,e),this._targetLinks=new Map,this._observableSections=new Map,this._rootElement="visible"===getComputedStyle(this._element).overflowY?null:this._element,this._activeTarget=null,this._observer=null,this._previousScrollData={visibleEntryTop:0,parentScrollTop:0},this.refresh()}static get Default(){return Es}static get DefaultType(){return Cs}static get NAME(){return"scrollspy"}refresh(){this._initializeTargetsAndObservables(),this._maybeEnableSmoothScroll(),this._observer?this._observer.disconnect():this._observer=this._getNewObserver();for(const t of this._observableSections.values())this._observer.observe(t)}dispose(){this._observer.disconnect(),super.dispose()}_configAfterMerge(t){return t.target=Ht(t.target)||document.body,t.rootMargin=t.offset?`${t.offset}px 0px -30%`:t.rootMargin,"string"==typeof t.threshold&&(t.threshold=t.threshold.split(",").map((t=>Number.parseFloat(t)))),t}_maybeEnableSmoothScroll(){this._config.smoothScroll&&(de.off(this._config.target,_s),de.on(this._config.target,_s,ys,(t=>{const e=this._observableSections.get(t.target.hash);if(e){t.preventDefault();const i=this._rootElement||window,n=e.offsetTop-this._element.offsetTop;if(i.scrollTo)return void i.scrollTo({top:n,behavior:"smooth"});i.scrollTop=n}})))}_getNewObserver(){const t={root:this._rootElement,threshold:this._config.threshold,rootMargin:this._config.rootMargin};return new IntersectionObserver((t=>this._observerCallback(t)),t)}_observerCallback(t){const e=t=>this._targetLinks.get(`#${t.target.id}`),i=t=>{this._previousScrollData.visibleEntryTop=t.target.offsetTop,this._process(e(t))},n=(this._rootElement||document.documentElement).scrollTop,s=n>=this._previousScrollData.parentScrollTop;this._previousScrollData.parentScrollTop=n;for(const o of t){if(!o.isIntersecting){this._activeTarget=null,this._clearActiveClass(e(o));continue}const t=o.target.offsetTop>=this._previousScrollData.visibleEntryTop;if(s&&t){if(i(o),!n)return}else s||t||i(o)}}_initializeTargetsAndObservables(){this._targetLinks=new Map,this._observableSections=new Map;const t=ke.find(ys,this._config.target);for(const e of t){if(!e.hash||Ft(e))continue;const t=ke.findOne(e.hash,this._element);Wt(t)&&(this._targetLinks.set(e.hash,e),this._observableSections.set(e.hash,t))}}_process(t){this._activeTarget!==t&&(this._clearActiveClass(this._config.target),this._activeTarget=t,t.classList.add(vs),this._activateParents(t),de.trigger(this._element,ms,{relatedTarget:t}))}_activateParents(t){if(t.classList.contains("dropdown-item"))ke.findOne(".dropdown-toggle",t.closest(".dropdown")).classList.add(vs);else for(const e of ke.parents(t,".nav, .list-group"))for(const t of ke.prev(e,As))t.classList.add(vs)}_clearActiveClass(t){t.classList.remove(vs);const e=ke.find(`${ys}.${vs}`,t);for(const t of e)t.classList.remove(vs)}static jQueryInterface(t){return this.each((function(){const e=Ts.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}de.on(window,bs,(()=>{for(const t of ke.find('[data-bs-spy="scroll"]'))Ts.getOrCreateInstance(t)})),Qt(Ts);const Os=".bs.tab",xs=`hide${Os}`,ks=`hidden${Os}`,Ls=`show${Os}`,Ds=`shown${Os}`,$s=`click${Os}`,Ss=`keydown${Os}`,Is=`load${Os}`,Ns="ArrowLeft",Ps="ArrowRight",js="ArrowUp",Ms="ArrowDown",Hs="active",Ws="fade",Fs="show",Bs=":not(.dropdown-toggle)",zs='[data-bs-toggle="tab"], [data-bs-toggle="pill"], [data-bs-toggle="list"]',qs=`.nav-link${Bs}, .list-group-item${Bs}, [role="tab"]${Bs}, ${zs}`,Rs=`.${Hs}[data-bs-toggle="tab"], .${Hs}[data-bs-toggle="pill"], .${Hs}[data-bs-toggle="list"]`;class Vs extends ye{constructor(t){super(t),this._parent=this._element.closest('.list-group, .nav, [role="tablist"]'),this._parent&&(this._setInitialAttributes(this._parent,this._getChildren()),de.on(this._element,Ss,(t=>this._keydown(t))))}static get NAME(){return"tab"}show(){const t=this._element;if(this._elemIsActive(t))return;const e=this._getActiveElem(),i=e?de.trigger(e,xs,{relatedTarget:t}):null;de.trigger(t,Ls,{relatedTarget:e}).defaultPrevented||i&&i.defaultPrevented||(this._deactivate(e,t),this._activate(t,e))}_activate(t,e){t&&(t.classList.add(Hs),this._activate(Pt(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.removeAttribute("tabindex"),t.setAttribute("aria-selected",!0),this._toggleDropDown(t,!0),de.trigger(t,Ds,{relatedTarget:e})):t.classList.add(Fs)}),t,t.classList.contains(Ws)))}_deactivate(t,e){t&&(t.classList.remove(Hs),t.blur(),this._deactivate(Pt(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.setAttribute("aria-selected",!1),t.setAttribute("tabindex","-1"),this._toggleDropDown(t,!1),de.trigger(t,ks,{relatedTarget:e})):t.classList.remove(Fs)}),t,t.classList.contains(Ws)))}_keydown(t){if(![Ns,Ps,js,Ms].includes(t.key))return;t.stopPropagation(),t.preventDefault();const e=[Ps,Ms].includes(t.key),i=Ut(this._getChildren().filter((t=>!Ft(t))),t.target,e,!0);i&&(i.focus({preventScroll:!0}),Vs.getOrCreateInstance(i).show())}_getChildren(){return ke.find(qs,this._parent)}_getActiveElem(){return this._getChildren().find((t=>this._elemIsActive(t)))||null}_setInitialAttributes(t,e){this._setAttributeIfNotExists(t,"role","tablist");for(const t of e)this._setInitialAttributesOnChild(t)}_setInitialAttributesOnChild(t){t=this._getInnerElement(t);const e=this._elemIsActive(t),i=this._getOuterElement(t);t.setAttribute("aria-selected",e),i!==t&&this._setAttributeIfNotExists(i,"role","presentation"),e||t.setAttribute("tabindex","-1"),this._setAttributeIfNotExists(t,"role","tab"),this._setInitialAttributesOnTargetPanel(t)}_setInitialAttributesOnTargetPanel(t){const e=Pt(t);e&&(this._setAttributeIfNotExists(e,"role","tabpanel"),t.id&&this._setAttributeIfNotExists(e,"aria-labelledby",`#${t.id}`))}_toggleDropDown(t,e){const i=this._getOuterElement(t);if(!i.classList.contains("dropdown"))return;const n=(t,n)=>{const s=ke.findOne(t,i);s&&s.classList.toggle(n,e)};n(".dropdown-toggle",Hs),n(".dropdown-menu",Fs),i.setAttribute("aria-expanded",e)}_setAttributeIfNotExists(t,e,i){t.hasAttribute(e)||t.setAttribute(e,i)}_elemIsActive(t){return t.classList.contains(Hs)}_getInnerElement(t){return t.matches(qs)?t:ke.findOne(qs,t)}_getOuterElement(t){return t.closest(".nav-item, .list-group-item")||t}static jQueryInterface(t){return this.each((function(){const e=Vs.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}de.on(document,$s,zs,(function(t){["A","AREA"].includes(this.tagName)&&t.preventDefault(),Ft(this)||Vs.getOrCreateInstance(this).show()})),de.on(window,Is,(()=>{for(const t of ke.find(Rs))Vs.getOrCreateInstance(t)})),Qt(Vs);const Ks=".bs.toast",Qs=`mouseover${Ks}`,Xs=`mouseout${Ks}`,Ys=`focusin${Ks}`,Us=`focusout${Ks}`,Gs=`hide${Ks}`,Js=`hidden${Ks}`,Zs=`show${Ks}`,to=`shown${Ks}`,eo="hide",io="show",no="showing",so={animation:"boolean",autohide:"boolean",delay:"number"},oo={animation:!0,autohide:!0,delay:5e3};class ro extends ye{constructor(t,e){super(t,e),this._timeout=null,this._hasMouseInteraction=!1,this._hasKeyboardInteraction=!1,this._setListeners()}static get Default(){return oo}static get DefaultType(){return so}static get NAME(){return"toast"}show(){de.trigger(this._element,Zs).defaultPrevented||(this._clearTimeout(),this._config.animation&&this._element.classList.add("fade"),this._element.classList.remove(eo),qt(this._element),this._element.classList.add(io,no),this._queueCallback((()=>{this._element.classList.remove(no),de.trigger(this._element,to),this._maybeScheduleHide()}),this._element,this._config.animation))}hide(){this.isShown()&&(de.trigger(this._element,Gs).defaultPrevented||(this._element.classList.add(no),this._queueCallback((()=>{this._element.classList.add(eo),this._element.classList.remove(no,io),de.trigger(this._element,Js)}),this._element,this._config.animation)))}dispose(){this._clearTimeout(),this.isShown()&&this._element.classList.remove(io),super.dispose()}isShown(){return this._element.classList.contains(io)}_maybeScheduleHide(){this._config.autohide&&(this._hasMouseInteraction||this._hasKeyboardInteraction||(this._timeout=setTimeout((()=>{this.hide()}),this._config.delay)))}_onInteraction(t,e){switch(t.type){case"mouseover":case"mouseout":this._hasMouseInteraction=e;break;case"focusin":case"focusout":this._hasKeyboardInteraction=e}if(e)return void this._clearTimeout();const i=t.relatedTarget;this._element===i||this._element.contains(i)||this._maybeScheduleHide()}_setListeners(){de.on(this._element,Qs,(t=>this._onInteraction(t,!0))),de.on(this._element,Xs,(t=>this._onInteraction(t,!1))),de.on(this._element,Ys,(t=>this._onInteraction(t,!0))),de.on(this._element,Us,(t=>this._onInteraction(t,!1)))}_clearTimeout(){clearTimeout(this._timeout),this._timeout=null}static jQueryInterface(t){return this.each((function(){const e=ro.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}var ao;we(ro),Qt(ro),ao=function(){[].slice.call(document.querySelectorAll('[data-bs-toggle="tooltip"]')).map((function(t){return new us(t,{delay:{show:500,hide:100}})}))},"loading"!=document.readyState?ao():document.addEventListener("DOMContentLoaded",ao)})(); +//# sourceMappingURL=bootstrap.js.map \ No newline at end of file diff --git a/_static/scripts/bootstrap.js.LICENSE.txt b/_static/scripts/bootstrap.js.LICENSE.txt new file mode 100644 index 0000000..91ad10a --- /dev/null +++ b/_static/scripts/bootstrap.js.LICENSE.txt @@ -0,0 +1,5 @@ +/*! + * Bootstrap v5.2.3 (https://getbootstrap.com/) + * Copyright 2011-2022 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors) + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + */ diff --git a/_static/scripts/bootstrap.js.map b/_static/scripts/bootstrap.js.map new file mode 100644 index 0000000..d83e2f7 --- /dev/null +++ b/_static/scripts/bootstrap.js.map @@ -0,0 +1 @@ +{"version":3,"file":"scripts/bootstrap.js","mappings":";mBACA,IAAIA,EAAsB,CCA1BA,EAAwB,CAACC,EAASC,KACjC,IAAI,IAAIC,KAAOD,EACXF,EAAoBI,EAAEF,EAAYC,KAASH,EAAoBI,EAAEH,EAASE,IAC5EE,OAAOC,eAAeL,EAASE,EAAK,CAAEI,YAAY,EAAMC,IAAKN,EAAWC,IAE1E,ECNDH,EAAwB,CAACS,EAAKC,IAAUL,OAAOM,UAAUC,eAAeC,KAAKJ,EAAKC,GCClFV,EAAyBC,IACH,oBAAXa,QAA0BA,OAAOC,aAC1CV,OAAOC,eAAeL,EAASa,OAAOC,YAAa,CAAEC,MAAO,WAE7DX,OAAOC,eAAeL,EAAS,aAAc,CAAEe,OAAO,GAAO,ipBCLvD,IAAI,EAAM,MACNC,EAAS,SACTC,EAAQ,QACRC,EAAO,OACPC,EAAO,OACPC,EAAiB,CAAC,EAAKJ,EAAQC,EAAOC,GACtCG,EAAQ,QACRC,EAAM,MACNC,EAAkB,kBAClBC,EAAW,WACXC,EAAS,SACTC,EAAY,YACZC,EAAmCP,EAAeQ,QAAO,SAAUC,EAAKC,GACjF,OAAOD,EAAIE,OAAO,CAACD,EAAY,IAAMT,EAAOS,EAAY,IAAMR,GAChE,GAAG,IACQ,EAA0B,GAAGS,OAAOX,EAAgB,CAACD,IAAOS,QAAO,SAAUC,EAAKC,GAC3F,OAAOD,EAAIE,OAAO,CAACD,EAAWA,EAAY,IAAMT,EAAOS,EAAY,IAAMR,GAC3E,GAAG,IAEQU,EAAa,aACbC,EAAO,OACPC,EAAY,YAEZC,EAAa,aACbC,EAAO,OACPC,EAAY,YAEZC,EAAc,cACdC,EAAQ,QACRC,EAAa,aACbC,EAAiB,CAACT,EAAYC,EAAMC,EAAWC,EAAYC,EAAMC,EAAWC,EAAaC,EAAOC,GC9B5F,SAASE,EAAYC,GAClC,OAAOA,GAAWA,EAAQC,UAAY,IAAIC,cAAgB,IAC5D,CCFe,SAASC,EAAUC,GAChC,GAAY,MAARA,EACF,OAAOC,OAGT,GAAwB,oBAApBD,EAAKE,WAAkC,CACzC,IAAIC,EAAgBH,EAAKG,cACzB,OAAOA,GAAgBA,EAAcC,aAAwBH,MAC/D,CAEA,OAAOD,CACT,CCTA,SAASK,EAAUL,GAEjB,OAAOA,aADUD,EAAUC,GAAMM,SACIN,aAAgBM,OACvD,CAEA,SAASC,EAAcP,GAErB,OAAOA,aADUD,EAAUC,GAAMQ,aACIR,aAAgBQ,WACvD,CAEA,SAASC,EAAaT,GAEpB,MAA0B,oBAAfU,aAKJV,aADUD,EAAUC,GAAMU,YACIV,aAAgBU,WACvD,CCwDA,SACEC,KAAM,cACNC,SAAS,EACTC,MAAO,QACPC,GA5EF,SAAqBC,GACnB,IAAIC,EAAQD,EAAKC,MACjB3D,OAAO4D,KAAKD,EAAME,UAAUC,SAAQ,SAAUR,GAC5C,IAAIS,EAAQJ,EAAMK,OAAOV,IAAS,CAAC,EAC/BW,EAAaN,EAAMM,WAAWX,IAAS,CAAC,EACxCf,EAAUoB,EAAME,SAASP,GAExBJ,EAAcX,IAAaD,EAAYC,KAO5CvC,OAAOkE,OAAO3B,EAAQwB,MAAOA,GAC7B/D,OAAO4D,KAAKK,GAAYH,SAAQ,SAAUR,GACxC,IAAI3C,EAAQsD,EAAWX,IAET,IAAV3C,EACF4B,EAAQ4B,gBAAgBb,GAExBf,EAAQ6B,aAAad,GAAgB,IAAV3C,EAAiB,GAAKA,EAErD,IACF,GACF,EAoDE0D,OAlDF,SAAgBC,GACd,IAAIX,EAAQW,EAAMX,MACdY,EAAgB,CAClBlD,OAAQ,CACNmD,SAAUb,EAAMc,QAAQC,SACxB5D,KAAM,IACN6D,IAAK,IACLC,OAAQ,KAEVC,MAAO,CACLL,SAAU,YAEZlD,UAAW,CAAC,GASd,OAPAtB,OAAOkE,OAAOP,EAAME,SAASxC,OAAO0C,MAAOQ,EAAclD,QACzDsC,EAAMK,OAASO,EAEXZ,EAAME,SAASgB,OACjB7E,OAAOkE,OAAOP,EAAME,SAASgB,MAAMd,MAAOQ,EAAcM,OAGnD,WACL7E,OAAO4D,KAAKD,EAAME,UAAUC,SAAQ,SAAUR,GAC5C,IAAIf,EAAUoB,EAAME,SAASP,GACzBW,EAAaN,EAAMM,WAAWX,IAAS,CAAC,EAGxCS,EAFkB/D,OAAO4D,KAAKD,EAAMK,OAAOzD,eAAe+C,GAAQK,EAAMK,OAAOV,GAAQiB,EAAcjB,IAE7E9B,QAAO,SAAUuC,EAAOe,GAElD,OADAf,EAAMe,GAAY,GACXf,CACT,GAAG,CAAC,GAECb,EAAcX,IAAaD,EAAYC,KAI5CvC,OAAOkE,OAAO3B,EAAQwB,MAAOA,GAC7B/D,OAAO4D,KAAKK,GAAYH,SAAQ,SAAUiB,GACxCxC,EAAQ4B,gBAAgBY,EAC1B,IACF,GACF,CACF,EASEC,SAAU,CAAC,kBCjFE,SAASC,EAAiBvD,GACvC,OAAOA,EAAUwD,MAAM,KAAK,EAC9B,CCHO,IAAI,EAAMC,KAAKC,IACX,EAAMD,KAAKE,IACXC,EAAQH,KAAKG,MCFT,SAASC,IACtB,IAAIC,EAASC,UAAUC,cAEvB,OAAc,MAAVF,GAAkBA,EAAOG,QAAUC,MAAMC,QAAQL,EAAOG,QACnDH,EAAOG,OAAOG,KAAI,SAAUC,GACjC,OAAOA,EAAKC,MAAQ,IAAMD,EAAKE,OACjC,IAAGC,KAAK,KAGHT,UAAUU,SACnB,CCTe,SAASC,IACtB,OAAQ,iCAAiCC,KAAKd,IAChD,CCCe,SAASe,EAAsB/D,EAASgE,EAAcC,QAC9C,IAAjBD,IACFA,GAAe,QAGO,IAApBC,IACFA,GAAkB,GAGpB,IAAIC,EAAalE,EAAQ+D,wBACrBI,EAAS,EACTC,EAAS,EAETJ,GAAgBrD,EAAcX,KAChCmE,EAASnE,EAAQqE,YAAc,GAAItB,EAAMmB,EAAWI,OAAStE,EAAQqE,aAAmB,EACxFD,EAASpE,EAAQuE,aAAe,GAAIxB,EAAMmB,EAAWM,QAAUxE,EAAQuE,cAAoB,GAG7F,IACIE,GADOhE,EAAUT,GAAWG,EAAUH,GAAWK,QAC3BoE,eAEtBC,GAAoBb,KAAsBI,EAC1CU,GAAKT,EAAW3F,MAAQmG,GAAoBD,EAAiBA,EAAeG,WAAa,IAAMT,EAC/FU,GAAKX,EAAW9B,KAAOsC,GAAoBD,EAAiBA,EAAeK,UAAY,IAAMV,EAC7FE,EAAQJ,EAAWI,MAAQH,EAC3BK,EAASN,EAAWM,OAASJ,EACjC,MAAO,CACLE,MAAOA,EACPE,OAAQA,EACRpC,IAAKyC,EACLvG,MAAOqG,EAAIL,EACXjG,OAAQwG,EAAIL,EACZjG,KAAMoG,EACNA,EAAGA,EACHE,EAAGA,EAEP,CCrCe,SAASE,EAAc/E,GACpC,IAAIkE,EAAaH,EAAsB/D,GAGnCsE,EAAQtE,EAAQqE,YAChBG,EAASxE,EAAQuE,aAUrB,OARI3B,KAAKoC,IAAId,EAAWI,MAAQA,IAAU,IACxCA,EAAQJ,EAAWI,OAGjB1B,KAAKoC,IAAId,EAAWM,OAASA,IAAW,IAC1CA,EAASN,EAAWM,QAGf,CACLG,EAAG3E,EAAQ4E,WACXC,EAAG7E,EAAQ8E,UACXR,MAAOA,EACPE,OAAQA,EAEZ,CCvBe,SAASS,EAASC,EAAQC,GACvC,IAAIC,EAAWD,EAAME,aAAeF,EAAME,cAE1C,GAAIH,EAAOD,SAASE,GAClB,OAAO,EAEJ,GAAIC,GAAYvE,EAAauE,GAAW,CACzC,IAAIE,EAAOH,EAEX,EAAG,CACD,GAAIG,GAAQJ,EAAOK,WAAWD,GAC5B,OAAO,EAITA,EAAOA,EAAKE,YAAcF,EAAKG,IACjC,OAASH,EACX,CAGF,OAAO,CACT,CCrBe,SAAS,EAAiBtF,GACvC,OAAOG,EAAUH,GAAS0F,iBAAiB1F,EAC7C,CCFe,SAAS2F,EAAe3F,GACrC,MAAO,CAAC,QAAS,KAAM,MAAM4F,QAAQ7F,EAAYC,KAAa,CAChE,CCFe,SAAS6F,EAAmB7F,GAEzC,QAASS,EAAUT,GAAWA,EAAQO,cACtCP,EAAQ8F,WAAazF,OAAOyF,UAAUC,eACxC,CCFe,SAASC,EAAchG,GACpC,MAA6B,SAAzBD,EAAYC,GACPA,EAMPA,EAAQiG,cACRjG,EAAQwF,aACR3E,EAAab,GAAWA,EAAQyF,KAAO,OAEvCI,EAAmB7F,EAGvB,CCVA,SAASkG,EAAoBlG,GAC3B,OAAKW,EAAcX,IACoB,UAAvC,EAAiBA,GAASiC,SAInBjC,EAAQmG,aAHN,IAIX,CAwCe,SAASC,EAAgBpG,GAItC,IAHA,IAAIK,EAASF,EAAUH,GACnBmG,EAAeD,EAAoBlG,GAEhCmG,GAAgBR,EAAeQ,IAA6D,WAA5C,EAAiBA,GAAclE,UACpFkE,EAAeD,EAAoBC,GAGrC,OAAIA,IAA+C,SAA9BpG,EAAYoG,IAA0D,SAA9BpG,EAAYoG,IAAwE,WAA5C,EAAiBA,GAAclE,UAC3H5B,EAGF8F,GAhDT,SAA4BnG,GAC1B,IAAIqG,EAAY,WAAWvC,KAAKd,KAGhC,GAFW,WAAWc,KAAKd,MAEfrC,EAAcX,IAII,UAFX,EAAiBA,GAEnBiC,SACb,OAAO,KAIX,IAAIqE,EAAcN,EAAchG,GAMhC,IAJIa,EAAayF,KACfA,EAAcA,EAAYb,MAGrB9E,EAAc2F,IAAgB,CAAC,OAAQ,QAAQV,QAAQ7F,EAAYuG,IAAgB,GAAG,CAC3F,IAAIC,EAAM,EAAiBD,GAI3B,GAAsB,SAAlBC,EAAIC,WAA4C,SAApBD,EAAIE,aAA0C,UAAhBF,EAAIG,UAAiF,IAA1D,CAAC,YAAa,eAAed,QAAQW,EAAII,aAAsBN,GAAgC,WAAnBE,EAAII,YAA2BN,GAAaE,EAAIK,QAAyB,SAAfL,EAAIK,OACjO,OAAON,EAEPA,EAAcA,EAAYd,UAE9B,CAEA,OAAO,IACT,CAgByBqB,CAAmB7G,IAAYK,CACxD,CCpEe,SAASyG,EAAyB3H,GAC/C,MAAO,CAAC,MAAO,UAAUyG,QAAQzG,IAAc,EAAI,IAAM,GAC3D,CCDO,SAAS4H,EAAOjE,EAAK1E,EAAOyE,GACjC,OAAO,EAAQC,EAAK,EAAQ1E,EAAOyE,GACrC,CCFe,SAASmE,EAAmBC,GACzC,OAAOxJ,OAAOkE,OAAO,CAAC,ECDf,CACLS,IAAK,EACL9D,MAAO,EACPD,OAAQ,EACRE,KAAM,GDHuC0I,EACjD,CEHe,SAASC,EAAgB9I,EAAOiD,GAC7C,OAAOA,EAAKpC,QAAO,SAAUkI,EAAS5J,GAEpC,OADA4J,EAAQ5J,GAAOa,EACR+I,CACT,GAAG,CAAC,EACN,CCuFA,SACEpG,KAAM,QACNC,SAAS,EACTC,MAAO,OACPC,GA9EF,SAAeC,GACb,IAAIiG,EAEAhG,EAAQD,EAAKC,MACbL,EAAOI,EAAKJ,KACZmB,EAAUf,EAAKe,QACfmF,EAAejG,EAAME,SAASgB,MAC9BgF,EAAgBlG,EAAMmG,cAAcD,cACpCE,EAAgB9E,EAAiBtB,EAAMjC,WACvCsI,EAAOX,EAAyBU,GAEhCE,EADa,CAACnJ,EAAMD,GAAOsH,QAAQ4B,IAAkB,EAClC,SAAW,QAElC,GAAKH,GAAiBC,EAAtB,CAIA,IAAIL,EAxBgB,SAAyBU,EAASvG,GAItD,OAAO4F,EAAsC,iBAH7CW,EAA6B,mBAAZA,EAAyBA,EAAQlK,OAAOkE,OAAO,CAAC,EAAGP,EAAMwG,MAAO,CAC/EzI,UAAWiC,EAAMjC,aACbwI,GACkDA,EAAUT,EAAgBS,EAASlJ,GAC7F,CAmBsBoJ,CAAgB3F,EAAQyF,QAASvG,GACjD0G,EAAY/C,EAAcsC,GAC1BU,EAAmB,MAATN,EAAe,EAAMlJ,EAC/ByJ,EAAmB,MAATP,EAAepJ,EAASC,EAClC2J,EAAU7G,EAAMwG,MAAM7I,UAAU2I,GAAOtG,EAAMwG,MAAM7I,UAAU0I,GAAQH,EAAcG,GAAQrG,EAAMwG,MAAM9I,OAAO4I,GAC9GQ,EAAYZ,EAAcG,GAAQrG,EAAMwG,MAAM7I,UAAU0I,GACxDU,EAAoB/B,EAAgBiB,GACpCe,EAAaD,EAA6B,MAATV,EAAeU,EAAkBE,cAAgB,EAAIF,EAAkBG,aAAe,EAAI,EAC3HC,EAAoBN,EAAU,EAAIC,EAAY,EAG9CpF,EAAMmE,EAAcc,GACpBlF,EAAMuF,EAAaN,EAAUJ,GAAOT,EAAce,GAClDQ,EAASJ,EAAa,EAAIN,EAAUJ,GAAO,EAAIa,EAC/CE,EAAS1B,EAAOjE,EAAK0F,EAAQ3F,GAE7B6F,EAAWjB,EACfrG,EAAMmG,cAAcxG,KAASqG,EAAwB,CAAC,GAAyBsB,GAAYD,EAAQrB,EAAsBuB,aAAeF,EAASD,EAAQpB,EAnBzJ,CAoBF,EA4CEtF,OA1CF,SAAgBC,GACd,IAAIX,EAAQW,EAAMX,MAEdwH,EADU7G,EAAMG,QACWlC,QAC3BqH,OAAoC,IAArBuB,EAA8B,sBAAwBA,EAErD,MAAhBvB,IAKwB,iBAAjBA,IACTA,EAAejG,EAAME,SAASxC,OAAO+J,cAAcxB,MAahDpC,EAAS7D,EAAME,SAASxC,OAAQuI,KAQrCjG,EAAME,SAASgB,MAAQ+E,EACzB,EASE5E,SAAU,CAAC,iBACXqG,iBAAkB,CAAC,oBCnGN,SAASC,EAAa5J,GACnC,OAAOA,EAAUwD,MAAM,KAAK,EAC9B,CCOA,IAAIqG,EAAa,CACf5G,IAAK,OACL9D,MAAO,OACPD,OAAQ,OACRE,KAAM,QAeD,SAAS0K,GAAYlH,GAC1B,IAAImH,EAEApK,EAASiD,EAAMjD,OACfqK,EAAapH,EAAMoH,WACnBhK,EAAY4C,EAAM5C,UAClBiK,EAAYrH,EAAMqH,UAClBC,EAAUtH,EAAMsH,QAChBpH,EAAWF,EAAME,SACjBqH,EAAkBvH,EAAMuH,gBACxBC,EAAWxH,EAAMwH,SACjBC,EAAezH,EAAMyH,aACrBC,EAAU1H,EAAM0H,QAChBC,EAAaL,EAAQ1E,EACrBA,OAAmB,IAAf+E,EAAwB,EAAIA,EAChCC,EAAaN,EAAQxE,EACrBA,OAAmB,IAAf8E,EAAwB,EAAIA,EAEhCC,EAAgC,mBAAjBJ,EAA8BA,EAAa,CAC5D7E,EAAGA,EACHE,IACG,CACHF,EAAGA,EACHE,GAGFF,EAAIiF,EAAMjF,EACVE,EAAI+E,EAAM/E,EACV,IAAIgF,EAAOR,EAAQrL,eAAe,KAC9B8L,EAAOT,EAAQrL,eAAe,KAC9B+L,EAAQxL,EACRyL,EAAQ,EACRC,EAAM5J,OAEV,GAAIkJ,EAAU,CACZ,IAAIpD,EAAeC,EAAgBtH,GAC/BoL,EAAa,eACbC,EAAY,cAEZhE,IAAiBhG,EAAUrB,IAGmB,WAA5C,EAFJqH,EAAeN,EAAmB/G,IAECmD,UAAsC,aAAbA,IAC1DiI,EAAa,eACbC,EAAY,gBAOZhL,IAAc,IAAQA,IAAcZ,GAAQY,IAAcb,IAAU8K,IAAczK,KACpFqL,EAAQ3L,EAGRwG,IAFc4E,GAAWtD,IAAiB8D,GAAOA,EAAIxF,eAAiBwF,EAAIxF,eAAeD,OACzF2B,EAAa+D,IACEf,EAAW3E,OAC1BK,GAAKyE,EAAkB,GAAK,GAG1BnK,IAAcZ,IAASY,IAAc,GAAOA,IAAcd,GAAW+K,IAAczK,KACrFoL,EAAQzL,EAGRqG,IAFc8E,GAAWtD,IAAiB8D,GAAOA,EAAIxF,eAAiBwF,EAAIxF,eAAeH,MACzF6B,EAAagE,IACEhB,EAAW7E,MAC1BK,GAAK2E,EAAkB,GAAK,EAEhC,CAEA,IAgBMc,EAhBFC,EAAe5M,OAAOkE,OAAO,CAC/BM,SAAUA,GACTsH,GAAYP,GAEXsB,GAAyB,IAAjBd,EAlFd,SAA2BrI,EAAM8I,GAC/B,IAAItF,EAAIxD,EAAKwD,EACTE,EAAI1D,EAAK0D,EACT0F,EAAMN,EAAIO,kBAAoB,EAClC,MAAO,CACL7F,EAAG5B,EAAM4B,EAAI4F,GAAOA,GAAO,EAC3B1F,EAAG9B,EAAM8B,EAAI0F,GAAOA,GAAO,EAE/B,CA0EsCE,CAAkB,CACpD9F,EAAGA,EACHE,GACC1E,EAAUrB,IAAW,CACtB6F,EAAGA,EACHE,GAMF,OAHAF,EAAI2F,EAAM3F,EACVE,EAAIyF,EAAMzF,EAENyE,EAGK7L,OAAOkE,OAAO,CAAC,EAAG0I,IAAeD,EAAiB,CAAC,GAAkBJ,GAASF,EAAO,IAAM,GAAIM,EAAeL,GAASF,EAAO,IAAM,GAAIO,EAAe5D,WAAayD,EAAIO,kBAAoB,IAAM,EAAI,aAAe7F,EAAI,OAASE,EAAI,MAAQ,eAAiBF,EAAI,OAASE,EAAI,SAAUuF,IAG5R3M,OAAOkE,OAAO,CAAC,EAAG0I,IAAenB,EAAkB,CAAC,GAAmBc,GAASF,EAAOjF,EAAI,KAAO,GAAIqE,EAAgBa,GAASF,EAAOlF,EAAI,KAAO,GAAIuE,EAAgB1C,UAAY,GAAI0C,GAC9L,CAuDA,UACEnI,KAAM,gBACNC,SAAS,EACTC,MAAO,cACPC,GAzDF,SAAuBwJ,GACrB,IAAItJ,EAAQsJ,EAAMtJ,MACdc,EAAUwI,EAAMxI,QAChByI,EAAwBzI,EAAQoH,gBAChCA,OAA4C,IAA1BqB,GAA0CA,EAC5DC,EAAoB1I,EAAQqH,SAC5BA,OAAiC,IAAtBqB,GAAsCA,EACjDC,EAAwB3I,EAAQsH,aAChCA,OAAyC,IAA1BqB,GAA0CA,EAYzDR,EAAe,CACjBlL,UAAWuD,EAAiBtB,EAAMjC,WAClCiK,UAAWL,EAAa3H,EAAMjC,WAC9BL,OAAQsC,EAAME,SAASxC,OACvBqK,WAAY/H,EAAMwG,MAAM9I,OACxBwK,gBAAiBA,EACjBG,QAAoC,UAA3BrI,EAAMc,QAAQC,UAGgB,MAArCf,EAAMmG,cAAcD,gBACtBlG,EAAMK,OAAO3C,OAASrB,OAAOkE,OAAO,CAAC,EAAGP,EAAMK,OAAO3C,OAAQmK,GAAYxL,OAAOkE,OAAO,CAAC,EAAG0I,EAAc,CACvGhB,QAASjI,EAAMmG,cAAcD,cAC7BrF,SAAUb,EAAMc,QAAQC,SACxBoH,SAAUA,EACVC,aAAcA,OAIe,MAA7BpI,EAAMmG,cAAcjF,QACtBlB,EAAMK,OAAOa,MAAQ7E,OAAOkE,OAAO,CAAC,EAAGP,EAAMK,OAAOa,MAAO2G,GAAYxL,OAAOkE,OAAO,CAAC,EAAG0I,EAAc,CACrGhB,QAASjI,EAAMmG,cAAcjF,MAC7BL,SAAU,WACVsH,UAAU,EACVC,aAAcA,OAIlBpI,EAAMM,WAAW5C,OAASrB,OAAOkE,OAAO,CAAC,EAAGP,EAAMM,WAAW5C,OAAQ,CACnE,wBAAyBsC,EAAMjC,WAEnC,EAQE2L,KAAM,CAAC,GChLT,IAAIC,GAAU,CACZA,SAAS,GAsCX,UACEhK,KAAM,iBACNC,SAAS,EACTC,MAAO,QACPC,GAAI,WAAe,EACnBY,OAxCF,SAAgBX,GACd,IAAIC,EAAQD,EAAKC,MACb4J,EAAW7J,EAAK6J,SAChB9I,EAAUf,EAAKe,QACf+I,EAAkB/I,EAAQgJ,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7CE,EAAkBjJ,EAAQkJ,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7C9K,EAASF,EAAUiB,EAAME,SAASxC,QAClCuM,EAAgB,GAAGjM,OAAOgC,EAAMiK,cAActM,UAAWqC,EAAMiK,cAAcvM,QAYjF,OAVIoM,GACFG,EAAc9J,SAAQ,SAAU+J,GAC9BA,EAAaC,iBAAiB,SAAUP,EAASQ,OAAQT,GAC3D,IAGEK,GACF/K,EAAOkL,iBAAiB,SAAUP,EAASQ,OAAQT,IAG9C,WACDG,GACFG,EAAc9J,SAAQ,SAAU+J,GAC9BA,EAAaG,oBAAoB,SAAUT,EAASQ,OAAQT,GAC9D,IAGEK,GACF/K,EAAOoL,oBAAoB,SAAUT,EAASQ,OAAQT,GAE1D,CACF,EASED,KAAM,CAAC,GC/CT,IAAIY,GAAO,CACTnN,KAAM,QACND,MAAO,OACPD,OAAQ,MACR+D,IAAK,UAEQ,SAASuJ,GAAqBxM,GAC3C,OAAOA,EAAUyM,QAAQ,0BAA0B,SAAUC,GAC3D,OAAOH,GAAKG,EACd,GACF,CCVA,IAAI,GAAO,CACTnN,MAAO,MACPC,IAAK,SAEQ,SAASmN,GAA8B3M,GACpD,OAAOA,EAAUyM,QAAQ,cAAc,SAAUC,GAC/C,OAAO,GAAKA,EACd,GACF,CCPe,SAASE,GAAgB3L,GACtC,IAAI6J,EAAM9J,EAAUC,GAGpB,MAAO,CACL4L,WAHe/B,EAAIgC,YAInBC,UAHcjC,EAAIkC,YAKtB,CCNe,SAASC,GAAoBpM,GAQ1C,OAAO+D,EAAsB8B,EAAmB7F,IAAUzB,KAAOwN,GAAgB/L,GAASgM,UAC5F,CCXe,SAASK,GAAerM,GAErC,IAAIsM,EAAoB,EAAiBtM,GACrCuM,EAAWD,EAAkBC,SAC7BC,EAAYF,EAAkBE,UAC9BC,EAAYH,EAAkBG,UAElC,MAAO,6BAA6B3I,KAAKyI,EAAWE,EAAYD,EAClE,CCLe,SAASE,GAAgBtM,GACtC,MAAI,CAAC,OAAQ,OAAQ,aAAawF,QAAQ7F,EAAYK,KAAU,EAEvDA,EAAKG,cAAcoM,KAGxBhM,EAAcP,IAASiM,GAAejM,GACjCA,EAGFsM,GAAgB1G,EAAc5F,GACvC,CCJe,SAASwM,GAAkB5M,EAAS6M,GACjD,IAAIC,OAES,IAATD,IACFA,EAAO,IAGT,IAAIvB,EAAeoB,GAAgB1M,GAC/B+M,EAASzB,KAAqE,OAAlDwB,EAAwB9M,EAAQO,oBAAyB,EAASuM,EAAsBH,MACpH1C,EAAM9J,EAAUmL,GAChB0B,EAASD,EAAS,CAAC9C,GAAK7K,OAAO6K,EAAIxF,gBAAkB,GAAI4H,GAAef,GAAgBA,EAAe,IAAMA,EAC7G2B,EAAcJ,EAAKzN,OAAO4N,GAC9B,OAAOD,EAASE,EAChBA,EAAY7N,OAAOwN,GAAkB5G,EAAcgH,IACrD,CCzBe,SAASE,GAAiBC,GACvC,OAAO1P,OAAOkE,OAAO,CAAC,EAAGwL,EAAM,CAC7B5O,KAAM4O,EAAKxI,EACXvC,IAAK+K,EAAKtI,EACVvG,MAAO6O,EAAKxI,EAAIwI,EAAK7I,MACrBjG,OAAQ8O,EAAKtI,EAAIsI,EAAK3I,QAE1B,CCqBA,SAAS4I,GAA2BpN,EAASqN,EAAgBlL,GAC3D,OAAOkL,IAAmBxO,EAAWqO,GCzBxB,SAAyBlN,EAASmC,GAC/C,IAAI8H,EAAM9J,EAAUH,GAChBsN,EAAOzH,EAAmB7F,GAC1ByE,EAAiBwF,EAAIxF,eACrBH,EAAQgJ,EAAKhF,YACb9D,EAAS8I,EAAKjF,aACd1D,EAAI,EACJE,EAAI,EAER,GAAIJ,EAAgB,CAClBH,EAAQG,EAAeH,MACvBE,EAASC,EAAeD,OACxB,IAAI+I,EAAiB1J,KAEjB0J,IAAmBA,GAA+B,UAAbpL,KACvCwC,EAAIF,EAAeG,WACnBC,EAAIJ,EAAeK,UAEvB,CAEA,MAAO,CACLR,MAAOA,EACPE,OAAQA,EACRG,EAAGA,EAAIyH,GAAoBpM,GAC3B6E,EAAGA,EAEP,CDDwD2I,CAAgBxN,EAASmC,IAAa1B,EAAU4M,GAdxG,SAAoCrN,EAASmC,GAC3C,IAAIgL,EAAOpJ,EAAsB/D,GAAS,EAAoB,UAAbmC,GASjD,OARAgL,EAAK/K,IAAM+K,EAAK/K,IAAMpC,EAAQyN,UAC9BN,EAAK5O,KAAO4O,EAAK5O,KAAOyB,EAAQ0N,WAChCP,EAAK9O,OAAS8O,EAAK/K,IAAMpC,EAAQqI,aACjC8E,EAAK7O,MAAQ6O,EAAK5O,KAAOyB,EAAQsI,YACjC6E,EAAK7I,MAAQtE,EAAQsI,YACrB6E,EAAK3I,OAASxE,EAAQqI,aACtB8E,EAAKxI,EAAIwI,EAAK5O,KACd4O,EAAKtI,EAAIsI,EAAK/K,IACP+K,CACT,CAG0HQ,CAA2BN,EAAgBlL,GAAY+K,GEtBlK,SAAyBlN,GACtC,IAAI8M,EAEAQ,EAAOzH,EAAmB7F,GAC1B4N,EAAY7B,GAAgB/L,GAC5B2M,EAA0D,OAAlDG,EAAwB9M,EAAQO,oBAAyB,EAASuM,EAAsBH,KAChGrI,EAAQ,EAAIgJ,EAAKO,YAAaP,EAAKhF,YAAaqE,EAAOA,EAAKkB,YAAc,EAAGlB,EAAOA,EAAKrE,YAAc,GACvG9D,EAAS,EAAI8I,EAAKQ,aAAcR,EAAKjF,aAAcsE,EAAOA,EAAKmB,aAAe,EAAGnB,EAAOA,EAAKtE,aAAe,GAC5G1D,GAAKiJ,EAAU5B,WAAaI,GAAoBpM,GAChD6E,GAAK+I,EAAU1B,UAMnB,MAJiD,QAA7C,EAAiBS,GAAQW,GAAMS,YACjCpJ,GAAK,EAAI2I,EAAKhF,YAAaqE,EAAOA,EAAKrE,YAAc,GAAKhE,GAGrD,CACLA,MAAOA,EACPE,OAAQA,EACRG,EAAGA,EACHE,EAAGA,EAEP,CFCkMmJ,CAAgBnI,EAAmB7F,IACrO,CG1Be,SAASiO,GAAe9M,GACrC,IAOIkI,EAPAtK,EAAYoC,EAAKpC,UACjBiB,EAAUmB,EAAKnB,QACfb,EAAYgC,EAAKhC,UACjBqI,EAAgBrI,EAAYuD,EAAiBvD,GAAa,KAC1DiK,EAAYjK,EAAY4J,EAAa5J,GAAa,KAClD+O,EAAUnP,EAAU4F,EAAI5F,EAAUuF,MAAQ,EAAItE,EAAQsE,MAAQ,EAC9D6J,EAAUpP,EAAU8F,EAAI9F,EAAUyF,OAAS,EAAIxE,EAAQwE,OAAS,EAGpE,OAAQgD,GACN,KAAK,EACH6B,EAAU,CACR1E,EAAGuJ,EACHrJ,EAAG9F,EAAU8F,EAAI7E,EAAQwE,QAE3B,MAEF,KAAKnG,EACHgL,EAAU,CACR1E,EAAGuJ,EACHrJ,EAAG9F,EAAU8F,EAAI9F,EAAUyF,QAE7B,MAEF,KAAKlG,EACH+K,EAAU,CACR1E,EAAG5F,EAAU4F,EAAI5F,EAAUuF,MAC3BO,EAAGsJ,GAEL,MAEF,KAAK5P,EACH8K,EAAU,CACR1E,EAAG5F,EAAU4F,EAAI3E,EAAQsE,MACzBO,EAAGsJ,GAEL,MAEF,QACE9E,EAAU,CACR1E,EAAG5F,EAAU4F,EACbE,EAAG9F,EAAU8F,GAInB,IAAIuJ,EAAW5G,EAAgBV,EAAyBU,GAAiB,KAEzE,GAAgB,MAAZ4G,EAAkB,CACpB,IAAI1G,EAAmB,MAAb0G,EAAmB,SAAW,QAExC,OAAQhF,GACN,KAAK1K,EACH2K,EAAQ+E,GAAY/E,EAAQ+E,IAAarP,EAAU2I,GAAO,EAAI1H,EAAQ0H,GAAO,GAC7E,MAEF,KAAK/I,EACH0K,EAAQ+E,GAAY/E,EAAQ+E,IAAarP,EAAU2I,GAAO,EAAI1H,EAAQ0H,GAAO,GAKnF,CAEA,OAAO2B,CACT,CC3De,SAASgF,GAAejN,EAAOc,QAC5B,IAAZA,IACFA,EAAU,CAAC,GAGb,IAAIoM,EAAWpM,EACXqM,EAAqBD,EAASnP,UAC9BA,OAAmC,IAAvBoP,EAAgCnN,EAAMjC,UAAYoP,EAC9DC,EAAoBF,EAASnM,SAC7BA,OAAiC,IAAtBqM,EAA+BpN,EAAMe,SAAWqM,EAC3DC,EAAoBH,EAASI,SAC7BA,OAAiC,IAAtBD,EAA+B7P,EAAkB6P,EAC5DE,EAAwBL,EAASM,aACjCA,OAAyC,IAA1BD,EAAmC9P,EAAW8P,EAC7DE,EAAwBP,EAASQ,eACjCA,OAA2C,IAA1BD,EAAmC/P,EAAS+P,EAC7DE,EAAuBT,EAASU,YAChCA,OAAuC,IAAzBD,GAA0CA,EACxDE,EAAmBX,EAAS3G,QAC5BA,OAA+B,IAArBsH,EAA8B,EAAIA,EAC5ChI,EAAgBD,EAAsC,iBAAZW,EAAuBA,EAAUT,EAAgBS,EAASlJ,IACpGyQ,EAAaJ,IAAmBhQ,EAASC,EAAYD,EACrDqK,EAAa/H,EAAMwG,MAAM9I,OACzBkB,EAAUoB,EAAME,SAAS0N,EAAcE,EAAaJ,GACpDK,EJkBS,SAAyBnP,EAAS0O,EAAUE,EAAczM,GACvE,IAAIiN,EAAmC,oBAAbV,EAlB5B,SAA4B1O,GAC1B,IAAIpB,EAAkBgO,GAAkB5G,EAAchG,IAElDqP,EADoB,CAAC,WAAY,SAASzJ,QAAQ,EAAiB5F,GAASiC,WAAa,GACnDtB,EAAcX,GAAWoG,EAAgBpG,GAAWA,EAE9F,OAAKS,EAAU4O,GAKRzQ,EAAgBgI,QAAO,SAAUyG,GACtC,OAAO5M,EAAU4M,IAAmBpI,EAASoI,EAAgBgC,IAAmD,SAAhCtP,EAAYsN,EAC9F,IANS,EAOX,CAK6DiC,CAAmBtP,GAAW,GAAGZ,OAAOsP,GAC/F9P,EAAkB,GAAGQ,OAAOgQ,EAAqB,CAACR,IAClDW,EAAsB3Q,EAAgB,GACtC4Q,EAAe5Q,EAAgBK,QAAO,SAAUwQ,EAASpC,GAC3D,IAAIF,EAAOC,GAA2BpN,EAASqN,EAAgBlL,GAK/D,OAJAsN,EAAQrN,IAAM,EAAI+K,EAAK/K,IAAKqN,EAAQrN,KACpCqN,EAAQnR,MAAQ,EAAI6O,EAAK7O,MAAOmR,EAAQnR,OACxCmR,EAAQpR,OAAS,EAAI8O,EAAK9O,OAAQoR,EAAQpR,QAC1CoR,EAAQlR,KAAO,EAAI4O,EAAK5O,KAAMkR,EAAQlR,MAC/BkR,CACT,GAAGrC,GAA2BpN,EAASuP,EAAqBpN,IAK5D,OAJAqN,EAAalL,MAAQkL,EAAalR,MAAQkR,EAAajR,KACvDiR,EAAahL,OAASgL,EAAanR,OAASmR,EAAapN,IACzDoN,EAAa7K,EAAI6K,EAAajR,KAC9BiR,EAAa3K,EAAI2K,EAAapN,IACvBoN,CACT,CInC2BE,CAAgBjP,EAAUT,GAAWA,EAAUA,EAAQ2P,gBAAkB9J,EAAmBzE,EAAME,SAASxC,QAAS4P,EAAUE,EAAczM,GACjKyN,EAAsB7L,EAAsB3C,EAAME,SAASvC,WAC3DuI,EAAgB2G,GAAe,CACjClP,UAAW6Q,EACX5P,QAASmJ,EACThH,SAAU,WACVhD,UAAWA,IAET0Q,EAAmB3C,GAAiBzP,OAAOkE,OAAO,CAAC,EAAGwH,EAAY7B,IAClEwI,EAAoBhB,IAAmBhQ,EAAS+Q,EAAmBD,EAGnEG,EAAkB,CACpB3N,IAAK+M,EAAmB/M,IAAM0N,EAAkB1N,IAAM6E,EAAc7E,IACpE/D,OAAQyR,EAAkBzR,OAAS8Q,EAAmB9Q,OAAS4I,EAAc5I,OAC7EE,KAAM4Q,EAAmB5Q,KAAOuR,EAAkBvR,KAAO0I,EAAc1I,KACvED,MAAOwR,EAAkBxR,MAAQ6Q,EAAmB7Q,MAAQ2I,EAAc3I,OAExE0R,EAAa5O,EAAMmG,cAAckB,OAErC,GAAIqG,IAAmBhQ,GAAUkR,EAAY,CAC3C,IAAIvH,EAASuH,EAAW7Q,GACxB1B,OAAO4D,KAAK0O,GAAiBxO,SAAQ,SAAUhE,GAC7C,IAAI0S,EAAW,CAAC3R,EAAOD,GAAQuH,QAAQrI,IAAQ,EAAI,GAAK,EACpDkK,EAAO,CAAC,EAAKpJ,GAAQuH,QAAQrI,IAAQ,EAAI,IAAM,IACnDwS,EAAgBxS,IAAQkL,EAAOhB,GAAQwI,CACzC,GACF,CAEA,OAAOF,CACT,CCyEA,UACEhP,KAAM,OACNC,SAAS,EACTC,MAAO,OACPC,GA5HF,SAAcC,GACZ,IAAIC,EAAQD,EAAKC,MACbc,EAAUf,EAAKe,QACfnB,EAAOI,EAAKJ,KAEhB,IAAIK,EAAMmG,cAAcxG,GAAMmP,MAA9B,CAoCA,IAhCA,IAAIC,EAAoBjO,EAAQkM,SAC5BgC,OAAsC,IAAtBD,GAAsCA,EACtDE,EAAmBnO,EAAQoO,QAC3BC,OAAoC,IAArBF,GAAqCA,EACpDG,EAA8BtO,EAAQuO,mBACtC9I,EAAUzF,EAAQyF,QAClB+G,EAAWxM,EAAQwM,SACnBE,EAAe1M,EAAQ0M,aACvBI,EAAc9M,EAAQ8M,YACtB0B,EAAwBxO,EAAQyO,eAChCA,OAA2C,IAA1BD,GAA0CA,EAC3DE,EAAwB1O,EAAQ0O,sBAChCC,EAAqBzP,EAAMc,QAAQ/C,UACnCqI,EAAgB9E,EAAiBmO,GAEjCJ,EAAqBD,IADHhJ,IAAkBqJ,GACqCF,EAjC/E,SAAuCxR,GACrC,GAAIuD,EAAiBvD,KAAeX,EAClC,MAAO,GAGT,IAAIsS,EAAoBnF,GAAqBxM,GAC7C,MAAO,CAAC2M,GAA8B3M,GAAY2R,EAAmBhF,GAA8BgF,GACrG,CA0B6IC,CAA8BF,GAA3E,CAAClF,GAAqBkF,KAChHG,EAAa,CAACH,GAAoBzR,OAAOqR,GAAoBxR,QAAO,SAAUC,EAAKC,GACrF,OAAOD,EAAIE,OAAOsD,EAAiBvD,KAAeX,ECvCvC,SAA8B4C,EAAOc,QAClC,IAAZA,IACFA,EAAU,CAAC,GAGb,IAAIoM,EAAWpM,EACX/C,EAAYmP,EAASnP,UACrBuP,EAAWJ,EAASI,SACpBE,EAAeN,EAASM,aACxBjH,EAAU2G,EAAS3G,QACnBgJ,EAAiBrC,EAASqC,eAC1BM,EAAwB3C,EAASsC,sBACjCA,OAAkD,IAA1BK,EAAmC,EAAgBA,EAC3E7H,EAAYL,EAAa5J,GACzB6R,EAAa5H,EAAYuH,EAAiB3R,EAAsBA,EAAoB4H,QAAO,SAAUzH,GACvG,OAAO4J,EAAa5J,KAAeiK,CACrC,IAAK3K,EACDyS,EAAoBF,EAAWpK,QAAO,SAAUzH,GAClD,OAAOyR,EAAsBhL,QAAQzG,IAAc,CACrD,IAEiC,IAA7B+R,EAAkBC,SACpBD,EAAoBF,GAQtB,IAAII,EAAYF,EAAkBjS,QAAO,SAAUC,EAAKC,GAOtD,OANAD,EAAIC,GAAakP,GAAejN,EAAO,CACrCjC,UAAWA,EACXuP,SAAUA,EACVE,aAAcA,EACdjH,QAASA,IACRjF,EAAiBvD,IACbD,CACT,GAAG,CAAC,GACJ,OAAOzB,OAAO4D,KAAK+P,GAAWC,MAAK,SAAUC,EAAGC,GAC9C,OAAOH,EAAUE,GAAKF,EAAUG,EAClC,GACF,CDH6DC,CAAqBpQ,EAAO,CACnFjC,UAAWA,EACXuP,SAAUA,EACVE,aAAcA,EACdjH,QAASA,EACTgJ,eAAgBA,EAChBC,sBAAuBA,IACpBzR,EACP,GAAG,IACCsS,EAAgBrQ,EAAMwG,MAAM7I,UAC5BoK,EAAa/H,EAAMwG,MAAM9I,OACzB4S,EAAY,IAAIC,IAChBC,GAAqB,EACrBC,EAAwBb,EAAW,GAE9Bc,EAAI,EAAGA,EAAId,EAAWG,OAAQW,IAAK,CAC1C,IAAI3S,EAAY6R,EAAWc,GAEvBC,EAAiBrP,EAAiBvD,GAElC6S,EAAmBjJ,EAAa5J,KAAeT,EAC/CuT,EAAa,CAAC,EAAK5T,GAAQuH,QAAQmM,IAAmB,EACtDrK,EAAMuK,EAAa,QAAU,SAC7B1F,EAAW8B,GAAejN,EAAO,CACnCjC,UAAWA,EACXuP,SAAUA,EACVE,aAAcA,EACdI,YAAaA,EACbrH,QAASA,IAEPuK,EAAoBD,EAAaD,EAAmB1T,EAAQC,EAAOyT,EAAmB3T,EAAS,EAE/FoT,EAAc/J,GAAOyB,EAAWzB,KAClCwK,EAAoBvG,GAAqBuG,IAG3C,IAAIC,EAAmBxG,GAAqBuG,GACxCE,EAAS,GAUb,GARIhC,GACFgC,EAAOC,KAAK9F,EAASwF,IAAmB,GAGtCxB,GACF6B,EAAOC,KAAK9F,EAAS2F,IAAsB,EAAG3F,EAAS4F,IAAqB,GAG1EC,EAAOE,OAAM,SAAUC,GACzB,OAAOA,CACT,IAAI,CACFV,EAAwB1S,EACxByS,GAAqB,EACrB,KACF,CAEAF,EAAUc,IAAIrT,EAAWiT,EAC3B,CAEA,GAAIR,EAqBF,IAnBA,IAEIa,EAAQ,SAAeC,GACzB,IAAIC,EAAmB3B,EAAW4B,MAAK,SAAUzT,GAC/C,IAAIiT,EAASV,EAAU9T,IAAIuB,GAE3B,GAAIiT,EACF,OAAOA,EAAOS,MAAM,EAAGH,GAAIJ,OAAM,SAAUC,GACzC,OAAOA,CACT,GAEJ,IAEA,GAAII,EAEF,OADAd,EAAwBc,EACjB,OAEX,EAESD,EAnBY/B,EAAiB,EAAI,EAmBZ+B,EAAK,GAGpB,UAFFD,EAAMC,GADmBA,KAOpCtR,EAAMjC,YAAc0S,IACtBzQ,EAAMmG,cAAcxG,GAAMmP,OAAQ,EAClC9O,EAAMjC,UAAY0S,EAClBzQ,EAAM0R,OAAQ,EA5GhB,CA8GF,EAQEhK,iBAAkB,CAAC,UACnBgC,KAAM,CACJoF,OAAO,IE7IX,SAAS6C,GAAexG,EAAUY,EAAM6F,GAQtC,YAPyB,IAArBA,IACFA,EAAmB,CACjBrO,EAAG,EACHE,EAAG,IAIA,CACLzC,IAAKmK,EAASnK,IAAM+K,EAAK3I,OAASwO,EAAiBnO,EACnDvG,MAAOiO,EAASjO,MAAQ6O,EAAK7I,MAAQ0O,EAAiBrO,EACtDtG,OAAQkO,EAASlO,OAAS8O,EAAK3I,OAASwO,EAAiBnO,EACzDtG,KAAMgO,EAAShO,KAAO4O,EAAK7I,MAAQ0O,EAAiBrO,EAExD,CAEA,SAASsO,GAAsB1G,GAC7B,MAAO,CAAC,EAAKjO,EAAOD,EAAQE,GAAM2U,MAAK,SAAUC,GAC/C,OAAO5G,EAAS4G,IAAS,CAC3B,GACF,CA+BA,UACEpS,KAAM,OACNC,SAAS,EACTC,MAAO,OACP6H,iBAAkB,CAAC,mBACnB5H,GAlCF,SAAcC,GACZ,IAAIC,EAAQD,EAAKC,MACbL,EAAOI,EAAKJ,KACZ0Q,EAAgBrQ,EAAMwG,MAAM7I,UAC5BoK,EAAa/H,EAAMwG,MAAM9I,OACzBkU,EAAmB5R,EAAMmG,cAAc6L,gBACvCC,EAAoBhF,GAAejN,EAAO,CAC5C0N,eAAgB,cAEdwE,EAAoBjF,GAAejN,EAAO,CAC5C4N,aAAa,IAEXuE,EAA2BR,GAAeM,EAAmB5B,GAC7D+B,EAAsBT,GAAeO,EAAmBnK,EAAY6J,GACpES,EAAoBR,GAAsBM,GAC1CG,EAAmBT,GAAsBO,GAC7CpS,EAAMmG,cAAcxG,GAAQ,CAC1BwS,yBAA0BA,EAC1BC,oBAAqBA,EACrBC,kBAAmBA,EACnBC,iBAAkBA,GAEpBtS,EAAMM,WAAW5C,OAASrB,OAAOkE,OAAO,CAAC,EAAGP,EAAMM,WAAW5C,OAAQ,CACnE,+BAAgC2U,EAChC,sBAAuBC,GAE3B,GCJA,IACE3S,KAAM,SACNC,SAAS,EACTC,MAAO,OACPwB,SAAU,CAAC,iBACXvB,GA5BF,SAAgBa,GACd,IAAIX,EAAQW,EAAMX,MACdc,EAAUH,EAAMG,QAChBnB,EAAOgB,EAAMhB,KACb4S,EAAkBzR,EAAQuG,OAC1BA,OAA6B,IAApBkL,EAA6B,CAAC,EAAG,GAAKA,EAC/C7I,EAAO,UAAkB,SAAU5L,EAAKC,GAE1C,OADAD,EAAIC,GA5BD,SAAiCA,EAAWyI,EAAOa,GACxD,IAAIjB,EAAgB9E,EAAiBvD,GACjCyU,EAAiB,CAACrV,EAAM,GAAKqH,QAAQ4B,IAAkB,GAAK,EAAI,EAEhErG,EAAyB,mBAAXsH,EAAwBA,EAAOhL,OAAOkE,OAAO,CAAC,EAAGiG,EAAO,CACxEzI,UAAWA,KACPsJ,EACFoL,EAAW1S,EAAK,GAChB2S,EAAW3S,EAAK,GAIpB,OAFA0S,EAAWA,GAAY,EACvBC,GAAYA,GAAY,GAAKF,EACtB,CAACrV,EAAMD,GAAOsH,QAAQ4B,IAAkB,EAAI,CACjD7C,EAAGmP,EACHjP,EAAGgP,GACD,CACFlP,EAAGkP,EACHhP,EAAGiP,EAEP,CASqBC,CAAwB5U,EAAWiC,EAAMwG,MAAOa,GAC1DvJ,CACT,GAAG,CAAC,GACA8U,EAAwBlJ,EAAK1J,EAAMjC,WACnCwF,EAAIqP,EAAsBrP,EAC1BE,EAAImP,EAAsBnP,EAEW,MAArCzD,EAAMmG,cAAcD,gBACtBlG,EAAMmG,cAAcD,cAAc3C,GAAKA,EACvCvD,EAAMmG,cAAcD,cAAczC,GAAKA,GAGzCzD,EAAMmG,cAAcxG,GAAQ+J,CAC9B,GC1BA,IACE/J,KAAM,gBACNC,SAAS,EACTC,MAAO,OACPC,GApBF,SAAuBC,GACrB,IAAIC,EAAQD,EAAKC,MACbL,EAAOI,EAAKJ,KAKhBK,EAAMmG,cAAcxG,GAAQkN,GAAe,CACzClP,UAAWqC,EAAMwG,MAAM7I,UACvBiB,QAASoB,EAAMwG,MAAM9I,OACrBqD,SAAU,WACVhD,UAAWiC,EAAMjC,WAErB,EAQE2L,KAAM,CAAC,GCgHT,IACE/J,KAAM,kBACNC,SAAS,EACTC,MAAO,OACPC,GA/HF,SAAyBC,GACvB,IAAIC,EAAQD,EAAKC,MACbc,EAAUf,EAAKe,QACfnB,EAAOI,EAAKJ,KACZoP,EAAoBjO,EAAQkM,SAC5BgC,OAAsC,IAAtBD,GAAsCA,EACtDE,EAAmBnO,EAAQoO,QAC3BC,OAAoC,IAArBF,GAAsCA,EACrD3B,EAAWxM,EAAQwM,SACnBE,EAAe1M,EAAQ0M,aACvBI,EAAc9M,EAAQ8M,YACtBrH,EAAUzF,EAAQyF,QAClBsM,EAAkB/R,EAAQgS,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7CE,EAAwBjS,EAAQkS,aAChCA,OAAyC,IAA1BD,EAAmC,EAAIA,EACtD5H,EAAW8B,GAAejN,EAAO,CACnCsN,SAAUA,EACVE,aAAcA,EACdjH,QAASA,EACTqH,YAAaA,IAEXxH,EAAgB9E,EAAiBtB,EAAMjC,WACvCiK,EAAYL,EAAa3H,EAAMjC,WAC/BkV,GAAmBjL,EACnBgF,EAAWtH,EAAyBU,GACpC8I,ECrCY,MDqCSlC,ECrCH,IAAM,IDsCxB9G,EAAgBlG,EAAMmG,cAAcD,cACpCmK,EAAgBrQ,EAAMwG,MAAM7I,UAC5BoK,EAAa/H,EAAMwG,MAAM9I,OACzBwV,EAA4C,mBAAjBF,EAA8BA,EAAa3W,OAAOkE,OAAO,CAAC,EAAGP,EAAMwG,MAAO,CACvGzI,UAAWiC,EAAMjC,aACbiV,EACFG,EAA2D,iBAAtBD,EAAiC,CACxElG,SAAUkG,EACVhE,QAASgE,GACP7W,OAAOkE,OAAO,CAChByM,SAAU,EACVkC,QAAS,GACRgE,GACCE,EAAsBpT,EAAMmG,cAAckB,OAASrH,EAAMmG,cAAckB,OAAOrH,EAAMjC,WAAa,KACjG2L,EAAO,CACTnG,EAAG,EACHE,EAAG,GAGL,GAAKyC,EAAL,CAIA,GAAI8I,EAAe,CACjB,IAAIqE,EAEAC,EAAwB,MAAbtG,EAAmB,EAAM7P,EACpCoW,EAAuB,MAAbvG,EAAmB/P,EAASC,EACtCoJ,EAAmB,MAAb0G,EAAmB,SAAW,QACpC3F,EAASnB,EAAc8G,GACvBtL,EAAM2F,EAAS8D,EAASmI,GACxB7R,EAAM4F,EAAS8D,EAASoI,GACxBC,EAAWV,GAAU/K,EAAWzB,GAAO,EAAI,EAC3CmN,EAASzL,IAAc1K,EAAQ+S,EAAc/J,GAAOyB,EAAWzB,GAC/DoN,EAAS1L,IAAc1K,GAASyK,EAAWzB,IAAQ+J,EAAc/J,GAGjEL,EAAejG,EAAME,SAASgB,MAC9BwF,EAAYoM,GAAU7M,EAAetC,EAAcsC,GAAgB,CACrE/C,MAAO,EACPE,OAAQ,GAENuQ,GAAqB3T,EAAMmG,cAAc,oBAAsBnG,EAAMmG,cAAc,oBAAoBI,QxBhFtG,CACLvF,IAAK,EACL9D,MAAO,EACPD,OAAQ,EACRE,KAAM,GwB6EFyW,GAAkBD,GAAmBL,GACrCO,GAAkBF,GAAmBJ,GAMrCO,GAAWnO,EAAO,EAAG0K,EAAc/J,GAAMI,EAAUJ,IACnDyN,GAAYd,EAAkB5C,EAAc/J,GAAO,EAAIkN,EAAWM,GAAWF,GAAkBT,EAA4BnG,SAAWyG,EAASK,GAAWF,GAAkBT,EAA4BnG,SACxMgH,GAAYf,GAAmB5C,EAAc/J,GAAO,EAAIkN,EAAWM,GAAWD,GAAkBV,EAA4BnG,SAAW0G,EAASI,GAAWD,GAAkBV,EAA4BnG,SACzMjG,GAAoB/G,EAAME,SAASgB,OAAS8D,EAAgBhF,EAAME,SAASgB,OAC3E+S,GAAelN,GAAiC,MAAbiG,EAAmBjG,GAAkBsF,WAAa,EAAItF,GAAkBuF,YAAc,EAAI,EAC7H4H,GAAwH,OAAjGb,EAA+C,MAAvBD,OAA8B,EAASA,EAAoBpG,IAAqBqG,EAAwB,EAEvJc,GAAY9M,EAAS2M,GAAYE,GACjCE,GAAkBzO,EAAOmN,EAAS,EAAQpR,EAF9B2F,EAAS0M,GAAYG,GAAsBD,IAEKvS,EAAK2F,EAAQyL,EAAS,EAAQrR,EAAK0S,IAAa1S,GAChHyE,EAAc8G,GAAYoH,GAC1B1K,EAAKsD,GAAYoH,GAAkB/M,CACrC,CAEA,GAAI8H,EAAc,CAChB,IAAIkF,GAEAC,GAAyB,MAAbtH,EAAmB,EAAM7P,EAErCoX,GAAwB,MAAbvH,EAAmB/P,EAASC,EAEvCsX,GAAUtO,EAAcgJ,GAExBuF,GAAmB,MAAZvF,EAAkB,SAAW,QAEpCwF,GAAOF,GAAUrJ,EAASmJ,IAE1BK,GAAOH,GAAUrJ,EAASoJ,IAE1BK,IAAuD,IAAxC,CAAC,EAAKzX,GAAMqH,QAAQ4B,GAEnCyO,GAAyH,OAAjGR,GAAgD,MAAvBjB,OAA8B,EAASA,EAAoBlE,IAAoBmF,GAAyB,EAEzJS,GAAaF,GAAeF,GAAOF,GAAUnE,EAAcoE,IAAQ1M,EAAW0M,IAAQI,GAAuB1B,EAA4BjE,QAEzI6F,GAAaH,GAAeJ,GAAUnE,EAAcoE,IAAQ1M,EAAW0M,IAAQI,GAAuB1B,EAA4BjE,QAAUyF,GAE5IK,GAAmBlC,GAAU8B,G1BzH9B,SAAwBlT,EAAK1E,EAAOyE,GACzC,IAAIwT,EAAItP,EAAOjE,EAAK1E,EAAOyE,GAC3B,OAAOwT,EAAIxT,EAAMA,EAAMwT,CACzB,C0BsHoDC,CAAeJ,GAAYN,GAASO,IAAcpP,EAAOmN,EAASgC,GAAaJ,GAAMF,GAAS1B,EAASiC,GAAaJ,IAEpKzO,EAAcgJ,GAAW8F,GACzBtL,EAAKwF,GAAW8F,GAAmBR,EACrC,CAEAxU,EAAMmG,cAAcxG,GAAQ+J,CAvE5B,CAwEF,EAQEhC,iBAAkB,CAAC,WE1HN,SAASyN,GAAiBC,EAAyBrQ,EAAcsD,QAC9D,IAAZA,IACFA,GAAU,GAGZ,ICnBoCrJ,ECJOJ,EFuBvCyW,EAA0B9V,EAAcwF,GACxCuQ,EAAuB/V,EAAcwF,IAf3C,SAAyBnG,GACvB,IAAImN,EAAOnN,EAAQ+D,wBACfI,EAASpB,EAAMoK,EAAK7I,OAAStE,EAAQqE,aAAe,EACpDD,EAASrB,EAAMoK,EAAK3I,QAAUxE,EAAQuE,cAAgB,EAC1D,OAAkB,IAAXJ,GAA2B,IAAXC,CACzB,CAU4DuS,CAAgBxQ,GACtEJ,EAAkBF,EAAmBM,GACrCgH,EAAOpJ,EAAsByS,EAAyBE,EAAsBjN,GAC5EyB,EAAS,CACXc,WAAY,EACZE,UAAW,GAET7C,EAAU,CACZ1E,EAAG,EACHE,EAAG,GAkBL,OAfI4R,IAA4BA,IAA4BhN,MACxB,SAA9B1J,EAAYoG,IAChBkG,GAAetG,MACbmF,GCnCgC9K,EDmCT+F,KClCdhG,EAAUC,IAAUO,EAAcP,GCJxC,CACL4L,YAFyChM,EDQbI,GCNR4L,WACpBE,UAAWlM,EAAQkM,WDGZH,GAAgB3L,IDoCnBO,EAAcwF,KAChBkD,EAAUtF,EAAsBoC,GAAc,IACtCxB,GAAKwB,EAAauH,WAC1BrE,EAAQxE,GAAKsB,EAAasH,WACjB1H,IACTsD,EAAQ1E,EAAIyH,GAAoBrG,KAI7B,CACLpB,EAAGwI,EAAK5O,KAAO2M,EAAOc,WAAa3C,EAAQ1E,EAC3CE,EAAGsI,EAAK/K,IAAM8I,EAAOgB,UAAY7C,EAAQxE,EACzCP,MAAO6I,EAAK7I,MACZE,OAAQ2I,EAAK3I,OAEjB,CGvDA,SAASoS,GAAMC,GACb,IAAItT,EAAM,IAAIoO,IACVmF,EAAU,IAAIC,IACdC,EAAS,GAKb,SAAS3F,EAAK4F,GACZH,EAAQI,IAAID,EAASlW,MACN,GAAG3B,OAAO6X,EAASxU,UAAY,GAAIwU,EAASnO,kBAAoB,IACtEvH,SAAQ,SAAU4V,GACzB,IAAKL,EAAQM,IAAID,GAAM,CACrB,IAAIE,EAAc9T,EAAI3F,IAAIuZ,GAEtBE,GACFhG,EAAKgG,EAET,CACF,IACAL,EAAO3E,KAAK4E,EACd,CAQA,OAzBAJ,EAAUtV,SAAQ,SAAU0V,GAC1B1T,EAAIiP,IAAIyE,EAASlW,KAAMkW,EACzB,IAiBAJ,EAAUtV,SAAQ,SAAU0V,GACrBH,EAAQM,IAAIH,EAASlW,OAExBsQ,EAAK4F,EAET,IACOD,CACT,CClBA,IAEIM,GAAkB,CACpBnY,UAAW,SACX0X,UAAW,GACX1U,SAAU,YAGZ,SAASoV,KACP,IAAK,IAAI1B,EAAO2B,UAAUrG,OAAQsG,EAAO,IAAIpU,MAAMwS,GAAO6B,EAAO,EAAGA,EAAO7B,EAAM6B,IAC/ED,EAAKC,GAAQF,UAAUE,GAGzB,OAAQD,EAAKvE,MAAK,SAAUlT,GAC1B,QAASA,GAAoD,mBAAlCA,EAAQ+D,sBACrC,GACF,CAEO,SAAS4T,GAAgBC,QACL,IAArBA,IACFA,EAAmB,CAAC,GAGtB,IAAIC,EAAoBD,EACpBE,EAAwBD,EAAkBE,iBAC1CA,OAA6C,IAA1BD,EAAmC,GAAKA,EAC3DE,EAAyBH,EAAkBI,eAC3CA,OAA4C,IAA3BD,EAAoCV,GAAkBU,EAC3E,OAAO,SAAsBjZ,EAAWD,EAAQoD,QAC9B,IAAZA,IACFA,EAAU+V,GAGZ,IC/C6B/W,EAC3BgX,ED8CE9W,EAAQ,CACVjC,UAAW,SACXgZ,iBAAkB,GAClBjW,QAASzE,OAAOkE,OAAO,CAAC,EAAG2V,GAAiBW,GAC5C1Q,cAAe,CAAC,EAChBjG,SAAU,CACRvC,UAAWA,EACXD,OAAQA,GAEV4C,WAAY,CAAC,EACbD,OAAQ,CAAC,GAEP2W,EAAmB,GACnBC,GAAc,EACdrN,EAAW,CACb5J,MAAOA,EACPkX,WAAY,SAAoBC,GAC9B,IAAIrW,EAAsC,mBAArBqW,EAAkCA,EAAiBnX,EAAMc,SAAWqW,EACzFC,IACApX,EAAMc,QAAUzE,OAAOkE,OAAO,CAAC,EAAGsW,EAAgB7W,EAAMc,QAASA,GACjEd,EAAMiK,cAAgB,CACpBtM,UAAW0B,EAAU1B,GAAa6N,GAAkB7N,GAAaA,EAAU4Q,eAAiB/C,GAAkB7N,EAAU4Q,gBAAkB,GAC1I7Q,OAAQ8N,GAAkB9N,IAI5B,IEzE4B+X,EAC9B4B,EFwEMN,EDvCG,SAAwBtB,GAErC,IAAIsB,EAAmBvB,GAAMC,GAE7B,OAAO/W,EAAeb,QAAO,SAAUC,EAAK+B,GAC1C,OAAO/B,EAAIE,OAAO+Y,EAAiBvR,QAAO,SAAUqQ,GAClD,OAAOA,EAAShW,QAAUA,CAC5B,IACF,GAAG,GACL,CC8B+ByX,EEzEK7B,EFyEsB,GAAGzX,OAAO2Y,EAAkB3W,EAAMc,QAAQ2U,WExE9F4B,EAAS5B,EAAU5X,QAAO,SAAUwZ,EAAQE,GAC9C,IAAIC,EAAWH,EAAOE,EAAQ5X,MAK9B,OAJA0X,EAAOE,EAAQ5X,MAAQ6X,EAAWnb,OAAOkE,OAAO,CAAC,EAAGiX,EAAUD,EAAS,CACrEzW,QAASzE,OAAOkE,OAAO,CAAC,EAAGiX,EAAS1W,QAASyW,EAAQzW,SACrD4I,KAAMrN,OAAOkE,OAAO,CAAC,EAAGiX,EAAS9N,KAAM6N,EAAQ7N,QAC5C6N,EACEF,CACT,GAAG,CAAC,GAEGhb,OAAO4D,KAAKoX,GAAQlV,KAAI,SAAUhG,GACvC,OAAOkb,EAAOlb,EAChB,MFsGM,OAvCA6D,EAAM+W,iBAAmBA,EAAiBvR,QAAO,SAAUiS,GACzD,OAAOA,EAAE7X,OACX,IAoJFI,EAAM+W,iBAAiB5W,SAAQ,SAAUqI,GACvC,IAAI7I,EAAO6I,EAAM7I,KACb+X,EAAgBlP,EAAM1H,QACtBA,OAA4B,IAAlB4W,EAA2B,CAAC,EAAIA,EAC1ChX,EAAS8H,EAAM9H,OAEnB,GAAsB,mBAAXA,EAAuB,CAChC,IAAIiX,EAAYjX,EAAO,CACrBV,MAAOA,EACPL,KAAMA,EACNiK,SAAUA,EACV9I,QAASA,IAKXkW,EAAiB/F,KAAK0G,GAFT,WAAmB,EAGlC,CACF,IAjIS/N,EAASQ,QAClB,EAMAwN,YAAa,WACX,IAAIX,EAAJ,CAIA,IAAIY,EAAkB7X,EAAME,SACxBvC,EAAYka,EAAgBla,UAC5BD,EAASma,EAAgBna,OAG7B,GAAKyY,GAAiBxY,EAAWD,GAAjC,CASAsC,EAAMwG,MAAQ,CACZ7I,UAAWwX,GAAiBxX,EAAWqH,EAAgBtH,GAAoC,UAA3BsC,EAAMc,QAAQC,UAC9ErD,OAAQiG,EAAcjG,IAOxBsC,EAAM0R,OAAQ,EACd1R,EAAMjC,UAAYiC,EAAMc,QAAQ/C,UAKhCiC,EAAM+W,iBAAiB5W,SAAQ,SAAU0V,GACvC,OAAO7V,EAAMmG,cAAc0P,EAASlW,MAAQtD,OAAOkE,OAAO,CAAC,EAAGsV,EAASnM,KACzE,IAGA,IAFA,IAESoO,EAAQ,EAAGA,EAAQ9X,EAAM+W,iBAAiBhH,OAAQ+H,IAUzD,IAAoB,IAAhB9X,EAAM0R,MAAV,CAMA,IAAIqG,EAAwB/X,EAAM+W,iBAAiBe,GAC/ChY,EAAKiY,EAAsBjY,GAC3BkY,EAAyBD,EAAsBjX,QAC/CoM,OAAsC,IAA3B8K,EAAoC,CAAC,EAAIA,EACpDrY,EAAOoY,EAAsBpY,KAEf,mBAAPG,IACTE,EAAQF,EAAG,CACTE,MAAOA,EACPc,QAASoM,EACTvN,KAAMA,EACNiK,SAAUA,KACN5J,EAdR,MAHEA,EAAM0R,OAAQ,EACdoG,GAAS,CAnCb,CAbA,CAmEF,EAGA1N,QClM2BtK,EDkMV,WACf,OAAO,IAAImY,SAAQ,SAAUC,GAC3BtO,EAASgO,cACTM,EAAQlY,EACV,GACF,ECrMG,WAUL,OATK8W,IACHA,EAAU,IAAImB,SAAQ,SAAUC,GAC9BD,QAAQC,UAAUC,MAAK,WACrBrB,OAAUsB,EACVF,EAAQpY,IACV,GACF,KAGKgX,CACT,GD2LIuB,QAAS,WACPjB,IACAH,GAAc,CAChB,GAGF,IAAKd,GAAiBxY,EAAWD,GAK/B,OAAOkM,EAmCT,SAASwN,IACPJ,EAAiB7W,SAAQ,SAAUL,GACjC,OAAOA,GACT,IACAkX,EAAmB,EACrB,CAEA,OAvCApN,EAASsN,WAAWpW,GAASqX,MAAK,SAAUnY,IACrCiX,GAAenW,EAAQwX,eAC1BxX,EAAQwX,cAActY,EAE1B,IAmCO4J,CACT,CACF,CACO,IAAI2O,GAA4BhC,KGrPnC,GAA4BA,GAAgB,CAC9CI,iBAFqB,CAAC6B,GAAgB,GAAe,GAAe,EAAa,GAAQ,GAAM,GAAiB,EAAO,MCJrH,GAA4BjC,GAAgB,CAC9CI,iBAFqB,CAAC6B,GAAgB,GAAe,GAAe,KCQtE,MAEMC,GAAiB,gBAsBjBC,GAAc9Z,IAClB,IAAI+Z,EAAW/Z,EAAQga,aAAa,kBAEpC,IAAKD,GAAyB,MAAbA,EAAkB,CACjC,IAAIE,EAAgBja,EAAQga,aAAa,QAKzC,IAAKC,IAAkBA,EAAcC,SAAS,OAASD,EAAcE,WAAW,KAC9E,OAAO,KAILF,EAAcC,SAAS,OAASD,EAAcE,WAAW,OAC3DF,EAAgB,IAAIA,EAActX,MAAM,KAAK,MAG/CoX,EAAWE,GAAmC,MAAlBA,EAAwBA,EAAcG,OAAS,IAC7E,CAEA,OAAOL,CAAQ,EAGXM,GAAyBra,IAC7B,MAAM+Z,EAAWD,GAAY9Z,GAE7B,OAAI+Z,GACKjU,SAAS+C,cAAckR,GAAYA,EAGrC,IAAI,EAGPO,GAAyBta,IAC7B,MAAM+Z,EAAWD,GAAY9Z,GAC7B,OAAO+Z,EAAWjU,SAAS+C,cAAckR,GAAY,IAAI,EA0BrDQ,GAAuBva,IAC3BA,EAAQwa,cAAc,IAAIC,MAAMZ,IAAgB,EAG5C,GAAYa,MACXA,GAA4B,iBAAXA,UAIO,IAAlBA,EAAOC,SAChBD,EAASA,EAAO,SAGgB,IAApBA,EAAOE,UAGjBC,GAAaH,GAEb,GAAUA,GACLA,EAAOC,OAASD,EAAO,GAAKA,EAGf,iBAAXA,GAAuBA,EAAOvJ,OAAS,EACzCrL,SAAS+C,cAAc6R,GAGzB,KAGHI,GAAY9a,IAChB,IAAK,GAAUA,IAAgD,IAApCA,EAAQ+a,iBAAiB5J,OAClD,OAAO,EAGT,MAAM6J,EAAgF,YAA7DtV,iBAAiB1F,GAASib,iBAAiB,cAE9DC,EAAgBlb,EAAQmb,QAAQ,uBAEtC,IAAKD,EACH,OAAOF,EAGT,GAAIE,IAAkBlb,EAAS,CAC7B,MAAMob,EAAUpb,EAAQmb,QAAQ,WAEhC,GAAIC,GAAWA,EAAQ5V,aAAe0V,EACpC,OAAO,EAGT,GAAgB,OAAZE,EACF,OAAO,CAEX,CAEA,OAAOJ,CAAgB,EAGnBK,GAAarb,IACZA,GAAWA,EAAQ4a,WAAaU,KAAKC,gBAItCvb,EAAQwb,UAAUvW,SAAS,mBAIC,IAArBjF,EAAQyb,SACVzb,EAAQyb,SAGVzb,EAAQ0b,aAAa,aAAoD,UAArC1b,EAAQga,aAAa,aAG5D2B,GAAiB3b,IACrB,IAAK8F,SAASC,gBAAgB6V,aAC5B,OAAO,KAIT,GAAmC,mBAAxB5b,EAAQqF,YAA4B,CAC7C,MAAMwW,EAAO7b,EAAQqF,cACrB,OAAOwW,aAAgB/a,WAAa+a,EAAO,IAC7C,CAEA,OAAI7b,aAAmBc,WACdd,EAIJA,EAAQwF,WAINmW,GAAe3b,EAAQwF,YAHrB,IAGgC,EAGrCsW,GAAO,OAWPC,GAAS/b,IACbA,EAAQuE,YAAY,EAGhByX,GAAY,IACZ3b,OAAO4b,SAAWnW,SAAS6G,KAAK+O,aAAa,qBACxCrb,OAAO4b,OAGT,KAGHC,GAA4B,GAmB5BC,GAAQ,IAAuC,QAAjCrW,SAASC,gBAAgBqW,IAEvCC,GAAqBC,IAnBAC,QAoBN,KACjB,MAAMC,EAAIR,KAGV,GAAIQ,EAAG,CACL,MAAMzb,EAAOub,EAAOG,KACdC,EAAqBF,EAAEtb,GAAGH,GAChCyb,EAAEtb,GAAGH,GAAQub,EAAOK,gBACpBH,EAAEtb,GAAGH,GAAM6b,YAAcN,EAEzBE,EAAEtb,GAAGH,GAAM8b,WAAa,KACtBL,EAAEtb,GAAGH,GAAQ2b,EACNJ,EAAOK,gBAElB,GAjC0B,YAAxB7W,SAASgX,YAENZ,GAA0B/K,QAC7BrL,SAASyF,iBAAiB,oBAAoB,KAC5C,IAAK,MAAMgR,KAAYL,GACrBK,GACF,IAIJL,GAA0B7J,KAAKkK,IAE/BA,GAsBA,EAGEQ,GAAUR,IACU,mBAAbA,GACTA,GACF,EAGIS,GAAyB,CAACT,EAAUU,EAAmBC,GAAoB,KAC/E,IAAKA,EAEH,YADAH,GAAQR,GAIV,MACMY,EAnMiCnd,KACvC,IAAKA,EACH,OAAO,EAIT,IAAI,mBACFod,EAAkB,gBAClBC,GACEhd,OAAOqF,iBAAiB1F,GAC5B,MAAMsd,EAA0BC,OAAOC,WAAWJ,GAC5CK,EAAuBF,OAAOC,WAAWH,GAE/C,OAAKC,GAA4BG,GAKjCL,EAAqBA,EAAmBza,MAAM,KAAK,GACnD0a,EAAkBA,EAAgB1a,MAAM,KAAK,GAjFf,KAkFtB4a,OAAOC,WAAWJ,GAAsBG,OAAOC,WAAWH,KANzD,CAMoG,EA+KpFK,CAAiCT,GADlC,EAExB,IAAIU,GAAS,EAEb,MAAMC,EAAU,EACd5Q,aAEIA,IAAWiQ,IAIfU,GAAS,EACTV,EAAkBxR,oBAAoBoO,GAAgB+D,GACtDb,GAAQR,GAAS,EAGnBU,EAAkB1R,iBAAiBsO,GAAgB+D,GACnDC,YAAW,KACJF,GACHpD,GAAqB0C,EACvB,GACCE,EAAiB,EAahBW,GAAuB,CAACjR,EAAMkR,EAAeC,EAAeC,KAChE,MAAMC,EAAarR,EAAKsE,OACxB,IAAI+H,EAAQrM,EAAKjH,QAAQmY,GAGzB,OAAe,IAAX7E,GACM8E,GAAiBC,EAAiBpR,EAAKqR,EAAa,GAAKrR,EAAK,IAGxEqM,GAAS8E,EAAgB,GAAK,EAE1BC,IACF/E,GAASA,EAAQgF,GAAcA,GAG1BrR,EAAKjK,KAAKC,IAAI,EAAGD,KAAKE,IAAIoW,EAAOgF,EAAa,KAAI,EAarDC,GAAiB,qBACjBC,GAAiB,OACjBC,GAAgB,SAChBC,GAAgB,CAAC,EAEvB,IAAIC,GAAW,EACf,MAAMC,GAAe,CACnBC,WAAY,YACZC,WAAY,YAERC,GAAe,IAAI5H,IAAI,CAAC,QAAS,WAAY,UAAW,YAAa,cAAe,aAAc,iBAAkB,YAAa,WAAY,YAAa,cAAe,YAAa,UAAW,WAAY,QAAS,oBAAqB,aAAc,YAAa,WAAY,cAAe,cAAe,cAAe,YAAa,eAAgB,gBAAiB,eAAgB,gBAAiB,aAAc,QAAS,OAAQ,SAAU,QAAS,SAAU,SAAU,UAAW,WAAY,OAAQ,SAAU,eAAgB,SAAU,OAAQ,mBAAoB,mBAAoB,QAAS,QAAS,WAK/lB,SAAS6H,GAAa5e,EAAS6e,GAC7B,OAAOA,GAAO,GAAGA,MAAQN,QAAgBve,EAAQue,UAAYA,IAC/D,CAEA,SAASO,GAAiB9e,GACxB,MAAM6e,EAAMD,GAAa5e,GAGzB,OAFAA,EAAQue,SAAWM,EACnBP,GAAcO,GAAOP,GAAcO,IAAQ,CAAC,EACrCP,GAAcO,EACvB,CA0CA,SAASE,GAAYC,EAAQC,EAAUC,EAAqB,MAC1D,OAAOzhB,OAAO0hB,OAAOH,GAAQpM,MAAKwM,GAASA,EAAMH,WAAaA,GAAYG,EAAMF,qBAAuBA,GACzG,CAEA,SAASG,GAAoBC,EAAmB1B,EAAS2B,GACvD,MAAMC,EAAiC,iBAAZ5B,EAErBqB,EAAWO,EAAcD,EAAqB3B,GAAW2B,EAC/D,IAAIE,EAAYC,GAAaJ,GAM7B,OAJKX,GAAavH,IAAIqI,KACpBA,EAAYH,GAGP,CAACE,EAAaP,EAAUQ,EACjC,CAEA,SAASE,GAAW3f,EAASsf,EAAmB1B,EAAS2B,EAAoBK,GAC3E,GAAiC,iBAAtBN,IAAmCtf,EAC5C,OAGF,IAAKwf,EAAaP,EAAUQ,GAAaJ,GAAoBC,EAAmB1B,EAAS2B,GAGzF,GAAID,KAAqBd,GAAc,CACrC,MAAMqB,EAAe3e,GACZ,SAAUke,GACf,IAAKA,EAAMU,eAAiBV,EAAMU,gBAAkBV,EAAMW,iBAAmBX,EAAMW,eAAe9a,SAASma,EAAMU,eAC/G,OAAO5e,EAAGjD,KAAK+hB,KAAMZ,EAEzB,EAGFH,EAAWY,EAAaZ,EAC1B,CAEA,MAAMD,EAASF,GAAiB9e,GAC1BigB,EAAWjB,EAAOS,KAAeT,EAAOS,GAAa,CAAC,GACtDS,EAAmBnB,GAAYkB,EAAUhB,EAAUO,EAAc5B,EAAU,MAEjF,GAAIsC,EAEF,YADAA,EAAiBN,OAASM,EAAiBN,QAAUA,GAIvD,MAAMf,EAAMD,GAAaK,EAAUK,EAAkB1T,QAAQuS,GAAgB,KACvEjd,EAAKse,EAzEb,SAAoCxf,EAAS+Z,EAAU7Y,GACrD,OAAO,SAAS0c,EAAQwB,GACtB,MAAMe,EAAcngB,EAAQogB,iBAAiBrG,GAE7C,IAAK,IAAI,OACP/M,GACEoS,EAAOpS,GAAUA,IAAWgT,KAAMhT,EAASA,EAAOxH,WACpD,IAAK,MAAM6a,KAAcF,EACvB,GAAIE,IAAerT,EAYnB,OARAsT,GAAWlB,EAAO,CAChBW,eAAgB/S,IAGd4Q,EAAQgC,QACVW,GAAaC,IAAIxgB,EAASof,EAAMqB,KAAM1G,EAAU7Y,GAG3CA,EAAGwf,MAAM1T,EAAQ,CAACoS,GAG/B,CACF,CAiD2BuB,CAA2B3gB,EAAS4d,EAASqB,GAvFxE,SAA0Bjf,EAASkB,GACjC,OAAO,SAAS0c,EAAQwB,GAStB,OARAkB,GAAWlB,EAAO,CAChBW,eAAgB/f,IAGd4d,EAAQgC,QACVW,GAAaC,IAAIxgB,EAASof,EAAMqB,KAAMvf,GAGjCA,EAAGwf,MAAM1gB,EAAS,CAACof,GAC5B,CACF,CA2EoFwB,CAAiB5gB,EAASif,GAC5G/d,EAAGge,mBAAqBM,EAAc5B,EAAU,KAChD1c,EAAG+d,SAAWA,EACd/d,EAAG0e,OAASA,EACZ1e,EAAGqd,SAAWM,EACdoB,EAASpB,GAAO3d,EAChBlB,EAAQuL,iBAAiBkU,EAAWve,EAAIse,EAC1C,CAEA,SAASqB,GAAc7gB,EAASgf,EAAQS,EAAW7B,EAASsB,GAC1D,MAAMhe,EAAK6d,GAAYC,EAAOS,GAAY7B,EAASsB,GAE9Che,IAILlB,EAAQyL,oBAAoBgU,EAAWve,EAAI4f,QAAQ5B,WAC5CF,EAAOS,GAAWve,EAAGqd,UAC9B,CAEA,SAASwC,GAAyB/gB,EAASgf,EAAQS,EAAWuB,GAC5D,MAAMC,EAAoBjC,EAAOS,IAAc,CAAC,EAEhD,IAAK,MAAMyB,KAAczjB,OAAO4D,KAAK4f,GACnC,GAAIC,EAAWhH,SAAS8G,GAAY,CAClC,MAAM5B,EAAQ6B,EAAkBC,GAChCL,GAAc7gB,EAASgf,EAAQS,EAAWL,EAAMH,SAAUG,EAAMF,mBAClE,CAEJ,CAEA,SAASQ,GAAaN,GAGpB,OADAA,EAAQA,EAAMxT,QAAQwS,GAAgB,IAC/BI,GAAaY,IAAUA,CAChC,CAEA,MAAMmB,GAAe,CACnBY,GAAGnhB,EAASof,EAAOxB,EAAS2B,GAC1BI,GAAW3f,EAASof,EAAOxB,EAAS2B,GAAoB,EAC1D,EAEA6B,IAAIphB,EAASof,EAAOxB,EAAS2B,GAC3BI,GAAW3f,EAASof,EAAOxB,EAAS2B,GAAoB,EAC1D,EAEAiB,IAAIxgB,EAASsf,EAAmB1B,EAAS2B,GACvC,GAAiC,iBAAtBD,IAAmCtf,EAC5C,OAGF,MAAOwf,EAAaP,EAAUQ,GAAaJ,GAAoBC,EAAmB1B,EAAS2B,GACrF8B,EAAc5B,IAAcH,EAC5BN,EAASF,GAAiB9e,GAC1BihB,EAAoBjC,EAAOS,IAAc,CAAC,EAC1C6B,EAAchC,EAAkBnF,WAAW,KAEjD,QAAwB,IAAb8E,EAAX,CAUA,GAAIqC,EACF,IAAK,MAAMC,KAAgB9jB,OAAO4D,KAAK2d,GACrC+B,GAAyB/gB,EAASgf,EAAQuC,EAAcjC,EAAkBzM,MAAM,IAIpF,IAAK,MAAM2O,KAAe/jB,OAAO4D,KAAK4f,GAAoB,CACxD,MAAMC,EAAaM,EAAY5V,QAAQyS,GAAe,IAEtD,IAAKgD,GAAe/B,EAAkBpF,SAASgH,GAAa,CAC1D,MAAM9B,EAAQ6B,EAAkBO,GAChCX,GAAc7gB,EAASgf,EAAQS,EAAWL,EAAMH,SAAUG,EAAMF,mBAClE,CACF,CAfA,KARA,CAEE,IAAKzhB,OAAO4D,KAAK4f,GAAmB9P,OAClC,OAGF0P,GAAc7gB,EAASgf,EAAQS,EAAWR,EAAUO,EAAc5B,EAAU,KAE9E,CAgBF,EAEA6D,QAAQzhB,EAASof,EAAO3H,GACtB,GAAqB,iBAAV2H,IAAuBpf,EAChC,OAAO,KAGT,MAAMwc,EAAIR,KAGV,IAAI0F,EAAc,KACdC,GAAU,EACVC,GAAiB,EACjBC,GAAmB,EAJHzC,IADFM,GAAaN,IAOZ5C,IACjBkF,EAAclF,EAAE/B,MAAM2E,EAAO3H,GAC7B+E,EAAExc,GAASyhB,QAAQC,GACnBC,GAAWD,EAAYI,uBACvBF,GAAkBF,EAAYK,gCAC9BF,EAAmBH,EAAYM,sBAGjC,IAAIC,EAAM,IAAIxH,MAAM2E,EAAO,CACzBuC,UACAO,YAAY,IAgBd,OAdAD,EAAM3B,GAAW2B,EAAKxK,GAElBoK,GACFI,EAAIE,iBAGFP,GACF5hB,EAAQwa,cAAcyH,GAGpBA,EAAIJ,kBAAoBH,GAC1BA,EAAYS,iBAGPF,CACT,GAIF,SAAS3B,GAAWziB,EAAKukB,GACvB,IAAK,MAAO7kB,EAAKa,KAAUX,OAAO4kB,QAAQD,GAAQ,CAAC,GACjD,IACEvkB,EAAIN,GAAOa,CACb,CAAE,MAAOkkB,GACP7kB,OAAOC,eAAeG,EAAKN,EAAK,CAC9BglB,cAAc,EAEd3kB,IAAG,IACMQ,GAIb,CAGF,OAAOP,CACT,CAYA,MAAM2kB,GAAa,IAAI7Q,IACjB8Q,GAAO,CACXjQ,IAAIxS,EAASzC,EAAKyN,GACXwX,GAAWpL,IAAIpX,IAClBwiB,GAAWhQ,IAAIxS,EAAS,IAAI2R,KAG9B,MAAM+Q,EAAcF,GAAW5kB,IAAIoC,GAG9B0iB,EAAYtL,IAAI7Z,IAA6B,IAArBmlB,EAAYC,KAMzCD,EAAYlQ,IAAIjV,EAAKyN,GAJnB4X,QAAQC,MAAM,+EAA+Exf,MAAMyf,KAAKJ,EAAYrhB,QAAQ,MAKhI,EAEAzD,IAAG,CAACoC,EAASzC,IACPilB,GAAWpL,IAAIpX,IACVwiB,GAAW5kB,IAAIoC,GAASpC,IAAIL,IAG9B,KAGTwlB,OAAO/iB,EAASzC,GACd,IAAKilB,GAAWpL,IAAIpX,GAClB,OAGF,MAAM0iB,EAAcF,GAAW5kB,IAAIoC,GACnC0iB,EAAYM,OAAOzlB,GAEM,IAArBmlB,EAAYC,MACdH,GAAWQ,OAAOhjB,EAEtB,GAUF,SAASijB,GAAc7kB,GACrB,GAAc,SAAVA,EACF,OAAO,EAGT,GAAc,UAAVA,EACF,OAAO,EAGT,GAAIA,IAAUmf,OAAOnf,GAAOkC,WAC1B,OAAOid,OAAOnf,GAGhB,GAAc,KAAVA,GAA0B,SAAVA,EAClB,OAAO,KAGT,GAAqB,iBAAVA,EACT,OAAOA,EAGT,IACE,OAAO8kB,KAAKC,MAAMC,mBAAmBhlB,GACvC,CAAE,MAAOkkB,GACP,OAAOlkB,CACT,CACF,CAEA,SAASilB,GAAiB9lB,GACxB,OAAOA,EAAIqO,QAAQ,UAAU0X,GAAO,IAAIA,EAAIpjB,iBAC9C,CAEA,MAAMqjB,GAAc,CAClBC,iBAAiBxjB,EAASzC,EAAKa,GAC7B4B,EAAQ6B,aAAa,WAAWwhB,GAAiB9lB,KAAQa,EAC3D,EAEAqlB,oBAAoBzjB,EAASzC,GAC3ByC,EAAQ4B,gBAAgB,WAAWyhB,GAAiB9lB,KACtD,EAEAmmB,kBAAkB1jB,GAChB,IAAKA,EACH,MAAO,CAAC,EAGV,MAAM0B,EAAa,CAAC,EACdiiB,EAASlmB,OAAO4D,KAAKrB,EAAQ4jB,SAAShd,QAAOrJ,GAAOA,EAAI4c,WAAW,QAAU5c,EAAI4c,WAAW,cAElG,IAAK,MAAM5c,KAAOomB,EAAQ,CACxB,IAAIE,EAAUtmB,EAAIqO,QAAQ,MAAO,IACjCiY,EAAUA,EAAQC,OAAO,GAAG5jB,cAAgB2jB,EAAQhR,MAAM,EAAGgR,EAAQ1S,QACrEzP,EAAWmiB,GAAWZ,GAAcjjB,EAAQ4jB,QAAQrmB,GACtD,CAEA,OAAOmE,CACT,EAEAqiB,iBAAgB,CAAC/jB,EAASzC,IACjB0lB,GAAcjjB,EAAQga,aAAa,WAAWqJ,GAAiB9lB,QAe1E,MAAMymB,GAEOC,qBACT,MAAO,CAAC,CACV,CAEWC,yBACT,MAAO,CAAC,CACV,CAEWzH,kBACT,MAAM,IAAI0H,MAAM,sEAClB,CAEAC,WAAWC,GAMT,OALAA,EAASrE,KAAKsE,gBAAgBD,GAC9BA,EAASrE,KAAKuE,kBAAkBF,GAEhCrE,KAAKwE,iBAAiBH,GAEfA,CACT,CAEAE,kBAAkBF,GAChB,OAAOA,CACT,CAEAC,gBAAgBD,EAAQrkB,GACtB,MAAMykB,EAAa,GAAUzkB,GAAWujB,GAAYQ,iBAAiB/jB,EAAS,UAAY,CAAC,EAE3F,MAAO,IAAKggB,KAAK0E,YAAYT,WACD,iBAAfQ,EAA0BA,EAAa,CAAC,KAC/C,GAAUzkB,GAAWujB,GAAYG,kBAAkB1jB,GAAW,CAAC,KAC7C,iBAAXqkB,EAAsBA,EAAS,CAAC,EAE/C,CAEAG,iBAAiBH,EAAQM,EAAc3E,KAAK0E,YAAYR,aACtD,IAAK,MAAM3hB,KAAY9E,OAAO4D,KAAKsjB,GAAc,CAC/C,MAAMC,EAAgBD,EAAYpiB,GAC5BnE,EAAQimB,EAAO9hB,GACfsiB,EAAY,GAAUzmB,GAAS,UA1uBrCsc,OADSA,EA2uB+Ctc,GAzuBnD,GAAGsc,IAGLjd,OAAOM,UAAUuC,SAASrC,KAAKyc,GAAQoK,MAAM,eAAe,GAAG5kB,cAwuBlE,IAAK,IAAI6kB,OAAOH,GAAe9gB,KAAK+gB,GAClC,MAAM,IAAIG,UAAU,GAAGhF,KAAK0E,YAAYjI,KAAKwI,0BAA0B1iB,qBAA4BsiB,yBAAiCD,MAExI,CAhvBWlK,KAivBb,EAmBF,MAAMwK,WAAsBlB,GAC1BU,YAAY1kB,EAASqkB,GACnBc,SACAnlB,EAAU6a,GAAW7a,MAMrBggB,KAAKoF,SAAWplB,EAChBggB,KAAKqF,QAAUrF,KAAKoE,WAAWC,GAC/B5B,GAAKjQ,IAAIwN,KAAKoF,SAAUpF,KAAK0E,YAAYY,SAAUtF,MACrD,CAGAuF,UACE9C,GAAKM,OAAO/C,KAAKoF,SAAUpF,KAAK0E,YAAYY,UAC5C/E,GAAaC,IAAIR,KAAKoF,SAAUpF,KAAK0E,YAAYc,WAEjD,IAAK,MAAMC,KAAgBhoB,OAAOioB,oBAAoB1F,MACpDA,KAAKyF,GAAgB,IAEzB,CAEAE,eAAepJ,EAAUvc,EAAS4lB,GAAa,GAC7C5I,GAAuBT,EAAUvc,EAAS4lB,EAC5C,CAEAxB,WAAWC,GAMT,OALAA,EAASrE,KAAKsE,gBAAgBD,EAAQrE,KAAKoF,UAC3Cf,EAASrE,KAAKuE,kBAAkBF,GAEhCrE,KAAKwE,iBAAiBH,GAEfA,CACT,CAGAwB,mBAAmB7lB,GACjB,OAAOyiB,GAAK7kB,IAAIid,GAAW7a,GAAUggB,KAAKsF,SAC5C,CAEAO,2BAA2B7lB,EAASqkB,EAAS,CAAC,GAC5C,OAAOrE,KAAK8F,YAAY9lB,IAAY,IAAIggB,KAAKhgB,EAA2B,iBAAXqkB,EAAsBA,EAAS,KAC9F,CAEW0B,qBACT,MApDY,OAqDd,CAEWT,sBACT,MAAO,MAAMtF,KAAKvD,MACpB,CAEW+I,uBACT,MAAO,IAAIxF,KAAKsF,UAClB,CAEAO,iBAAiB9kB,GACf,MAAO,GAAGA,IAAOif,KAAKwF,WACxB,EAWF,MAAMQ,GAAuB,CAACC,EAAWC,EAAS,UAChD,MAAMC,EAAa,gBAAgBF,EAAUT,YACvCzkB,EAAOklB,EAAUxJ,KACvB8D,GAAaY,GAAGrb,SAAUqgB,EAAY,qBAAqBplB,OAAU,SAAUqe,GAK7E,GAJI,CAAC,IAAK,QAAQlF,SAAS8F,KAAKoG,UAC9BhH,EAAM+C,iBAGJ9G,GAAW2E,MACb,OAGF,MAAMhT,EAASsN,GAAuB0F,OAASA,KAAK7E,QAAQ,IAAIpa,KAC/CklB,EAAUI,oBAAoBrZ,GAEtCkZ,IACX,GAAE,EAeEI,GAAc,YACdC,GAAc,QAAQD,KACtBE,GAAe,SAASF,KAO9B,MAAMG,WAAcvB,GAEPzI,kBACT,MAdW,OAeb,CAGAiK,QAGE,GAFmBnG,GAAakB,QAAQzB,KAAKoF,SAAUmB,IAExC1E,iBACb,OAGF7B,KAAKoF,SAAS5J,UAAUuH,OAnBF,QAqBtB,MAAM6C,EAAa5F,KAAKoF,SAAS5J,UAAUvW,SAtBrB,QAwBtB+a,KAAK2F,gBAAe,IAAM3F,KAAK2G,mBAAmB3G,KAAKoF,SAAUQ,EACnE,CAGAe,kBACE3G,KAAKoF,SAASrC,SAEdxC,GAAakB,QAAQzB,KAAKoF,SAAUoB,IACpCxG,KAAKuF,SACP,CAGAM,uBAAuBxB,GACrB,OAAOrE,KAAK4G,MAAK,WACf,MAAM9b,EAAO2b,GAAMJ,oBAAoBrG,MAEvC,GAAsB,iBAAXqE,EAAX,CAIA,QAAqB7K,IAAjB1O,EAAKuZ,IAAyBA,EAAOlK,WAAW,MAAmB,gBAAXkK,EAC1D,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,GAAQrE,KANb,CAOF,GACF,EAQFgG,GAAqBS,GAAO,SAK5BpK,GAAmBoK,IAYnB,MAKMI,GAAyB,4BAM/B,MAAMC,WAAe5B,GAERzI,kBACT,MAdW,QAeb,CAGAsK,SAEE/G,KAAKoF,SAASvjB,aAAa,eAAgBme,KAAKoF,SAAS5J,UAAUuL,OAhB3C,UAiB1B,CAGAlB,uBAAuBxB,GACrB,OAAOrE,KAAK4G,MAAK,WACf,MAAM9b,EAAOgc,GAAOT,oBAAoBrG,MAEzB,WAAXqE,GACFvZ,EAAKuZ,IAET,GACF,EAQF9D,GAAaY,GAAGrb,SAlCe,2BAkCmB+gB,IAAwBzH,IACxEA,EAAM+C,iBACN,MAAM6E,EAAS5H,EAAMpS,OAAOmO,QAAQ0L,IACvBC,GAAOT,oBAAoBW,GACnCD,QAAQ,IAMf1K,GAAmByK,IAYnB,MAAMG,GAAiB,CACrBrU,KAAI,CAACmH,EAAU/Z,EAAU8F,SAASC,kBACzB,GAAG3G,UAAUsB,QAAQ3C,UAAUqiB,iBAAiBniB,KAAK+B,EAAS+Z,IAGvEmN,QAAO,CAACnN,EAAU/Z,EAAU8F,SAASC,kBAC5BrF,QAAQ3C,UAAU8K,cAAc5K,KAAK+B,EAAS+Z,GAGvDoN,SAAQ,CAACnnB,EAAS+Z,IACT,GAAG3a,UAAUY,EAAQmnB,UAAUvgB,QAAOzB,GAASA,EAAMiiB,QAAQrN,KAGtEsN,QAAQrnB,EAAS+Z,GACf,MAAMsN,EAAU,GAChB,IAAIC,EAAWtnB,EAAQwF,WAAW2V,QAAQpB,GAE1C,KAAOuN,GACLD,EAAQhV,KAAKiV,GACbA,EAAWA,EAAS9hB,WAAW2V,QAAQpB,GAGzC,OAAOsN,CACT,EAEAE,KAAKvnB,EAAS+Z,GACZ,IAAIyN,EAAWxnB,EAAQynB,uBAEvB,KAAOD,GAAU,CACf,GAAIA,EAASJ,QAAQrN,GACnB,MAAO,CAACyN,GAGVA,EAAWA,EAASC,sBACtB,CAEA,MAAO,EACT,EAGAniB,KAAKtF,EAAS+Z,GACZ,IAAIzU,EAAOtF,EAAQ0nB,mBAEnB,KAAOpiB,GAAM,CACX,GAAIA,EAAK8hB,QAAQrN,GACf,MAAO,CAACzU,GAGVA,EAAOA,EAAKoiB,kBACd,CAEA,MAAO,EACT,EAEAC,kBAAkB3nB,GAChB,MAAM4nB,EAAa,CAAC,IAAK,SAAU,QAAS,WAAY,SAAU,UAAW,aAAc,4BAA4BrkB,KAAIwW,GAAY,GAAGA,2BAAiCpW,KAAK,KAChL,OAAOqc,KAAKpN,KAAKgV,EAAY5nB,GAAS4G,QAAOihB,IAAOxM,GAAWwM,IAAO/M,GAAU+M,IAClF,GAeIC,GAAc,YACdC,GAAmB,aAAaD,KAChCE,GAAkB,YAAYF,KAC9BG,GAAiB,WAAWH,KAC5BI,GAAoB,cAAcJ,KAClCK,GAAkB,YAAYL,KAK9BM,GAAY,CAChBC,YAAa,KACbC,aAAc,KACdC,cAAe,MAEXC,GAAgB,CACpBH,YAAa,kBACbC,aAAc,kBACdC,cAAe,mBAMjB,MAAME,WAAczE,GAClBU,YAAY1kB,EAASqkB,GACnBc,QACAnF,KAAKoF,SAAWplB,EAEXA,GAAYyoB,GAAMC,gBAIvB1I,KAAKqF,QAAUrF,KAAKoE,WAAWC,GAC/BrE,KAAK2I,QAAU,EACf3I,KAAK4I,sBAAwB9H,QAAQzgB,OAAOwoB,cAE5C7I,KAAK8I,cACP,CAGW7E,qBACT,OAAOmE,EACT,CAEWlE,yBACT,OAAOsE,EACT,CAEW/L,kBACT,MAnDW,OAoDb,CAGA8I,UACEhF,GAAaC,IAAIR,KAAKoF,SAAU0C,GAClC,CAGAiB,OAAO3J,GACAY,KAAK4I,sBAKN5I,KAAKgJ,wBAAwB5J,KAC/BY,KAAK2I,QAAUvJ,EAAM6J,SALrBjJ,KAAK2I,QAAUvJ,EAAM8J,QAAQ,GAAGD,OAOpC,CAEAE,KAAK/J,GACCY,KAAKgJ,wBAAwB5J,KAC/BY,KAAK2I,QAAUvJ,EAAM6J,QAAUjJ,KAAK2I,SAGtC3I,KAAKoJ,eAELrM,GAAQiD,KAAKqF,QAAQgD,YACvB,CAEAgB,MAAMjK,GACJY,KAAK2I,QAAUvJ,EAAM8J,SAAW9J,EAAM8J,QAAQ/X,OAAS,EAAI,EAAIiO,EAAM8J,QAAQ,GAAGD,QAAUjJ,KAAK2I,OACjG,CAEAS,eACE,MAAME,EAAY1mB,KAAKoC,IAAIgb,KAAK2I,SAEhC,GAAIW,GA9EgB,GA+ElB,OAGF,MAAMvb,EAAYub,EAAYtJ,KAAK2I,QACnC3I,KAAK2I,QAAU,EAEV5a,GAILgP,GAAQhP,EAAY,EAAIiS,KAAKqF,QAAQkD,cAAgBvI,KAAKqF,QAAQiD,aACpE,CAEAQ,cACM9I,KAAK4I,uBACPrI,GAAaY,GAAGnB,KAAKoF,SAAU8C,IAAmB9I,GAASY,KAAK+I,OAAO3J,KACvEmB,GAAaY,GAAGnB,KAAKoF,SAAU+C,IAAiB/I,GAASY,KAAKmJ,KAAK/J,KAEnEY,KAAKoF,SAAS5J,UAAUtE,IAlGG,mBAoG3BqJ,GAAaY,GAAGnB,KAAKoF,SAAU2C,IAAkB3I,GAASY,KAAK+I,OAAO3J,KACtEmB,GAAaY,GAAGnB,KAAKoF,SAAU4C,IAAiB5I,GAASY,KAAKqJ,MAAMjK,KACpEmB,GAAaY,GAAGnB,KAAKoF,SAAU6C,IAAgB7I,GAASY,KAAKmJ,KAAK/J,KAEtE,CAEA4J,wBAAwB5J,GACtB,OAAOY,KAAK4I,wBA5GS,QA4GiBxJ,EAAMmK,aA7GrB,UA6GyDnK,EAAMmK,YACxF,CAGA1D,qBACE,MAAO,iBAAkB/f,SAASC,iBAAmB7C,UAAUsmB,eAAiB,CAClF,EAcF,MAEMC,GAAc,eACdC,GAAiB,YAKjBC,GAAa,OACbC,GAAa,OACbC,GAAiB,OACjBC,GAAkB,QAClBC,GAAc,QAAQN,KACtBO,GAAa,OAAOP,KACpBQ,GAAkB,UAAUR,KAC5BS,GAAqB,aAAaT,KAClCU,GAAqB,aAAaV,KAClCW,GAAmB,YAAYX,KAC/BY,GAAwB,OAAOZ,KAAcC,KAC7CY,GAAyB,QAAQb,KAAcC,KAC/Ca,GAAsB,WACtBC,GAAsB,SAMtBC,GAAkB,UAClBC,GAAgB,iBAChBC,GAAuBF,GAAkBC,GAKzCE,GAAmB,CACvB,UAAoBd,GACpB,WAAqBD,IAEjBgB,GAAY,CAChBC,SAAU,IACVC,UAAU,EACVC,MAAO,QACPC,MAAM,EACNC,OAAO,EACPC,MAAM,GAEFC,GAAgB,CACpBN,SAAU,mBAEVC,SAAU,UACVC,MAAO,mBACPC,KAAM,mBACNC,MAAO,UACPC,KAAM,WAMR,MAAME,WAAiBnG,GACrBR,YAAY1kB,EAASqkB,GACnBc,MAAMnlB,EAASqkB,GACfrE,KAAKsL,UAAY,KACjBtL,KAAKuL,eAAiB,KACtBvL,KAAKwL,YAAa,EAClBxL,KAAKyL,aAAe,KACpBzL,KAAK0L,aAAe,KACpB1L,KAAK2L,mBAAqB1E,GAAeC,QApCjB,uBAoC8ClH,KAAKoF,UAE3EpF,KAAK4L,qBAED5L,KAAKqF,QAAQ4F,OAASV,IACxBvK,KAAK6L,OAET,CAGW5H,qBACT,OAAO4G,EACT,CAEW3G,yBACT,OAAOkH,EACT,CAEW3O,kBACT,MAtFW,UAuFb,CAGAnX,OACE0a,KAAK8L,OAAOnC,GACd,CAEAoC,mBAIOjmB,SAASkmB,QAAUlR,GAAUkF,KAAKoF,WACrCpF,KAAK1a,MAET,CAEAiiB,OACEvH,KAAK8L,OAAOlC,GACd,CAEAoB,QACMhL,KAAKwL,YACPjR,GAAqByF,KAAKoF,UAG5BpF,KAAKiM,gBACP,CAEAJ,QACE7L,KAAKiM,iBAELjM,KAAKkM,kBAELlM,KAAKsL,UAAYa,aAAY,IAAMnM,KAAK+L,mBAAmB/L,KAAKqF,QAAQyF,SAC1E,CAEAsB,oBACOpM,KAAKqF,QAAQ4F,OAIdjL,KAAKwL,WACPjL,GAAaa,IAAIpB,KAAKoF,SAAU4E,IAAY,IAAMhK,KAAK6L,UAIzD7L,KAAK6L,QACP,CAEAQ,GAAGnT,GACD,MAAMoT,EAAQtM,KAAKuM,YAEnB,GAAIrT,EAAQoT,EAAMnb,OAAS,GAAK+H,EAAQ,EACtC,OAGF,GAAI8G,KAAKwL,WAEP,YADAjL,GAAaa,IAAIpB,KAAKoF,SAAU4E,IAAY,IAAMhK,KAAKqM,GAAGnT,KAI5D,MAAMsT,EAAcxM,KAAKyM,cAAczM,KAAK0M,cAE5C,GAAIF,IAAgBtT,EAClB,OAGF,MAAMtC,EAAQsC,EAAQsT,EAAc7C,GAAaC,GAEjD5J,KAAK8L,OAAOlV,EAAO0V,EAAMpT,GAC3B,CAEAqM,UACMvF,KAAK0L,cACP1L,KAAK0L,aAAanG,UAGpBJ,MAAMI,SACR,CAGAhB,kBAAkBF,GAEhB,OADAA,EAAOsI,gBAAkBtI,EAAOyG,SACzBzG,CACT,CAEAuH,qBACM5L,KAAKqF,QAAQ0F,UACfxK,GAAaY,GAAGnB,KAAKoF,SAAU6E,IAAiB7K,GAASY,KAAK4M,SAASxN,KAG9C,UAAvBY,KAAKqF,QAAQ2F,QACfzK,GAAaY,GAAGnB,KAAKoF,SAAU8E,IAAoB,IAAMlK,KAAKgL,UAC9DzK,GAAaY,GAAGnB,KAAKoF,SAAU+E,IAAoB,IAAMnK,KAAKoM,uBAG5DpM,KAAKqF,QAAQ6F,OAASzC,GAAMC,eAC9B1I,KAAK6M,yBAET,CAEAA,0BACE,IAAK,MAAMC,KAAO7F,GAAerU,KA/JX,qBA+JmCoN,KAAKoF,UAC5D7E,GAAaY,GAAG2L,EAAK1C,IAAkBhL,GAASA,EAAM+C,mBAGxD,MAqBM4K,EAAc,CAClBzE,aAAc,IAAMtI,KAAK8L,OAAO9L,KAAKgN,kBAAkBnD,KACvDtB,cAAe,IAAMvI,KAAK8L,OAAO9L,KAAKgN,kBAAkBlD,KACxDzB,YAxBkB,KACS,UAAvBrI,KAAKqF,QAAQ2F,QAWjBhL,KAAKgL,QAEDhL,KAAKyL,cACPwB,aAAajN,KAAKyL,cAGpBzL,KAAKyL,aAAe5N,YAAW,IAAMmC,KAAKoM,qBA7MjB,IA6M+DpM,KAAKqF,QAAQyF,UAAS,GAQhH9K,KAAK0L,aAAe,IAAIjD,GAAMzI,KAAKoF,SAAU2H,EAC/C,CAEAH,SAASxN,GACP,GAAI,kBAAkBtb,KAAKsb,EAAMpS,OAAOoZ,SACtC,OAGF,MAAMrY,EAAY6c,GAAiBxL,EAAM7hB,KAErCwQ,IACFqR,EAAM+C,iBAENnC,KAAK8L,OAAO9L,KAAKgN,kBAAkBjf,IAEvC,CAEA0e,cAAczsB,GACZ,OAAOggB,KAAKuM,YAAY3mB,QAAQ5F,EAClC,CAEAktB,2BAA2BhU,GACzB,IAAK8G,KAAK2L,mBACR,OAGF,MAAMwB,EAAkBlG,GAAeC,QAAQuD,GAAiBzK,KAAK2L,oBACrEwB,EAAgB3R,UAAUuH,OAAOyH,IACjC2C,EAAgBvrB,gBAAgB,gBAChC,MAAMwrB,EAAqBnG,GAAeC,QAAQ,sBAAsBhO,MAAW8G,KAAK2L,oBAEpFyB,IACFA,EAAmB5R,UAAUtE,IAAIsT,IACjC4C,EAAmBvrB,aAAa,eAAgB,QAEpD,CAEAqqB,kBACE,MAAMlsB,EAAUggB,KAAKuL,gBAAkBvL,KAAK0M,aAE5C,IAAK1sB,EACH,OAGF,MAAMqtB,EAAkB9P,OAAO+P,SAASttB,EAAQga,aAAa,oBAAqB,IAClFgG,KAAKqF,QAAQyF,SAAWuC,GAAmBrN,KAAKqF,QAAQsH,eAC1D,CAEAb,OAAOlV,EAAO5W,EAAU,MACtB,GAAIggB,KAAKwL,WACP,OAGF,MAAMzN,EAAgBiC,KAAK0M,aAErBa,EAAS3W,IAAU+S,GACnB6D,EAAcxtB,GAAW8d,GAAqBkC,KAAKuM,YAAaxO,EAAewP,EAAQvN,KAAKqF,QAAQ8F,MAE1G,GAAIqC,IAAgBzP,EAClB,OAGF,MAAM0P,EAAmBzN,KAAKyM,cAAce,GAEtCE,EAAeC,GACZpN,GAAakB,QAAQzB,KAAKoF,SAAUuI,EAAW,CACpD7N,cAAe0N,EACfzf,UAAWiS,KAAK4N,kBAAkBhX,GAClCkM,KAAM9C,KAAKyM,cAAc1O,GACzBsO,GAAIoB,IAMR,GAFmBC,EAAa3D,IAEjBlI,iBACb,OAGF,IAAK9D,IAAkByP,EAGrB,OAGF,MAAMK,EAAY/M,QAAQd,KAAKsL,WAC/BtL,KAAKgL,QACLhL,KAAKwL,YAAa,EAElBxL,KAAKkN,2BAA2BO,GAEhCzN,KAAKuL,eAAiBiC,EACtB,MAAMM,EAAuBP,EA/RR,sBADF,oBAiSbQ,EAAiBR,EA/RH,qBACA,qBA+RpBC,EAAYhS,UAAUtE,IAAI6W,GAC1BhS,GAAOyR,GACPzP,EAAcvC,UAAUtE,IAAI4W,GAC5BN,EAAYhS,UAAUtE,IAAI4W,GAU1B9N,KAAK2F,gBARoB,KACvB6H,EAAYhS,UAAUuH,OAAO+K,EAAsBC,GACnDP,EAAYhS,UAAUtE,IAAIsT,IAC1BzM,EAAcvC,UAAUuH,OAAOyH,GAAqBuD,EAAgBD,GACpE9N,KAAKwL,YAAa,EAClBkC,EAAa1D,GAAW,GAGYjM,EAAeiC,KAAKgO,eAEtDH,GACF7N,KAAK6L,OAET,CAEAmC,cACE,OAAOhO,KAAKoF,SAAS5J,UAAUvW,SAxTV,QAyTvB,CAEAynB,aACE,OAAOzF,GAAeC,QAAQyD,GAAsB3K,KAAKoF,SAC3D,CAEAmH,YACE,OAAOtF,GAAerU,KAAK8X,GAAe1K,KAAKoF,SACjD,CAEA6G,iBACMjM,KAAKsL,YACP2C,cAAcjO,KAAKsL,WACnBtL,KAAKsL,UAAY,KAErB,CAEA0B,kBAAkBjf,GAChB,OAAIoO,KACKpO,IAAc8b,GAAiBD,GAAaD,GAG9C5b,IAAc8b,GAAiBF,GAAaC,EACrD,CAEAgE,kBAAkBhX,GAChB,OAAIuF,KACKvF,IAAUgT,GAAaC,GAAiBC,GAG1ClT,IAAUgT,GAAaE,GAAkBD,EAClD,CAGAhE,uBAAuBxB,GACrB,OAAOrE,KAAK4G,MAAK,WACf,MAAM9b,EAAOugB,GAAShF,oBAAoBrG,KAAMqE,GAEhD,GAAsB,iBAAXA,GAKX,GAAsB,iBAAXA,EAAqB,CAC9B,QAAqB7K,IAAjB1O,EAAKuZ,IAAyBA,EAAOlK,WAAW,MAAmB,gBAAXkK,EAC1D,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,IACP,OAVEvZ,EAAKuhB,GAAGhI,EAWZ,GACF,EAQF9D,GAAaY,GAAGrb,SAAUwkB,GA1WE,uCA0W2C,SAAUlL,GAC/E,MAAMpS,EAASsN,GAAuB0F,MAEtC,IAAKhT,IAAWA,EAAOwO,UAAUvW,SAASslB,IACxC,OAGFnL,EAAM+C,iBACN,MAAM+L,EAAW7C,GAAShF,oBAAoBrZ,GACxCmhB,EAAanO,KAAKhG,aAAa,oBAErC,OAAImU,GACFD,EAAS7B,GAAG8B,QAEZD,EAAS9B,qBAKyC,SAAhD7I,GAAYQ,iBAAiB/D,KAAM,UACrCkO,EAAS5oB,YAET4oB,EAAS9B,sBAKX8B,EAAS3G,YAET2G,EAAS9B,oBACX,IACA7L,GAAaY,GAAG9gB,OAAQgqB,IAAuB,KAC7C,MAAM+D,EAAYnH,GAAerU,KAzYR,6BA2YzB,IAAK,MAAMsb,KAAYE,EACrB/C,GAAShF,oBAAoB6H,EAC/B,IAMF7R,GAAmBgP,IAYnB,MAEMgD,GAAc,eAEdC,GAAe,OAAOD,KACtBE,GAAgB,QAAQF,KACxBG,GAAe,OAAOH,KACtBI,GAAiB,SAASJ,KAC1BK,GAAyB,QAAQL,cACjCM,GAAoB,OACpBC,GAAsB,WACtBC,GAAwB,aAExBC,GAA6B,WAAWF,OAAwBA,KAKhEG,GAAyB,8BACzBC,GAAY,CAChB9pB,OAAQ,KACR6hB,QAAQ,GAEJkI,GAAgB,CACpB/pB,OAAQ,iBACR6hB,OAAQ,WAMV,MAAMmI,WAAiBhK,GACrBR,YAAY1kB,EAASqkB,GACnBc,MAAMnlB,EAASqkB,GACfrE,KAAKmP,kBAAmB,EACxBnP,KAAKoP,cAAgB,GACrB,MAAMC,EAAapI,GAAerU,KAAKmc,IAEvC,IAAK,MAAMO,KAAQD,EAAY,CAC7B,MAAMtV,EAAWM,GAAuBiV,GAClCC,EAAgBtI,GAAerU,KAAKmH,GAAUnT,QAAO4oB,GAAgBA,IAAiBxP,KAAKoF,WAEhF,OAAbrL,GAAqBwV,EAAcpe,QACrC6O,KAAKoP,cAAc/c,KAAKid,EAE5B,CAEAtP,KAAKyP,sBAEAzP,KAAKqF,QAAQngB,QAChB8a,KAAK0P,0BAA0B1P,KAAKoP,cAAepP,KAAK2P,YAGtD3P,KAAKqF,QAAQ0B,QACf/G,KAAK+G,QAET,CAGW9C,qBACT,OAAO+K,EACT,CAEW9K,yBACT,OAAO+K,EACT,CAEWxS,kBACT,MApEW,UAqEb,CAGAsK,SACM/G,KAAK2P,WACP3P,KAAK4P,OAEL5P,KAAK6P,MAET,CAEAA,OACE,GAAI7P,KAAKmP,kBAAoBnP,KAAK2P,WAChC,OAGF,IAAIG,EAAiB,GAQrB,GANI9P,KAAKqF,QAAQngB,SACf4qB,EAAiB9P,KAAK+P,uBAvEH,wCAuE4CnpB,QAAO5G,GAAWA,IAAYggB,KAAKoF,WAAU7hB,KAAIvD,GAAWkvB,GAAS7I,oBAAoBrmB,EAAS,CAC/J+mB,QAAQ,OAIR+I,EAAe3e,QAAU2e,EAAe,GAAGX,iBAC7C,OAKF,GAFmB5O,GAAakB,QAAQzB,KAAKoF,SAAUkJ,IAExCzM,iBACb,OAGF,IAAK,MAAMmO,KAAkBF,EAC3BE,EAAeJ,OAGjB,MAAMK,EAAYjQ,KAAKkQ,gBAEvBlQ,KAAKoF,SAAS5J,UAAUuH,OAAO6L,IAE/B5O,KAAKoF,SAAS5J,UAAUtE,IAAI2X,IAE5B7O,KAAKoF,SAAS5jB,MAAMyuB,GAAa,EAEjCjQ,KAAK0P,0BAA0B1P,KAAKoP,eAAe,GAEnDpP,KAAKmP,kBAAmB,EAExB,MAYMgB,EAAa,SADUF,EAAU,GAAGhL,cAAgBgL,EAAUpd,MAAM,KAG1EmN,KAAK2F,gBAdY,KACf3F,KAAKmP,kBAAmB,EAExBnP,KAAKoF,SAAS5J,UAAUuH,OAAO8L,IAE/B7O,KAAKoF,SAAS5J,UAAUtE,IAAI0X,GAAqBD,IAEjD3O,KAAKoF,SAAS5jB,MAAMyuB,GAAa,GACjC1P,GAAakB,QAAQzB,KAAKoF,SAAUmJ,GAAc,GAMtBvO,KAAKoF,UAAU,GAE7CpF,KAAKoF,SAAS5jB,MAAMyuB,GAAa,GAAGjQ,KAAKoF,SAAS+K,MACpD,CAEAP,OACE,GAAI5P,KAAKmP,mBAAqBnP,KAAK2P,WACjC,OAKF,GAFmBpP,GAAakB,QAAQzB,KAAKoF,SAAUoJ,IAExC3M,iBACb,OAGF,MAAMoO,EAAYjQ,KAAKkQ,gBAEvBlQ,KAAKoF,SAAS5jB,MAAMyuB,GAAa,GAAGjQ,KAAKoF,SAASrhB,wBAAwBksB,OAC1ElU,GAAOiE,KAAKoF,UAEZpF,KAAKoF,SAAS5J,UAAUtE,IAAI2X,IAE5B7O,KAAKoF,SAAS5J,UAAUuH,OAAO6L,GAAqBD,IAEpD,IAAK,MAAMlN,KAAWzB,KAAKoP,cAAe,CACxC,MAAMpvB,EAAUsa,GAAuBmH,GAEnCzhB,IAAYggB,KAAK2P,SAAS3vB,IAC5BggB,KAAK0P,0BAA0B,CAACjO,IAAU,EAE9C,CAEAzB,KAAKmP,kBAAmB,EAYxBnP,KAAKoF,SAAS5jB,MAAMyuB,GAAa,GAEjCjQ,KAAK2F,gBAZY,KACf3F,KAAKmP,kBAAmB,EAExBnP,KAAKoF,SAAS5J,UAAUuH,OAAO8L,IAE/B7O,KAAKoF,SAAS5J,UAAUtE,IAAI0X,IAE5BrO,GAAakB,QAAQzB,KAAKoF,SAAUqJ,GAAe,GAKvBzO,KAAKoF,UAAU,EAC/C,CAEAuK,SAAS3vB,EAAUggB,KAAKoF,UACtB,OAAOplB,EAAQwb,UAAUvW,SAAS0pB,GACpC,CAGApK,kBAAkBF,GAIhB,OAHAA,EAAO0C,OAASjG,QAAQuD,EAAO0C,QAE/B1C,EAAOnf,OAAS2V,GAAWwJ,EAAOnf,QAC3Bmf,CACT,CAEA6L,gBACE,OAAOlQ,KAAKoF,SAAS5J,UAAUvW,SAtLL,uBAChB,QACC,QAqLb,CAEAwqB,sBACE,IAAKzP,KAAKqF,QAAQngB,OAChB,OAGF,MAAMiiB,EAAWnH,KAAK+P,uBAAuBhB,IAE7C,IAAK,MAAM/uB,KAAWmnB,EAAU,CAC9B,MAAMiJ,EAAW9V,GAAuBta,GAEpCowB,GACFpQ,KAAK0P,0BAA0B,CAAC1vB,GAAUggB,KAAK2P,SAASS,GAE5D,CACF,CAEAL,uBAAuBhW,GACrB,MAAMoN,EAAWF,GAAerU,KAAKkc,GAA4B9O,KAAKqF,QAAQngB,QAE9E,OAAO+hB,GAAerU,KAAKmH,EAAUiG,KAAKqF,QAAQngB,QAAQ0B,QAAO5G,IAAYmnB,EAASjN,SAASla,IACjG,CAEA0vB,0BAA0BW,EAAcC,GACtC,GAAKD,EAAalf,OAIlB,IAAK,MAAMnR,KAAWqwB,EACpBrwB,EAAQwb,UAAUuL,OAvNK,aAuNyBuJ,GAChDtwB,EAAQ6B,aAAa,gBAAiByuB,EAE1C,CAGAzK,uBAAuBxB,GACrB,MAAMgB,EAAU,CAAC,EAMjB,MAJsB,iBAAXhB,GAAuB,YAAYvgB,KAAKugB,KACjDgB,EAAQ0B,QAAS,GAGZ/G,KAAK4G,MAAK,WACf,MAAM9b,EAAOokB,GAAS7I,oBAAoBrG,KAAMqF,GAEhD,GAAsB,iBAAXhB,EAAqB,CAC9B,QAA4B,IAAjBvZ,EAAKuZ,GACd,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,IACP,CACF,GACF,EAQF9D,GAAaY,GAAGrb,SAAU4oB,GAAwBK,IAAwB,SAAU3P,IAErD,MAAzBA,EAAMpS,OAAOoZ,SAAmBhH,EAAMW,gBAAmD,MAAjCX,EAAMW,eAAeqG,UAC/EhH,EAAM+C,iBAGR,MAAMpI,EAAWM,GAAuB2F,MAClCuQ,EAAmBtJ,GAAerU,KAAKmH,GAE7C,IAAK,MAAM/Z,KAAWuwB,EACpBrB,GAAS7I,oBAAoBrmB,EAAS,CACpC+mB,QAAQ,IACPA,QAEP,IAKA1K,GAAmB6S,IAYnB,MAAMsB,GAAS,WAETC,GAAc,eACdC,GAAiB,YAGjBC,GAAiB,UACjBC,GAAmB,YAGnBC,GAAe,OAAOJ,KACtBK,GAAiB,SAASL,KAC1BM,GAAe,OAAON,KACtBO,GAAgB,QAAQP,KACxBQ,GAAyB,QAAQR,KAAcC,KAC/CQ,GAAyB,UAAUT,KAAcC,KACjDS,GAAuB,QAAQV,KAAcC,KAC7CU,GAAoB,OAMpBC,GAAyB,4DACzBC,GAA6B,GAAGD,MAA0BD,KAC1DG,GAAgB,iBAIhBC,GAAgBrV,KAAU,UAAY,YACtCsV,GAAmBtV,KAAU,YAAc,UAC3CuV,GAAmBvV,KAAU,aAAe,eAC5CwV,GAAsBxV,KAAU,eAAiB,aACjDyV,GAAkBzV,KAAU,aAAe,cAC3C0V,GAAiB1V,KAAU,cAAgB,aAG3C2V,GAAY,CAChBC,WAAW,EACXrjB,SAAU,kBACVsjB,QAAS,UACTvpB,OAAQ,CAAC,EAAG,GACZwpB,aAAc,KACdlzB,UAAW,UAEPmzB,GAAgB,CACpBH,UAAW,mBACXrjB,SAAU,mBACVsjB,QAAS,SACTvpB,OAAQ,0BACRwpB,aAAc,yBACdlzB,UAAW,2BAMb,MAAMozB,WAAiBjN,GACrBR,YAAY1kB,EAASqkB,GACnBc,MAAMnlB,EAASqkB,GACfrE,KAAKoS,QAAU,KACfpS,KAAKqS,QAAUrS,KAAKoF,SAAS5f,WAG7Bwa,KAAKsS,MAAQrL,GAAe3hB,KAAK0a,KAAKoF,SAAUmM,IAAe,IAAMtK,GAAeM,KAAKvH,KAAKoF,SAAUmM,IAAe,IAAMtK,GAAeC,QAAQqK,GAAevR,KAAKqS,SACxKrS,KAAKuS,UAAYvS,KAAKwS,eACxB,CAGWvO,qBACT,OAAO6N,EACT,CAEW5N,yBACT,OAAOgO,EACT,CAEWzV,kBACT,OAAO+T,EACT,CAGAzJ,SACE,OAAO/G,KAAK2P,WAAa3P,KAAK4P,OAAS5P,KAAK6P,MAC9C,CAEAA,OACE,GAAIxU,GAAW2E,KAAKoF,WAAapF,KAAK2P,WACpC,OAGF,MAAM7P,EAAgB,CACpBA,cAAeE,KAAKoF,UAItB,IAFkB7E,GAAakB,QAAQzB,KAAKoF,SAAU2L,GAAcjR,GAEtD+B,iBAAd,CAUA,GANA7B,KAAKyS,gBAMD,iBAAkB3sB,SAASC,kBAAoBia,KAAKqS,QAAQlX,QA/ExC,eAgFtB,IAAK,MAAMnb,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAKwa,UAC/C5G,GAAaY,GAAGnhB,EAAS,YAAa8b,IAI1CkE,KAAKoF,SAASsN,QAEd1S,KAAKoF,SAASvjB,aAAa,iBAAiB,GAE5Cme,KAAKsS,MAAM9W,UAAUtE,IAAIka,IAEzBpR,KAAKoF,SAAS5J,UAAUtE,IAAIka,IAE5B7Q,GAAakB,QAAQzB,KAAKoF,SAAU4L,GAAelR,EAtBnD,CAuBF,CAEA8P,OACE,GAAIvU,GAAW2E,KAAKoF,YAAcpF,KAAK2P,WACrC,OAGF,MAAM7P,EAAgB,CACpBA,cAAeE,KAAKoF,UAGtBpF,KAAK2S,cAAc7S,EACrB,CAEAyF,UACMvF,KAAKoS,SACPpS,KAAKoS,QAAQ3Y,UAGf0L,MAAMI,SACR,CAEA/Z,SACEwU,KAAKuS,UAAYvS,KAAKwS,gBAElBxS,KAAKoS,SACPpS,KAAKoS,QAAQ5mB,QAEjB,CAGAmnB,cAAc7S,GAGZ,IAFkBS,GAAakB,QAAQzB,KAAKoF,SAAUyL,GAAc/Q,GAEtD+B,iBAAd,CAMA,GAAI,iBAAkB/b,SAASC,gBAC7B,IAAK,MAAM/F,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAKwa,UAC/C5G,GAAaC,IAAIxgB,EAAS,YAAa8b,IAIvCkE,KAAKoS,SACPpS,KAAKoS,QAAQ3Y,UAGfuG,KAAKsS,MAAM9W,UAAUuH,OAAOqO,IAE5BpR,KAAKoF,SAAS5J,UAAUuH,OAAOqO,IAE/BpR,KAAKoF,SAASvjB,aAAa,gBAAiB,SAE5C0hB,GAAYE,oBAAoBzD,KAAKsS,MAAO,UAC5C/R,GAAakB,QAAQzB,KAAKoF,SAAU0L,GAAgBhR,EArBpD,CAsBF,CAEAsE,WAAWC,GAGT,GAAgC,iBAFhCA,EAASc,MAAMf,WAAWC,IAERtlB,YAA2B,GAAUslB,EAAOtlB,YAAgE,mBAA3CslB,EAAOtlB,UAAUgF,sBAElG,MAAM,IAAIihB,UAAU,GAAGwL,GAAOvL,+GAGhC,OAAOZ,CACT,CAEAoO,gBACE,QAAsB,IAAX,EACT,MAAM,IAAIzN,UAAU,gEAGtB,IAAI4N,EAAmB5S,KAAKoF,SAEG,WAA3BpF,KAAKqF,QAAQtmB,UACf6zB,EAAmB5S,KAAKqS,QACf,GAAUrS,KAAKqF,QAAQtmB,WAChC6zB,EAAmB/X,GAAWmF,KAAKqF,QAAQtmB,WACA,iBAA3BihB,KAAKqF,QAAQtmB,YAC7B6zB,EAAmB5S,KAAKqF,QAAQtmB,WAGlC,MAAMkzB,EAAejS,KAAK6S,mBAE1B7S,KAAKoS,QAAU,GAAoBQ,EAAkB5S,KAAKsS,MAAOL,EACnE,CAEAtC,WACE,OAAO3P,KAAKsS,MAAM9W,UAAUvW,SAASmsB,GACvC,CAEA0B,gBACE,MAAMC,EAAiB/S,KAAKqS,QAE5B,GAAIU,EAAevX,UAAUvW,SAxMN,WAyMrB,OAAO2sB,GAGT,GAAImB,EAAevX,UAAUvW,SA3MJ,aA4MvB,OAAO4sB,GAGT,GAAIkB,EAAevX,UAAUvW,SA9MA,iBA+M3B,MAjMsB,MAoMxB,GAAI8tB,EAAevX,UAAUvW,SAjNE,mBAkN7B,MApMyB,SAwM3B,MAAM+tB,EAAkF,QAA1EttB,iBAAiBsa,KAAKsS,OAAOrX,iBAAiB,iBAAiBb,OAE7E,OAAI2Y,EAAevX,UAAUvW,SA5NP,UA6Nb+tB,EAAQvB,GAAmBD,GAG7BwB,EAAQrB,GAAsBD,EACvC,CAEAc,gBACE,OAAkD,OAA3CxS,KAAKoF,SAASjK,QA5ND,UA6NtB,CAEA8X,aACE,MAAM,OACJxqB,GACEuX,KAAKqF,QAET,MAAsB,iBAAX5c,EACFA,EAAO9F,MAAM,KAAKY,KAAInF,GAASmf,OAAO+P,SAASlvB,EAAO,MAGzC,mBAAXqK,EACFyqB,GAAczqB,EAAOyqB,EAAYlT,KAAKoF,UAGxC3c,CACT,CAEAoqB,mBACE,MAAMM,EAAwB,CAC5Bh0B,UAAW6gB,KAAK8S,gBAChBjc,UAAW,CAAC,CACV9V,KAAM,kBACNmB,QAAS,CACPwM,SAAUsR,KAAKqF,QAAQ3W,WAExB,CACD3N,KAAM,SACNmB,QAAS,CACPuG,OAAQuX,KAAKiT,iBAcnB,OATIjT,KAAKuS,WAAsC,WAAzBvS,KAAKqF,QAAQ2M,WACjCzO,GAAYC,iBAAiBxD,KAAKsS,MAAO,SAAU,UAEnDa,EAAsBtc,UAAY,CAAC,CACjC9V,KAAM,cACNC,SAAS,KAIN,IAAKmyB,KAC+B,mBAA9BnT,KAAKqF,QAAQ4M,aAA8BjS,KAAKqF,QAAQ4M,aAAakB,GAAyBnT,KAAKqF,QAAQ4M,aAE1H,CAEAmB,iBAAgB,IACd71B,EAAG,OACHyP,IAEA,MAAMsf,EAAQrF,GAAerU,KA/QF,8DA+Q+BoN,KAAKsS,OAAO1rB,QAAO5G,GAAW8a,GAAU9a,KAE7FssB,EAAMnb,QAMX2M,GAAqBwO,EAAOtf,EAAQzP,IAAQqzB,IAAmBtE,EAAMpS,SAASlN,IAAS0lB,OACzF,CAGA7M,uBAAuBxB,GACrB,OAAOrE,KAAK4G,MAAK,WACf,MAAM9b,EAAOqnB,GAAS9L,oBAAoBrG,KAAMqE,GAEhD,GAAsB,iBAAXA,EAAX,CAIA,QAA4B,IAAjBvZ,EAAKuZ,GACd,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,IANL,CAOF,GACF,CAEAwB,kBAAkBzG,GAChB,GAhUuB,IAgUnBA,EAAM4H,QAAgD,UAAf5H,EAAMqB,MAnUnC,QAmUuDrB,EAAM7hB,IACzE,OAGF,MAAM81B,EAAcpM,GAAerU,KAAK0e,IAExC,IAAK,MAAMvK,KAAUsM,EAAa,CAChC,MAAMC,EAAUnB,GAASrM,YAAYiB,GAErC,IAAKuM,IAAyC,IAA9BA,EAAQjO,QAAQ0M,UAC9B,SAGF,MAAMwB,EAAenU,EAAMmU,eACrBC,EAAeD,EAAarZ,SAASoZ,EAAQhB,OAEnD,GAAIiB,EAAarZ,SAASoZ,EAAQlO,WAA2C,WAA9BkO,EAAQjO,QAAQ0M,YAA2ByB,GAA8C,YAA9BF,EAAQjO,QAAQ0M,WAA2ByB,EACnJ,SAIF,GAAIF,EAAQhB,MAAMrtB,SAASma,EAAMpS,UAA2B,UAAfoS,EAAMqB,MAxVvC,QAwV2DrB,EAAM7hB,KAAqB,qCAAqCuG,KAAKsb,EAAMpS,OAAOoZ,UACvJ,SAGF,MAAMtG,EAAgB,CACpBA,cAAewT,EAAQlO,UAGN,UAAfhG,EAAMqB,OACRX,EAAcqG,WAAa/G,GAG7BkU,EAAQX,cAAc7S,EACxB,CACF,CAEA+F,6BAA6BzG,GAG3B,MAAMqU,EAAU,kBAAkB3vB,KAAKsb,EAAMpS,OAAOoZ,SAC9CsN,EA7WW,WA6WKtU,EAAM7hB,IACtBo2B,EAAkB,CAAChD,GAAgBC,IAAkB1W,SAASkF,EAAM7hB,KAE1E,IAAKo2B,IAAoBD,EACvB,OAGF,GAAID,IAAYC,EACd,OAGFtU,EAAM+C,iBAEN,MAAMyR,EAAkB5T,KAAKoH,QAAQiK,IAA0BrR,KAAOiH,GAAeM,KAAKvH,KAAMqR,IAAwB,IAAMpK,GAAe3hB,KAAK0a,KAAMqR,IAAwB,IAAMpK,GAAeC,QAAQmK,GAAwBjS,EAAMW,eAAeva,YACpPwF,EAAWmnB,GAAS9L,oBAAoBuN,GAE9C,GAAID,EAMF,OALAvU,EAAMyU,kBACN7oB,EAAS6kB,YAET7kB,EAASooB,gBAAgBhU,GAKvBpU,EAAS2kB,aAEXvQ,EAAMyU,kBACN7oB,EAAS4kB,OACTgE,EAAgBlB,QAEpB,EAQFnS,GAAaY,GAAGrb,SAAUorB,GAAwBG,GAAwBc,GAAS2B,uBACnFvT,GAAaY,GAAGrb,SAAUorB,GAAwBK,GAAeY,GAAS2B,uBAC1EvT,GAAaY,GAAGrb,SAAUmrB,GAAwBkB,GAAS4B,YAC3DxT,GAAaY,GAAGrb,SAAUqrB,GAAsBgB,GAAS4B,YACzDxT,GAAaY,GAAGrb,SAAUmrB,GAAwBI,IAAwB,SAAUjS,GAClFA,EAAM+C,iBACNgQ,GAAS9L,oBAAoBrG,MAAM+G,QACrC,IAKA1K,GAAmB8V,IAYnB,MAAM6B,GAAyB,oDACzBC,GAA0B,cAC1BC,GAAmB,gBACnBC,GAAkB,eAKxB,MAAMC,GACJ1P,cACE1E,KAAKoF,SAAWtf,SAAS6G,IAC3B,CAGA0nB,WAEE,MAAMC,EAAgBxuB,SAASC,gBAAgBuC,YAC/C,OAAO1F,KAAKoC,IAAI3E,OAAOk0B,WAAaD,EACtC,CAEA1E,OACE,MAAMtrB,EAAQ0b,KAAKqU,WAEnBrU,KAAKwU,mBAGLxU,KAAKyU,sBAAsBzU,KAAKoF,SAAU8O,IAAkBQ,GAAmBA,EAAkBpwB,IAGjG0b,KAAKyU,sBAAsBT,GAAwBE,IAAkBQ,GAAmBA,EAAkBpwB,IAE1G0b,KAAKyU,sBAAsBR,GAAyBE,IAAiBO,GAAmBA,EAAkBpwB,GAC5G,CAEAwO,QACEkN,KAAK2U,wBAAwB3U,KAAKoF,SAAU,YAE5CpF,KAAK2U,wBAAwB3U,KAAKoF,SAAU8O,IAE5ClU,KAAK2U,wBAAwBX,GAAwBE,IAErDlU,KAAK2U,wBAAwBV,GAAyBE,GACxD,CAEAS,gBACE,OAAO5U,KAAKqU,WAAa,CAC3B,CAGAG,mBACExU,KAAK6U,sBAAsB7U,KAAKoF,SAAU,YAE1CpF,KAAKoF,SAAS5jB,MAAM+K,SAAW,QACjC,CAEAkoB,sBAAsB1a,EAAU+a,EAAevY,GAC7C,MAAMwY,EAAiB/U,KAAKqU,WAa5BrU,KAAKgV,2BAA2Bjb,GAXH/Z,IAC3B,GAAIA,IAAYggB,KAAKoF,UAAY/kB,OAAOk0B,WAAav0B,EAAQsI,YAAcysB,EACzE,OAGF/U,KAAK6U,sBAAsB70B,EAAS80B,GAEpC,MAAMJ,EAAkBr0B,OAAOqF,iBAAiB1F,GAASib,iBAAiB6Z,GAC1E90B,EAAQwB,MAAMyzB,YAAYH,EAAe,GAAGvY,EAASgB,OAAOC,WAAWkX,QAAsB,GAIjG,CAEAG,sBAAsB70B,EAAS80B,GAC7B,MAAMI,EAAcl1B,EAAQwB,MAAMyZ,iBAAiB6Z,GAE/CI,GACF3R,GAAYC,iBAAiBxjB,EAAS80B,EAAeI,EAEzD,CAEAP,wBAAwB5a,EAAU+a,GAahC9U,KAAKgV,2BAA2Bjb,GAZH/Z,IAC3B,MAAM5B,EAAQmlB,GAAYQ,iBAAiB/jB,EAAS80B,GAEtC,OAAV12B,GAKJmlB,GAAYE,oBAAoBzjB,EAAS80B,GACzC90B,EAAQwB,MAAMyzB,YAAYH,EAAe12B,IALvC4B,EAAQwB,MAAM2zB,eAAeL,EAKgB,GAInD,CAEAE,2BAA2Bjb,EAAUqb,GACnC,GAAI,GAAUrb,GACZqb,EAASrb,QAIX,IAAK,MAAMsb,KAAOpO,GAAerU,KAAKmH,EAAUiG,KAAKoF,UACnDgQ,EAASC,EAEb,EAcF,MAAMC,GAAS,WAETC,GAAoB,OACpBC,GAAkB,gBAAgBF,KAClCG,GAAY,CAChBC,UAAW,iBACXC,cAAe,KACf/P,YAAY,EACZ9K,WAAW,EAEX8a,YAAa,QAGTC,GAAgB,CACpBH,UAAW,SACXC,cAAe,kBACf/P,WAAY,UACZ9K,UAAW,UACX8a,YAAa,oBAMf,MAAME,WAAiB9R,GACrBU,YAAYL,GACVc,QACAnF,KAAKqF,QAAUrF,KAAKoE,WAAWC,GAC/BrE,KAAK+V,aAAc,EACnB/V,KAAKoF,SAAW,IAClB,CAGWnB,qBACT,OAAOwR,EACT,CAEWvR,yBACT,OAAO2R,EACT,CAEWpZ,kBACT,OAAO6Y,EACT,CAGAzF,KAAKtT,GACH,IAAKyD,KAAKqF,QAAQvK,UAEhB,YADAiC,GAAQR,GAIVyD,KAAKgW,UAEL,MAAMh2B,EAAUggB,KAAKiW,cAEjBjW,KAAKqF,QAAQO,YACf7J,GAAO/b,GAGTA,EAAQwb,UAAUtE,IAAIqe,IAEtBvV,KAAKkW,mBAAkB,KACrBnZ,GAAQR,EAAS,GAErB,CAEAqT,KAAKrT,GACEyD,KAAKqF,QAAQvK,WAKlBkF,KAAKiW,cAAcza,UAAUuH,OAAOwS,IAEpCvV,KAAKkW,mBAAkB,KACrBlW,KAAKuF,UACLxI,GAAQR,EAAS,KARjBQ,GAAQR,EAUZ,CAEAgJ,UACOvF,KAAK+V,cAIVxV,GAAaC,IAAIR,KAAKoF,SAAUoQ,IAEhCxV,KAAKoF,SAASrC,SAEd/C,KAAK+V,aAAc,EACrB,CAGAE,cACE,IAAKjW,KAAKoF,SAAU,CAClB,MAAM+Q,EAAWrwB,SAASswB,cAAc,OACxCD,EAAST,UAAY1V,KAAKqF,QAAQqQ,UAE9B1V,KAAKqF,QAAQO,YACfuQ,EAAS3a,UAAUtE,IAnGD,QAsGpB8I,KAAKoF,SAAW+Q,CAClB,CAEA,OAAOnW,KAAKoF,QACd,CAEAb,kBAAkBF,GAGhB,OADAA,EAAOuR,YAAc/a,GAAWwJ,EAAOuR,aAChCvR,CACT,CAEA2R,UACE,GAAIhW,KAAK+V,YACP,OAGF,MAAM/1B,EAAUggB,KAAKiW,cAErBjW,KAAKqF,QAAQuQ,YAAYS,OAAOr2B,GAEhCugB,GAAaY,GAAGnhB,EAASw1B,IAAiB,KACxCzY,GAAQiD,KAAKqF,QAAQsQ,cAAc,IAErC3V,KAAK+V,aAAc,CACrB,CAEAG,kBAAkB3Z,GAChBS,GAAuBT,EAAUyD,KAAKiW,cAAejW,KAAKqF,QAAQO,WACpE,EAcF,MAEM0Q,GAAc,gBACdC,GAAkB,UAAUD,KAC5BE,GAAoB,cAAcF,KAGlCG,GAAmB,WACnBC,GAAY,CAChBC,WAAW,EACXC,YAAa,MAGTC,GAAgB,CACpBF,UAAW,UACXC,YAAa,WAMf,MAAME,WAAkB9S,GACtBU,YAAYL,GACVc,QACAnF,KAAKqF,QAAUrF,KAAKoE,WAAWC,GAC/BrE,KAAK+W,WAAY,EACjB/W,KAAKgX,qBAAuB,IAC9B,CAGW/S,qBACT,OAAOyS,EACT,CAEWxS,yBACT,OAAO2S,EACT,CAEWpa,kBACT,MAvCW,WAwCb,CAGAwa,WACMjX,KAAK+W,YAIL/W,KAAKqF,QAAQsR,WACf3W,KAAKqF,QAAQuR,YAAYlE,QAG3BnS,GAAaC,IAAI1a,SAAUwwB,IAE3B/V,GAAaY,GAAGrb,SAAUywB,IAAiBnX,GAASY,KAAKkX,eAAe9X,KACxEmB,GAAaY,GAAGrb,SAAU0wB,IAAmBpX,GAASY,KAAKmX,eAAe/X,KAC1EY,KAAK+W,WAAY,EACnB,CAEAK,aACOpX,KAAK+W,YAIV/W,KAAK+W,WAAY,EACjBxW,GAAaC,IAAI1a,SAAUwwB,IAC7B,CAGAY,eAAe9X,GACb,MAAM,YACJwX,GACE5W,KAAKqF,QAET,GAAIjG,EAAMpS,SAAWlH,UAAYsZ,EAAMpS,SAAW4pB,GAAeA,EAAY3xB,SAASma,EAAMpS,QAC1F,OAGF,MAAM1L,EAAW2lB,GAAeU,kBAAkBiP,GAE1B,IAApBt1B,EAAS6P,OACXylB,EAAYlE,QACH1S,KAAKgX,uBAAyBP,GACvCn1B,EAASA,EAAS6P,OAAS,GAAGuhB,QAE9BpxB,EAAS,GAAGoxB,OAEhB,CAEAyE,eAAe/X,GApFD,QAqFRA,EAAM7hB,MAIVyiB,KAAKgX,qBAAuB5X,EAAMiY,SAAWZ,GAxFzB,UAyFtB,EAcF,MAEMa,GAAc,YAGdC,GAAe,OAAOD,KACtBE,GAAyB,gBAAgBF,KACzCG,GAAiB,SAASH,KAC1BI,GAAe,OAAOJ,KACtBK,GAAgB,QAAQL,KACxBM,GAAiB,SAASN,KAC1BO,GAAsB,gBAAgBP,KACtCQ,GAA0B,oBAAoBR,KAC9CS,GAA0B,kBAAkBT,KAC5CU,GAAyB,QAAQV,cACjCW,GAAkB,aAElBC,GAAoB,OACpBC,GAAoB,eAKpBC,GAAY,CAChBjC,UAAU,EACVzD,OAAO,EACP3H,UAAU,GAENsN,GAAgB,CACpBlC,SAAU,mBACVzD,MAAO,UACP3H,SAAU,WAMZ,MAAMuN,WAAcpT,GAClBR,YAAY1kB,EAASqkB,GACnBc,MAAMnlB,EAASqkB,GACfrE,KAAKuY,QAAUtR,GAAeC,QApBV,gBAoBmClH,KAAKoF,UAC5DpF,KAAKwY,UAAYxY,KAAKyY,sBACtBzY,KAAK0Y,WAAa1Y,KAAK2Y,uBACvB3Y,KAAK2P,UAAW,EAChB3P,KAAKmP,kBAAmB,EACxBnP,KAAK4Y,WAAa,IAAIxE,GAEtBpU,KAAK4L,oBACP,CAGW3H,qBACT,OAAOmU,EACT,CAEWlU,yBACT,OAAOmU,EACT,CAEW5b,kBACT,MA5DW,OA6Db,CAGAsK,OAAOjH,GACL,OAAOE,KAAK2P,SAAW3P,KAAK4P,OAAS5P,KAAK6P,KAAK/P,EACjD,CAEA+P,KAAK/P,GACCE,KAAK2P,UAAY3P,KAAKmP,kBAIR5O,GAAakB,QAAQzB,KAAKoF,SAAUsS,GAAc,CAClE5X,kBAGY+B,mBAId7B,KAAK2P,UAAW,EAChB3P,KAAKmP,kBAAmB,EAExBnP,KAAK4Y,WAAWhJ,OAEhB9pB,SAAS6G,KAAK6O,UAAUtE,IAAI+gB,IAE5BjY,KAAK6Y,gBAEL7Y,KAAKwY,UAAU3I,MAAK,IAAM7P,KAAK8Y,aAAahZ,KAC9C,CAEA8P,OACO5P,KAAK2P,WAAY3P,KAAKmP,mBAIT5O,GAAakB,QAAQzB,KAAKoF,SAAUmS,IAExC1V,mBAId7B,KAAK2P,UAAW,EAChB3P,KAAKmP,kBAAmB,EAExBnP,KAAK0Y,WAAWtB,aAEhBpX,KAAKoF,SAAS5J,UAAUuH,OAAOmV,IAE/BlY,KAAK2F,gBAAe,IAAM3F,KAAK+Y,cAAc/Y,KAAKoF,SAAUpF,KAAKgO,gBACnE,CAEAzI,UACE,IAAK,MAAMyT,IAAe,CAAC34B,OAAQ2f,KAAKuY,SACtChY,GAAaC,IAAIwY,EAAa1B,IAGhCtX,KAAKwY,UAAUjT,UAEfvF,KAAK0Y,WAAWtB,aAEhBjS,MAAMI,SACR,CAEA0T,eACEjZ,KAAK6Y,eACP,CAGAJ,sBACE,OAAO,IAAI3C,GAAS,CAClBhb,UAAWgG,QAAQd,KAAKqF,QAAQ8Q,UAEhCvQ,WAAY5F,KAAKgO,eAErB,CAEA2K,uBACE,OAAO,IAAI7B,GAAU,CACnBF,YAAa5W,KAAKoF,UAEtB,CAEA0T,aAAahZ,GAENha,SAAS6G,KAAK1H,SAAS+a,KAAKoF,WAC/Btf,SAAS6G,KAAK0pB,OAAOrW,KAAKoF,UAG5BpF,KAAKoF,SAAS5jB,MAAMwwB,QAAU,QAE9BhS,KAAKoF,SAASxjB,gBAAgB,eAE9Boe,KAAKoF,SAASvjB,aAAa,cAAc,GAEzCme,KAAKoF,SAASvjB,aAAa,OAAQ,UAEnCme,KAAKoF,SAASlZ,UAAY,EAC1B,MAAMgtB,EAAYjS,GAAeC,QA3IT,cA2IsClH,KAAKuY,SAE/DW,IACFA,EAAUhtB,UAAY,GAGxB6P,GAAOiE,KAAKoF,UAEZpF,KAAKoF,SAAS5J,UAAUtE,IAAIghB,IAa5BlY,KAAK2F,gBAXsB,KACrB3F,KAAKqF,QAAQqN,OACf1S,KAAK0Y,WAAWzB,WAGlBjX,KAAKmP,kBAAmB,EACxB5O,GAAakB,QAAQzB,KAAKoF,SAAUuS,GAAe,CACjD7X,iBACA,GAGoCE,KAAKuY,QAASvY,KAAKgO,cAC7D,CAEApC,qBACErL,GAAaY,GAAGnB,KAAKoF,SAAU2S,IAAyB3Y,IACtD,GAtLe,WAsLXA,EAAM7hB,IAIV,OAAIyiB,KAAKqF,QAAQ0F,UACf3L,EAAM+C,sBACNnC,KAAK4P,aAIP5P,KAAKmZ,4BAA4B,IAEnC5Y,GAAaY,GAAG9gB,OAAQu3B,IAAgB,KAClC5X,KAAK2P,WAAa3P,KAAKmP,kBACzBnP,KAAK6Y,eACP,IAEFtY,GAAaY,GAAGnB,KAAKoF,SAAU0S,IAAyB1Y,IAEtDmB,GAAaa,IAAIpB,KAAKoF,SAAUyS,IAAqBuB,IAC/CpZ,KAAKoF,WAAahG,EAAMpS,QAAUgT,KAAKoF,WAAagU,EAAOpsB,SAIjC,WAA1BgT,KAAKqF,QAAQ8Q,SAMbnW,KAAKqF,QAAQ8Q,UACfnW,KAAK4P,OANL5P,KAAKmZ,6BAOP,GACA,GAEN,CAEAJ,aACE/Y,KAAKoF,SAAS5jB,MAAMwwB,QAAU,OAE9BhS,KAAKoF,SAASvjB,aAAa,eAAe,GAE1Cme,KAAKoF,SAASxjB,gBAAgB,cAE9Boe,KAAKoF,SAASxjB,gBAAgB,QAE9Boe,KAAKmP,kBAAmB,EAExBnP,KAAKwY,UAAU5I,MAAK,KAClB9pB,SAAS6G,KAAK6O,UAAUuH,OAAOkV,IAE/BjY,KAAKqZ,oBAELrZ,KAAK4Y,WAAW9lB,QAEhByN,GAAakB,QAAQzB,KAAKoF,SAAUqS,GAAe,GAEvD,CAEAzJ,cACE,OAAOhO,KAAKoF,SAAS5J,UAAUvW,SAtOT,OAuOxB,CAEAk0B,6BAGE,GAFkB5Y,GAAakB,QAAQzB,KAAKoF,SAAUoS,IAExC3V,iBACZ,OAGF,MAAMyX,EAAqBtZ,KAAKoF,SAAStX,aAAehI,SAASC,gBAAgBsC,aAC3EkxB,EAAmBvZ,KAAKoF,SAAS5jB,MAAMiL,UAEpB,WAArB8sB,GAAiCvZ,KAAKoF,SAAS5J,UAAUvW,SAASkzB,MAIjEmB,IACHtZ,KAAKoF,SAAS5jB,MAAMiL,UAAY,UAGlCuT,KAAKoF,SAAS5J,UAAUtE,IAAIihB,IAE5BnY,KAAK2F,gBAAe,KAClB3F,KAAKoF,SAAS5J,UAAUuH,OAAOoV,IAE/BnY,KAAK2F,gBAAe,KAClB3F,KAAKoF,SAAS5jB,MAAMiL,UAAY8sB,CAAgB,GAC/CvZ,KAAKuY,QAAQ,GACfvY,KAAKuY,SAERvY,KAAKoF,SAASsN,QAChB,CAMAmG,gBACE,MAAMS,EAAqBtZ,KAAKoF,SAAStX,aAAehI,SAASC,gBAAgBsC,aAE3E0sB,EAAiB/U,KAAK4Y,WAAWvE,WAEjCmF,EAAoBzE,EAAiB,EAE3C,GAAIyE,IAAsBF,EAAoB,CAC5C,MAAM/2B,EAAW4Z,KAAU,cAAgB,eAC3C6D,KAAKoF,SAAS5jB,MAAMe,GAAY,GAAGwyB,KACrC,CAEA,IAAKyE,GAAqBF,EAAoB,CAC5C,MAAM/2B,EAAW4Z,KAAU,eAAiB,cAC5C6D,KAAKoF,SAAS5jB,MAAMe,GAAY,GAAGwyB,KACrC,CACF,CAEAsE,oBACErZ,KAAKoF,SAAS5jB,MAAMi4B,YAAc,GAClCzZ,KAAKoF,SAAS5jB,MAAMk4B,aAAe,EACrC,CAGA7T,uBAAuBxB,EAAQvE,GAC7B,OAAOE,KAAK4G,MAAK,WACf,MAAM9b,EAAOwtB,GAAMjS,oBAAoBrG,KAAMqE,GAE7C,GAAsB,iBAAXA,EAAX,CAIA,QAA4B,IAAjBvZ,EAAKuZ,GACd,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,GAAQvE,EANb,CAOF,GACF,EAQFS,GAAaY,GAAGrb,SAAUkyB,GApTK,4BAoT2C,SAAU5Y,GAClF,MAAMpS,EAASsN,GAAuB0F,MAElC,CAAC,IAAK,QAAQ9F,SAAS8F,KAAKoG,UAC9BhH,EAAM+C,iBAGR5B,GAAaa,IAAIpU,EAAQ0qB,IAAciC,IACjCA,EAAU9X,kBAKdtB,GAAaa,IAAIpU,EAAQyqB,IAAgB,KACnC3c,GAAUkF,OACZA,KAAK0S,OACP,GACA,IAGJ,MAAMkH,EAAc3S,GAAeC,QA3Ub,eA6UlB0S,GACFtB,GAAMxS,YAAY8T,GAAahK,OAGpB0I,GAAMjS,oBAAoBrZ,GAClC+Z,OAAO/G,KACd,IACAgG,GAAqBsS,IAKrBjc,GAAmBic,IAYnB,MAEMuB,GAAc,gBACdC,GAAiB,YACjBC,GAAwB,OAAOF,KAAcC,KAE7CE,GAAoB,OACpBC,GAAuB,UACvBC,GAAoB,SAEpBC,GAAgB,kBAChBC,GAAe,OAAOP,KACtBQ,GAAgB,QAAQR,KACxBS,GAAe,OAAOT,KACtBU,GAAuB,gBAAgBV,KACvCW,GAAiB,SAASX,KAC1BY,GAAe,SAASZ,KACxBa,GAAyB,QAAQb,KAAcC,KAC/Ca,GAAwB,kBAAkBd,KAE1Ce,GAAY,CAChBzE,UAAU,EACVpL,UAAU,EACV7f,QAAQ,GAEJ2vB,GAAgB,CACpB1E,SAAU,mBACVpL,SAAU,UACV7f,OAAQ,WAMV,MAAM4vB,WAAkB5V,GACtBR,YAAY1kB,EAASqkB,GACnBc,MAAMnlB,EAASqkB,GACfrE,KAAK2P,UAAW,EAChB3P,KAAKwY,UAAYxY,KAAKyY,sBACtBzY,KAAK0Y,WAAa1Y,KAAK2Y,uBAEvB3Y,KAAK4L,oBACP,CAGW3H,qBACT,OAAO2W,EACT,CAEW1W,yBACT,OAAO2W,EACT,CAEWpe,kBACT,MAtDW,WAuDb,CAGAsK,OAAOjH,GACL,OAAOE,KAAK2P,SAAW3P,KAAK4P,OAAS5P,KAAK6P,KAAK/P,EACjD,CAEA+P,KAAK/P,GACCE,KAAK2P,UAISpP,GAAakB,QAAQzB,KAAKoF,SAAUgV,GAAc,CAClEta,kBAGY+B,mBAId7B,KAAK2P,UAAW,EAEhB3P,KAAKwY,UAAU3I,OAEV7P,KAAKqF,QAAQna,SAChB,IAAIkpB,IAAkBxE,OAGxB5P,KAAKoF,SAASvjB,aAAa,cAAc,GAEzCme,KAAKoF,SAASvjB,aAAa,OAAQ,UAEnCme,KAAKoF,SAAS5J,UAAUtE,IAAI+iB,IAgB5Bja,KAAK2F,gBAdoB,KAClB3F,KAAKqF,QAAQna,SAAU8U,KAAKqF,QAAQ8Q,UACvCnW,KAAK0Y,WAAWzB,WAGlBjX,KAAKoF,SAAS5J,UAAUtE,IAAI8iB,IAE5Bha,KAAKoF,SAAS5J,UAAUuH,OAAOkX,IAE/B1Z,GAAakB,QAAQzB,KAAKoF,SAAUiV,GAAe,CACjDva,iBACA,GAGkCE,KAAKoF,UAAU,GACvD,CAEAwK,OACO5P,KAAK2P,WAIQpP,GAAakB,QAAQzB,KAAKoF,SAAUkV,IAExCzY,mBAId7B,KAAK0Y,WAAWtB,aAEhBpX,KAAKoF,SAAS2V,OAEd/a,KAAK2P,UAAW,EAEhB3P,KAAKoF,SAAS5J,UAAUtE,IAAIgjB,IAE5Bla,KAAKwY,UAAU5I,OAgBf5P,KAAK2F,gBAdoB,KACvB3F,KAAKoF,SAAS5J,UAAUuH,OAAOiX,GAAmBE,IAElDla,KAAKoF,SAASxjB,gBAAgB,cAE9Boe,KAAKoF,SAASxjB,gBAAgB,QAEzBoe,KAAKqF,QAAQna,SAChB,IAAIkpB,IAAkBthB,QAGxByN,GAAakB,QAAQzB,KAAKoF,SAAUoV,GAAe,GAGfxa,KAAKoF,UAAU,IACvD,CAEAG,UACEvF,KAAKwY,UAAUjT,UAEfvF,KAAK0Y,WAAWtB,aAEhBjS,MAAMI,SACR,CAGAkT,sBACE,MAUM3d,EAAYgG,QAAQd,KAAKqF,QAAQ8Q,UACvC,OAAO,IAAIL,GAAS,CAClBJ,UA7JsB,qBA8JtB5a,YACA8K,YAAY,EACZgQ,YAAa5V,KAAKoF,SAAS5f,WAC3BmwB,cAAe7a,EAhBK,KACU,WAA1BkF,KAAKqF,QAAQ8Q,SAKjBnW,KAAK4P,OAJHrP,GAAakB,QAAQzB,KAAKoF,SAAUmV,GAI3B,EAUgC,MAE/C,CAEA5B,uBACE,OAAO,IAAI7B,GAAU,CACnBF,YAAa5W,KAAKoF,UAEtB,CAEAwG,qBACErL,GAAaY,GAAGnB,KAAKoF,SAAUuV,IAAuBvb,IAhLvC,WAiLTA,EAAM7hB,MAILyiB,KAAKqF,QAAQ0F,SAKlB/K,KAAK4P,OAJHrP,GAAakB,QAAQzB,KAAKoF,SAAUmV,IAI3B,GAEf,CAGA1U,uBAAuBxB,GACrB,OAAOrE,KAAK4G,MAAK,WACf,MAAM9b,EAAOgwB,GAAUzU,oBAAoBrG,KAAMqE,GAEjD,GAAsB,iBAAXA,EAAX,CAIA,QAAqB7K,IAAjB1O,EAAKuZ,IAAyBA,EAAOlK,WAAW,MAAmB,gBAAXkK,EAC1D,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,GAAQrE,KANb,CAOF,GACF,EAQFO,GAAaY,GAAGrb,SAAU40B,GAvMK,gCAuM2C,SAAUtb,GAClF,MAAMpS,EAASsN,GAAuB0F,MAMtC,GAJI,CAAC,IAAK,QAAQ9F,SAAS8F,KAAKoG,UAC9BhH,EAAM+C,iBAGJ9G,GAAW2E,MACb,OAGFO,GAAaa,IAAIpU,EAAQwtB,IAAgB,KAEnC1f,GAAUkF,OACZA,KAAK0S,OACP,IAGF,MAAMkH,EAAc3S,GAAeC,QAAQiT,IAEvCP,GAAeA,IAAgB5sB,GACjC8tB,GAAUhV,YAAY8T,GAAahK,OAGxBkL,GAAUzU,oBAAoBrZ,GACtC+Z,OAAO/G,KACd,IACAO,GAAaY,GAAG9gB,OAAQ05B,IAAuB,KAC7C,IAAK,MAAMhgB,KAAYkN,GAAerU,KAAKunB,IACzCW,GAAUzU,oBAAoBtM,GAAU8V,MAC1C,IAEFtP,GAAaY,GAAG9gB,OAAQo6B,IAAc,KACpC,IAAK,MAAMz6B,KAAWinB,GAAerU,KAAK,gDACG,UAAvClN,iBAAiB1F,GAASiC,UAC5B64B,GAAUzU,oBAAoBrmB,GAAS4vB,MAE3C,IAEF5J,GAAqB8U,IAKrBze,GAAmBye,IAQnB,MAAME,GAAgB,IAAIjkB,IAAI,CAAC,aAAc,OAAQ,OAAQ,WAAY,WAAY,SAAU,MAAO,eAQhGkkB,GAAmB,iEAOnBC,GAAmB,qIAEnBC,GAAmB,CAAC34B,EAAW44B,KACnC,MAAMC,EAAgB74B,EAAUvC,SAASC,cAEzC,OAAIk7B,EAAqBlhB,SAASmhB,IAC5BL,GAAc5jB,IAAIikB,IACbva,QAAQma,GAAiBn3B,KAAKtB,EAAU84B,YAAcJ,GAAiBp3B,KAAKtB,EAAU84B,YAO1FF,EAAqBx0B,QAAO20B,GAAkBA,aAA0BxW,SAAQ7R,MAAKsoB,GAASA,EAAM13B,KAAKu3B,IAAe,EAG3HI,GAAmB,CAEvB,IAAK,CAAC,QAAS,MAAO,KAAM,OAAQ,OAjCP,kBAkC7BnqB,EAAG,CAAC,SAAU,OAAQ,QAAS,OAC/BoqB,KAAM,GACNnqB,EAAG,GACHoqB,GAAI,GACJC,IAAK,GACLC,KAAM,GACNC,IAAK,GACLC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJxqB,EAAG,GACHgb,IAAK,CAAC,MAAO,SAAU,MAAO,QAAS,QAAS,UAChDyP,GAAI,GACJC,GAAI,GACJC,EAAG,GACHC,IAAK,GACLC,EAAG,GACHC,MAAO,GACPC,KAAM,GACNC,IAAK,GACLC,IAAK,GACLC,OAAQ,GACRC,EAAG,GACHC,GAAI,IA+CAC,GAAY,CAChBC,UAAW3B,GACX4B,QAAS,CAAC,EAEVC,WAAY,GACZhwB,MAAM,EACNiwB,UAAU,EACVC,WAAY,KACZC,SAAU,eAENC,GAAgB,CACpBN,UAAW,SACXC,QAAS,SACTC,WAAY,oBACZhwB,KAAM,UACNiwB,SAAU,UACVC,WAAY,kBACZC,SAAU,UAENE,GAAqB,CACzBC,MAAO,iCACP7jB,SAAU,oBAMZ,MAAM8jB,WAAwB7Z,GAC5BU,YAAYL,GACVc,QACAnF,KAAKqF,QAAUrF,KAAKoE,WAAWC,EACjC,CAGWJ,qBACT,OAAOkZ,EACT,CAEWjZ,yBACT,OAAOwZ,EACT,CAEWjhB,kBACT,MA5CW,iBA6Cb,CAGAqhB,aACE,OAAOrgC,OAAO0hB,OAAOa,KAAKqF,QAAQgY,SAAS95B,KAAI8gB,GAAUrE,KAAK+d,yBAAyB1Z,KAASzd,OAAOka,QACzG,CAEAkd,aACE,OAAOhe,KAAK8d,aAAa3sB,OAAS,CACpC,CAEA8sB,cAAcZ,GAMZ,OALArd,KAAKke,cAAcb,GAEnBrd,KAAKqF,QAAQgY,QAAU,IAAKrd,KAAKqF,QAAQgY,WACpCA,GAEErd,IACT,CAEAme,SACE,MAAMC,EAAkBt4B,SAASswB,cAAc,OAC/CgI,EAAgBC,UAAYre,KAAKse,eAAete,KAAKqF,QAAQoY,UAE7D,IAAK,MAAO1jB,EAAUwkB,KAAS9gC,OAAO4kB,QAAQrC,KAAKqF,QAAQgY,SACzDrd,KAAKwe,YAAYJ,EAAiBG,EAAMxkB,GAG1C,MAAM0jB,EAAWW,EAAgBjX,SAAS,GAEpCmW,EAAatd,KAAK+d,yBAAyB/d,KAAKqF,QAAQiY,YAM9D,OAJIA,GACFG,EAASjiB,UAAUtE,OAAOomB,EAAW36B,MAAM,MAGtC86B,CACT,CAGAjZ,iBAAiBH,GACfc,MAAMX,iBAAiBH,GAEvBrE,KAAKke,cAAc7Z,EAAOgZ,QAC5B,CAEAa,cAAcO,GACZ,IAAK,MAAO1kB,EAAUsjB,KAAY5/B,OAAO4kB,QAAQoc,GAC/CtZ,MAAMX,iBAAiB,CACrBzK,WACA6jB,MAAOP,GACNM,GAEP,CAEAa,YAAYf,EAAUJ,EAAStjB,GAC7B,MAAM2kB,EAAkBzX,GAAeC,QAAQnN,EAAU0jB,GAEpDiB,KAILrB,EAAUrd,KAAK+d,yBAAyBV,IAOpC,GAAUA,GACZrd,KAAK2e,sBAAsB9jB,GAAWwiB,GAAUqB,GAK9C1e,KAAKqF,QAAQ/X,KACfoxB,EAAgBL,UAAYre,KAAKse,eAAejB,GAIlDqB,EAAgBE,YAAcvB,EAf5BqB,EAAgB3b,SAgBpB,CAEAub,eAAeG,GACb,OAAOze,KAAKqF,QAAQkY,SA7KxB,SAAsBsB,EAAYzB,EAAW0B,GAC3C,IAAKD,EAAW1tB,OACd,OAAO0tB,EAGT,GAAIC,GAAgD,mBAArBA,EAC7B,OAAOA,EAAiBD,GAG1B,MACME,GADY,IAAI1+B,OAAO2+B,WACKC,gBAAgBJ,EAAY,aACxDv9B,EAAW,GAAGlC,UAAU2/B,EAAgBpyB,KAAKyT,iBAAiB,MAEpE,IAAK,MAAMpgB,KAAWsB,EAAU,CAC9B,MAAM49B,EAAcl/B,EAAQC,SAASC,cAErC,IAAKzC,OAAO4D,KAAK+7B,GAAWljB,SAASglB,GAAc,CACjDl/B,EAAQ+iB,SACR,QACF,CAEA,MAAMoc,EAAgB,GAAG//B,UAAUY,EAAQ0B,YACrC09B,EAAoB,GAAGhgC,OAAOg+B,EAAU,MAAQ,GAAIA,EAAU8B,IAAgB,IAEpF,IAAK,MAAM18B,KAAa28B,EACjBhE,GAAiB34B,EAAW48B,IAC/Bp/B,EAAQ4B,gBAAgBY,EAAUvC,SAGxC,CAEA,OAAO8+B,EAAgBpyB,KAAK0xB,SAC9B,CA6ImCgB,CAAaZ,EAAKze,KAAKqF,QAAQ+X,UAAWpd,KAAKqF,QAAQmY,YAAciB,CACtG,CAEAV,yBAAyBU,GACvB,MAAsB,mBAARA,EAAqBA,EAAIze,MAAQye,CACjD,CAEAE,sBAAsB3+B,EAAS0+B,GAC7B,GAAI1e,KAAKqF,QAAQ/X,KAGf,OAFAoxB,EAAgBL,UAAY,QAC5BK,EAAgBrI,OAAOr2B,GAIzB0+B,EAAgBE,YAAc5+B,EAAQ4+B,WACxC,EAcF,MACMU,GAAwB,IAAIvoB,IAAI,CAAC,WAAY,YAAa,eAC1DwoB,GAAoB,OAEpBC,GAAoB,OAEpBC,GAAiB,SACjBC,GAAmB,gBACnBC,GAAgB,QAChBC,GAAgB,QAahBC,GAAgB,CACpBC,KAAM,OACNC,IAAK,MACLC,MAAO7jB,KAAU,OAAS,QAC1B8jB,OAAQ,SACRC,KAAM/jB,KAAU,QAAU,QAEtBgkB,GAAY,CAChB/C,UAAW3B,GACX2E,WAAW,EACX1xB,SAAU,kBACV2xB,WAAW,EACXC,YAAa,GACbC,MAAO,EACP9vB,mBAAoB,CAAC,MAAO,QAAS,SAAU,QAC/CnD,MAAM,EACN7E,OAAQ,CAAC,EAAG,GACZtJ,UAAW,MACX8yB,aAAc,KACdsL,UAAU,EACVC,WAAY,KACZzjB,UAAU,EACV0jB,SAAU,+GACV+C,MAAO,GACP/e,QAAS,eAELgf,GAAgB,CACpBrD,UAAW,SACXgD,UAAW,UACX1xB,SAAU,mBACV2xB,UAAW,2BACXC,YAAa,oBACbC,MAAO,kBACP9vB,mBAAoB,QACpBnD,KAAM,UACN7E,OAAQ,0BACRtJ,UAAW,oBACX8yB,aAAc,yBACdsL,SAAU,UACVC,WAAY,kBACZzjB,SAAU,mBACV0jB,SAAU,SACV+C,MAAO,4BACP/e,QAAS,UAMX,MAAMif,WAAgBxb,GACpBR,YAAY1kB,EAASqkB,GACnB,QAAsB,IAAX,EACT,MAAM,IAAIW,UAAU,+DAGtBG,MAAMnlB,EAASqkB,GAEfrE,KAAK2gB,YAAa,EAClB3gB,KAAK4gB,SAAW,EAChB5gB,KAAK6gB,WAAa,KAClB7gB,KAAK8gB,eAAiB,CAAC,EACvB9gB,KAAKoS,QAAU,KACfpS,KAAK+gB,iBAAmB,KACxB/gB,KAAKghB,YAAc,KAEnBhhB,KAAKihB,IAAM,KAEXjhB,KAAKkhB,gBAEAlhB,KAAKqF,QAAQtL,UAChBiG,KAAKmhB,WAET,CAGWld,qBACT,OAAOkc,EACT,CAEWjc,yBACT,OAAOuc,EACT,CAEWhkB,kBACT,MA1GW,SA2Gb,CAGA2kB,SACEphB,KAAK2gB,YAAa,CACpB,CAEAU,UACErhB,KAAK2gB,YAAa,CACpB,CAEAW,gBACEthB,KAAK2gB,YAAc3gB,KAAK2gB,UAC1B,CAEA5Z,SACO/G,KAAK2gB,aAIV3gB,KAAK8gB,eAAeS,OAASvhB,KAAK8gB,eAAeS,MAE7CvhB,KAAK2P,WACP3P,KAAKwhB,SAKPxhB,KAAKyhB,SACP,CAEAlc,UACE0H,aAAajN,KAAK4gB,UAClBrgB,GAAaC,IAAIR,KAAKoF,SAASjK,QAAQskB,IAAiBC,GAAkB1f,KAAK0hB,mBAE3E1hB,KAAKoF,SAASpL,aAAa,2BAC7BgG,KAAKoF,SAASvjB,aAAa,QAASme,KAAKoF,SAASpL,aAAa,2BAGjEgG,KAAK2hB,iBAELxc,MAAMI,SACR,CAEAsK,OACE,GAAoC,SAAhC7P,KAAKoF,SAAS5jB,MAAMwwB,QACtB,MAAM,IAAI7N,MAAM,uCAGlB,IAAMnE,KAAK4hB,mBAAoB5hB,KAAK2gB,WAClC,OAGF,MAAMhH,EAAYpZ,GAAakB,QAAQzB,KAAKoF,SAAUpF,KAAK0E,YAAYiJ,UAlJtD,SAqJXkU,GAFalmB,GAAeqE,KAAKoF,WAELpF,KAAKoF,SAAS7kB,cAAcwF,iBAAiBd,SAAS+a,KAAKoF,UAE7F,GAAIuU,EAAU9X,mBAAqBggB,EACjC,OAIF7hB,KAAK2hB,iBAEL,MAAMV,EAAMjhB,KAAK8hB,iBAEjB9hB,KAAKoF,SAASvjB,aAAa,mBAAoBo/B,EAAIjnB,aAAa,OAEhE,MAAM,UACJqmB,GACErgB,KAAKqF,QAaT,GAXKrF,KAAKoF,SAAS7kB,cAAcwF,gBAAgBd,SAAS+a,KAAKihB,OAC7DZ,EAAUhK,OAAO4K,GACjB1gB,GAAakB,QAAQzB,KAAKoF,SAAUpF,KAAK0E,YAAYiJ,UAtKpC,cAyKnB3N,KAAKoS,QAAUpS,KAAKyS,cAAcwO,GAClCA,EAAIzlB,UAAUtE,IAAIsoB,IAKd,iBAAkB15B,SAASC,gBAC7B,IAAK,MAAM/F,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAKwa,UAC/C5G,GAAaY,GAAGnhB,EAAS,YAAa8b,IAc1CkE,KAAK2F,gBAVY,KACfpF,GAAakB,QAAQzB,KAAKoF,SAAUpF,KAAK0E,YAAYiJ,UAvLrC,WAyLQ,IAApB3N,KAAK6gB,YACP7gB,KAAKwhB,SAGPxhB,KAAK6gB,YAAa,CAAK,GAGK7gB,KAAKihB,IAAKjhB,KAAKgO,cAC/C,CAEA4B,OACE,GAAK5P,KAAK2P,aAIQpP,GAAakB,QAAQzB,KAAKoF,SAAUpF,KAAK0E,YAAYiJ,UA3MtD,SA6MH9L,iBAAd,CASA,GALY7B,KAAK8hB,iBAEbtmB,UAAUuH,OAAOyc,IAGjB,iBAAkB15B,SAASC,gBAC7B,IAAK,MAAM/F,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAKwa,UAC/C5G,GAAaC,IAAIxgB,EAAS,YAAa8b,IAI3CkE,KAAK8gB,eAA4B,OAAI,EACrC9gB,KAAK8gB,eAAelB,KAAiB,EACrC5f,KAAK8gB,eAAenB,KAAiB,EACrC3f,KAAK6gB,WAAa,KAgBlB7gB,KAAK2F,gBAdY,KACX3F,KAAK+hB,yBAIJ/hB,KAAK6gB,YACR7gB,KAAK2hB,iBAGP3hB,KAAKoF,SAASxjB,gBAAgB,oBAE9B2e,GAAakB,QAAQzB,KAAKoF,SAAUpF,KAAK0E,YAAYiJ,UA3OpC,WA2O8D,GAGnD3N,KAAKihB,IAAKjhB,KAAKgO,cAhC7C,CAiCF,CAEAxiB,SACMwU,KAAKoS,SACPpS,KAAKoS,QAAQ5mB,QAEjB,CAGAo2B,iBACE,OAAO9gB,QAAQd,KAAKgiB,YACtB,CAEAF,iBAKE,OAJK9hB,KAAKihB,MACRjhB,KAAKihB,IAAMjhB,KAAKiiB,kBAAkBjiB,KAAKghB,aAAehhB,KAAKkiB,2BAGtDliB,KAAKihB,GACd,CAEAgB,kBAAkB5E,GAChB,MAAM4D,EAAMjhB,KAAKmiB,oBAAoB9E,GAASc,SAG9C,IAAK8C,EACH,OAAO,KAGTA,EAAIzlB,UAAUuH,OAAOwc,GAAmBC,IAExCyB,EAAIzlB,UAAUtE,IAAI,MAAM8I,KAAK0E,YAAYjI,aACzC,MAAM2lB,EA92HKC,KACb,GACEA,GAAUz/B,KAAK0/B,MAlBH,IAkBS1/B,KAAK2/B,gBACnBz8B,SAAS08B,eAAeH,IAEjC,OAAOA,CAAM,EAy2HGI,CAAOziB,KAAK0E,YAAYjI,MAAMnc,WAO5C,OANA2gC,EAAIp/B,aAAa,KAAMugC,GAEnBpiB,KAAKgO,eACPiT,EAAIzlB,UAAUtE,IAAIqoB,IAGb0B,CACT,CAEAyB,WAAWrF,GACTrd,KAAKghB,YAAc3D,EAEfrd,KAAK2P,aACP3P,KAAK2hB,iBAEL3hB,KAAK6P,OAET,CAEAsS,oBAAoB9E,GAYlB,OAXIrd,KAAK+gB,iBACP/gB,KAAK+gB,iBAAiB9C,cAAcZ,GAEpCrd,KAAK+gB,iBAAmB,IAAIlD,GAAgB,IAAK7d,KAAKqF,QAGpDgY,UACAC,WAAYtd,KAAK+d,yBAAyB/d,KAAKqF,QAAQib,eAIpDtgB,KAAK+gB,gBACd,CAEAmB,yBACE,MAAO,CACL,iBAA0BliB,KAAKgiB,YAEnC,CAEAA,YACE,OAAOhiB,KAAK+d,yBAAyB/d,KAAKqF,QAAQmb,QAAUxgB,KAAKoF,SAASpL,aAAa,yBACzF,CAGA2oB,6BAA6BvjB,GAC3B,OAAOY,KAAK0E,YAAY2B,oBAAoBjH,EAAMW,eAAgBC,KAAK4iB,qBACzE,CAEA5U,cACE,OAAOhO,KAAKqF,QAAQ+a,WAAapgB,KAAKihB,KAAOjhB,KAAKihB,IAAIzlB,UAAUvW,SAASs6B,GAC3E,CAEA5P,WACE,OAAO3P,KAAKihB,KAAOjhB,KAAKihB,IAAIzlB,UAAUvW,SAASu6B,GACjD,CAEA/M,cAAcwO,GACZ,MAAM9hC,EAA8C,mBAA3B6gB,KAAKqF,QAAQlmB,UAA2B6gB,KAAKqF,QAAQlmB,UAAUlB,KAAK+hB,KAAMihB,EAAKjhB,KAAKoF,UAAYpF,KAAKqF,QAAQlmB,UAChI0jC,EAAahD,GAAc1gC,EAAU8lB,eAC3C,OAAO,GAAoBjF,KAAKoF,SAAU6b,EAAKjhB,KAAK6S,iBAAiBgQ,GACvE,CAEA5P,aACE,MAAM,OACJxqB,GACEuX,KAAKqF,QAET,MAAsB,iBAAX5c,EACFA,EAAO9F,MAAM,KAAKY,KAAInF,GAASmf,OAAO+P,SAASlvB,EAAO,MAGzC,mBAAXqK,EACFyqB,GAAczqB,EAAOyqB,EAAYlT,KAAKoF,UAGxC3c,CACT,CAEAs1B,yBAAyBU,GACvB,MAAsB,mBAARA,EAAqBA,EAAIxgC,KAAK+hB,KAAKoF,UAAYqZ,CAC/D,CAEA5L,iBAAiBgQ,GACf,MAAM1P,EAAwB,CAC5Bh0B,UAAW0jC,EACXhsB,UAAW,CAAC,CACV9V,KAAM,OACNmB,QAAS,CACPuO,mBAAoBuP,KAAKqF,QAAQ5U,qBAElC,CACD1P,KAAM,SACNmB,QAAS,CACPuG,OAAQuX,KAAKiT,eAEd,CACDlyB,KAAM,kBACNmB,QAAS,CACPwM,SAAUsR,KAAKqF,QAAQ3W,WAExB,CACD3N,KAAM,QACNmB,QAAS,CACPlC,QAAS,IAAIggB,KAAK0E,YAAYjI,eAE/B,CACD1b,KAAM,kBACNC,SAAS,EACTC,MAAO,aACPC,GAAI4J,IAGFkV,KAAK8hB,iBAAiBjgC,aAAa,wBAAyBiJ,EAAK1J,MAAMjC,UAAU,KAIvF,MAAO,IAAKg0B,KAC+B,mBAA9BnT,KAAKqF,QAAQ4M,aAA8BjS,KAAKqF,QAAQ4M,aAAakB,GAAyBnT,KAAKqF,QAAQ4M,aAE1H,CAEAiP,gBACE,MAAM4B,EAAW9iB,KAAKqF,QAAQ5D,QAAQ9e,MAAM,KAE5C,IAAK,MAAM8e,KAAWqhB,EACpB,GAAgB,UAAZrhB,EACFlB,GAAaY,GAAGnB,KAAKoF,SAAUpF,KAAK0E,YAAYiJ,UA3YlC,SA2Y4D3N,KAAKqF,QAAQtL,UAAUqF,IAC/EY,KAAK2iB,6BAA6BvjB,GAE1C2H,QAAQ,SAEb,GAtZU,WAsZNtF,EAA4B,CACrC,MAAMshB,EAAUthB,IAAYke,GAAgB3f,KAAK0E,YAAYiJ,UA9Y5C,cA8Y0E3N,KAAK0E,YAAYiJ,UAhZ5F,WAiZVqV,EAAWvhB,IAAYke,GAAgB3f,KAAK0E,YAAYiJ,UA9Y7C,cA8Y2E3N,KAAK0E,YAAYiJ,UAhZ5F,YAiZjBpN,GAAaY,GAAGnB,KAAKoF,SAAU2d,EAAS/iB,KAAKqF,QAAQtL,UAAUqF,IAC7D,MAAMkU,EAAUtT,KAAK2iB,6BAA6BvjB,GAElDkU,EAAQwN,eAA8B,YAAf1hB,EAAMqB,KAAqBmf,GAAgBD,KAAiB,EAEnFrM,EAAQmO,QAAQ,IAElBlhB,GAAaY,GAAGnB,KAAKoF,SAAU4d,EAAUhjB,KAAKqF,QAAQtL,UAAUqF,IAC9D,MAAMkU,EAAUtT,KAAK2iB,6BAA6BvjB,GAElDkU,EAAQwN,eAA8B,aAAf1hB,EAAMqB,KAAsBmf,GAAgBD,IAAiBrM,EAAQlO,SAASngB,SAASma,EAAMU,eAEpHwT,EAAQkO,QAAQ,GAEpB,CAGFxhB,KAAK0hB,kBAAoB,KACnB1hB,KAAKoF,UACPpF,KAAK4P,MACP,EAGFrP,GAAaY,GAAGnB,KAAKoF,SAASjK,QAAQskB,IAAiBC,GAAkB1f,KAAK0hB,kBAChF,CAEAP,YACE,MAAMX,EAAQxgB,KAAKoF,SAASpL,aAAa,SAEpCwmB,IAIAxgB,KAAKoF,SAASpL,aAAa,eAAkBgG,KAAKoF,SAASwZ,YAAYxkB,QAC1E4F,KAAKoF,SAASvjB,aAAa,aAAc2+B,GAG3CxgB,KAAKoF,SAASvjB,aAAa,yBAA0B2+B,GAGrDxgB,KAAKoF,SAASxjB,gBAAgB,SAChC,CAEA6/B,SACMzhB,KAAK2P,YAAc3P,KAAK6gB,WAC1B7gB,KAAK6gB,YAAa,GAIpB7gB,KAAK6gB,YAAa,EAElB7gB,KAAKijB,aAAY,KACXjjB,KAAK6gB,YACP7gB,KAAK6P,MACP,GACC7P,KAAKqF,QAAQkb,MAAM1Q,MACxB,CAEA2R,SACMxhB,KAAK+hB,yBAIT/hB,KAAK6gB,YAAa,EAElB7gB,KAAKijB,aAAY,KACVjjB,KAAK6gB,YACR7gB,KAAK4P,MACP,GACC5P,KAAKqF,QAAQkb,MAAM3Q,MACxB,CAEAqT,YAAYrlB,EAASslB,GACnBjW,aAAajN,KAAK4gB,UAClB5gB,KAAK4gB,SAAW/iB,WAAWD,EAASslB,EACtC,CAEAnB,uBACE,OAAOtkC,OAAO0hB,OAAOa,KAAK8gB,gBAAgB5mB,UAAS,EACrD,CAEAkK,WAAWC,GACT,MAAM8e,EAAiB5f,GAAYG,kBAAkB1D,KAAKoF,UAE1D,IAAK,MAAMge,KAAiB3lC,OAAO4D,KAAK8hC,GAClC7D,GAAsBloB,IAAIgsB,WACrBD,EAAeC,GAY1B,OARA/e,EAAS,IAAK8e,KACU,iBAAX9e,GAAuBA,EAASA,EAAS,CAAC,GAEvDA,EAASrE,KAAKsE,gBAAgBD,GAC9BA,EAASrE,KAAKuE,kBAAkBF,GAEhCrE,KAAKwE,iBAAiBH,GAEfA,CACT,CAEAE,kBAAkBF,GAkBhB,OAjBAA,EAAOgc,WAAiC,IAArBhc,EAAOgc,UAAsBv6B,SAAS6G,KAAOkO,GAAWwJ,EAAOgc,WAEtD,iBAAjBhc,EAAOkc,QAChBlc,EAAOkc,MAAQ,CACb1Q,KAAMxL,EAAOkc,MACb3Q,KAAMvL,EAAOkc,QAIW,iBAAjBlc,EAAOmc,QAChBnc,EAAOmc,MAAQnc,EAAOmc,MAAMlgC,YAGA,iBAAnB+jB,EAAOgZ,UAChBhZ,EAAOgZ,QAAUhZ,EAAOgZ,QAAQ/8B,YAG3B+jB,CACT,CAEAue,qBACE,MAAMve,EAAS,CAAC,EAEhB,IAAK,MAAM9mB,KAAOyiB,KAAKqF,QACjBrF,KAAK0E,YAAYT,QAAQ1mB,KAASyiB,KAAKqF,QAAQ9nB,KACjD8mB,EAAO9mB,GAAOyiB,KAAKqF,QAAQ9nB,IAS/B,OALA8mB,EAAOtK,UAAW,EAClBsK,EAAO5C,QAAU,SAIV4C,CACT,CAEAsd,iBACM3hB,KAAKoS,UACPpS,KAAKoS,QAAQ3Y,UAEbuG,KAAKoS,QAAU,MAGbpS,KAAKihB,MACPjhB,KAAKihB,IAAIle,SACT/C,KAAKihB,IAAM,KAEf,CAGApb,uBAAuBxB,GACrB,OAAOrE,KAAK4G,MAAK,WACf,MAAM9b,EAAO41B,GAAQra,oBAAoBrG,KAAMqE,GAE/C,GAAsB,iBAAXA,EAAX,CAIA,QAA4B,IAAjBvZ,EAAKuZ,GACd,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,IANL,CAOF,GACF,EAQFhI,GAAmBqkB,IAYnB,MAGM2C,GAAY,IAAK3C,GAAQzc,QAC7BoZ,QAAS,GACT50B,OAAQ,CAAC,EAAG,GACZtJ,UAAW,QACXs+B,SAAU,8IACVhc,QAAS,SAEL6hB,GAAgB,IAAK5C,GAAQxc,YACjCmZ,QAAS,kCAMX,MAAMkG,WAAgB7C,GAETzc,qBACT,OAAOof,EACT,CAEWnf,yBACT,OAAOof,EACT,CAEW7mB,kBACT,MA5BW,SA6Bb,CAGAmlB,iBACE,OAAO5hB,KAAKgiB,aAAehiB,KAAKwjB,aAClC,CAGAtB,yBACE,MAAO,CACL,kBAAkBliB,KAAKgiB,YACvB,gBAAoBhiB,KAAKwjB,cAE7B,CAEAA,cACE,OAAOxjB,KAAK+d,yBAAyB/d,KAAKqF,QAAQgY,QACpD,CAGAxX,uBAAuBxB,GACrB,OAAOrE,KAAK4G,MAAK,WACf,MAAM9b,EAAOy4B,GAAQld,oBAAoBrG,KAAMqE,GAE/C,GAAsB,iBAAXA,EAAX,CAIA,QAA4B,IAAjBvZ,EAAKuZ,GACd,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,IANL,CAOF,GACF,EAQFhI,GAAmBknB,IAYnB,MAEME,GAAc,gBAEdC,GAAiB,WAAWD,KAC5BE,GAAc,QAAQF,KACtBG,GAAwB,OAAOH,cAE/BI,GAAsB,SAEtBC,GAAwB,SAExBC,GAAqB,YAGrBC,GAAsB,GAAGD,mBAA+CA,uBAGxEE,GAAY,CAChBx7B,OAAQ,KAERy7B,WAAY,eACZC,cAAc,EACdn3B,OAAQ,KACRo3B,UAAW,CAAC,GAAK,GAAK,IAElBC,GAAgB,CACpB57B,OAAQ,gBAERy7B,WAAY,SACZC,aAAc,UACdn3B,OAAQ,UACRo3B,UAAW,SAMb,MAAME,WAAkBpf,GACtBR,YAAY1kB,EAASqkB,GACnBc,MAAMnlB,EAASqkB,GAEfrE,KAAKukB,aAAe,IAAI5yB,IACxBqO,KAAKwkB,oBAAsB,IAAI7yB,IAC/BqO,KAAKykB,aAA6D,YAA9C/+B,iBAAiBsa,KAAKoF,UAAU3Y,UAA0B,KAAOuT,KAAKoF,SAC1FpF,KAAK0kB,cAAgB,KACrB1kB,KAAK2kB,UAAY,KACjB3kB,KAAK4kB,oBAAsB,CACzBC,gBAAiB,EACjBC,gBAAiB,GAEnB9kB,KAAK+kB,SACP,CAGW9gB,qBACT,OAAOggB,EACT,CAEW/f,yBACT,OAAOmgB,EACT,CAEW5nB,kBACT,MAhEW,WAiEb,CAGAsoB,UACE/kB,KAAKglB,mCAELhlB,KAAKilB,2BAEDjlB,KAAK2kB,UACP3kB,KAAK2kB,UAAUO,aAEfllB,KAAK2kB,UAAY3kB,KAAKmlB,kBAGxB,IAAK,MAAMC,KAAWplB,KAAKwkB,oBAAoBrlB,SAC7Ca,KAAK2kB,UAAUU,QAAQD,EAE3B,CAEA7f,UACEvF,KAAK2kB,UAAUO,aAEf/f,MAAMI,SACR,CAGAhB,kBAAkBF,GAUhB,OARAA,EAAOrX,OAAS6N,GAAWwJ,EAAOrX,SAAWlH,SAAS6G,KAEtD0X,EAAO6f,WAAa7f,EAAO5b,OAAS,GAAG4b,EAAO5b,oBAAsB4b,EAAO6f,WAE3C,iBAArB7f,EAAO+f,YAChB/f,EAAO+f,UAAY/f,EAAO+f,UAAUzhC,MAAM,KAAKY,KAAInF,GAASmf,OAAOC,WAAWpf,MAGzEimB,CACT,CAEA4gB,2BACOjlB,KAAKqF,QAAQ8e,eAKlB5jB,GAAaC,IAAIR,KAAKqF,QAAQrY,OAAQ22B,IACtCpjB,GAAaY,GAAGnB,KAAKqF,QAAQrY,OAAQ22B,GAAaG,IAAuB1kB,IACvE,MAAMkmB,EAAoBtlB,KAAKwkB,oBAAoB5mC,IAAIwhB,EAAMpS,OAAOtB,MAEpE,GAAI45B,EAAmB,CACrBlmB,EAAM+C,iBACN,MAAMtG,EAAOmE,KAAKykB,cAAgBpkC,OAC5BmE,EAAS8gC,EAAkBxgC,UAAYkb,KAAKoF,SAAStgB,UAE3D,GAAI+W,EAAK0pB,SAKP,YAJA1pB,EAAK0pB,SAAS,CACZnjC,IAAKoC,EACLghC,SAAU,WAMd3pB,EAAK3P,UAAY1H,CACnB,KAEJ,CAEA2gC,kBACE,MAAMjjC,EAAU,CACd2Z,KAAMmE,KAAKykB,aACXL,UAAWpkB,KAAKqF,QAAQ+e,UACxBF,WAAYlkB,KAAKqF,QAAQ6e,YAE3B,OAAO,IAAIuB,sBAAqBpjB,GAAWrC,KAAK0lB,kBAAkBrjB,IAAUngB,EAC9E,CAGAwjC,kBAAkBrjB,GAChB,MAAMsjB,EAAgB/H,GAAS5d,KAAKukB,aAAa3mC,IAAI,IAAIggC,EAAM5wB,OAAO44B,MAEhE3O,EAAW2G,IACf5d,KAAK4kB,oBAAoBC,gBAAkBjH,EAAM5wB,OAAOlI,UAExDkb,KAAK6lB,SAASF,EAAc/H,GAAO,EAG/BkH,GAAmB9kB,KAAKykB,cAAgB3+B,SAASC,iBAAiBmG,UAClE45B,EAAkBhB,GAAmB9kB,KAAK4kB,oBAAoBE,gBACpE9kB,KAAK4kB,oBAAoBE,gBAAkBA,EAE3C,IAAK,MAAMlH,KAASvb,EAAS,CAC3B,IAAKub,EAAMmI,eAAgB,CACzB/lB,KAAK0kB,cAAgB,KAErB1kB,KAAKgmB,kBAAkBL,EAAc/H,IAErC,QACF,CAEA,MAAMqI,EAA2BrI,EAAM5wB,OAAOlI,WAAakb,KAAK4kB,oBAAoBC,gBAEpF,GAAIiB,GAAmBG,GAGrB,GAFAhP,EAAS2G,IAEJkH,EACH,YAOCgB,GAAoBG,GACvBhP,EAAS2G,EAEb,CACF,CAEAoH,mCACEhlB,KAAKukB,aAAe,IAAI5yB,IACxBqO,KAAKwkB,oBAAsB,IAAI7yB,IAC/B,MAAMu0B,EAAcjf,GAAerU,KAAKkxB,GAAuB9jB,KAAKqF,QAAQrY,QAE5E,IAAK,MAAMm5B,KAAUD,EAAa,CAEhC,IAAKC,EAAOz6B,MAAQ2P,GAAW8qB,GAC7B,SAGF,MAAMb,EAAoBre,GAAeC,QAAQif,EAAOz6B,KAAMsU,KAAKoF,UAE/DtK,GAAUwqB,KACZtlB,KAAKukB,aAAa/xB,IAAI2zB,EAAOz6B,KAAMy6B,GAEnCnmB,KAAKwkB,oBAAoBhyB,IAAI2zB,EAAOz6B,KAAM45B,GAE9C,CACF,CAEAO,SAAS74B,GACHgT,KAAK0kB,gBAAkB13B,IAI3BgT,KAAKgmB,kBAAkBhmB,KAAKqF,QAAQrY,QAEpCgT,KAAK0kB,cAAgB13B,EACrBA,EAAOwO,UAAUtE,IAAI2sB,IAErB7jB,KAAKomB,iBAAiBp5B,GAEtBuT,GAAakB,QAAQzB,KAAKoF,SAAUse,GAAgB,CAClD5jB,cAAe9S,IAEnB,CAEAo5B,iBAAiBp5B,GAEf,GAAIA,EAAOwO,UAAUvW,SAzNQ,iBA0N3BgiB,GAAeC,QAhNc,mBAgNsBla,EAAOmO,QAjNtC,cAiNkEK,UAAUtE,IAAI2sB,SAItG,IAAK,MAAMwC,KAAapf,GAAeI,QAAQra,EA1NnB,qBA6N1B,IAAK,MAAMxJ,KAAQyjB,GAAeM,KAAK8e,EAAWrC,IAChDxgC,EAAKgY,UAAUtE,IAAI2sB,GAGzB,CAEAmC,kBAAkB9gC,GAChBA,EAAOsW,UAAUuH,OAAO8gB,IACxB,MAAMyC,EAAcrf,GAAerU,KAAK,GAAGkxB,MAAyBD,KAAuB3+B,GAE3F,IAAK,MAAM9E,KAAQkmC,EACjBlmC,EAAKob,UAAUuH,OAAO8gB,GAE1B,CAGAhe,uBAAuBxB,GACrB,OAAOrE,KAAK4G,MAAK,WACf,MAAM9b,EAAOw5B,GAAUje,oBAAoBrG,KAAMqE,GAEjD,GAAsB,iBAAXA,EAAX,CAIA,QAAqB7K,IAAjB1O,EAAKuZ,IAAyBA,EAAOlK,WAAW,MAAmB,gBAAXkK,EAC1D,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,IANL,CAOF,GACF,EAQF9D,GAAaY,GAAG9gB,OAAQujC,IAAuB,KAC7C,IAAK,MAAM2C,KAAOtf,GAAerU,KAtQT,0BAuQtB0xB,GAAUje,oBAAoBkgB,EAChC,IAMFlqB,GAAmBioB,IAYnB,MAEMkC,GAAc,UACdC,GAAe,OAAOD,KACtBE,GAAiB,SAASF,KAC1BG,GAAe,OAAOH,KACtBI,GAAgB,QAAQJ,KACxBK,GAAuB,QAAQL,KAC/BM,GAAgB,UAAUN,KAC1BO,GAAsB,OAAOP,KAC7BQ,GAAiB,YACjBC,GAAkB,aAClBC,GAAe,UACfC,GAAiB,YACjBC,GAAoB,SACpBC,GAAoB,OACpBC,GAAoB,OAIpBC,GAA+B,yBAI/BC,GAAuB,2EAEvBC,GAAsB,YAHOF,uBAAiDA,mBAA6CA,OAG/EC,KAC5CE,GAA8B,IAAIN,8BAA6CA,+BAA8CA,4BAKnI,MAAMO,WAAYziB,GAChBR,YAAY1kB,GACVmlB,MAAMnlB,GACNggB,KAAKqS,QAAUrS,KAAKoF,SAASjK,QAdN,uCAgBlB6E,KAAKqS,UAMVrS,KAAK4nB,sBAAsB5nB,KAAKqS,QAASrS,KAAK6nB,gBAE9CtnB,GAAaY,GAAGnB,KAAKoF,SAAU0hB,IAAe1nB,GAASY,KAAK4M,SAASxN,KACvE,CAGW3C,kBACT,MAlDW,KAmDb,CAGAoT,OAEE,MAAMiY,EAAY9nB,KAAKoF,SAEvB,GAAIpF,KAAK+nB,cAAcD,GACrB,OAIF,MAAME,EAAShoB,KAAKioB,iBAEdC,EAAYF,EAASznB,GAAakB,QAAQumB,EAAQvB,GAAc,CACpE3mB,cAAegoB,IACZ,KACavnB,GAAakB,QAAQqmB,EAAWnB,GAAc,CAC9D7mB,cAAekoB,IAGHnmB,kBAAoBqmB,GAAaA,EAAUrmB,mBAIzD7B,KAAKmoB,YAAYH,EAAQF,GAEzB9nB,KAAKooB,UAAUN,EAAWE,GAC5B,CAGAI,UAAUpoC,EAASqoC,GACZroC,IAILA,EAAQwb,UAAUtE,IAAIkwB,IAEtBpnB,KAAKooB,UAAU9tB,GAAuBta,IAmBtCggB,KAAK2F,gBAhBY,KACsB,QAAjC3lB,EAAQga,aAAa,SAKzBha,EAAQ4B,gBAAgB,YACxB5B,EAAQ6B,aAAa,iBAAiB,GAEtCme,KAAKsoB,gBAAgBtoC,GAAS,GAE9BugB,GAAakB,QAAQzhB,EAAS4mC,GAAe,CAC3C9mB,cAAeuoB,KAVfroC,EAAQwb,UAAUtE,IAAIowB,GAWtB,GAG0BtnC,EAASA,EAAQwb,UAAUvW,SAASoiC,KACpE,CAEAc,YAAYnoC,EAASqoC,GACdroC,IAILA,EAAQwb,UAAUuH,OAAOqkB,IACzBpnC,EAAQ+6B,OAER/a,KAAKmoB,YAAY7tB,GAAuBta,IAmBxCggB,KAAK2F,gBAhBY,KACsB,QAAjC3lB,EAAQga,aAAa,SAKzBha,EAAQ6B,aAAa,iBAAiB,GACtC7B,EAAQ6B,aAAa,WAAY,MAEjCme,KAAKsoB,gBAAgBtoC,GAAS,GAE9BugB,GAAakB,QAAQzhB,EAAS0mC,GAAgB,CAC5C5mB,cAAeuoB,KAVfroC,EAAQwb,UAAUuH,OAAOukB,GAWzB,GAG0BtnC,EAASA,EAAQwb,UAAUvW,SAASoiC,KACpE,CAEAza,SAASxN,GACP,IAAK,CAAC4nB,GAAgBC,GAAiBC,GAAcC,IAAgBjtB,SAASkF,EAAM7hB,KAClF,OAGF6hB,EAAMyU,kBAENzU,EAAM+C,iBACN,MAAMoL,EAAS,CAAC0Z,GAAiBE,IAAgBjtB,SAASkF,EAAM7hB,KAC1DgrC,EAAoBzqB,GAAqBkC,KAAK6nB,eAAejhC,QAAO5G,IAAYqb,GAAWrb,KAAWof,EAAMpS,OAAQugB,GAAQ,GAE9Hgb,IACFA,EAAkB7V,MAAM,CACtB8V,eAAe,IAEjBb,GAAIthB,oBAAoBkiB,GAAmB1Y,OAE/C,CAEAgY,eAEE,OAAO5gB,GAAerU,KAAK60B,GAAqBznB,KAAKqS,QACvD,CAEA4V,iBACE,OAAOjoB,KAAK6nB,eAAej1B,MAAKzN,GAAS6a,KAAK+nB,cAAc5iC,MAAW,IACzE,CAEAyiC,sBAAsB1iC,EAAQiiB,GAC5BnH,KAAKyoB,yBAAyBvjC,EAAQ,OAAQ,WAE9C,IAAK,MAAMC,KAASgiB,EAClBnH,KAAK0oB,6BAA6BvjC,EAEtC,CAEAujC,6BAA6BvjC,GAC3BA,EAAQ6a,KAAK2oB,iBAAiBxjC,GAE9B,MAAMyjC,EAAW5oB,KAAK+nB,cAAc5iC,GAE9B0jC,EAAY7oB,KAAK8oB,iBAAiB3jC,GAExCA,EAAMtD,aAAa,gBAAiB+mC,GAEhCC,IAAc1jC,GAChB6a,KAAKyoB,yBAAyBI,EAAW,OAAQ,gBAG9CD,GACHzjC,EAAMtD,aAAa,WAAY,MAGjCme,KAAKyoB,yBAAyBtjC,EAAO,OAAQ,OAG7C6a,KAAK+oB,mCAAmC5jC,EAC1C,CAEA4jC,mCAAmC5jC,GACjC,MAAM6H,EAASsN,GAAuBnV,GAEjC6H,IAILgT,KAAKyoB,yBAAyBz7B,EAAQ,OAAQ,YAE1C7H,EAAMygC,IACR5lB,KAAKyoB,yBAAyBz7B,EAAQ,kBAAmB,IAAI7H,EAAMygC,MAEvE,CAEA0C,gBAAgBtoC,EAASgpC,GACvB,MAAMH,EAAY7oB,KAAK8oB,iBAAiB9oC,GAExC,IAAK6oC,EAAUrtB,UAAUvW,SAxMN,YAyMjB,OAGF,MAAM8hB,EAAS,CAAChN,EAAU2b,KACxB,MAAM11B,EAAUinB,GAAeC,QAAQnN,EAAU8uB,GAE7C7oC,GACFA,EAAQwb,UAAUuL,OAAO2O,EAAWsT,EACtC,EAGFjiB,EAnN6B,mBAmNIqgB,IACjCrgB,EAnN2B,iBAmNIugB,IAC/BuB,EAAUhnC,aAAa,gBAAiBmnC,EAC1C,CAEAP,yBAAyBzoC,EAASwC,EAAWpE,GACtC4B,EAAQ0b,aAAalZ,IACxBxC,EAAQ6B,aAAaW,EAAWpE,EAEpC,CAEA2pC,cAAczY,GACZ,OAAOA,EAAK9T,UAAUvW,SAASmiC,GACjC,CAGAuB,iBAAiBrZ,GACf,OAAOA,EAAKlI,QAAQqgB,IAAuBnY,EAAOrI,GAAeC,QAAQugB,GAAqBnY,EAChG,CAGAwZ,iBAAiBxZ,GACf,OAAOA,EAAKnU,QArOO,gCAqOoBmU,CACzC,CAGAzJ,uBAAuBxB,GACrB,OAAOrE,KAAK4G,MAAK,WACf,MAAM9b,EAAO68B,GAAIthB,oBAAoBrG,MAErC,GAAsB,iBAAXqE,EAAX,CAIA,QAAqB7K,IAAjB1O,EAAKuZ,IAAyBA,EAAOlK,WAAW,MAAmB,gBAAXkK,EAC1D,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,IANL,CAOF,GACF,EAQF9D,GAAaY,GAAGrb,SAAU+gC,GAAsBW,IAAsB,SAAUpoB,GAC1E,CAAC,IAAK,QAAQlF,SAAS8F,KAAKoG,UAC9BhH,EAAM+C,iBAGJ9G,GAAW2E,OAIf2nB,GAAIthB,oBAAoBrG,MAAM6P,MAChC,IAKAtP,GAAaY,GAAG9gB,OAAQ0mC,IAAqB,KAC3C,IAAK,MAAM/mC,KAAWinB,GAAerU,KAAK80B,IACxCC,GAAIthB,oBAAoBrmB,EAC1B,IAMFqc,GAAmBsrB,IAYnB,MAEMniB,GAAY,YACZyjB,GAAkB,YAAYzjB,KAC9B0jB,GAAiB,WAAW1jB,KAC5B2jB,GAAgB,UAAU3jB,KAC1B4jB,GAAiB,WAAW5jB,KAC5B6jB,GAAa,OAAO7jB,KACpB8jB,GAAe,SAAS9jB,KACxB+jB,GAAa,OAAO/jB,KACpBgkB,GAAc,QAAQhkB,KAEtBikB,GAAkB,OAElBC,GAAkB,OAClBC,GAAqB,UACrBzlB,GAAc,CAClBkc,UAAW,UACXwJ,SAAU,UACVrJ,MAAO,UAEHtc,GAAU,CACdmc,WAAW,EACXwJ,UAAU,EACVrJ,MAAO,KAMT,MAAMsJ,WAAc3kB,GAClBR,YAAY1kB,EAASqkB,GACnBc,MAAMnlB,EAASqkB,GACfrE,KAAK4gB,SAAW,KAChB5gB,KAAK8pB,sBAAuB,EAC5B9pB,KAAK+pB,yBAA0B,EAE/B/pB,KAAKkhB,eACP,CAGWjd,qBACT,OAAOA,EACT,CAEWC,yBACT,OAAOA,EACT,CAEWzH,kBACT,MAlDS,OAmDX,CAGAoT,OACoBtP,GAAakB,QAAQzB,KAAKoF,SAAUmkB,IAExC1nB,mBAId7B,KAAKgqB,gBAEDhqB,KAAKqF,QAAQ+a,WACfpgB,KAAKoF,SAAS5J,UAAUtE,IArDN,QAgEpB8I,KAAKoF,SAAS5J,UAAUuH,OAAO0mB,IAG/B1tB,GAAOiE,KAAKoF,UAEZpF,KAAKoF,SAAS5J,UAAUtE,IAAIwyB,GAAiBC,IAE7C3pB,KAAK2F,gBAfY,KACf3F,KAAKoF,SAAS5J,UAAUuH,OAAO4mB,IAE/BppB,GAAakB,QAAQzB,KAAKoF,SAAUokB,IAEpCxpB,KAAKiqB,oBAAoB,GAUGjqB,KAAKoF,SAAUpF,KAAKqF,QAAQ+a,WAC5D,CAEAxQ,OACO5P,KAAKkqB,YAIQ3pB,GAAakB,QAAQzB,KAAKoF,SAAUikB,IAExCxnB,mBAad7B,KAAKoF,SAAS5J,UAAUtE,IAAIyyB,IAE5B3pB,KAAK2F,gBAXY,KACf3F,KAAKoF,SAAS5J,UAAUtE,IAAIuyB,IAG5BzpB,KAAKoF,SAAS5J,UAAUuH,OAAO4mB,GAAoBD,IAEnDnpB,GAAakB,QAAQzB,KAAKoF,SAAUkkB,GAAa,GAKrBtpB,KAAKoF,SAAUpF,KAAKqF,QAAQ+a,YAC5D,CAEA7a,UACEvF,KAAKgqB,gBAEDhqB,KAAKkqB,WACPlqB,KAAKoF,SAAS5J,UAAUuH,OAAO2mB,IAGjCvkB,MAAMI,SACR,CAEA2kB,UACE,OAAOlqB,KAAKoF,SAAS5J,UAAUvW,SAASykC,GAC1C,CAGAO,qBACOjqB,KAAKqF,QAAQukB,WAId5pB,KAAK8pB,sBAAwB9pB,KAAK+pB,0BAItC/pB,KAAK4gB,SAAW/iB,YAAW,KACzBmC,KAAK4P,MAAM,GACV5P,KAAKqF,QAAQkb,QAClB,CAEA4J,eAAe/qB,EAAOgrB,GACpB,OAAQhrB,EAAMqB,MACZ,IAAK,YACL,IAAK,WAEDT,KAAK8pB,qBAAuBM,EAC5B,MAGJ,IAAK,UACL,IAAK,WAEDpqB,KAAK+pB,wBAA0BK,EAKrC,GAAIA,EAGF,YAFApqB,KAAKgqB,gBAKP,MAAMxc,EAAcpO,EAAMU,cAEtBE,KAAKoF,WAAaoI,GAAexN,KAAKoF,SAASngB,SAASuoB,IAI5DxN,KAAKiqB,oBACP,CAEA/I,gBACE3gB,GAAaY,GAAGnB,KAAKoF,SAAU6jB,IAAiB7pB,GAASY,KAAKmqB,eAAe/qB,GAAO,KACpFmB,GAAaY,GAAGnB,KAAKoF,SAAU8jB,IAAgB9pB,GAASY,KAAKmqB,eAAe/qB,GAAO,KACnFmB,GAAaY,GAAGnB,KAAKoF,SAAU+jB,IAAe/pB,GAASY,KAAKmqB,eAAe/qB,GAAO,KAClFmB,GAAaY,GAAGnB,KAAKoF,SAAUgkB,IAAgBhqB,GAASY,KAAKmqB,eAAe/qB,GAAO,IACrF,CAEA4qB,gBACE/c,aAAajN,KAAK4gB,UAClB5gB,KAAK4gB,SAAW,IAClB,CAGA/a,uBAAuBxB,GACrB,OAAOrE,KAAK4G,MAAK,WACf,MAAM9b,EAAO++B,GAAMxjB,oBAAoBrG,KAAMqE,GAE7C,GAAsB,iBAAXA,EAAqB,CAC9B,QAA4B,IAAjBvZ,EAAKuZ,GACd,MAAM,IAAIW,UAAU,oBAAoBX,MAG1CvZ,EAAKuZ,GAAQrE,KACf,CACF,GACF,ECxjKK,IAAuBzD,GDgkK9ByJ,GAAqB6jB,IAKrBxtB,GAAmBwtB,ICrkKWttB,GCK9B,WAC2B,GAAG1J,MAAM5U,KAChC6H,SAASsa,iBAAiB,+BAET7c,KAAI,SAAU8mC,GAC/B,OAAO,IAAI3J,GAAQ2J,EAAkB,CAAE9J,MAAO,CAAE1Q,KAAM,IAAKD,KAAM,MACnE,GACF,EDX6B,WAAvB9pB,SAASgX,WAAyBP,KACjCzW,SAASyF,iBAAiB,mBAAoBgR","sources":["webpack://pydata_sphinx_theme/webpack/bootstrap","webpack://pydata_sphinx_theme/webpack/runtime/define property getters","webpack://pydata_sphinx_theme/webpack/runtime/hasOwnProperty shorthand","webpack://pydata_sphinx_theme/webpack/runtime/make namespace object","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/enums.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getNodeName.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getWindow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/instanceOf.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/applyStyles.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getBasePlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/math.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/userAgent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/isLayoutViewport.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getBoundingClientRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getLayoutRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/contains.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getComputedStyle.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/isTableElement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getDocumentElement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getParentNode.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getOffsetParent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getMainAxisFromPlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/within.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/mergePaddingObject.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getFreshSideObject.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/expandToHashMap.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/arrow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getVariation.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/computeStyles.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/eventListeners.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getOppositePlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getOppositeVariationPlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getWindowScroll.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getWindowScrollBarX.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/isScrollParent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getScrollParent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/listScrollParents.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/rectToClientRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getClippingRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getViewportRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getDocumentRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/computeOffsets.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/detectOverflow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/flip.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/computeAutoPlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/hide.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/offset.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/popperOffsets.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/preventOverflow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getAltAxis.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getCompositeRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getNodeScroll.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getHTMLElementScroll.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/orderModifiers.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/createPopper.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/debounce.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/mergeByName.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/popper.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/popper-lite.js","webpack://pydata_sphinx_theme/./node_modules/bootstrap/dist/js/bootstrap.esm.js","webpack://pydata_sphinx_theme/./src/pydata_sphinx_theme/assets/scripts/mixin.js","webpack://pydata_sphinx_theme/./src/pydata_sphinx_theme/assets/scripts/bootstrap.js"],"sourcesContent":["// The require scope\nvar __webpack_require__ = {};\n\n","// define getter functions for harmony exports\n__webpack_require__.d = (exports, definition) => {\n\tfor(var key in definition) {\n\t\tif(__webpack_require__.o(definition, key) && !__webpack_require__.o(exports, key)) {\n\t\t\tObject.defineProperty(exports, key, { enumerable: true, get: definition[key] });\n\t\t}\n\t}\n};","__webpack_require__.o = (obj, prop) => (Object.prototype.hasOwnProperty.call(obj, prop))","// define __esModule on exports\n__webpack_require__.r = (exports) => {\n\tif(typeof Symbol !== 'undefined' && Symbol.toStringTag) {\n\t\tObject.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });\n\t}\n\tObject.defineProperty(exports, '__esModule', { value: true });\n};","export var top = 'top';\nexport var bottom = 'bottom';\nexport var right = 'right';\nexport var left = 'left';\nexport var auto = 'auto';\nexport var basePlacements = [top, bottom, right, left];\nexport var start = 'start';\nexport var end = 'end';\nexport var clippingParents = 'clippingParents';\nexport var viewport = 'viewport';\nexport var popper = 'popper';\nexport var reference = 'reference';\nexport var variationPlacements = /*#__PURE__*/basePlacements.reduce(function (acc, placement) {\n return acc.concat([placement + \"-\" + start, placement + \"-\" + end]);\n}, []);\nexport var placements = /*#__PURE__*/[].concat(basePlacements, [auto]).reduce(function (acc, placement) {\n return acc.concat([placement, placement + \"-\" + start, placement + \"-\" + end]);\n}, []); // modifiers that need to read the DOM\n\nexport var beforeRead = 'beforeRead';\nexport var read = 'read';\nexport var afterRead = 'afterRead'; // pure-logic modifiers\n\nexport var beforeMain = 'beforeMain';\nexport var main = 'main';\nexport var afterMain = 'afterMain'; // modifier with the purpose to write to the DOM (or write into a framework state)\n\nexport var beforeWrite = 'beforeWrite';\nexport var write = 'write';\nexport var afterWrite = 'afterWrite';\nexport var modifierPhases = [beforeRead, read, afterRead, beforeMain, main, afterMain, beforeWrite, write, afterWrite];","export default function getNodeName(element) {\n return element ? (element.nodeName || '').toLowerCase() : null;\n}","export default function getWindow(node) {\n if (node == null) {\n return window;\n }\n\n if (node.toString() !== '[object Window]') {\n var ownerDocument = node.ownerDocument;\n return ownerDocument ? ownerDocument.defaultView || window : window;\n }\n\n return node;\n}","import getWindow from \"./getWindow.js\";\n\nfunction isElement(node) {\n var OwnElement = getWindow(node).Element;\n return node instanceof OwnElement || node instanceof Element;\n}\n\nfunction isHTMLElement(node) {\n var OwnElement = getWindow(node).HTMLElement;\n return node instanceof OwnElement || node instanceof HTMLElement;\n}\n\nfunction isShadowRoot(node) {\n // IE 11 has no ShadowRoot\n if (typeof ShadowRoot === 'undefined') {\n return false;\n }\n\n var OwnElement = getWindow(node).ShadowRoot;\n return node instanceof OwnElement || node instanceof ShadowRoot;\n}\n\nexport { isElement, isHTMLElement, isShadowRoot };","import getNodeName from \"../dom-utils/getNodeName.js\";\nimport { isHTMLElement } from \"../dom-utils/instanceOf.js\"; // This modifier takes the styles prepared by the `computeStyles` modifier\n// and applies them to the HTMLElements such as popper and arrow\n\nfunction applyStyles(_ref) {\n var state = _ref.state;\n Object.keys(state.elements).forEach(function (name) {\n var style = state.styles[name] || {};\n var attributes = state.attributes[name] || {};\n var element = state.elements[name]; // arrow is optional + virtual elements\n\n if (!isHTMLElement(element) || !getNodeName(element)) {\n return;\n } // Flow doesn't support to extend this property, but it's the most\n // effective way to apply styles to an HTMLElement\n // $FlowFixMe[cannot-write]\n\n\n Object.assign(element.style, style);\n Object.keys(attributes).forEach(function (name) {\n var value = attributes[name];\n\n if (value === false) {\n element.removeAttribute(name);\n } else {\n element.setAttribute(name, value === true ? '' : value);\n }\n });\n });\n}\n\nfunction effect(_ref2) {\n var state = _ref2.state;\n var initialStyles = {\n popper: {\n position: state.options.strategy,\n left: '0',\n top: '0',\n margin: '0'\n },\n arrow: {\n position: 'absolute'\n },\n reference: {}\n };\n Object.assign(state.elements.popper.style, initialStyles.popper);\n state.styles = initialStyles;\n\n if (state.elements.arrow) {\n Object.assign(state.elements.arrow.style, initialStyles.arrow);\n }\n\n return function () {\n Object.keys(state.elements).forEach(function (name) {\n var element = state.elements[name];\n var attributes = state.attributes[name] || {};\n var styleProperties = Object.keys(state.styles.hasOwnProperty(name) ? state.styles[name] : initialStyles[name]); // Set all values to an empty string to unset them\n\n var style = styleProperties.reduce(function (style, property) {\n style[property] = '';\n return style;\n }, {}); // arrow is optional + virtual elements\n\n if (!isHTMLElement(element) || !getNodeName(element)) {\n return;\n }\n\n Object.assign(element.style, style);\n Object.keys(attributes).forEach(function (attribute) {\n element.removeAttribute(attribute);\n });\n });\n };\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'applyStyles',\n enabled: true,\n phase: 'write',\n fn: applyStyles,\n effect: effect,\n requires: ['computeStyles']\n};","import { auto } from \"../enums.js\";\nexport default function getBasePlacement(placement) {\n return placement.split('-')[0];\n}","export var max = Math.max;\nexport var min = Math.min;\nexport var round = Math.round;","export default function getUAString() {\n var uaData = navigator.userAgentData;\n\n if (uaData != null && uaData.brands && Array.isArray(uaData.brands)) {\n return uaData.brands.map(function (item) {\n return item.brand + \"/\" + item.version;\n }).join(' ');\n }\n\n return navigator.userAgent;\n}","import getUAString from \"../utils/userAgent.js\";\nexport default function isLayoutViewport() {\n return !/^((?!chrome|android).)*safari/i.test(getUAString());\n}","import { isElement, isHTMLElement } from \"./instanceOf.js\";\nimport { round } from \"../utils/math.js\";\nimport getWindow from \"./getWindow.js\";\nimport isLayoutViewport from \"./isLayoutViewport.js\";\nexport default function getBoundingClientRect(element, includeScale, isFixedStrategy) {\n if (includeScale === void 0) {\n includeScale = false;\n }\n\n if (isFixedStrategy === void 0) {\n isFixedStrategy = false;\n }\n\n var clientRect = element.getBoundingClientRect();\n var scaleX = 1;\n var scaleY = 1;\n\n if (includeScale && isHTMLElement(element)) {\n scaleX = element.offsetWidth > 0 ? round(clientRect.width) / element.offsetWidth || 1 : 1;\n scaleY = element.offsetHeight > 0 ? round(clientRect.height) / element.offsetHeight || 1 : 1;\n }\n\n var _ref = isElement(element) ? getWindow(element) : window,\n visualViewport = _ref.visualViewport;\n\n var addVisualOffsets = !isLayoutViewport() && isFixedStrategy;\n var x = (clientRect.left + (addVisualOffsets && visualViewport ? visualViewport.offsetLeft : 0)) / scaleX;\n var y = (clientRect.top + (addVisualOffsets && visualViewport ? visualViewport.offsetTop : 0)) / scaleY;\n var width = clientRect.width / scaleX;\n var height = clientRect.height / scaleY;\n return {\n width: width,\n height: height,\n top: y,\n right: x + width,\n bottom: y + height,\n left: x,\n x: x,\n y: y\n };\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\"; // Returns the layout rect of an element relative to its offsetParent. Layout\n// means it doesn't take into account transforms.\n\nexport default function getLayoutRect(element) {\n var clientRect = getBoundingClientRect(element); // Use the clientRect sizes if it's not been transformed.\n // Fixes https://github.com/popperjs/popper-core/issues/1223\n\n var width = element.offsetWidth;\n var height = element.offsetHeight;\n\n if (Math.abs(clientRect.width - width) <= 1) {\n width = clientRect.width;\n }\n\n if (Math.abs(clientRect.height - height) <= 1) {\n height = clientRect.height;\n }\n\n return {\n x: element.offsetLeft,\n y: element.offsetTop,\n width: width,\n height: height\n };\n}","import { isShadowRoot } from \"./instanceOf.js\";\nexport default function contains(parent, child) {\n var rootNode = child.getRootNode && child.getRootNode(); // First, attempt with faster native method\n\n if (parent.contains(child)) {\n return true;\n } // then fallback to custom implementation with Shadow DOM support\n else if (rootNode && isShadowRoot(rootNode)) {\n var next = child;\n\n do {\n if (next && parent.isSameNode(next)) {\n return true;\n } // $FlowFixMe[prop-missing]: need a better way to handle this...\n\n\n next = next.parentNode || next.host;\n } while (next);\n } // Give up, the result is false\n\n\n return false;\n}","import getWindow from \"./getWindow.js\";\nexport default function getComputedStyle(element) {\n return getWindow(element).getComputedStyle(element);\n}","import getNodeName from \"./getNodeName.js\";\nexport default function isTableElement(element) {\n return ['table', 'td', 'th'].indexOf(getNodeName(element)) >= 0;\n}","import { isElement } from \"./instanceOf.js\";\nexport default function getDocumentElement(element) {\n // $FlowFixMe[incompatible-return]: assume body is always available\n return ((isElement(element) ? element.ownerDocument : // $FlowFixMe[prop-missing]\n element.document) || window.document).documentElement;\n}","import getNodeName from \"./getNodeName.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport { isShadowRoot } from \"./instanceOf.js\";\nexport default function getParentNode(element) {\n if (getNodeName(element) === 'html') {\n return element;\n }\n\n return (// this is a quicker (but less type safe) way to save quite some bytes from the bundle\n // $FlowFixMe[incompatible-return]\n // $FlowFixMe[prop-missing]\n element.assignedSlot || // step into the shadow DOM of the parent of a slotted node\n element.parentNode || ( // DOM Element detected\n isShadowRoot(element) ? element.host : null) || // ShadowRoot detected\n // $FlowFixMe[incompatible-call]: HTMLElement is a Node\n getDocumentElement(element) // fallback\n\n );\n}","import getWindow from \"./getWindow.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport { isHTMLElement, isShadowRoot } from \"./instanceOf.js\";\nimport isTableElement from \"./isTableElement.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport getUAString from \"../utils/userAgent.js\";\n\nfunction getTrueOffsetParent(element) {\n if (!isHTMLElement(element) || // https://github.com/popperjs/popper-core/issues/837\n getComputedStyle(element).position === 'fixed') {\n return null;\n }\n\n return element.offsetParent;\n} // `.offsetParent` reports `null` for fixed elements, while absolute elements\n// return the containing block\n\n\nfunction getContainingBlock(element) {\n var isFirefox = /firefox/i.test(getUAString());\n var isIE = /Trident/i.test(getUAString());\n\n if (isIE && isHTMLElement(element)) {\n // In IE 9, 10 and 11 fixed elements containing block is always established by the viewport\n var elementCss = getComputedStyle(element);\n\n if (elementCss.position === 'fixed') {\n return null;\n }\n }\n\n var currentNode = getParentNode(element);\n\n if (isShadowRoot(currentNode)) {\n currentNode = currentNode.host;\n }\n\n while (isHTMLElement(currentNode) && ['html', 'body'].indexOf(getNodeName(currentNode)) < 0) {\n var css = getComputedStyle(currentNode); // This is non-exhaustive but covers the most common CSS properties that\n // create a containing block.\n // https://developer.mozilla.org/en-US/docs/Web/CSS/Containing_block#identifying_the_containing_block\n\n if (css.transform !== 'none' || css.perspective !== 'none' || css.contain === 'paint' || ['transform', 'perspective'].indexOf(css.willChange) !== -1 || isFirefox && css.willChange === 'filter' || isFirefox && css.filter && css.filter !== 'none') {\n return currentNode;\n } else {\n currentNode = currentNode.parentNode;\n }\n }\n\n return null;\n} // Gets the closest ancestor positioned element. Handles some edge cases,\n// such as table ancestors and cross browser bugs.\n\n\nexport default function getOffsetParent(element) {\n var window = getWindow(element);\n var offsetParent = getTrueOffsetParent(element);\n\n while (offsetParent && isTableElement(offsetParent) && getComputedStyle(offsetParent).position === 'static') {\n offsetParent = getTrueOffsetParent(offsetParent);\n }\n\n if (offsetParent && (getNodeName(offsetParent) === 'html' || getNodeName(offsetParent) === 'body' && getComputedStyle(offsetParent).position === 'static')) {\n return window;\n }\n\n return offsetParent || getContainingBlock(element) || window;\n}","export default function getMainAxisFromPlacement(placement) {\n return ['top', 'bottom'].indexOf(placement) >= 0 ? 'x' : 'y';\n}","import { max as mathMax, min as mathMin } from \"./math.js\";\nexport function within(min, value, max) {\n return mathMax(min, mathMin(value, max));\n}\nexport function withinMaxClamp(min, value, max) {\n var v = within(min, value, max);\n return v > max ? max : v;\n}","import getFreshSideObject from \"./getFreshSideObject.js\";\nexport default function mergePaddingObject(paddingObject) {\n return Object.assign({}, getFreshSideObject(), paddingObject);\n}","export default function getFreshSideObject() {\n return {\n top: 0,\n right: 0,\n bottom: 0,\n left: 0\n };\n}","export default function expandToHashMap(value, keys) {\n return keys.reduce(function (hashMap, key) {\n hashMap[key] = value;\n return hashMap;\n }, {});\n}","import getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getLayoutRect from \"../dom-utils/getLayoutRect.js\";\nimport contains from \"../dom-utils/contains.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport getMainAxisFromPlacement from \"../utils/getMainAxisFromPlacement.js\";\nimport { within } from \"../utils/within.js\";\nimport mergePaddingObject from \"../utils/mergePaddingObject.js\";\nimport expandToHashMap from \"../utils/expandToHashMap.js\";\nimport { left, right, basePlacements, top, bottom } from \"../enums.js\";\nimport { isHTMLElement } from \"../dom-utils/instanceOf.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar toPaddingObject = function toPaddingObject(padding, state) {\n padding = typeof padding === 'function' ? padding(Object.assign({}, state.rects, {\n placement: state.placement\n })) : padding;\n return mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements));\n};\n\nfunction arrow(_ref) {\n var _state$modifiersData$;\n\n var state = _ref.state,\n name = _ref.name,\n options = _ref.options;\n var arrowElement = state.elements.arrow;\n var popperOffsets = state.modifiersData.popperOffsets;\n var basePlacement = getBasePlacement(state.placement);\n var axis = getMainAxisFromPlacement(basePlacement);\n var isVertical = [left, right].indexOf(basePlacement) >= 0;\n var len = isVertical ? 'height' : 'width';\n\n if (!arrowElement || !popperOffsets) {\n return;\n }\n\n var paddingObject = toPaddingObject(options.padding, state);\n var arrowRect = getLayoutRect(arrowElement);\n var minProp = axis === 'y' ? top : left;\n var maxProp = axis === 'y' ? bottom : right;\n var endDiff = state.rects.reference[len] + state.rects.reference[axis] - popperOffsets[axis] - state.rects.popper[len];\n var startDiff = popperOffsets[axis] - state.rects.reference[axis];\n var arrowOffsetParent = getOffsetParent(arrowElement);\n var clientSize = arrowOffsetParent ? axis === 'y' ? arrowOffsetParent.clientHeight || 0 : arrowOffsetParent.clientWidth || 0 : 0;\n var centerToReference = endDiff / 2 - startDiff / 2; // Make sure the arrow doesn't overflow the popper if the center point is\n // outside of the popper bounds\n\n var min = paddingObject[minProp];\n var max = clientSize - arrowRect[len] - paddingObject[maxProp];\n var center = clientSize / 2 - arrowRect[len] / 2 + centerToReference;\n var offset = within(min, center, max); // Prevents breaking syntax highlighting...\n\n var axisProp = axis;\n state.modifiersData[name] = (_state$modifiersData$ = {}, _state$modifiersData$[axisProp] = offset, _state$modifiersData$.centerOffset = offset - center, _state$modifiersData$);\n}\n\nfunction effect(_ref2) {\n var state = _ref2.state,\n options = _ref2.options;\n var _options$element = options.element,\n arrowElement = _options$element === void 0 ? '[data-popper-arrow]' : _options$element;\n\n if (arrowElement == null) {\n return;\n } // CSS selector\n\n\n if (typeof arrowElement === 'string') {\n arrowElement = state.elements.popper.querySelector(arrowElement);\n\n if (!arrowElement) {\n return;\n }\n }\n\n if (process.env.NODE_ENV !== \"production\") {\n if (!isHTMLElement(arrowElement)) {\n console.error(['Popper: \"arrow\" element must be an HTMLElement (not an SVGElement).', 'To use an SVG arrow, wrap it in an HTMLElement that will be used as', 'the arrow.'].join(' '));\n }\n }\n\n if (!contains(state.elements.popper, arrowElement)) {\n if (process.env.NODE_ENV !== \"production\") {\n console.error(['Popper: \"arrow\" modifier\\'s `element` must be a child of the popper', 'element.'].join(' '));\n }\n\n return;\n }\n\n state.elements.arrow = arrowElement;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'arrow',\n enabled: true,\n phase: 'main',\n fn: arrow,\n effect: effect,\n requires: ['popperOffsets'],\n requiresIfExists: ['preventOverflow']\n};","export default function getVariation(placement) {\n return placement.split('-')[1];\n}","import { top, left, right, bottom, end } from \"../enums.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport getWindow from \"../dom-utils/getWindow.js\";\nimport getDocumentElement from \"../dom-utils/getDocumentElement.js\";\nimport getComputedStyle from \"../dom-utils/getComputedStyle.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getVariation from \"../utils/getVariation.js\";\nimport { round } from \"../utils/math.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar unsetSides = {\n top: 'auto',\n right: 'auto',\n bottom: 'auto',\n left: 'auto'\n}; // Round the offsets to the nearest suitable subpixel based on the DPR.\n// Zooming can change the DPR, but it seems to report a value that will\n// cleanly divide the values into the appropriate subpixels.\n\nfunction roundOffsetsByDPR(_ref, win) {\n var x = _ref.x,\n y = _ref.y;\n var dpr = win.devicePixelRatio || 1;\n return {\n x: round(x * dpr) / dpr || 0,\n y: round(y * dpr) / dpr || 0\n };\n}\n\nexport function mapToStyles(_ref2) {\n var _Object$assign2;\n\n var popper = _ref2.popper,\n popperRect = _ref2.popperRect,\n placement = _ref2.placement,\n variation = _ref2.variation,\n offsets = _ref2.offsets,\n position = _ref2.position,\n gpuAcceleration = _ref2.gpuAcceleration,\n adaptive = _ref2.adaptive,\n roundOffsets = _ref2.roundOffsets,\n isFixed = _ref2.isFixed;\n var _offsets$x = offsets.x,\n x = _offsets$x === void 0 ? 0 : _offsets$x,\n _offsets$y = offsets.y,\n y = _offsets$y === void 0 ? 0 : _offsets$y;\n\n var _ref3 = typeof roundOffsets === 'function' ? roundOffsets({\n x: x,\n y: y\n }) : {\n x: x,\n y: y\n };\n\n x = _ref3.x;\n y = _ref3.y;\n var hasX = offsets.hasOwnProperty('x');\n var hasY = offsets.hasOwnProperty('y');\n var sideX = left;\n var sideY = top;\n var win = window;\n\n if (adaptive) {\n var offsetParent = getOffsetParent(popper);\n var heightProp = 'clientHeight';\n var widthProp = 'clientWidth';\n\n if (offsetParent === getWindow(popper)) {\n offsetParent = getDocumentElement(popper);\n\n if (getComputedStyle(offsetParent).position !== 'static' && position === 'absolute') {\n heightProp = 'scrollHeight';\n widthProp = 'scrollWidth';\n }\n } // $FlowFixMe[incompatible-cast]: force type refinement, we compare offsetParent with window above, but Flow doesn't detect it\n\n\n offsetParent = offsetParent;\n\n if (placement === top || (placement === left || placement === right) && variation === end) {\n sideY = bottom;\n var offsetY = isFixed && offsetParent === win && win.visualViewport ? win.visualViewport.height : // $FlowFixMe[prop-missing]\n offsetParent[heightProp];\n y -= offsetY - popperRect.height;\n y *= gpuAcceleration ? 1 : -1;\n }\n\n if (placement === left || (placement === top || placement === bottom) && variation === end) {\n sideX = right;\n var offsetX = isFixed && offsetParent === win && win.visualViewport ? win.visualViewport.width : // $FlowFixMe[prop-missing]\n offsetParent[widthProp];\n x -= offsetX - popperRect.width;\n x *= gpuAcceleration ? 1 : -1;\n }\n }\n\n var commonStyles = Object.assign({\n position: position\n }, adaptive && unsetSides);\n\n var _ref4 = roundOffsets === true ? roundOffsetsByDPR({\n x: x,\n y: y\n }, getWindow(popper)) : {\n x: x,\n y: y\n };\n\n x = _ref4.x;\n y = _ref4.y;\n\n if (gpuAcceleration) {\n var _Object$assign;\n\n return Object.assign({}, commonStyles, (_Object$assign = {}, _Object$assign[sideY] = hasY ? '0' : '', _Object$assign[sideX] = hasX ? '0' : '', _Object$assign.transform = (win.devicePixelRatio || 1) <= 1 ? \"translate(\" + x + \"px, \" + y + \"px)\" : \"translate3d(\" + x + \"px, \" + y + \"px, 0)\", _Object$assign));\n }\n\n return Object.assign({}, commonStyles, (_Object$assign2 = {}, _Object$assign2[sideY] = hasY ? y + \"px\" : '', _Object$assign2[sideX] = hasX ? x + \"px\" : '', _Object$assign2.transform = '', _Object$assign2));\n}\n\nfunction computeStyles(_ref5) {\n var state = _ref5.state,\n options = _ref5.options;\n var _options$gpuAccelerat = options.gpuAcceleration,\n gpuAcceleration = _options$gpuAccelerat === void 0 ? true : _options$gpuAccelerat,\n _options$adaptive = options.adaptive,\n adaptive = _options$adaptive === void 0 ? true : _options$adaptive,\n _options$roundOffsets = options.roundOffsets,\n roundOffsets = _options$roundOffsets === void 0 ? true : _options$roundOffsets;\n\n if (process.env.NODE_ENV !== \"production\") {\n var transitionProperty = getComputedStyle(state.elements.popper).transitionProperty || '';\n\n if (adaptive && ['transform', 'top', 'right', 'bottom', 'left'].some(function (property) {\n return transitionProperty.indexOf(property) >= 0;\n })) {\n console.warn(['Popper: Detected CSS transitions on at least one of the following', 'CSS properties: \"transform\", \"top\", \"right\", \"bottom\", \"left\".', '\\n\\n', 'Disable the \"computeStyles\" modifier\\'s `adaptive` option to allow', 'for smooth transitions, or remove these properties from the CSS', 'transition declaration on the popper element if only transitioning', 'opacity or background-color for example.', '\\n\\n', 'We recommend using the popper element as a wrapper around an inner', 'element that can have any CSS property transitioned for animations.'].join(' '));\n }\n }\n\n var commonStyles = {\n placement: getBasePlacement(state.placement),\n variation: getVariation(state.placement),\n popper: state.elements.popper,\n popperRect: state.rects.popper,\n gpuAcceleration: gpuAcceleration,\n isFixed: state.options.strategy === 'fixed'\n };\n\n if (state.modifiersData.popperOffsets != null) {\n state.styles.popper = Object.assign({}, state.styles.popper, mapToStyles(Object.assign({}, commonStyles, {\n offsets: state.modifiersData.popperOffsets,\n position: state.options.strategy,\n adaptive: adaptive,\n roundOffsets: roundOffsets\n })));\n }\n\n if (state.modifiersData.arrow != null) {\n state.styles.arrow = Object.assign({}, state.styles.arrow, mapToStyles(Object.assign({}, commonStyles, {\n offsets: state.modifiersData.arrow,\n position: 'absolute',\n adaptive: false,\n roundOffsets: roundOffsets\n })));\n }\n\n state.attributes.popper = Object.assign({}, state.attributes.popper, {\n 'data-popper-placement': state.placement\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'computeStyles',\n enabled: true,\n phase: 'beforeWrite',\n fn: computeStyles,\n data: {}\n};","import getWindow from \"../dom-utils/getWindow.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar passive = {\n passive: true\n};\n\nfunction effect(_ref) {\n var state = _ref.state,\n instance = _ref.instance,\n options = _ref.options;\n var _options$scroll = options.scroll,\n scroll = _options$scroll === void 0 ? true : _options$scroll,\n _options$resize = options.resize,\n resize = _options$resize === void 0 ? true : _options$resize;\n var window = getWindow(state.elements.popper);\n var scrollParents = [].concat(state.scrollParents.reference, state.scrollParents.popper);\n\n if (scroll) {\n scrollParents.forEach(function (scrollParent) {\n scrollParent.addEventListener('scroll', instance.update, passive);\n });\n }\n\n if (resize) {\n window.addEventListener('resize', instance.update, passive);\n }\n\n return function () {\n if (scroll) {\n scrollParents.forEach(function (scrollParent) {\n scrollParent.removeEventListener('scroll', instance.update, passive);\n });\n }\n\n if (resize) {\n window.removeEventListener('resize', instance.update, passive);\n }\n };\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'eventListeners',\n enabled: true,\n phase: 'write',\n fn: function fn() {},\n effect: effect,\n data: {}\n};","var hash = {\n left: 'right',\n right: 'left',\n bottom: 'top',\n top: 'bottom'\n};\nexport default function getOppositePlacement(placement) {\n return placement.replace(/left|right|bottom|top/g, function (matched) {\n return hash[matched];\n });\n}","var hash = {\n start: 'end',\n end: 'start'\n};\nexport default function getOppositeVariationPlacement(placement) {\n return placement.replace(/start|end/g, function (matched) {\n return hash[matched];\n });\n}","import getWindow from \"./getWindow.js\";\nexport default function getWindowScroll(node) {\n var win = getWindow(node);\n var scrollLeft = win.pageXOffset;\n var scrollTop = win.pageYOffset;\n return {\n scrollLeft: scrollLeft,\n scrollTop: scrollTop\n };\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getWindowScroll from \"./getWindowScroll.js\";\nexport default function getWindowScrollBarX(element) {\n // If has a CSS width greater than the viewport, then this will be\n // incorrect for RTL.\n // Popper 1 is broken in this case and never had a bug report so let's assume\n // it's not an issue. I don't think anyone ever specifies width on \n // anyway.\n // Browsers where the left scrollbar doesn't cause an issue report `0` for\n // this (e.g. Edge 2019, IE11, Safari)\n return getBoundingClientRect(getDocumentElement(element)).left + getWindowScroll(element).scrollLeft;\n}","import getComputedStyle from \"./getComputedStyle.js\";\nexport default function isScrollParent(element) {\n // Firefox wants us to check `-x` and `-y` variations as well\n var _getComputedStyle = getComputedStyle(element),\n overflow = _getComputedStyle.overflow,\n overflowX = _getComputedStyle.overflowX,\n overflowY = _getComputedStyle.overflowY;\n\n return /auto|scroll|overlay|hidden/.test(overflow + overflowY + overflowX);\n}","import getParentNode from \"./getParentNode.js\";\nimport isScrollParent from \"./isScrollParent.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nexport default function getScrollParent(node) {\n if (['html', 'body', '#document'].indexOf(getNodeName(node)) >= 0) {\n // $FlowFixMe[incompatible-return]: assume body is always available\n return node.ownerDocument.body;\n }\n\n if (isHTMLElement(node) && isScrollParent(node)) {\n return node;\n }\n\n return getScrollParent(getParentNode(node));\n}","import getScrollParent from \"./getScrollParent.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport getWindow from \"./getWindow.js\";\nimport isScrollParent from \"./isScrollParent.js\";\n/*\ngiven a DOM element, return the list of all scroll parents, up the list of ancesors\nuntil we get to the top window object. This list is what we attach scroll listeners\nto, because if any of these parent elements scroll, we'll need to re-calculate the\nreference element's position.\n*/\n\nexport default function listScrollParents(element, list) {\n var _element$ownerDocumen;\n\n if (list === void 0) {\n list = [];\n }\n\n var scrollParent = getScrollParent(element);\n var isBody = scrollParent === ((_element$ownerDocumen = element.ownerDocument) == null ? void 0 : _element$ownerDocumen.body);\n var win = getWindow(scrollParent);\n var target = isBody ? [win].concat(win.visualViewport || [], isScrollParent(scrollParent) ? scrollParent : []) : scrollParent;\n var updatedList = list.concat(target);\n return isBody ? updatedList : // $FlowFixMe[incompatible-call]: isBody tells us target will be an HTMLElement here\n updatedList.concat(listScrollParents(getParentNode(target)));\n}","export default function rectToClientRect(rect) {\n return Object.assign({}, rect, {\n left: rect.x,\n top: rect.y,\n right: rect.x + rect.width,\n bottom: rect.y + rect.height\n });\n}","import { viewport } from \"../enums.js\";\nimport getViewportRect from \"./getViewportRect.js\";\nimport getDocumentRect from \"./getDocumentRect.js\";\nimport listScrollParents from \"./listScrollParents.js\";\nimport getOffsetParent from \"./getOffsetParent.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport { isElement, isHTMLElement } from \"./instanceOf.js\";\nimport getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport contains from \"./contains.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport rectToClientRect from \"../utils/rectToClientRect.js\";\nimport { max, min } from \"../utils/math.js\";\n\nfunction getInnerBoundingClientRect(element, strategy) {\n var rect = getBoundingClientRect(element, false, strategy === 'fixed');\n rect.top = rect.top + element.clientTop;\n rect.left = rect.left + element.clientLeft;\n rect.bottom = rect.top + element.clientHeight;\n rect.right = rect.left + element.clientWidth;\n rect.width = element.clientWidth;\n rect.height = element.clientHeight;\n rect.x = rect.left;\n rect.y = rect.top;\n return rect;\n}\n\nfunction getClientRectFromMixedType(element, clippingParent, strategy) {\n return clippingParent === viewport ? rectToClientRect(getViewportRect(element, strategy)) : isElement(clippingParent) ? getInnerBoundingClientRect(clippingParent, strategy) : rectToClientRect(getDocumentRect(getDocumentElement(element)));\n} // A \"clipping parent\" is an overflowable container with the characteristic of\n// clipping (or hiding) overflowing elements with a position different from\n// `initial`\n\n\nfunction getClippingParents(element) {\n var clippingParents = listScrollParents(getParentNode(element));\n var canEscapeClipping = ['absolute', 'fixed'].indexOf(getComputedStyle(element).position) >= 0;\n var clipperElement = canEscapeClipping && isHTMLElement(element) ? getOffsetParent(element) : element;\n\n if (!isElement(clipperElement)) {\n return [];\n } // $FlowFixMe[incompatible-return]: https://github.com/facebook/flow/issues/1414\n\n\n return clippingParents.filter(function (clippingParent) {\n return isElement(clippingParent) && contains(clippingParent, clipperElement) && getNodeName(clippingParent) !== 'body';\n });\n} // Gets the maximum area that the element is visible in due to any number of\n// clipping parents\n\n\nexport default function getClippingRect(element, boundary, rootBoundary, strategy) {\n var mainClippingParents = boundary === 'clippingParents' ? getClippingParents(element) : [].concat(boundary);\n var clippingParents = [].concat(mainClippingParents, [rootBoundary]);\n var firstClippingParent = clippingParents[0];\n var clippingRect = clippingParents.reduce(function (accRect, clippingParent) {\n var rect = getClientRectFromMixedType(element, clippingParent, strategy);\n accRect.top = max(rect.top, accRect.top);\n accRect.right = min(rect.right, accRect.right);\n accRect.bottom = min(rect.bottom, accRect.bottom);\n accRect.left = max(rect.left, accRect.left);\n return accRect;\n }, getClientRectFromMixedType(element, firstClippingParent, strategy));\n clippingRect.width = clippingRect.right - clippingRect.left;\n clippingRect.height = clippingRect.bottom - clippingRect.top;\n clippingRect.x = clippingRect.left;\n clippingRect.y = clippingRect.top;\n return clippingRect;\n}","import getWindow from \"./getWindow.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport isLayoutViewport from \"./isLayoutViewport.js\";\nexport default function getViewportRect(element, strategy) {\n var win = getWindow(element);\n var html = getDocumentElement(element);\n var visualViewport = win.visualViewport;\n var width = html.clientWidth;\n var height = html.clientHeight;\n var x = 0;\n var y = 0;\n\n if (visualViewport) {\n width = visualViewport.width;\n height = visualViewport.height;\n var layoutViewport = isLayoutViewport();\n\n if (layoutViewport || !layoutViewport && strategy === 'fixed') {\n x = visualViewport.offsetLeft;\n y = visualViewport.offsetTop;\n }\n }\n\n return {\n width: width,\n height: height,\n x: x + getWindowScrollBarX(element),\n y: y\n };\n}","import getDocumentElement from \"./getDocumentElement.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport getWindowScroll from \"./getWindowScroll.js\";\nimport { max } from \"../utils/math.js\"; // Gets the entire size of the scrollable document area, even extending outside\n// of the `` and `` rect bounds if horizontally scrollable\n\nexport default function getDocumentRect(element) {\n var _element$ownerDocumen;\n\n var html = getDocumentElement(element);\n var winScroll = getWindowScroll(element);\n var body = (_element$ownerDocumen = element.ownerDocument) == null ? void 0 : _element$ownerDocumen.body;\n var width = max(html.scrollWidth, html.clientWidth, body ? body.scrollWidth : 0, body ? body.clientWidth : 0);\n var height = max(html.scrollHeight, html.clientHeight, body ? body.scrollHeight : 0, body ? body.clientHeight : 0);\n var x = -winScroll.scrollLeft + getWindowScrollBarX(element);\n var y = -winScroll.scrollTop;\n\n if (getComputedStyle(body || html).direction === 'rtl') {\n x += max(html.clientWidth, body ? body.clientWidth : 0) - width;\n }\n\n return {\n width: width,\n height: height,\n x: x,\n y: y\n };\n}","import getBasePlacement from \"./getBasePlacement.js\";\nimport getVariation from \"./getVariation.js\";\nimport getMainAxisFromPlacement from \"./getMainAxisFromPlacement.js\";\nimport { top, right, bottom, left, start, end } from \"../enums.js\";\nexport default function computeOffsets(_ref) {\n var reference = _ref.reference,\n element = _ref.element,\n placement = _ref.placement;\n var basePlacement = placement ? getBasePlacement(placement) : null;\n var variation = placement ? getVariation(placement) : null;\n var commonX = reference.x + reference.width / 2 - element.width / 2;\n var commonY = reference.y + reference.height / 2 - element.height / 2;\n var offsets;\n\n switch (basePlacement) {\n case top:\n offsets = {\n x: commonX,\n y: reference.y - element.height\n };\n break;\n\n case bottom:\n offsets = {\n x: commonX,\n y: reference.y + reference.height\n };\n break;\n\n case right:\n offsets = {\n x: reference.x + reference.width,\n y: commonY\n };\n break;\n\n case left:\n offsets = {\n x: reference.x - element.width,\n y: commonY\n };\n break;\n\n default:\n offsets = {\n x: reference.x,\n y: reference.y\n };\n }\n\n var mainAxis = basePlacement ? getMainAxisFromPlacement(basePlacement) : null;\n\n if (mainAxis != null) {\n var len = mainAxis === 'y' ? 'height' : 'width';\n\n switch (variation) {\n case start:\n offsets[mainAxis] = offsets[mainAxis] - (reference[len] / 2 - element[len] / 2);\n break;\n\n case end:\n offsets[mainAxis] = offsets[mainAxis] + (reference[len] / 2 - element[len] / 2);\n break;\n\n default:\n }\n }\n\n return offsets;\n}","import getClippingRect from \"../dom-utils/getClippingRect.js\";\nimport getDocumentElement from \"../dom-utils/getDocumentElement.js\";\nimport getBoundingClientRect from \"../dom-utils/getBoundingClientRect.js\";\nimport computeOffsets from \"./computeOffsets.js\";\nimport rectToClientRect from \"./rectToClientRect.js\";\nimport { clippingParents, reference, popper, bottom, top, right, basePlacements, viewport } from \"../enums.js\";\nimport { isElement } from \"../dom-utils/instanceOf.js\";\nimport mergePaddingObject from \"./mergePaddingObject.js\";\nimport expandToHashMap from \"./expandToHashMap.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport default function detectOverflow(state, options) {\n if (options === void 0) {\n options = {};\n }\n\n var _options = options,\n _options$placement = _options.placement,\n placement = _options$placement === void 0 ? state.placement : _options$placement,\n _options$strategy = _options.strategy,\n strategy = _options$strategy === void 0 ? state.strategy : _options$strategy,\n _options$boundary = _options.boundary,\n boundary = _options$boundary === void 0 ? clippingParents : _options$boundary,\n _options$rootBoundary = _options.rootBoundary,\n rootBoundary = _options$rootBoundary === void 0 ? viewport : _options$rootBoundary,\n _options$elementConte = _options.elementContext,\n elementContext = _options$elementConte === void 0 ? popper : _options$elementConte,\n _options$altBoundary = _options.altBoundary,\n altBoundary = _options$altBoundary === void 0 ? false : _options$altBoundary,\n _options$padding = _options.padding,\n padding = _options$padding === void 0 ? 0 : _options$padding;\n var paddingObject = mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements));\n var altContext = elementContext === popper ? reference : popper;\n var popperRect = state.rects.popper;\n var element = state.elements[altBoundary ? altContext : elementContext];\n var clippingClientRect = getClippingRect(isElement(element) ? element : element.contextElement || getDocumentElement(state.elements.popper), boundary, rootBoundary, strategy);\n var referenceClientRect = getBoundingClientRect(state.elements.reference);\n var popperOffsets = computeOffsets({\n reference: referenceClientRect,\n element: popperRect,\n strategy: 'absolute',\n placement: placement\n });\n var popperClientRect = rectToClientRect(Object.assign({}, popperRect, popperOffsets));\n var elementClientRect = elementContext === popper ? popperClientRect : referenceClientRect; // positive = overflowing the clipping rect\n // 0 or negative = within the clipping rect\n\n var overflowOffsets = {\n top: clippingClientRect.top - elementClientRect.top + paddingObject.top,\n bottom: elementClientRect.bottom - clippingClientRect.bottom + paddingObject.bottom,\n left: clippingClientRect.left - elementClientRect.left + paddingObject.left,\n right: elementClientRect.right - clippingClientRect.right + paddingObject.right\n };\n var offsetData = state.modifiersData.offset; // Offsets can be applied only to the popper element\n\n if (elementContext === popper && offsetData) {\n var offset = offsetData[placement];\n Object.keys(overflowOffsets).forEach(function (key) {\n var multiply = [right, bottom].indexOf(key) >= 0 ? 1 : -1;\n var axis = [top, bottom].indexOf(key) >= 0 ? 'y' : 'x';\n overflowOffsets[key] += offset[axis] * multiply;\n });\n }\n\n return overflowOffsets;\n}","import getOppositePlacement from \"../utils/getOppositePlacement.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getOppositeVariationPlacement from \"../utils/getOppositeVariationPlacement.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\nimport computeAutoPlacement from \"../utils/computeAutoPlacement.js\";\nimport { bottom, top, start, right, left, auto } from \"../enums.js\";\nimport getVariation from \"../utils/getVariation.js\"; // eslint-disable-next-line import/no-unused-modules\n\nfunction getExpandedFallbackPlacements(placement) {\n if (getBasePlacement(placement) === auto) {\n return [];\n }\n\n var oppositePlacement = getOppositePlacement(placement);\n return [getOppositeVariationPlacement(placement), oppositePlacement, getOppositeVariationPlacement(oppositePlacement)];\n}\n\nfunction flip(_ref) {\n var state = _ref.state,\n options = _ref.options,\n name = _ref.name;\n\n if (state.modifiersData[name]._skip) {\n return;\n }\n\n var _options$mainAxis = options.mainAxis,\n checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis,\n _options$altAxis = options.altAxis,\n checkAltAxis = _options$altAxis === void 0 ? true : _options$altAxis,\n specifiedFallbackPlacements = options.fallbackPlacements,\n padding = options.padding,\n boundary = options.boundary,\n rootBoundary = options.rootBoundary,\n altBoundary = options.altBoundary,\n _options$flipVariatio = options.flipVariations,\n flipVariations = _options$flipVariatio === void 0 ? true : _options$flipVariatio,\n allowedAutoPlacements = options.allowedAutoPlacements;\n var preferredPlacement = state.options.placement;\n var basePlacement = getBasePlacement(preferredPlacement);\n var isBasePlacement = basePlacement === preferredPlacement;\n var fallbackPlacements = specifiedFallbackPlacements || (isBasePlacement || !flipVariations ? [getOppositePlacement(preferredPlacement)] : getExpandedFallbackPlacements(preferredPlacement));\n var placements = [preferredPlacement].concat(fallbackPlacements).reduce(function (acc, placement) {\n return acc.concat(getBasePlacement(placement) === auto ? computeAutoPlacement(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding,\n flipVariations: flipVariations,\n allowedAutoPlacements: allowedAutoPlacements\n }) : placement);\n }, []);\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var checksMap = new Map();\n var makeFallbackChecks = true;\n var firstFittingPlacement = placements[0];\n\n for (var i = 0; i < placements.length; i++) {\n var placement = placements[i];\n\n var _basePlacement = getBasePlacement(placement);\n\n var isStartVariation = getVariation(placement) === start;\n var isVertical = [top, bottom].indexOf(_basePlacement) >= 0;\n var len = isVertical ? 'width' : 'height';\n var overflow = detectOverflow(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n altBoundary: altBoundary,\n padding: padding\n });\n var mainVariationSide = isVertical ? isStartVariation ? right : left : isStartVariation ? bottom : top;\n\n if (referenceRect[len] > popperRect[len]) {\n mainVariationSide = getOppositePlacement(mainVariationSide);\n }\n\n var altVariationSide = getOppositePlacement(mainVariationSide);\n var checks = [];\n\n if (checkMainAxis) {\n checks.push(overflow[_basePlacement] <= 0);\n }\n\n if (checkAltAxis) {\n checks.push(overflow[mainVariationSide] <= 0, overflow[altVariationSide] <= 0);\n }\n\n if (checks.every(function (check) {\n return check;\n })) {\n firstFittingPlacement = placement;\n makeFallbackChecks = false;\n break;\n }\n\n checksMap.set(placement, checks);\n }\n\n if (makeFallbackChecks) {\n // `2` may be desired in some cases – research later\n var numberOfChecks = flipVariations ? 3 : 1;\n\n var _loop = function _loop(_i) {\n var fittingPlacement = placements.find(function (placement) {\n var checks = checksMap.get(placement);\n\n if (checks) {\n return checks.slice(0, _i).every(function (check) {\n return check;\n });\n }\n });\n\n if (fittingPlacement) {\n firstFittingPlacement = fittingPlacement;\n return \"break\";\n }\n };\n\n for (var _i = numberOfChecks; _i > 0; _i--) {\n var _ret = _loop(_i);\n\n if (_ret === \"break\") break;\n }\n }\n\n if (state.placement !== firstFittingPlacement) {\n state.modifiersData[name]._skip = true;\n state.placement = firstFittingPlacement;\n state.reset = true;\n }\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'flip',\n enabled: true,\n phase: 'main',\n fn: flip,\n requiresIfExists: ['offset'],\n data: {\n _skip: false\n }\n};","import getVariation from \"./getVariation.js\";\nimport { variationPlacements, basePlacements, placements as allPlacements } from \"../enums.js\";\nimport detectOverflow from \"./detectOverflow.js\";\nimport getBasePlacement from \"./getBasePlacement.js\";\nexport default function computeAutoPlacement(state, options) {\n if (options === void 0) {\n options = {};\n }\n\n var _options = options,\n placement = _options.placement,\n boundary = _options.boundary,\n rootBoundary = _options.rootBoundary,\n padding = _options.padding,\n flipVariations = _options.flipVariations,\n _options$allowedAutoP = _options.allowedAutoPlacements,\n allowedAutoPlacements = _options$allowedAutoP === void 0 ? allPlacements : _options$allowedAutoP;\n var variation = getVariation(placement);\n var placements = variation ? flipVariations ? variationPlacements : variationPlacements.filter(function (placement) {\n return getVariation(placement) === variation;\n }) : basePlacements;\n var allowedPlacements = placements.filter(function (placement) {\n return allowedAutoPlacements.indexOf(placement) >= 0;\n });\n\n if (allowedPlacements.length === 0) {\n allowedPlacements = placements;\n\n if (process.env.NODE_ENV !== \"production\") {\n console.error(['Popper: The `allowedAutoPlacements` option did not allow any', 'placements. Ensure the `placement` option matches the variation', 'of the allowed placements.', 'For example, \"auto\" cannot be used to allow \"bottom-start\".', 'Use \"auto-start\" instead.'].join(' '));\n }\n } // $FlowFixMe[incompatible-type]: Flow seems to have problems with two array unions...\n\n\n var overflows = allowedPlacements.reduce(function (acc, placement) {\n acc[placement] = detectOverflow(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding\n })[getBasePlacement(placement)];\n return acc;\n }, {});\n return Object.keys(overflows).sort(function (a, b) {\n return overflows[a] - overflows[b];\n });\n}","import { top, bottom, left, right } from \"../enums.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\n\nfunction getSideOffsets(overflow, rect, preventedOffsets) {\n if (preventedOffsets === void 0) {\n preventedOffsets = {\n x: 0,\n y: 0\n };\n }\n\n return {\n top: overflow.top - rect.height - preventedOffsets.y,\n right: overflow.right - rect.width + preventedOffsets.x,\n bottom: overflow.bottom - rect.height + preventedOffsets.y,\n left: overflow.left - rect.width - preventedOffsets.x\n };\n}\n\nfunction isAnySideFullyClipped(overflow) {\n return [top, right, bottom, left].some(function (side) {\n return overflow[side] >= 0;\n });\n}\n\nfunction hide(_ref) {\n var state = _ref.state,\n name = _ref.name;\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var preventedOffsets = state.modifiersData.preventOverflow;\n var referenceOverflow = detectOverflow(state, {\n elementContext: 'reference'\n });\n var popperAltOverflow = detectOverflow(state, {\n altBoundary: true\n });\n var referenceClippingOffsets = getSideOffsets(referenceOverflow, referenceRect);\n var popperEscapeOffsets = getSideOffsets(popperAltOverflow, popperRect, preventedOffsets);\n var isReferenceHidden = isAnySideFullyClipped(referenceClippingOffsets);\n var hasPopperEscaped = isAnySideFullyClipped(popperEscapeOffsets);\n state.modifiersData[name] = {\n referenceClippingOffsets: referenceClippingOffsets,\n popperEscapeOffsets: popperEscapeOffsets,\n isReferenceHidden: isReferenceHidden,\n hasPopperEscaped: hasPopperEscaped\n };\n state.attributes.popper = Object.assign({}, state.attributes.popper, {\n 'data-popper-reference-hidden': isReferenceHidden,\n 'data-popper-escaped': hasPopperEscaped\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'hide',\n enabled: true,\n phase: 'main',\n requiresIfExists: ['preventOverflow'],\n fn: hide\n};","import getBasePlacement from \"../utils/getBasePlacement.js\";\nimport { top, left, right, placements } from \"../enums.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport function distanceAndSkiddingToXY(placement, rects, offset) {\n var basePlacement = getBasePlacement(placement);\n var invertDistance = [left, top].indexOf(basePlacement) >= 0 ? -1 : 1;\n\n var _ref = typeof offset === 'function' ? offset(Object.assign({}, rects, {\n placement: placement\n })) : offset,\n skidding = _ref[0],\n distance = _ref[1];\n\n skidding = skidding || 0;\n distance = (distance || 0) * invertDistance;\n return [left, right].indexOf(basePlacement) >= 0 ? {\n x: distance,\n y: skidding\n } : {\n x: skidding,\n y: distance\n };\n}\n\nfunction offset(_ref2) {\n var state = _ref2.state,\n options = _ref2.options,\n name = _ref2.name;\n var _options$offset = options.offset,\n offset = _options$offset === void 0 ? [0, 0] : _options$offset;\n var data = placements.reduce(function (acc, placement) {\n acc[placement] = distanceAndSkiddingToXY(placement, state.rects, offset);\n return acc;\n }, {});\n var _data$state$placement = data[state.placement],\n x = _data$state$placement.x,\n y = _data$state$placement.y;\n\n if (state.modifiersData.popperOffsets != null) {\n state.modifiersData.popperOffsets.x += x;\n state.modifiersData.popperOffsets.y += y;\n }\n\n state.modifiersData[name] = data;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'offset',\n enabled: true,\n phase: 'main',\n requires: ['popperOffsets'],\n fn: offset\n};","import computeOffsets from \"../utils/computeOffsets.js\";\n\nfunction popperOffsets(_ref) {\n var state = _ref.state,\n name = _ref.name;\n // Offsets are the actual position the popper needs to have to be\n // properly positioned near its reference element\n // This is the most basic placement, and will be adjusted by\n // the modifiers in the next step\n state.modifiersData[name] = computeOffsets({\n reference: state.rects.reference,\n element: state.rects.popper,\n strategy: 'absolute',\n placement: state.placement\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'popperOffsets',\n enabled: true,\n phase: 'read',\n fn: popperOffsets,\n data: {}\n};","import { top, left, right, bottom, start } from \"../enums.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getMainAxisFromPlacement from \"../utils/getMainAxisFromPlacement.js\";\nimport getAltAxis from \"../utils/getAltAxis.js\";\nimport { within, withinMaxClamp } from \"../utils/within.js\";\nimport getLayoutRect from \"../dom-utils/getLayoutRect.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\nimport getVariation from \"../utils/getVariation.js\";\nimport getFreshSideObject from \"../utils/getFreshSideObject.js\";\nimport { min as mathMin, max as mathMax } from \"../utils/math.js\";\n\nfunction preventOverflow(_ref) {\n var state = _ref.state,\n options = _ref.options,\n name = _ref.name;\n var _options$mainAxis = options.mainAxis,\n checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis,\n _options$altAxis = options.altAxis,\n checkAltAxis = _options$altAxis === void 0 ? false : _options$altAxis,\n boundary = options.boundary,\n rootBoundary = options.rootBoundary,\n altBoundary = options.altBoundary,\n padding = options.padding,\n _options$tether = options.tether,\n tether = _options$tether === void 0 ? true : _options$tether,\n _options$tetherOffset = options.tetherOffset,\n tetherOffset = _options$tetherOffset === void 0 ? 0 : _options$tetherOffset;\n var overflow = detectOverflow(state, {\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding,\n altBoundary: altBoundary\n });\n var basePlacement = getBasePlacement(state.placement);\n var variation = getVariation(state.placement);\n var isBasePlacement = !variation;\n var mainAxis = getMainAxisFromPlacement(basePlacement);\n var altAxis = getAltAxis(mainAxis);\n var popperOffsets = state.modifiersData.popperOffsets;\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var tetherOffsetValue = typeof tetherOffset === 'function' ? tetherOffset(Object.assign({}, state.rects, {\n placement: state.placement\n })) : tetherOffset;\n var normalizedTetherOffsetValue = typeof tetherOffsetValue === 'number' ? {\n mainAxis: tetherOffsetValue,\n altAxis: tetherOffsetValue\n } : Object.assign({\n mainAxis: 0,\n altAxis: 0\n }, tetherOffsetValue);\n var offsetModifierState = state.modifiersData.offset ? state.modifiersData.offset[state.placement] : null;\n var data = {\n x: 0,\n y: 0\n };\n\n if (!popperOffsets) {\n return;\n }\n\n if (checkMainAxis) {\n var _offsetModifierState$;\n\n var mainSide = mainAxis === 'y' ? top : left;\n var altSide = mainAxis === 'y' ? bottom : right;\n var len = mainAxis === 'y' ? 'height' : 'width';\n var offset = popperOffsets[mainAxis];\n var min = offset + overflow[mainSide];\n var max = offset - overflow[altSide];\n var additive = tether ? -popperRect[len] / 2 : 0;\n var minLen = variation === start ? referenceRect[len] : popperRect[len];\n var maxLen = variation === start ? -popperRect[len] : -referenceRect[len]; // We need to include the arrow in the calculation so the arrow doesn't go\n // outside the reference bounds\n\n var arrowElement = state.elements.arrow;\n var arrowRect = tether && arrowElement ? getLayoutRect(arrowElement) : {\n width: 0,\n height: 0\n };\n var arrowPaddingObject = state.modifiersData['arrow#persistent'] ? state.modifiersData['arrow#persistent'].padding : getFreshSideObject();\n var arrowPaddingMin = arrowPaddingObject[mainSide];\n var arrowPaddingMax = arrowPaddingObject[altSide]; // If the reference length is smaller than the arrow length, we don't want\n // to include its full size in the calculation. If the reference is small\n // and near the edge of a boundary, the popper can overflow even if the\n // reference is not overflowing as well (e.g. virtual elements with no\n // width or height)\n\n var arrowLen = within(0, referenceRect[len], arrowRect[len]);\n var minOffset = isBasePlacement ? referenceRect[len] / 2 - additive - arrowLen - arrowPaddingMin - normalizedTetherOffsetValue.mainAxis : minLen - arrowLen - arrowPaddingMin - normalizedTetherOffsetValue.mainAxis;\n var maxOffset = isBasePlacement ? -referenceRect[len] / 2 + additive + arrowLen + arrowPaddingMax + normalizedTetherOffsetValue.mainAxis : maxLen + arrowLen + arrowPaddingMax + normalizedTetherOffsetValue.mainAxis;\n var arrowOffsetParent = state.elements.arrow && getOffsetParent(state.elements.arrow);\n var clientOffset = arrowOffsetParent ? mainAxis === 'y' ? arrowOffsetParent.clientTop || 0 : arrowOffsetParent.clientLeft || 0 : 0;\n var offsetModifierValue = (_offsetModifierState$ = offsetModifierState == null ? void 0 : offsetModifierState[mainAxis]) != null ? _offsetModifierState$ : 0;\n var tetherMin = offset + minOffset - offsetModifierValue - clientOffset;\n var tetherMax = offset + maxOffset - offsetModifierValue;\n var preventedOffset = within(tether ? mathMin(min, tetherMin) : min, offset, tether ? mathMax(max, tetherMax) : max);\n popperOffsets[mainAxis] = preventedOffset;\n data[mainAxis] = preventedOffset - offset;\n }\n\n if (checkAltAxis) {\n var _offsetModifierState$2;\n\n var _mainSide = mainAxis === 'x' ? top : left;\n\n var _altSide = mainAxis === 'x' ? bottom : right;\n\n var _offset = popperOffsets[altAxis];\n\n var _len = altAxis === 'y' ? 'height' : 'width';\n\n var _min = _offset + overflow[_mainSide];\n\n var _max = _offset - overflow[_altSide];\n\n var isOriginSide = [top, left].indexOf(basePlacement) !== -1;\n\n var _offsetModifierValue = (_offsetModifierState$2 = offsetModifierState == null ? void 0 : offsetModifierState[altAxis]) != null ? _offsetModifierState$2 : 0;\n\n var _tetherMin = isOriginSide ? _min : _offset - referenceRect[_len] - popperRect[_len] - _offsetModifierValue + normalizedTetherOffsetValue.altAxis;\n\n var _tetherMax = isOriginSide ? _offset + referenceRect[_len] + popperRect[_len] - _offsetModifierValue - normalizedTetherOffsetValue.altAxis : _max;\n\n var _preventedOffset = tether && isOriginSide ? withinMaxClamp(_tetherMin, _offset, _tetherMax) : within(tether ? _tetherMin : _min, _offset, tether ? _tetherMax : _max);\n\n popperOffsets[altAxis] = _preventedOffset;\n data[altAxis] = _preventedOffset - _offset;\n }\n\n state.modifiersData[name] = data;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'preventOverflow',\n enabled: true,\n phase: 'main',\n fn: preventOverflow,\n requiresIfExists: ['offset']\n};","export default function getAltAxis(axis) {\n return axis === 'x' ? 'y' : 'x';\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getNodeScroll from \"./getNodeScroll.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport isScrollParent from \"./isScrollParent.js\";\nimport { round } from \"../utils/math.js\";\n\nfunction isElementScaled(element) {\n var rect = element.getBoundingClientRect();\n var scaleX = round(rect.width) / element.offsetWidth || 1;\n var scaleY = round(rect.height) / element.offsetHeight || 1;\n return scaleX !== 1 || scaleY !== 1;\n} // Returns the composite rect of an element relative to its offsetParent.\n// Composite means it takes into account transforms as well as layout.\n\n\nexport default function getCompositeRect(elementOrVirtualElement, offsetParent, isFixed) {\n if (isFixed === void 0) {\n isFixed = false;\n }\n\n var isOffsetParentAnElement = isHTMLElement(offsetParent);\n var offsetParentIsScaled = isHTMLElement(offsetParent) && isElementScaled(offsetParent);\n var documentElement = getDocumentElement(offsetParent);\n var rect = getBoundingClientRect(elementOrVirtualElement, offsetParentIsScaled, isFixed);\n var scroll = {\n scrollLeft: 0,\n scrollTop: 0\n };\n var offsets = {\n x: 0,\n y: 0\n };\n\n if (isOffsetParentAnElement || !isOffsetParentAnElement && !isFixed) {\n if (getNodeName(offsetParent) !== 'body' || // https://github.com/popperjs/popper-core/issues/1078\n isScrollParent(documentElement)) {\n scroll = getNodeScroll(offsetParent);\n }\n\n if (isHTMLElement(offsetParent)) {\n offsets = getBoundingClientRect(offsetParent, true);\n offsets.x += offsetParent.clientLeft;\n offsets.y += offsetParent.clientTop;\n } else if (documentElement) {\n offsets.x = getWindowScrollBarX(documentElement);\n }\n }\n\n return {\n x: rect.left + scroll.scrollLeft - offsets.x,\n y: rect.top + scroll.scrollTop - offsets.y,\n width: rect.width,\n height: rect.height\n };\n}","import getWindowScroll from \"./getWindowScroll.js\";\nimport getWindow from \"./getWindow.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nimport getHTMLElementScroll from \"./getHTMLElementScroll.js\";\nexport default function getNodeScroll(node) {\n if (node === getWindow(node) || !isHTMLElement(node)) {\n return getWindowScroll(node);\n } else {\n return getHTMLElementScroll(node);\n }\n}","export default function getHTMLElementScroll(element) {\n return {\n scrollLeft: element.scrollLeft,\n scrollTop: element.scrollTop\n };\n}","import { modifierPhases } from \"../enums.js\"; // source: https://stackoverflow.com/questions/49875255\n\nfunction order(modifiers) {\n var map = new Map();\n var visited = new Set();\n var result = [];\n modifiers.forEach(function (modifier) {\n map.set(modifier.name, modifier);\n }); // On visiting object, check for its dependencies and visit them recursively\n\n function sort(modifier) {\n visited.add(modifier.name);\n var requires = [].concat(modifier.requires || [], modifier.requiresIfExists || []);\n requires.forEach(function (dep) {\n if (!visited.has(dep)) {\n var depModifier = map.get(dep);\n\n if (depModifier) {\n sort(depModifier);\n }\n }\n });\n result.push(modifier);\n }\n\n modifiers.forEach(function (modifier) {\n if (!visited.has(modifier.name)) {\n // check for visited object\n sort(modifier);\n }\n });\n return result;\n}\n\nexport default function orderModifiers(modifiers) {\n // order based on dependencies\n var orderedModifiers = order(modifiers); // order based on phase\n\n return modifierPhases.reduce(function (acc, phase) {\n return acc.concat(orderedModifiers.filter(function (modifier) {\n return modifier.phase === phase;\n }));\n }, []);\n}","import getCompositeRect from \"./dom-utils/getCompositeRect.js\";\nimport getLayoutRect from \"./dom-utils/getLayoutRect.js\";\nimport listScrollParents from \"./dom-utils/listScrollParents.js\";\nimport getOffsetParent from \"./dom-utils/getOffsetParent.js\";\nimport getComputedStyle from \"./dom-utils/getComputedStyle.js\";\nimport orderModifiers from \"./utils/orderModifiers.js\";\nimport debounce from \"./utils/debounce.js\";\nimport validateModifiers from \"./utils/validateModifiers.js\";\nimport uniqueBy from \"./utils/uniqueBy.js\";\nimport getBasePlacement from \"./utils/getBasePlacement.js\";\nimport mergeByName from \"./utils/mergeByName.js\";\nimport detectOverflow from \"./utils/detectOverflow.js\";\nimport { isElement } from \"./dom-utils/instanceOf.js\";\nimport { auto } from \"./enums.js\";\nvar INVALID_ELEMENT_ERROR = 'Popper: Invalid reference or popper argument provided. They must be either a DOM element or virtual element.';\nvar INFINITE_LOOP_ERROR = 'Popper: An infinite loop in the modifiers cycle has been detected! The cycle has been interrupted to prevent a browser crash.';\nvar DEFAULT_OPTIONS = {\n placement: 'bottom',\n modifiers: [],\n strategy: 'absolute'\n};\n\nfunction areValidElements() {\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n return !args.some(function (element) {\n return !(element && typeof element.getBoundingClientRect === 'function');\n });\n}\n\nexport function popperGenerator(generatorOptions) {\n if (generatorOptions === void 0) {\n generatorOptions = {};\n }\n\n var _generatorOptions = generatorOptions,\n _generatorOptions$def = _generatorOptions.defaultModifiers,\n defaultModifiers = _generatorOptions$def === void 0 ? [] : _generatorOptions$def,\n _generatorOptions$def2 = _generatorOptions.defaultOptions,\n defaultOptions = _generatorOptions$def2 === void 0 ? DEFAULT_OPTIONS : _generatorOptions$def2;\n return function createPopper(reference, popper, options) {\n if (options === void 0) {\n options = defaultOptions;\n }\n\n var state = {\n placement: 'bottom',\n orderedModifiers: [],\n options: Object.assign({}, DEFAULT_OPTIONS, defaultOptions),\n modifiersData: {},\n elements: {\n reference: reference,\n popper: popper\n },\n attributes: {},\n styles: {}\n };\n var effectCleanupFns = [];\n var isDestroyed = false;\n var instance = {\n state: state,\n setOptions: function setOptions(setOptionsAction) {\n var options = typeof setOptionsAction === 'function' ? setOptionsAction(state.options) : setOptionsAction;\n cleanupModifierEffects();\n state.options = Object.assign({}, defaultOptions, state.options, options);\n state.scrollParents = {\n reference: isElement(reference) ? listScrollParents(reference) : reference.contextElement ? listScrollParents(reference.contextElement) : [],\n popper: listScrollParents(popper)\n }; // Orders the modifiers based on their dependencies and `phase`\n // properties\n\n var orderedModifiers = orderModifiers(mergeByName([].concat(defaultModifiers, state.options.modifiers))); // Strip out disabled modifiers\n\n state.orderedModifiers = orderedModifiers.filter(function (m) {\n return m.enabled;\n }); // Validate the provided modifiers so that the consumer will get warned\n // if one of the modifiers is invalid for any reason\n\n if (process.env.NODE_ENV !== \"production\") {\n var modifiers = uniqueBy([].concat(orderedModifiers, state.options.modifiers), function (_ref) {\n var name = _ref.name;\n return name;\n });\n validateModifiers(modifiers);\n\n if (getBasePlacement(state.options.placement) === auto) {\n var flipModifier = state.orderedModifiers.find(function (_ref2) {\n var name = _ref2.name;\n return name === 'flip';\n });\n\n if (!flipModifier) {\n console.error(['Popper: \"auto\" placements require the \"flip\" modifier be', 'present and enabled to work.'].join(' '));\n }\n }\n\n var _getComputedStyle = getComputedStyle(popper),\n marginTop = _getComputedStyle.marginTop,\n marginRight = _getComputedStyle.marginRight,\n marginBottom = _getComputedStyle.marginBottom,\n marginLeft = _getComputedStyle.marginLeft; // We no longer take into account `margins` on the popper, and it can\n // cause bugs with positioning, so we'll warn the consumer\n\n\n if ([marginTop, marginRight, marginBottom, marginLeft].some(function (margin) {\n return parseFloat(margin);\n })) {\n console.warn(['Popper: CSS \"margin\" styles cannot be used to apply padding', 'between the popper and its reference element or boundary.', 'To replicate margin, use the `offset` modifier, as well as', 'the `padding` option in the `preventOverflow` and `flip`', 'modifiers.'].join(' '));\n }\n }\n\n runModifierEffects();\n return instance.update();\n },\n // Sync update – it will always be executed, even if not necessary. This\n // is useful for low frequency updates where sync behavior simplifies the\n // logic.\n // For high frequency updates (e.g. `resize` and `scroll` events), always\n // prefer the async Popper#update method\n forceUpdate: function forceUpdate() {\n if (isDestroyed) {\n return;\n }\n\n var _state$elements = state.elements,\n reference = _state$elements.reference,\n popper = _state$elements.popper; // Don't proceed if `reference` or `popper` are not valid elements\n // anymore\n\n if (!areValidElements(reference, popper)) {\n if (process.env.NODE_ENV !== \"production\") {\n console.error(INVALID_ELEMENT_ERROR);\n }\n\n return;\n } // Store the reference and popper rects to be read by modifiers\n\n\n state.rects = {\n reference: getCompositeRect(reference, getOffsetParent(popper), state.options.strategy === 'fixed'),\n popper: getLayoutRect(popper)\n }; // Modifiers have the ability to reset the current update cycle. The\n // most common use case for this is the `flip` modifier changing the\n // placement, which then needs to re-run all the modifiers, because the\n // logic was previously ran for the previous placement and is therefore\n // stale/incorrect\n\n state.reset = false;\n state.placement = state.options.placement; // On each update cycle, the `modifiersData` property for each modifier\n // is filled with the initial data specified by the modifier. This means\n // it doesn't persist and is fresh on each update.\n // To ensure persistent data, use `${name}#persistent`\n\n state.orderedModifiers.forEach(function (modifier) {\n return state.modifiersData[modifier.name] = Object.assign({}, modifier.data);\n });\n var __debug_loops__ = 0;\n\n for (var index = 0; index < state.orderedModifiers.length; index++) {\n if (process.env.NODE_ENV !== \"production\") {\n __debug_loops__ += 1;\n\n if (__debug_loops__ > 100) {\n console.error(INFINITE_LOOP_ERROR);\n break;\n }\n }\n\n if (state.reset === true) {\n state.reset = false;\n index = -1;\n continue;\n }\n\n var _state$orderedModifie = state.orderedModifiers[index],\n fn = _state$orderedModifie.fn,\n _state$orderedModifie2 = _state$orderedModifie.options,\n _options = _state$orderedModifie2 === void 0 ? {} : _state$orderedModifie2,\n name = _state$orderedModifie.name;\n\n if (typeof fn === 'function') {\n state = fn({\n state: state,\n options: _options,\n name: name,\n instance: instance\n }) || state;\n }\n }\n },\n // Async and optimistically optimized update – it will not be executed if\n // not necessary (debounced to run at most once-per-tick)\n update: debounce(function () {\n return new Promise(function (resolve) {\n instance.forceUpdate();\n resolve(state);\n });\n }),\n destroy: function destroy() {\n cleanupModifierEffects();\n isDestroyed = true;\n }\n };\n\n if (!areValidElements(reference, popper)) {\n if (process.env.NODE_ENV !== \"production\") {\n console.error(INVALID_ELEMENT_ERROR);\n }\n\n return instance;\n }\n\n instance.setOptions(options).then(function (state) {\n if (!isDestroyed && options.onFirstUpdate) {\n options.onFirstUpdate(state);\n }\n }); // Modifiers have the ability to execute arbitrary code before the first\n // update cycle runs. They will be executed in the same order as the update\n // cycle. This is useful when a modifier adds some persistent data that\n // other modifiers need to use, but the modifier is run after the dependent\n // one.\n\n function runModifierEffects() {\n state.orderedModifiers.forEach(function (_ref3) {\n var name = _ref3.name,\n _ref3$options = _ref3.options,\n options = _ref3$options === void 0 ? {} : _ref3$options,\n effect = _ref3.effect;\n\n if (typeof effect === 'function') {\n var cleanupFn = effect({\n state: state,\n name: name,\n instance: instance,\n options: options\n });\n\n var noopFn = function noopFn() {};\n\n effectCleanupFns.push(cleanupFn || noopFn);\n }\n });\n }\n\n function cleanupModifierEffects() {\n effectCleanupFns.forEach(function (fn) {\n return fn();\n });\n effectCleanupFns = [];\n }\n\n return instance;\n };\n}\nexport var createPopper = /*#__PURE__*/popperGenerator(); // eslint-disable-next-line import/no-unused-modules\n\nexport { detectOverflow };","export default function debounce(fn) {\n var pending;\n return function () {\n if (!pending) {\n pending = new Promise(function (resolve) {\n Promise.resolve().then(function () {\n pending = undefined;\n resolve(fn());\n });\n });\n }\n\n return pending;\n };\n}","export default function mergeByName(modifiers) {\n var merged = modifiers.reduce(function (merged, current) {\n var existing = merged[current.name];\n merged[current.name] = existing ? Object.assign({}, existing, current, {\n options: Object.assign({}, existing.options, current.options),\n data: Object.assign({}, existing.data, current.data)\n }) : current;\n return merged;\n }, {}); // IE11 does not support Object.values\n\n return Object.keys(merged).map(function (key) {\n return merged[key];\n });\n}","import { popperGenerator, detectOverflow } from \"./createPopper.js\";\nimport eventListeners from \"./modifiers/eventListeners.js\";\nimport popperOffsets from \"./modifiers/popperOffsets.js\";\nimport computeStyles from \"./modifiers/computeStyles.js\";\nimport applyStyles from \"./modifiers/applyStyles.js\";\nimport offset from \"./modifiers/offset.js\";\nimport flip from \"./modifiers/flip.js\";\nimport preventOverflow from \"./modifiers/preventOverflow.js\";\nimport arrow from \"./modifiers/arrow.js\";\nimport hide from \"./modifiers/hide.js\";\nvar defaultModifiers = [eventListeners, popperOffsets, computeStyles, applyStyles, offset, flip, preventOverflow, arrow, hide];\nvar createPopper = /*#__PURE__*/popperGenerator({\n defaultModifiers: defaultModifiers\n}); // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper, popperGenerator, defaultModifiers, detectOverflow }; // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper as createPopperLite } from \"./popper-lite.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport * from \"./modifiers/index.js\";","import { popperGenerator, detectOverflow } from \"./createPopper.js\";\nimport eventListeners from \"./modifiers/eventListeners.js\";\nimport popperOffsets from \"./modifiers/popperOffsets.js\";\nimport computeStyles from \"./modifiers/computeStyles.js\";\nimport applyStyles from \"./modifiers/applyStyles.js\";\nvar defaultModifiers = [eventListeners, popperOffsets, computeStyles, applyStyles];\nvar createPopper = /*#__PURE__*/popperGenerator({\n defaultModifiers: defaultModifiers\n}); // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper, popperGenerator, defaultModifiers, detectOverflow };","/*!\n * Bootstrap v5.2.3 (https://getbootstrap.com/)\n * Copyright 2011-2022 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n */\nimport * as Popper from '@popperjs/core';\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): util/index.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\nconst MAX_UID = 1000000;\nconst MILLISECONDS_MULTIPLIER = 1000;\nconst TRANSITION_END = 'transitionend'; // Shout-out Angus Croll (https://goo.gl/pxwQGp)\n\nconst toType = object => {\n if (object === null || object === undefined) {\n return `${object}`;\n }\n\n return Object.prototype.toString.call(object).match(/\\s([a-z]+)/i)[1].toLowerCase();\n};\n/**\n * Public Util API\n */\n\n\nconst getUID = prefix => {\n do {\n prefix += Math.floor(Math.random() * MAX_UID);\n } while (document.getElementById(prefix));\n\n return prefix;\n};\n\nconst getSelector = element => {\n let selector = element.getAttribute('data-bs-target');\n\n if (!selector || selector === '#') {\n let hrefAttribute = element.getAttribute('href'); // The only valid content that could double as a selector are IDs or classes,\n // so everything starting with `#` or `.`. If a \"real\" URL is used as the selector,\n // `document.querySelector` will rightfully complain it is invalid.\n // See https://github.com/twbs/bootstrap/issues/32273\n\n if (!hrefAttribute || !hrefAttribute.includes('#') && !hrefAttribute.startsWith('.')) {\n return null;\n } // Just in case some CMS puts out a full URL with the anchor appended\n\n\n if (hrefAttribute.includes('#') && !hrefAttribute.startsWith('#')) {\n hrefAttribute = `#${hrefAttribute.split('#')[1]}`;\n }\n\n selector = hrefAttribute && hrefAttribute !== '#' ? hrefAttribute.trim() : null;\n }\n\n return selector;\n};\n\nconst getSelectorFromElement = element => {\n const selector = getSelector(element);\n\n if (selector) {\n return document.querySelector(selector) ? selector : null;\n }\n\n return null;\n};\n\nconst getElementFromSelector = element => {\n const selector = getSelector(element);\n return selector ? document.querySelector(selector) : null;\n};\n\nconst getTransitionDurationFromElement = element => {\n if (!element) {\n return 0;\n } // Get transition-duration of the element\n\n\n let {\n transitionDuration,\n transitionDelay\n } = window.getComputedStyle(element);\n const floatTransitionDuration = Number.parseFloat(transitionDuration);\n const floatTransitionDelay = Number.parseFloat(transitionDelay); // Return 0 if element or transition duration is not found\n\n if (!floatTransitionDuration && !floatTransitionDelay) {\n return 0;\n } // If multiple durations are defined, take the first\n\n\n transitionDuration = transitionDuration.split(',')[0];\n transitionDelay = transitionDelay.split(',')[0];\n return (Number.parseFloat(transitionDuration) + Number.parseFloat(transitionDelay)) * MILLISECONDS_MULTIPLIER;\n};\n\nconst triggerTransitionEnd = element => {\n element.dispatchEvent(new Event(TRANSITION_END));\n};\n\nconst isElement = object => {\n if (!object || typeof object !== 'object') {\n return false;\n }\n\n if (typeof object.jquery !== 'undefined') {\n object = object[0];\n }\n\n return typeof object.nodeType !== 'undefined';\n};\n\nconst getElement = object => {\n // it's a jQuery object or a node element\n if (isElement(object)) {\n return object.jquery ? object[0] : object;\n }\n\n if (typeof object === 'string' && object.length > 0) {\n return document.querySelector(object);\n }\n\n return null;\n};\n\nconst isVisible = element => {\n if (!isElement(element) || element.getClientRects().length === 0) {\n return false;\n }\n\n const elementIsVisible = getComputedStyle(element).getPropertyValue('visibility') === 'visible'; // Handle `details` element as its content may falsie appear visible when it is closed\n\n const closedDetails = element.closest('details:not([open])');\n\n if (!closedDetails) {\n return elementIsVisible;\n }\n\n if (closedDetails !== element) {\n const summary = element.closest('summary');\n\n if (summary && summary.parentNode !== closedDetails) {\n return false;\n }\n\n if (summary === null) {\n return false;\n }\n }\n\n return elementIsVisible;\n};\n\nconst isDisabled = element => {\n if (!element || element.nodeType !== Node.ELEMENT_NODE) {\n return true;\n }\n\n if (element.classList.contains('disabled')) {\n return true;\n }\n\n if (typeof element.disabled !== 'undefined') {\n return element.disabled;\n }\n\n return element.hasAttribute('disabled') && element.getAttribute('disabled') !== 'false';\n};\n\nconst findShadowRoot = element => {\n if (!document.documentElement.attachShadow) {\n return null;\n } // Can find the shadow root otherwise it'll return the document\n\n\n if (typeof element.getRootNode === 'function') {\n const root = element.getRootNode();\n return root instanceof ShadowRoot ? root : null;\n }\n\n if (element instanceof ShadowRoot) {\n return element;\n } // when we don't find a shadow root\n\n\n if (!element.parentNode) {\n return null;\n }\n\n return findShadowRoot(element.parentNode);\n};\n\nconst noop = () => {};\n/**\n * Trick to restart an element's animation\n *\n * @param {HTMLElement} element\n * @return void\n *\n * @see https://www.charistheo.io/blog/2021/02/restart-a-css-animation-with-javascript/#restarting-a-css-animation\n */\n\n\nconst reflow = element => {\n element.offsetHeight; // eslint-disable-line no-unused-expressions\n};\n\nconst getjQuery = () => {\n if (window.jQuery && !document.body.hasAttribute('data-bs-no-jquery')) {\n return window.jQuery;\n }\n\n return null;\n};\n\nconst DOMContentLoadedCallbacks = [];\n\nconst onDOMContentLoaded = callback => {\n if (document.readyState === 'loading') {\n // add listener on the first call when the document is in loading state\n if (!DOMContentLoadedCallbacks.length) {\n document.addEventListener('DOMContentLoaded', () => {\n for (const callback of DOMContentLoadedCallbacks) {\n callback();\n }\n });\n }\n\n DOMContentLoadedCallbacks.push(callback);\n } else {\n callback();\n }\n};\n\nconst isRTL = () => document.documentElement.dir === 'rtl';\n\nconst defineJQueryPlugin = plugin => {\n onDOMContentLoaded(() => {\n const $ = getjQuery();\n /* istanbul ignore if */\n\n if ($) {\n const name = plugin.NAME;\n const JQUERY_NO_CONFLICT = $.fn[name];\n $.fn[name] = plugin.jQueryInterface;\n $.fn[name].Constructor = plugin;\n\n $.fn[name].noConflict = () => {\n $.fn[name] = JQUERY_NO_CONFLICT;\n return plugin.jQueryInterface;\n };\n }\n });\n};\n\nconst execute = callback => {\n if (typeof callback === 'function') {\n callback();\n }\n};\n\nconst executeAfterTransition = (callback, transitionElement, waitForTransition = true) => {\n if (!waitForTransition) {\n execute(callback);\n return;\n }\n\n const durationPadding = 5;\n const emulatedDuration = getTransitionDurationFromElement(transitionElement) + durationPadding;\n let called = false;\n\n const handler = ({\n target\n }) => {\n if (target !== transitionElement) {\n return;\n }\n\n called = true;\n transitionElement.removeEventListener(TRANSITION_END, handler);\n execute(callback);\n };\n\n transitionElement.addEventListener(TRANSITION_END, handler);\n setTimeout(() => {\n if (!called) {\n triggerTransitionEnd(transitionElement);\n }\n }, emulatedDuration);\n};\n/**\n * Return the previous/next element of a list.\n *\n * @param {array} list The list of elements\n * @param activeElement The active element\n * @param shouldGetNext Choose to get next or previous element\n * @param isCycleAllowed\n * @return {Element|elem} The proper element\n */\n\n\nconst getNextActiveElement = (list, activeElement, shouldGetNext, isCycleAllowed) => {\n const listLength = list.length;\n let index = list.indexOf(activeElement); // if the element does not exist in the list return an element\n // depending on the direction and if cycle is allowed\n\n if (index === -1) {\n return !shouldGetNext && isCycleAllowed ? list[listLength - 1] : list[0];\n }\n\n index += shouldGetNext ? 1 : -1;\n\n if (isCycleAllowed) {\n index = (index + listLength) % listLength;\n }\n\n return list[Math.max(0, Math.min(index, listLength - 1))];\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): dom/event-handler.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst namespaceRegex = /[^.]*(?=\\..*)\\.|.*/;\nconst stripNameRegex = /\\..*/;\nconst stripUidRegex = /::\\d+$/;\nconst eventRegistry = {}; // Events storage\n\nlet uidEvent = 1;\nconst customEvents = {\n mouseenter: 'mouseover',\n mouseleave: 'mouseout'\n};\nconst nativeEvents = new Set(['click', 'dblclick', 'mouseup', 'mousedown', 'contextmenu', 'mousewheel', 'DOMMouseScroll', 'mouseover', 'mouseout', 'mousemove', 'selectstart', 'selectend', 'keydown', 'keypress', 'keyup', 'orientationchange', 'touchstart', 'touchmove', 'touchend', 'touchcancel', 'pointerdown', 'pointermove', 'pointerup', 'pointerleave', 'pointercancel', 'gesturestart', 'gesturechange', 'gestureend', 'focus', 'blur', 'change', 'reset', 'select', 'submit', 'focusin', 'focusout', 'load', 'unload', 'beforeunload', 'resize', 'move', 'DOMContentLoaded', 'readystatechange', 'error', 'abort', 'scroll']);\n/**\n * Private methods\n */\n\nfunction makeEventUid(element, uid) {\n return uid && `${uid}::${uidEvent++}` || element.uidEvent || uidEvent++;\n}\n\nfunction getElementEvents(element) {\n const uid = makeEventUid(element);\n element.uidEvent = uid;\n eventRegistry[uid] = eventRegistry[uid] || {};\n return eventRegistry[uid];\n}\n\nfunction bootstrapHandler(element, fn) {\n return function handler(event) {\n hydrateObj(event, {\n delegateTarget: element\n });\n\n if (handler.oneOff) {\n EventHandler.off(element, event.type, fn);\n }\n\n return fn.apply(element, [event]);\n };\n}\n\nfunction bootstrapDelegationHandler(element, selector, fn) {\n return function handler(event) {\n const domElements = element.querySelectorAll(selector);\n\n for (let {\n target\n } = event; target && target !== this; target = target.parentNode) {\n for (const domElement of domElements) {\n if (domElement !== target) {\n continue;\n }\n\n hydrateObj(event, {\n delegateTarget: target\n });\n\n if (handler.oneOff) {\n EventHandler.off(element, event.type, selector, fn);\n }\n\n return fn.apply(target, [event]);\n }\n }\n };\n}\n\nfunction findHandler(events, callable, delegationSelector = null) {\n return Object.values(events).find(event => event.callable === callable && event.delegationSelector === delegationSelector);\n}\n\nfunction normalizeParameters(originalTypeEvent, handler, delegationFunction) {\n const isDelegated = typeof handler === 'string'; // todo: tooltip passes `false` instead of selector, so we need to check\n\n const callable = isDelegated ? delegationFunction : handler || delegationFunction;\n let typeEvent = getTypeEvent(originalTypeEvent);\n\n if (!nativeEvents.has(typeEvent)) {\n typeEvent = originalTypeEvent;\n }\n\n return [isDelegated, callable, typeEvent];\n}\n\nfunction addHandler(element, originalTypeEvent, handler, delegationFunction, oneOff) {\n if (typeof originalTypeEvent !== 'string' || !element) {\n return;\n }\n\n let [isDelegated, callable, typeEvent] = normalizeParameters(originalTypeEvent, handler, delegationFunction); // in case of mouseenter or mouseleave wrap the handler within a function that checks for its DOM position\n // this prevents the handler from being dispatched the same way as mouseover or mouseout does\n\n if (originalTypeEvent in customEvents) {\n const wrapFunction = fn => {\n return function (event) {\n if (!event.relatedTarget || event.relatedTarget !== event.delegateTarget && !event.delegateTarget.contains(event.relatedTarget)) {\n return fn.call(this, event);\n }\n };\n };\n\n callable = wrapFunction(callable);\n }\n\n const events = getElementEvents(element);\n const handlers = events[typeEvent] || (events[typeEvent] = {});\n const previousFunction = findHandler(handlers, callable, isDelegated ? handler : null);\n\n if (previousFunction) {\n previousFunction.oneOff = previousFunction.oneOff && oneOff;\n return;\n }\n\n const uid = makeEventUid(callable, originalTypeEvent.replace(namespaceRegex, ''));\n const fn = isDelegated ? bootstrapDelegationHandler(element, handler, callable) : bootstrapHandler(element, callable);\n fn.delegationSelector = isDelegated ? handler : null;\n fn.callable = callable;\n fn.oneOff = oneOff;\n fn.uidEvent = uid;\n handlers[uid] = fn;\n element.addEventListener(typeEvent, fn, isDelegated);\n}\n\nfunction removeHandler(element, events, typeEvent, handler, delegationSelector) {\n const fn = findHandler(events[typeEvent], handler, delegationSelector);\n\n if (!fn) {\n return;\n }\n\n element.removeEventListener(typeEvent, fn, Boolean(delegationSelector));\n delete events[typeEvent][fn.uidEvent];\n}\n\nfunction removeNamespacedHandlers(element, events, typeEvent, namespace) {\n const storeElementEvent = events[typeEvent] || {};\n\n for (const handlerKey of Object.keys(storeElementEvent)) {\n if (handlerKey.includes(namespace)) {\n const event = storeElementEvent[handlerKey];\n removeHandler(element, events, typeEvent, event.callable, event.delegationSelector);\n }\n }\n}\n\nfunction getTypeEvent(event) {\n // allow to get the native events from namespaced events ('click.bs.button' --> 'click')\n event = event.replace(stripNameRegex, '');\n return customEvents[event] || event;\n}\n\nconst EventHandler = {\n on(element, event, handler, delegationFunction) {\n addHandler(element, event, handler, delegationFunction, false);\n },\n\n one(element, event, handler, delegationFunction) {\n addHandler(element, event, handler, delegationFunction, true);\n },\n\n off(element, originalTypeEvent, handler, delegationFunction) {\n if (typeof originalTypeEvent !== 'string' || !element) {\n return;\n }\n\n const [isDelegated, callable, typeEvent] = normalizeParameters(originalTypeEvent, handler, delegationFunction);\n const inNamespace = typeEvent !== originalTypeEvent;\n const events = getElementEvents(element);\n const storeElementEvent = events[typeEvent] || {};\n const isNamespace = originalTypeEvent.startsWith('.');\n\n if (typeof callable !== 'undefined') {\n // Simplest case: handler is passed, remove that listener ONLY.\n if (!Object.keys(storeElementEvent).length) {\n return;\n }\n\n removeHandler(element, events, typeEvent, callable, isDelegated ? handler : null);\n return;\n }\n\n if (isNamespace) {\n for (const elementEvent of Object.keys(events)) {\n removeNamespacedHandlers(element, events, elementEvent, originalTypeEvent.slice(1));\n }\n }\n\n for (const keyHandlers of Object.keys(storeElementEvent)) {\n const handlerKey = keyHandlers.replace(stripUidRegex, '');\n\n if (!inNamespace || originalTypeEvent.includes(handlerKey)) {\n const event = storeElementEvent[keyHandlers];\n removeHandler(element, events, typeEvent, event.callable, event.delegationSelector);\n }\n }\n },\n\n trigger(element, event, args) {\n if (typeof event !== 'string' || !element) {\n return null;\n }\n\n const $ = getjQuery();\n const typeEvent = getTypeEvent(event);\n const inNamespace = event !== typeEvent;\n let jQueryEvent = null;\n let bubbles = true;\n let nativeDispatch = true;\n let defaultPrevented = false;\n\n if (inNamespace && $) {\n jQueryEvent = $.Event(event, args);\n $(element).trigger(jQueryEvent);\n bubbles = !jQueryEvent.isPropagationStopped();\n nativeDispatch = !jQueryEvent.isImmediatePropagationStopped();\n defaultPrevented = jQueryEvent.isDefaultPrevented();\n }\n\n let evt = new Event(event, {\n bubbles,\n cancelable: true\n });\n evt = hydrateObj(evt, args);\n\n if (defaultPrevented) {\n evt.preventDefault();\n }\n\n if (nativeDispatch) {\n element.dispatchEvent(evt);\n }\n\n if (evt.defaultPrevented && jQueryEvent) {\n jQueryEvent.preventDefault();\n }\n\n return evt;\n }\n\n};\n\nfunction hydrateObj(obj, meta) {\n for (const [key, value] of Object.entries(meta || {})) {\n try {\n obj[key] = value;\n } catch (_unused) {\n Object.defineProperty(obj, key, {\n configurable: true,\n\n get() {\n return value;\n }\n\n });\n }\n }\n\n return obj;\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): dom/data.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n/**\n * Constants\n */\nconst elementMap = new Map();\nconst Data = {\n set(element, key, instance) {\n if (!elementMap.has(element)) {\n elementMap.set(element, new Map());\n }\n\n const instanceMap = elementMap.get(element); // make it clear we only want one instance per element\n // can be removed later when multiple key/instances are fine to be used\n\n if (!instanceMap.has(key) && instanceMap.size !== 0) {\n // eslint-disable-next-line no-console\n console.error(`Bootstrap doesn't allow more than one instance per element. Bound instance: ${Array.from(instanceMap.keys())[0]}.`);\n return;\n }\n\n instanceMap.set(key, instance);\n },\n\n get(element, key) {\n if (elementMap.has(element)) {\n return elementMap.get(element).get(key) || null;\n }\n\n return null;\n },\n\n remove(element, key) {\n if (!elementMap.has(element)) {\n return;\n }\n\n const instanceMap = elementMap.get(element);\n instanceMap.delete(key); // free up element references if there are no instances left for an element\n\n if (instanceMap.size === 0) {\n elementMap.delete(element);\n }\n }\n\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): dom/manipulator.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\nfunction normalizeData(value) {\n if (value === 'true') {\n return true;\n }\n\n if (value === 'false') {\n return false;\n }\n\n if (value === Number(value).toString()) {\n return Number(value);\n }\n\n if (value === '' || value === 'null') {\n return null;\n }\n\n if (typeof value !== 'string') {\n return value;\n }\n\n try {\n return JSON.parse(decodeURIComponent(value));\n } catch (_unused) {\n return value;\n }\n}\n\nfunction normalizeDataKey(key) {\n return key.replace(/[A-Z]/g, chr => `-${chr.toLowerCase()}`);\n}\n\nconst Manipulator = {\n setDataAttribute(element, key, value) {\n element.setAttribute(`data-bs-${normalizeDataKey(key)}`, value);\n },\n\n removeDataAttribute(element, key) {\n element.removeAttribute(`data-bs-${normalizeDataKey(key)}`);\n },\n\n getDataAttributes(element) {\n if (!element) {\n return {};\n }\n\n const attributes = {};\n const bsKeys = Object.keys(element.dataset).filter(key => key.startsWith('bs') && !key.startsWith('bsConfig'));\n\n for (const key of bsKeys) {\n let pureKey = key.replace(/^bs/, '');\n pureKey = pureKey.charAt(0).toLowerCase() + pureKey.slice(1, pureKey.length);\n attributes[pureKey] = normalizeData(element.dataset[key]);\n }\n\n return attributes;\n },\n\n getDataAttribute(element, key) {\n return normalizeData(element.getAttribute(`data-bs-${normalizeDataKey(key)}`));\n }\n\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): util/config.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Class definition\n */\n\nclass Config {\n // Getters\n static get Default() {\n return {};\n }\n\n static get DefaultType() {\n return {};\n }\n\n static get NAME() {\n throw new Error('You have to implement the static method \"NAME\", for each component!');\n }\n\n _getConfig(config) {\n config = this._mergeConfigObj(config);\n config = this._configAfterMerge(config);\n\n this._typeCheckConfig(config);\n\n return config;\n }\n\n _configAfterMerge(config) {\n return config;\n }\n\n _mergeConfigObj(config, element) {\n const jsonConfig = isElement(element) ? Manipulator.getDataAttribute(element, 'config') : {}; // try to parse\n\n return { ...this.constructor.Default,\n ...(typeof jsonConfig === 'object' ? jsonConfig : {}),\n ...(isElement(element) ? Manipulator.getDataAttributes(element) : {}),\n ...(typeof config === 'object' ? config : {})\n };\n }\n\n _typeCheckConfig(config, configTypes = this.constructor.DefaultType) {\n for (const property of Object.keys(configTypes)) {\n const expectedTypes = configTypes[property];\n const value = config[property];\n const valueType = isElement(value) ? 'element' : toType(value);\n\n if (!new RegExp(expectedTypes).test(valueType)) {\n throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option \"${property}\" provided type \"${valueType}\" but expected type \"${expectedTypes}\".`);\n }\n }\n }\n\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): base-component.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst VERSION = '5.2.3';\n/**\n * Class definition\n */\n\nclass BaseComponent extends Config {\n constructor(element, config) {\n super();\n element = getElement(element);\n\n if (!element) {\n return;\n }\n\n this._element = element;\n this._config = this._getConfig(config);\n Data.set(this._element, this.constructor.DATA_KEY, this);\n } // Public\n\n\n dispose() {\n Data.remove(this._element, this.constructor.DATA_KEY);\n EventHandler.off(this._element, this.constructor.EVENT_KEY);\n\n for (const propertyName of Object.getOwnPropertyNames(this)) {\n this[propertyName] = null;\n }\n }\n\n _queueCallback(callback, element, isAnimated = true) {\n executeAfterTransition(callback, element, isAnimated);\n }\n\n _getConfig(config) {\n config = this._mergeConfigObj(config, this._element);\n config = this._configAfterMerge(config);\n\n this._typeCheckConfig(config);\n\n return config;\n } // Static\n\n\n static getInstance(element) {\n return Data.get(getElement(element), this.DATA_KEY);\n }\n\n static getOrCreateInstance(element, config = {}) {\n return this.getInstance(element) || new this(element, typeof config === 'object' ? config : null);\n }\n\n static get VERSION() {\n return VERSION;\n }\n\n static get DATA_KEY() {\n return `bs.${this.NAME}`;\n }\n\n static get EVENT_KEY() {\n return `.${this.DATA_KEY}`;\n }\n\n static eventName(name) {\n return `${name}${this.EVENT_KEY}`;\n }\n\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): util/component-functions.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nconst enableDismissTrigger = (component, method = 'hide') => {\n const clickEvent = `click.dismiss${component.EVENT_KEY}`;\n const name = component.NAME;\n EventHandler.on(document, clickEvent, `[data-bs-dismiss=\"${name}\"]`, function (event) {\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault();\n }\n\n if (isDisabled(this)) {\n return;\n }\n\n const target = getElementFromSelector(this) || this.closest(`.${name}`);\n const instance = component.getOrCreateInstance(target); // Method argument is left, for Alert and only, as it doesn't implement the 'hide' method\n\n instance[method]();\n });\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): alert.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$f = 'alert';\nconst DATA_KEY$a = 'bs.alert';\nconst EVENT_KEY$b = `.${DATA_KEY$a}`;\nconst EVENT_CLOSE = `close${EVENT_KEY$b}`;\nconst EVENT_CLOSED = `closed${EVENT_KEY$b}`;\nconst CLASS_NAME_FADE$5 = 'fade';\nconst CLASS_NAME_SHOW$8 = 'show';\n/**\n * Class definition\n */\n\nclass Alert extends BaseComponent {\n // Getters\n static get NAME() {\n return NAME$f;\n } // Public\n\n\n close() {\n const closeEvent = EventHandler.trigger(this._element, EVENT_CLOSE);\n\n if (closeEvent.defaultPrevented) {\n return;\n }\n\n this._element.classList.remove(CLASS_NAME_SHOW$8);\n\n const isAnimated = this._element.classList.contains(CLASS_NAME_FADE$5);\n\n this._queueCallback(() => this._destroyElement(), this._element, isAnimated);\n } // Private\n\n\n _destroyElement() {\n this._element.remove();\n\n EventHandler.trigger(this._element, EVENT_CLOSED);\n this.dispose();\n } // Static\n\n\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Alert.getOrCreateInstance(this);\n\n if (typeof config !== 'string') {\n return;\n }\n\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n\n data[config](this);\n });\n }\n\n}\n/**\n * Data API implementation\n */\n\n\nenableDismissTrigger(Alert, 'close');\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Alert);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): button.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$e = 'button';\nconst DATA_KEY$9 = 'bs.button';\nconst EVENT_KEY$a = `.${DATA_KEY$9}`;\nconst DATA_API_KEY$6 = '.data-api';\nconst CLASS_NAME_ACTIVE$3 = 'active';\nconst SELECTOR_DATA_TOGGLE$5 = '[data-bs-toggle=\"button\"]';\nconst EVENT_CLICK_DATA_API$6 = `click${EVENT_KEY$a}${DATA_API_KEY$6}`;\n/**\n * Class definition\n */\n\nclass Button extends BaseComponent {\n // Getters\n static get NAME() {\n return NAME$e;\n } // Public\n\n\n toggle() {\n // Toggle class and sync the `aria-pressed` attribute with the return value of the `.toggle()` method\n this._element.setAttribute('aria-pressed', this._element.classList.toggle(CLASS_NAME_ACTIVE$3));\n } // Static\n\n\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Button.getOrCreateInstance(this);\n\n if (config === 'toggle') {\n data[config]();\n }\n });\n }\n\n}\n/**\n * Data API implementation\n */\n\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$6, SELECTOR_DATA_TOGGLE$5, event => {\n event.preventDefault();\n const button = event.target.closest(SELECTOR_DATA_TOGGLE$5);\n const data = Button.getOrCreateInstance(button);\n data.toggle();\n});\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Button);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): dom/selector-engine.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst SelectorEngine = {\n find(selector, element = document.documentElement) {\n return [].concat(...Element.prototype.querySelectorAll.call(element, selector));\n },\n\n findOne(selector, element = document.documentElement) {\n return Element.prototype.querySelector.call(element, selector);\n },\n\n children(element, selector) {\n return [].concat(...element.children).filter(child => child.matches(selector));\n },\n\n parents(element, selector) {\n const parents = [];\n let ancestor = element.parentNode.closest(selector);\n\n while (ancestor) {\n parents.push(ancestor);\n ancestor = ancestor.parentNode.closest(selector);\n }\n\n return parents;\n },\n\n prev(element, selector) {\n let previous = element.previousElementSibling;\n\n while (previous) {\n if (previous.matches(selector)) {\n return [previous];\n }\n\n previous = previous.previousElementSibling;\n }\n\n return [];\n },\n\n // TODO: this is now unused; remove later along with prev()\n next(element, selector) {\n let next = element.nextElementSibling;\n\n while (next) {\n if (next.matches(selector)) {\n return [next];\n }\n\n next = next.nextElementSibling;\n }\n\n return [];\n },\n\n focusableChildren(element) {\n const focusables = ['a', 'button', 'input', 'textarea', 'select', 'details', '[tabindex]', '[contenteditable=\"true\"]'].map(selector => `${selector}:not([tabindex^=\"-\"])`).join(',');\n return this.find(focusables, element).filter(el => !isDisabled(el) && isVisible(el));\n }\n\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): util/swipe.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$d = 'swipe';\nconst EVENT_KEY$9 = '.bs.swipe';\nconst EVENT_TOUCHSTART = `touchstart${EVENT_KEY$9}`;\nconst EVENT_TOUCHMOVE = `touchmove${EVENT_KEY$9}`;\nconst EVENT_TOUCHEND = `touchend${EVENT_KEY$9}`;\nconst EVENT_POINTERDOWN = `pointerdown${EVENT_KEY$9}`;\nconst EVENT_POINTERUP = `pointerup${EVENT_KEY$9}`;\nconst POINTER_TYPE_TOUCH = 'touch';\nconst POINTER_TYPE_PEN = 'pen';\nconst CLASS_NAME_POINTER_EVENT = 'pointer-event';\nconst SWIPE_THRESHOLD = 40;\nconst Default$c = {\n endCallback: null,\n leftCallback: null,\n rightCallback: null\n};\nconst DefaultType$c = {\n endCallback: '(function|null)',\n leftCallback: '(function|null)',\n rightCallback: '(function|null)'\n};\n/**\n * Class definition\n */\n\nclass Swipe extends Config {\n constructor(element, config) {\n super();\n this._element = element;\n\n if (!element || !Swipe.isSupported()) {\n return;\n }\n\n this._config = this._getConfig(config);\n this._deltaX = 0;\n this._supportPointerEvents = Boolean(window.PointerEvent);\n\n this._initEvents();\n } // Getters\n\n\n static get Default() {\n return Default$c;\n }\n\n static get DefaultType() {\n return DefaultType$c;\n }\n\n static get NAME() {\n return NAME$d;\n } // Public\n\n\n dispose() {\n EventHandler.off(this._element, EVENT_KEY$9);\n } // Private\n\n\n _start(event) {\n if (!this._supportPointerEvents) {\n this._deltaX = event.touches[0].clientX;\n return;\n }\n\n if (this._eventIsPointerPenTouch(event)) {\n this._deltaX = event.clientX;\n }\n }\n\n _end(event) {\n if (this._eventIsPointerPenTouch(event)) {\n this._deltaX = event.clientX - this._deltaX;\n }\n\n this._handleSwipe();\n\n execute(this._config.endCallback);\n }\n\n _move(event) {\n this._deltaX = event.touches && event.touches.length > 1 ? 0 : event.touches[0].clientX - this._deltaX;\n }\n\n _handleSwipe() {\n const absDeltaX = Math.abs(this._deltaX);\n\n if (absDeltaX <= SWIPE_THRESHOLD) {\n return;\n }\n\n const direction = absDeltaX / this._deltaX;\n this._deltaX = 0;\n\n if (!direction) {\n return;\n }\n\n execute(direction > 0 ? this._config.rightCallback : this._config.leftCallback);\n }\n\n _initEvents() {\n if (this._supportPointerEvents) {\n EventHandler.on(this._element, EVENT_POINTERDOWN, event => this._start(event));\n EventHandler.on(this._element, EVENT_POINTERUP, event => this._end(event));\n\n this._element.classList.add(CLASS_NAME_POINTER_EVENT);\n } else {\n EventHandler.on(this._element, EVENT_TOUCHSTART, event => this._start(event));\n EventHandler.on(this._element, EVENT_TOUCHMOVE, event => this._move(event));\n EventHandler.on(this._element, EVENT_TOUCHEND, event => this._end(event));\n }\n }\n\n _eventIsPointerPenTouch(event) {\n return this._supportPointerEvents && (event.pointerType === POINTER_TYPE_PEN || event.pointerType === POINTER_TYPE_TOUCH);\n } // Static\n\n\n static isSupported() {\n return 'ontouchstart' in document.documentElement || navigator.maxTouchPoints > 0;\n }\n\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): carousel.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$c = 'carousel';\nconst DATA_KEY$8 = 'bs.carousel';\nconst EVENT_KEY$8 = `.${DATA_KEY$8}`;\nconst DATA_API_KEY$5 = '.data-api';\nconst ARROW_LEFT_KEY$1 = 'ArrowLeft';\nconst ARROW_RIGHT_KEY$1 = 'ArrowRight';\nconst TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch\n\nconst ORDER_NEXT = 'next';\nconst ORDER_PREV = 'prev';\nconst DIRECTION_LEFT = 'left';\nconst DIRECTION_RIGHT = 'right';\nconst EVENT_SLIDE = `slide${EVENT_KEY$8}`;\nconst EVENT_SLID = `slid${EVENT_KEY$8}`;\nconst EVENT_KEYDOWN$1 = `keydown${EVENT_KEY$8}`;\nconst EVENT_MOUSEENTER$1 = `mouseenter${EVENT_KEY$8}`;\nconst EVENT_MOUSELEAVE$1 = `mouseleave${EVENT_KEY$8}`;\nconst EVENT_DRAG_START = `dragstart${EVENT_KEY$8}`;\nconst EVENT_LOAD_DATA_API$3 = `load${EVENT_KEY$8}${DATA_API_KEY$5}`;\nconst EVENT_CLICK_DATA_API$5 = `click${EVENT_KEY$8}${DATA_API_KEY$5}`;\nconst CLASS_NAME_CAROUSEL = 'carousel';\nconst CLASS_NAME_ACTIVE$2 = 'active';\nconst CLASS_NAME_SLIDE = 'slide';\nconst CLASS_NAME_END = 'carousel-item-end';\nconst CLASS_NAME_START = 'carousel-item-start';\nconst CLASS_NAME_NEXT = 'carousel-item-next';\nconst CLASS_NAME_PREV = 'carousel-item-prev';\nconst SELECTOR_ACTIVE = '.active';\nconst SELECTOR_ITEM = '.carousel-item';\nconst SELECTOR_ACTIVE_ITEM = SELECTOR_ACTIVE + SELECTOR_ITEM;\nconst SELECTOR_ITEM_IMG = '.carousel-item img';\nconst SELECTOR_INDICATORS = '.carousel-indicators';\nconst SELECTOR_DATA_SLIDE = '[data-bs-slide], [data-bs-slide-to]';\nconst SELECTOR_DATA_RIDE = '[data-bs-ride=\"carousel\"]';\nconst KEY_TO_DIRECTION = {\n [ARROW_LEFT_KEY$1]: DIRECTION_RIGHT,\n [ARROW_RIGHT_KEY$1]: DIRECTION_LEFT\n};\nconst Default$b = {\n interval: 5000,\n keyboard: true,\n pause: 'hover',\n ride: false,\n touch: true,\n wrap: true\n};\nconst DefaultType$b = {\n interval: '(number|boolean)',\n // TODO:v6 remove boolean support\n keyboard: 'boolean',\n pause: '(string|boolean)',\n ride: '(boolean|string)',\n touch: 'boolean',\n wrap: 'boolean'\n};\n/**\n * Class definition\n */\n\nclass Carousel extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._interval = null;\n this._activeElement = null;\n this._isSliding = false;\n this.touchTimeout = null;\n this._swipeHelper = null;\n this._indicatorsElement = SelectorEngine.findOne(SELECTOR_INDICATORS, this._element);\n\n this._addEventListeners();\n\n if (this._config.ride === CLASS_NAME_CAROUSEL) {\n this.cycle();\n }\n } // Getters\n\n\n static get Default() {\n return Default$b;\n }\n\n static get DefaultType() {\n return DefaultType$b;\n }\n\n static get NAME() {\n return NAME$c;\n } // Public\n\n\n next() {\n this._slide(ORDER_NEXT);\n }\n\n nextWhenVisible() {\n // FIXME TODO use `document.visibilityState`\n // Don't call next when the page isn't visible\n // or the carousel or its parent isn't visible\n if (!document.hidden && isVisible(this._element)) {\n this.next();\n }\n }\n\n prev() {\n this._slide(ORDER_PREV);\n }\n\n pause() {\n if (this._isSliding) {\n triggerTransitionEnd(this._element);\n }\n\n this._clearInterval();\n }\n\n cycle() {\n this._clearInterval();\n\n this._updateInterval();\n\n this._interval = setInterval(() => this.nextWhenVisible(), this._config.interval);\n }\n\n _maybeEnableCycle() {\n if (!this._config.ride) {\n return;\n }\n\n if (this._isSliding) {\n EventHandler.one(this._element, EVENT_SLID, () => this.cycle());\n return;\n }\n\n this.cycle();\n }\n\n to(index) {\n const items = this._getItems();\n\n if (index > items.length - 1 || index < 0) {\n return;\n }\n\n if (this._isSliding) {\n EventHandler.one(this._element, EVENT_SLID, () => this.to(index));\n return;\n }\n\n const activeIndex = this._getItemIndex(this._getActive());\n\n if (activeIndex === index) {\n return;\n }\n\n const order = index > activeIndex ? ORDER_NEXT : ORDER_PREV;\n\n this._slide(order, items[index]);\n }\n\n dispose() {\n if (this._swipeHelper) {\n this._swipeHelper.dispose();\n }\n\n super.dispose();\n } // Private\n\n\n _configAfterMerge(config) {\n config.defaultInterval = config.interval;\n return config;\n }\n\n _addEventListeners() {\n if (this._config.keyboard) {\n EventHandler.on(this._element, EVENT_KEYDOWN$1, event => this._keydown(event));\n }\n\n if (this._config.pause === 'hover') {\n EventHandler.on(this._element, EVENT_MOUSEENTER$1, () => this.pause());\n EventHandler.on(this._element, EVENT_MOUSELEAVE$1, () => this._maybeEnableCycle());\n }\n\n if (this._config.touch && Swipe.isSupported()) {\n this._addTouchEventListeners();\n }\n }\n\n _addTouchEventListeners() {\n for (const img of SelectorEngine.find(SELECTOR_ITEM_IMG, this._element)) {\n EventHandler.on(img, EVENT_DRAG_START, event => event.preventDefault());\n }\n\n const endCallBack = () => {\n if (this._config.pause !== 'hover') {\n return;\n } // If it's a touch-enabled device, mouseenter/leave are fired as\n // part of the mouse compatibility events on first tap - the carousel\n // would stop cycling until user tapped out of it;\n // here, we listen for touchend, explicitly pause the carousel\n // (as if it's the second time we tap on it, mouseenter compat event\n // is NOT fired) and after a timeout (to allow for mouse compatibility\n // events to fire) we explicitly restart cycling\n\n\n this.pause();\n\n if (this.touchTimeout) {\n clearTimeout(this.touchTimeout);\n }\n\n this.touchTimeout = setTimeout(() => this._maybeEnableCycle(), TOUCHEVENT_COMPAT_WAIT + this._config.interval);\n };\n\n const swipeConfig = {\n leftCallback: () => this._slide(this._directionToOrder(DIRECTION_LEFT)),\n rightCallback: () => this._slide(this._directionToOrder(DIRECTION_RIGHT)),\n endCallback: endCallBack\n };\n this._swipeHelper = new Swipe(this._element, swipeConfig);\n }\n\n _keydown(event) {\n if (/input|textarea/i.test(event.target.tagName)) {\n return;\n }\n\n const direction = KEY_TO_DIRECTION[event.key];\n\n if (direction) {\n event.preventDefault();\n\n this._slide(this._directionToOrder(direction));\n }\n }\n\n _getItemIndex(element) {\n return this._getItems().indexOf(element);\n }\n\n _setActiveIndicatorElement(index) {\n if (!this._indicatorsElement) {\n return;\n }\n\n const activeIndicator = SelectorEngine.findOne(SELECTOR_ACTIVE, this._indicatorsElement);\n activeIndicator.classList.remove(CLASS_NAME_ACTIVE$2);\n activeIndicator.removeAttribute('aria-current');\n const newActiveIndicator = SelectorEngine.findOne(`[data-bs-slide-to=\"${index}\"]`, this._indicatorsElement);\n\n if (newActiveIndicator) {\n newActiveIndicator.classList.add(CLASS_NAME_ACTIVE$2);\n newActiveIndicator.setAttribute('aria-current', 'true');\n }\n }\n\n _updateInterval() {\n const element = this._activeElement || this._getActive();\n\n if (!element) {\n return;\n }\n\n const elementInterval = Number.parseInt(element.getAttribute('data-bs-interval'), 10);\n this._config.interval = elementInterval || this._config.defaultInterval;\n }\n\n _slide(order, element = null) {\n if (this._isSliding) {\n return;\n }\n\n const activeElement = this._getActive();\n\n const isNext = order === ORDER_NEXT;\n const nextElement = element || getNextActiveElement(this._getItems(), activeElement, isNext, this._config.wrap);\n\n if (nextElement === activeElement) {\n return;\n }\n\n const nextElementIndex = this._getItemIndex(nextElement);\n\n const triggerEvent = eventName => {\n return EventHandler.trigger(this._element, eventName, {\n relatedTarget: nextElement,\n direction: this._orderToDirection(order),\n from: this._getItemIndex(activeElement),\n to: nextElementIndex\n });\n };\n\n const slideEvent = triggerEvent(EVENT_SLIDE);\n\n if (slideEvent.defaultPrevented) {\n return;\n }\n\n if (!activeElement || !nextElement) {\n // Some weirdness is happening, so we bail\n // todo: change tests that use empty divs to avoid this check\n return;\n }\n\n const isCycling = Boolean(this._interval);\n this.pause();\n this._isSliding = true;\n\n this._setActiveIndicatorElement(nextElementIndex);\n\n this._activeElement = nextElement;\n const directionalClassName = isNext ? CLASS_NAME_START : CLASS_NAME_END;\n const orderClassName = isNext ? CLASS_NAME_NEXT : CLASS_NAME_PREV;\n nextElement.classList.add(orderClassName);\n reflow(nextElement);\n activeElement.classList.add(directionalClassName);\n nextElement.classList.add(directionalClassName);\n\n const completeCallBack = () => {\n nextElement.classList.remove(directionalClassName, orderClassName);\n nextElement.classList.add(CLASS_NAME_ACTIVE$2);\n activeElement.classList.remove(CLASS_NAME_ACTIVE$2, orderClassName, directionalClassName);\n this._isSliding = false;\n triggerEvent(EVENT_SLID);\n };\n\n this._queueCallback(completeCallBack, activeElement, this._isAnimated());\n\n if (isCycling) {\n this.cycle();\n }\n }\n\n _isAnimated() {\n return this._element.classList.contains(CLASS_NAME_SLIDE);\n }\n\n _getActive() {\n return SelectorEngine.findOne(SELECTOR_ACTIVE_ITEM, this._element);\n }\n\n _getItems() {\n return SelectorEngine.find(SELECTOR_ITEM, this._element);\n }\n\n _clearInterval() {\n if (this._interval) {\n clearInterval(this._interval);\n this._interval = null;\n }\n }\n\n _directionToOrder(direction) {\n if (isRTL()) {\n return direction === DIRECTION_LEFT ? ORDER_PREV : ORDER_NEXT;\n }\n\n return direction === DIRECTION_LEFT ? ORDER_NEXT : ORDER_PREV;\n }\n\n _orderToDirection(order) {\n if (isRTL()) {\n return order === ORDER_PREV ? DIRECTION_LEFT : DIRECTION_RIGHT;\n }\n\n return order === ORDER_PREV ? DIRECTION_RIGHT : DIRECTION_LEFT;\n } // Static\n\n\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Carousel.getOrCreateInstance(this, config);\n\n if (typeof config === 'number') {\n data.to(config);\n return;\n }\n\n if (typeof config === 'string') {\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n\n data[config]();\n }\n });\n }\n\n}\n/**\n * Data API implementation\n */\n\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$5, SELECTOR_DATA_SLIDE, function (event) {\n const target = getElementFromSelector(this);\n\n if (!target || !target.classList.contains(CLASS_NAME_CAROUSEL)) {\n return;\n }\n\n event.preventDefault();\n const carousel = Carousel.getOrCreateInstance(target);\n const slideIndex = this.getAttribute('data-bs-slide-to');\n\n if (slideIndex) {\n carousel.to(slideIndex);\n\n carousel._maybeEnableCycle();\n\n return;\n }\n\n if (Manipulator.getDataAttribute(this, 'slide') === 'next') {\n carousel.next();\n\n carousel._maybeEnableCycle();\n\n return;\n }\n\n carousel.prev();\n\n carousel._maybeEnableCycle();\n});\nEventHandler.on(window, EVENT_LOAD_DATA_API$3, () => {\n const carousels = SelectorEngine.find(SELECTOR_DATA_RIDE);\n\n for (const carousel of carousels) {\n Carousel.getOrCreateInstance(carousel);\n }\n});\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Carousel);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): collapse.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$b = 'collapse';\nconst DATA_KEY$7 = 'bs.collapse';\nconst EVENT_KEY$7 = `.${DATA_KEY$7}`;\nconst DATA_API_KEY$4 = '.data-api';\nconst EVENT_SHOW$6 = `show${EVENT_KEY$7}`;\nconst EVENT_SHOWN$6 = `shown${EVENT_KEY$7}`;\nconst EVENT_HIDE$6 = `hide${EVENT_KEY$7}`;\nconst EVENT_HIDDEN$6 = `hidden${EVENT_KEY$7}`;\nconst EVENT_CLICK_DATA_API$4 = `click${EVENT_KEY$7}${DATA_API_KEY$4}`;\nconst CLASS_NAME_SHOW$7 = 'show';\nconst CLASS_NAME_COLLAPSE = 'collapse';\nconst CLASS_NAME_COLLAPSING = 'collapsing';\nconst CLASS_NAME_COLLAPSED = 'collapsed';\nconst CLASS_NAME_DEEPER_CHILDREN = `:scope .${CLASS_NAME_COLLAPSE} .${CLASS_NAME_COLLAPSE}`;\nconst CLASS_NAME_HORIZONTAL = 'collapse-horizontal';\nconst WIDTH = 'width';\nconst HEIGHT = 'height';\nconst SELECTOR_ACTIVES = '.collapse.show, .collapse.collapsing';\nconst SELECTOR_DATA_TOGGLE$4 = '[data-bs-toggle=\"collapse\"]';\nconst Default$a = {\n parent: null,\n toggle: true\n};\nconst DefaultType$a = {\n parent: '(null|element)',\n toggle: 'boolean'\n};\n/**\n * Class definition\n */\n\nclass Collapse extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._isTransitioning = false;\n this._triggerArray = [];\n const toggleList = SelectorEngine.find(SELECTOR_DATA_TOGGLE$4);\n\n for (const elem of toggleList) {\n const selector = getSelectorFromElement(elem);\n const filterElement = SelectorEngine.find(selector).filter(foundElement => foundElement === this._element);\n\n if (selector !== null && filterElement.length) {\n this._triggerArray.push(elem);\n }\n }\n\n this._initializeChildren();\n\n if (!this._config.parent) {\n this._addAriaAndCollapsedClass(this._triggerArray, this._isShown());\n }\n\n if (this._config.toggle) {\n this.toggle();\n }\n } // Getters\n\n\n static get Default() {\n return Default$a;\n }\n\n static get DefaultType() {\n return DefaultType$a;\n }\n\n static get NAME() {\n return NAME$b;\n } // Public\n\n\n toggle() {\n if (this._isShown()) {\n this.hide();\n } else {\n this.show();\n }\n }\n\n show() {\n if (this._isTransitioning || this._isShown()) {\n return;\n }\n\n let activeChildren = []; // find active children\n\n if (this._config.parent) {\n activeChildren = this._getFirstLevelChildren(SELECTOR_ACTIVES).filter(element => element !== this._element).map(element => Collapse.getOrCreateInstance(element, {\n toggle: false\n }));\n }\n\n if (activeChildren.length && activeChildren[0]._isTransitioning) {\n return;\n }\n\n const startEvent = EventHandler.trigger(this._element, EVENT_SHOW$6);\n\n if (startEvent.defaultPrevented) {\n return;\n }\n\n for (const activeInstance of activeChildren) {\n activeInstance.hide();\n }\n\n const dimension = this._getDimension();\n\n this._element.classList.remove(CLASS_NAME_COLLAPSE);\n\n this._element.classList.add(CLASS_NAME_COLLAPSING);\n\n this._element.style[dimension] = 0;\n\n this._addAriaAndCollapsedClass(this._triggerArray, true);\n\n this._isTransitioning = true;\n\n const complete = () => {\n this._isTransitioning = false;\n\n this._element.classList.remove(CLASS_NAME_COLLAPSING);\n\n this._element.classList.add(CLASS_NAME_COLLAPSE, CLASS_NAME_SHOW$7);\n\n this._element.style[dimension] = '';\n EventHandler.trigger(this._element, EVENT_SHOWN$6);\n };\n\n const capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1);\n const scrollSize = `scroll${capitalizedDimension}`;\n\n this._queueCallback(complete, this._element, true);\n\n this._element.style[dimension] = `${this._element[scrollSize]}px`;\n }\n\n hide() {\n if (this._isTransitioning || !this._isShown()) {\n return;\n }\n\n const startEvent = EventHandler.trigger(this._element, EVENT_HIDE$6);\n\n if (startEvent.defaultPrevented) {\n return;\n }\n\n const dimension = this._getDimension();\n\n this._element.style[dimension] = `${this._element.getBoundingClientRect()[dimension]}px`;\n reflow(this._element);\n\n this._element.classList.add(CLASS_NAME_COLLAPSING);\n\n this._element.classList.remove(CLASS_NAME_COLLAPSE, CLASS_NAME_SHOW$7);\n\n for (const trigger of this._triggerArray) {\n const element = getElementFromSelector(trigger);\n\n if (element && !this._isShown(element)) {\n this._addAriaAndCollapsedClass([trigger], false);\n }\n }\n\n this._isTransitioning = true;\n\n const complete = () => {\n this._isTransitioning = false;\n\n this._element.classList.remove(CLASS_NAME_COLLAPSING);\n\n this._element.classList.add(CLASS_NAME_COLLAPSE);\n\n EventHandler.trigger(this._element, EVENT_HIDDEN$6);\n };\n\n this._element.style[dimension] = '';\n\n this._queueCallback(complete, this._element, true);\n }\n\n _isShown(element = this._element) {\n return element.classList.contains(CLASS_NAME_SHOW$7);\n } // Private\n\n\n _configAfterMerge(config) {\n config.toggle = Boolean(config.toggle); // Coerce string values\n\n config.parent = getElement(config.parent);\n return config;\n }\n\n _getDimension() {\n return this._element.classList.contains(CLASS_NAME_HORIZONTAL) ? WIDTH : HEIGHT;\n }\n\n _initializeChildren() {\n if (!this._config.parent) {\n return;\n }\n\n const children = this._getFirstLevelChildren(SELECTOR_DATA_TOGGLE$4);\n\n for (const element of children) {\n const selected = getElementFromSelector(element);\n\n if (selected) {\n this._addAriaAndCollapsedClass([element], this._isShown(selected));\n }\n }\n }\n\n _getFirstLevelChildren(selector) {\n const children = SelectorEngine.find(CLASS_NAME_DEEPER_CHILDREN, this._config.parent); // remove children if greater depth\n\n return SelectorEngine.find(selector, this._config.parent).filter(element => !children.includes(element));\n }\n\n _addAriaAndCollapsedClass(triggerArray, isOpen) {\n if (!triggerArray.length) {\n return;\n }\n\n for (const element of triggerArray) {\n element.classList.toggle(CLASS_NAME_COLLAPSED, !isOpen);\n element.setAttribute('aria-expanded', isOpen);\n }\n } // Static\n\n\n static jQueryInterface(config) {\n const _config = {};\n\n if (typeof config === 'string' && /show|hide/.test(config)) {\n _config.toggle = false;\n }\n\n return this.each(function () {\n const data = Collapse.getOrCreateInstance(this, _config);\n\n if (typeof config === 'string') {\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n\n data[config]();\n }\n });\n }\n\n}\n/**\n * Data API implementation\n */\n\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$4, SELECTOR_DATA_TOGGLE$4, function (event) {\n // preventDefault only for elements (which change the URL) not inside the collapsible element\n if (event.target.tagName === 'A' || event.delegateTarget && event.delegateTarget.tagName === 'A') {\n event.preventDefault();\n }\n\n const selector = getSelectorFromElement(this);\n const selectorElements = SelectorEngine.find(selector);\n\n for (const element of selectorElements) {\n Collapse.getOrCreateInstance(element, {\n toggle: false\n }).toggle();\n }\n});\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Collapse);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): dropdown.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$a = 'dropdown';\nconst DATA_KEY$6 = 'bs.dropdown';\nconst EVENT_KEY$6 = `.${DATA_KEY$6}`;\nconst DATA_API_KEY$3 = '.data-api';\nconst ESCAPE_KEY$2 = 'Escape';\nconst TAB_KEY$1 = 'Tab';\nconst ARROW_UP_KEY$1 = 'ArrowUp';\nconst ARROW_DOWN_KEY$1 = 'ArrowDown';\nconst RIGHT_MOUSE_BUTTON = 2; // MouseEvent.button value for the secondary button, usually the right button\n\nconst EVENT_HIDE$5 = `hide${EVENT_KEY$6}`;\nconst EVENT_HIDDEN$5 = `hidden${EVENT_KEY$6}`;\nconst EVENT_SHOW$5 = `show${EVENT_KEY$6}`;\nconst EVENT_SHOWN$5 = `shown${EVENT_KEY$6}`;\nconst EVENT_CLICK_DATA_API$3 = `click${EVENT_KEY$6}${DATA_API_KEY$3}`;\nconst EVENT_KEYDOWN_DATA_API = `keydown${EVENT_KEY$6}${DATA_API_KEY$3}`;\nconst EVENT_KEYUP_DATA_API = `keyup${EVENT_KEY$6}${DATA_API_KEY$3}`;\nconst CLASS_NAME_SHOW$6 = 'show';\nconst CLASS_NAME_DROPUP = 'dropup';\nconst CLASS_NAME_DROPEND = 'dropend';\nconst CLASS_NAME_DROPSTART = 'dropstart';\nconst CLASS_NAME_DROPUP_CENTER = 'dropup-center';\nconst CLASS_NAME_DROPDOWN_CENTER = 'dropdown-center';\nconst SELECTOR_DATA_TOGGLE$3 = '[data-bs-toggle=\"dropdown\"]:not(.disabled):not(:disabled)';\nconst SELECTOR_DATA_TOGGLE_SHOWN = `${SELECTOR_DATA_TOGGLE$3}.${CLASS_NAME_SHOW$6}`;\nconst SELECTOR_MENU = '.dropdown-menu';\nconst SELECTOR_NAVBAR = '.navbar';\nconst SELECTOR_NAVBAR_NAV = '.navbar-nav';\nconst SELECTOR_VISIBLE_ITEMS = '.dropdown-menu .dropdown-item:not(.disabled):not(:disabled)';\nconst PLACEMENT_TOP = isRTL() ? 'top-end' : 'top-start';\nconst PLACEMENT_TOPEND = isRTL() ? 'top-start' : 'top-end';\nconst PLACEMENT_BOTTOM = isRTL() ? 'bottom-end' : 'bottom-start';\nconst PLACEMENT_BOTTOMEND = isRTL() ? 'bottom-start' : 'bottom-end';\nconst PLACEMENT_RIGHT = isRTL() ? 'left-start' : 'right-start';\nconst PLACEMENT_LEFT = isRTL() ? 'right-start' : 'left-start';\nconst PLACEMENT_TOPCENTER = 'top';\nconst PLACEMENT_BOTTOMCENTER = 'bottom';\nconst Default$9 = {\n autoClose: true,\n boundary: 'clippingParents',\n display: 'dynamic',\n offset: [0, 2],\n popperConfig: null,\n reference: 'toggle'\n};\nconst DefaultType$9 = {\n autoClose: '(boolean|string)',\n boundary: '(string|element)',\n display: 'string',\n offset: '(array|string|function)',\n popperConfig: '(null|object|function)',\n reference: '(string|element|object)'\n};\n/**\n * Class definition\n */\n\nclass Dropdown extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._popper = null;\n this._parent = this._element.parentNode; // dropdown wrapper\n // todo: v6 revert #37011 & change markup https://getbootstrap.com/docs/5.2/forms/input-group/\n\n this._menu = SelectorEngine.next(this._element, SELECTOR_MENU)[0] || SelectorEngine.prev(this._element, SELECTOR_MENU)[0] || SelectorEngine.findOne(SELECTOR_MENU, this._parent);\n this._inNavbar = this._detectNavbar();\n } // Getters\n\n\n static get Default() {\n return Default$9;\n }\n\n static get DefaultType() {\n return DefaultType$9;\n }\n\n static get NAME() {\n return NAME$a;\n } // Public\n\n\n toggle() {\n return this._isShown() ? this.hide() : this.show();\n }\n\n show() {\n if (isDisabled(this._element) || this._isShown()) {\n return;\n }\n\n const relatedTarget = {\n relatedTarget: this._element\n };\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$5, relatedTarget);\n\n if (showEvent.defaultPrevented) {\n return;\n }\n\n this._createPopper(); // If this is a touch-enabled device we add extra\n // empty mouseover listeners to the body's immediate children;\n // only needed because of broken event delegation on iOS\n // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html\n\n\n if ('ontouchstart' in document.documentElement && !this._parent.closest(SELECTOR_NAVBAR_NAV)) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.on(element, 'mouseover', noop);\n }\n }\n\n this._element.focus();\n\n this._element.setAttribute('aria-expanded', true);\n\n this._menu.classList.add(CLASS_NAME_SHOW$6);\n\n this._element.classList.add(CLASS_NAME_SHOW$6);\n\n EventHandler.trigger(this._element, EVENT_SHOWN$5, relatedTarget);\n }\n\n hide() {\n if (isDisabled(this._element) || !this._isShown()) {\n return;\n }\n\n const relatedTarget = {\n relatedTarget: this._element\n };\n\n this._completeHide(relatedTarget);\n }\n\n dispose() {\n if (this._popper) {\n this._popper.destroy();\n }\n\n super.dispose();\n }\n\n update() {\n this._inNavbar = this._detectNavbar();\n\n if (this._popper) {\n this._popper.update();\n }\n } // Private\n\n\n _completeHide(relatedTarget) {\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$5, relatedTarget);\n\n if (hideEvent.defaultPrevented) {\n return;\n } // If this is a touch-enabled device we remove the extra\n // empty mouseover listeners we added for iOS support\n\n\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.off(element, 'mouseover', noop);\n }\n }\n\n if (this._popper) {\n this._popper.destroy();\n }\n\n this._menu.classList.remove(CLASS_NAME_SHOW$6);\n\n this._element.classList.remove(CLASS_NAME_SHOW$6);\n\n this._element.setAttribute('aria-expanded', 'false');\n\n Manipulator.removeDataAttribute(this._menu, 'popper');\n EventHandler.trigger(this._element, EVENT_HIDDEN$5, relatedTarget);\n }\n\n _getConfig(config) {\n config = super._getConfig(config);\n\n if (typeof config.reference === 'object' && !isElement(config.reference) && typeof config.reference.getBoundingClientRect !== 'function') {\n // Popper virtual elements require a getBoundingClientRect method\n throw new TypeError(`${NAME$a.toUpperCase()}: Option \"reference\" provided type \"object\" without a required \"getBoundingClientRect\" method.`);\n }\n\n return config;\n }\n\n _createPopper() {\n if (typeof Popper === 'undefined') {\n throw new TypeError('Bootstrap\\'s dropdowns require Popper (https://popper.js.org)');\n }\n\n let referenceElement = this._element;\n\n if (this._config.reference === 'parent') {\n referenceElement = this._parent;\n } else if (isElement(this._config.reference)) {\n referenceElement = getElement(this._config.reference);\n } else if (typeof this._config.reference === 'object') {\n referenceElement = this._config.reference;\n }\n\n const popperConfig = this._getPopperConfig();\n\n this._popper = Popper.createPopper(referenceElement, this._menu, popperConfig);\n }\n\n _isShown() {\n return this._menu.classList.contains(CLASS_NAME_SHOW$6);\n }\n\n _getPlacement() {\n const parentDropdown = this._parent;\n\n if (parentDropdown.classList.contains(CLASS_NAME_DROPEND)) {\n return PLACEMENT_RIGHT;\n }\n\n if (parentDropdown.classList.contains(CLASS_NAME_DROPSTART)) {\n return PLACEMENT_LEFT;\n }\n\n if (parentDropdown.classList.contains(CLASS_NAME_DROPUP_CENTER)) {\n return PLACEMENT_TOPCENTER;\n }\n\n if (parentDropdown.classList.contains(CLASS_NAME_DROPDOWN_CENTER)) {\n return PLACEMENT_BOTTOMCENTER;\n } // We need to trim the value because custom properties can also include spaces\n\n\n const isEnd = getComputedStyle(this._menu).getPropertyValue('--bs-position').trim() === 'end';\n\n if (parentDropdown.classList.contains(CLASS_NAME_DROPUP)) {\n return isEnd ? PLACEMENT_TOPEND : PLACEMENT_TOP;\n }\n\n return isEnd ? PLACEMENT_BOTTOMEND : PLACEMENT_BOTTOM;\n }\n\n _detectNavbar() {\n return this._element.closest(SELECTOR_NAVBAR) !== null;\n }\n\n _getOffset() {\n const {\n offset\n } = this._config;\n\n if (typeof offset === 'string') {\n return offset.split(',').map(value => Number.parseInt(value, 10));\n }\n\n if (typeof offset === 'function') {\n return popperData => offset(popperData, this._element);\n }\n\n return offset;\n }\n\n _getPopperConfig() {\n const defaultBsPopperConfig = {\n placement: this._getPlacement(),\n modifiers: [{\n name: 'preventOverflow',\n options: {\n boundary: this._config.boundary\n }\n }, {\n name: 'offset',\n options: {\n offset: this._getOffset()\n }\n }]\n }; // Disable Popper if we have a static display or Dropdown is in Navbar\n\n if (this._inNavbar || this._config.display === 'static') {\n Manipulator.setDataAttribute(this._menu, 'popper', 'static'); // todo:v6 remove\n\n defaultBsPopperConfig.modifiers = [{\n name: 'applyStyles',\n enabled: false\n }];\n }\n\n return { ...defaultBsPopperConfig,\n ...(typeof this._config.popperConfig === 'function' ? this._config.popperConfig(defaultBsPopperConfig) : this._config.popperConfig)\n };\n }\n\n _selectMenuItem({\n key,\n target\n }) {\n const items = SelectorEngine.find(SELECTOR_VISIBLE_ITEMS, this._menu).filter(element => isVisible(element));\n\n if (!items.length) {\n return;\n } // if target isn't included in items (e.g. when expanding the dropdown)\n // allow cycling to get the last item in case key equals ARROW_UP_KEY\n\n\n getNextActiveElement(items, target, key === ARROW_DOWN_KEY$1, !items.includes(target)).focus();\n } // Static\n\n\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Dropdown.getOrCreateInstance(this, config);\n\n if (typeof config !== 'string') {\n return;\n }\n\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n\n data[config]();\n });\n }\n\n static clearMenus(event) {\n if (event.button === RIGHT_MOUSE_BUTTON || event.type === 'keyup' && event.key !== TAB_KEY$1) {\n return;\n }\n\n const openToggles = SelectorEngine.find(SELECTOR_DATA_TOGGLE_SHOWN);\n\n for (const toggle of openToggles) {\n const context = Dropdown.getInstance(toggle);\n\n if (!context || context._config.autoClose === false) {\n continue;\n }\n\n const composedPath = event.composedPath();\n const isMenuTarget = composedPath.includes(context._menu);\n\n if (composedPath.includes(context._element) || context._config.autoClose === 'inside' && !isMenuTarget || context._config.autoClose === 'outside' && isMenuTarget) {\n continue;\n } // Tab navigation through the dropdown menu or events from contained inputs shouldn't close the menu\n\n\n if (context._menu.contains(event.target) && (event.type === 'keyup' && event.key === TAB_KEY$1 || /input|select|option|textarea|form/i.test(event.target.tagName))) {\n continue;\n }\n\n const relatedTarget = {\n relatedTarget: context._element\n };\n\n if (event.type === 'click') {\n relatedTarget.clickEvent = event;\n }\n\n context._completeHide(relatedTarget);\n }\n }\n\n static dataApiKeydownHandler(event) {\n // If not an UP | DOWN | ESCAPE key => not a dropdown command\n // If input/textarea && if key is other than ESCAPE => not a dropdown command\n const isInput = /input|textarea/i.test(event.target.tagName);\n const isEscapeEvent = event.key === ESCAPE_KEY$2;\n const isUpOrDownEvent = [ARROW_UP_KEY$1, ARROW_DOWN_KEY$1].includes(event.key);\n\n if (!isUpOrDownEvent && !isEscapeEvent) {\n return;\n }\n\n if (isInput && !isEscapeEvent) {\n return;\n }\n\n event.preventDefault(); // todo: v6 revert #37011 & change markup https://getbootstrap.com/docs/5.2/forms/input-group/\n\n const getToggleButton = this.matches(SELECTOR_DATA_TOGGLE$3) ? this : SelectorEngine.prev(this, SELECTOR_DATA_TOGGLE$3)[0] || SelectorEngine.next(this, SELECTOR_DATA_TOGGLE$3)[0] || SelectorEngine.findOne(SELECTOR_DATA_TOGGLE$3, event.delegateTarget.parentNode);\n const instance = Dropdown.getOrCreateInstance(getToggleButton);\n\n if (isUpOrDownEvent) {\n event.stopPropagation();\n instance.show();\n\n instance._selectMenuItem(event);\n\n return;\n }\n\n if (instance._isShown()) {\n // else is escape and we check if it is shown\n event.stopPropagation();\n instance.hide();\n getToggleButton.focus();\n }\n }\n\n}\n/**\n * Data API implementation\n */\n\n\nEventHandler.on(document, EVENT_KEYDOWN_DATA_API, SELECTOR_DATA_TOGGLE$3, Dropdown.dataApiKeydownHandler);\nEventHandler.on(document, EVENT_KEYDOWN_DATA_API, SELECTOR_MENU, Dropdown.dataApiKeydownHandler);\nEventHandler.on(document, EVENT_CLICK_DATA_API$3, Dropdown.clearMenus);\nEventHandler.on(document, EVENT_KEYUP_DATA_API, Dropdown.clearMenus);\nEventHandler.on(document, EVENT_CLICK_DATA_API$3, SELECTOR_DATA_TOGGLE$3, function (event) {\n event.preventDefault();\n Dropdown.getOrCreateInstance(this).toggle();\n});\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Dropdown);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): util/scrollBar.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst SELECTOR_FIXED_CONTENT = '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top';\nconst SELECTOR_STICKY_CONTENT = '.sticky-top';\nconst PROPERTY_PADDING = 'padding-right';\nconst PROPERTY_MARGIN = 'margin-right';\n/**\n * Class definition\n */\n\nclass ScrollBarHelper {\n constructor() {\n this._element = document.body;\n } // Public\n\n\n getWidth() {\n // https://developer.mozilla.org/en-US/docs/Web/API/Window/innerWidth#usage_notes\n const documentWidth = document.documentElement.clientWidth;\n return Math.abs(window.innerWidth - documentWidth);\n }\n\n hide() {\n const width = this.getWidth();\n\n this._disableOverFlow(); // give padding to element to balance the hidden scrollbar width\n\n\n this._setElementAttributes(this._element, PROPERTY_PADDING, calculatedValue => calculatedValue + width); // trick: We adjust positive paddingRight and negative marginRight to sticky-top elements to keep showing fullwidth\n\n\n this._setElementAttributes(SELECTOR_FIXED_CONTENT, PROPERTY_PADDING, calculatedValue => calculatedValue + width);\n\n this._setElementAttributes(SELECTOR_STICKY_CONTENT, PROPERTY_MARGIN, calculatedValue => calculatedValue - width);\n }\n\n reset() {\n this._resetElementAttributes(this._element, 'overflow');\n\n this._resetElementAttributes(this._element, PROPERTY_PADDING);\n\n this._resetElementAttributes(SELECTOR_FIXED_CONTENT, PROPERTY_PADDING);\n\n this._resetElementAttributes(SELECTOR_STICKY_CONTENT, PROPERTY_MARGIN);\n }\n\n isOverflowing() {\n return this.getWidth() > 0;\n } // Private\n\n\n _disableOverFlow() {\n this._saveInitialAttribute(this._element, 'overflow');\n\n this._element.style.overflow = 'hidden';\n }\n\n _setElementAttributes(selector, styleProperty, callback) {\n const scrollbarWidth = this.getWidth();\n\n const manipulationCallBack = element => {\n if (element !== this._element && window.innerWidth > element.clientWidth + scrollbarWidth) {\n return;\n }\n\n this._saveInitialAttribute(element, styleProperty);\n\n const calculatedValue = window.getComputedStyle(element).getPropertyValue(styleProperty);\n element.style.setProperty(styleProperty, `${callback(Number.parseFloat(calculatedValue))}px`);\n };\n\n this._applyManipulationCallback(selector, manipulationCallBack);\n }\n\n _saveInitialAttribute(element, styleProperty) {\n const actualValue = element.style.getPropertyValue(styleProperty);\n\n if (actualValue) {\n Manipulator.setDataAttribute(element, styleProperty, actualValue);\n }\n }\n\n _resetElementAttributes(selector, styleProperty) {\n const manipulationCallBack = element => {\n const value = Manipulator.getDataAttribute(element, styleProperty); // We only want to remove the property if the value is `null`; the value can also be zero\n\n if (value === null) {\n element.style.removeProperty(styleProperty);\n return;\n }\n\n Manipulator.removeDataAttribute(element, styleProperty);\n element.style.setProperty(styleProperty, value);\n };\n\n this._applyManipulationCallback(selector, manipulationCallBack);\n }\n\n _applyManipulationCallback(selector, callBack) {\n if (isElement(selector)) {\n callBack(selector);\n return;\n }\n\n for (const sel of SelectorEngine.find(selector, this._element)) {\n callBack(sel);\n }\n }\n\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): util/backdrop.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$9 = 'backdrop';\nconst CLASS_NAME_FADE$4 = 'fade';\nconst CLASS_NAME_SHOW$5 = 'show';\nconst EVENT_MOUSEDOWN = `mousedown.bs.${NAME$9}`;\nconst Default$8 = {\n className: 'modal-backdrop',\n clickCallback: null,\n isAnimated: false,\n isVisible: true,\n // if false, we use the backdrop helper without adding any element to the dom\n rootElement: 'body' // give the choice to place backdrop under different elements\n\n};\nconst DefaultType$8 = {\n className: 'string',\n clickCallback: '(function|null)',\n isAnimated: 'boolean',\n isVisible: 'boolean',\n rootElement: '(element|string)'\n};\n/**\n * Class definition\n */\n\nclass Backdrop extends Config {\n constructor(config) {\n super();\n this._config = this._getConfig(config);\n this._isAppended = false;\n this._element = null;\n } // Getters\n\n\n static get Default() {\n return Default$8;\n }\n\n static get DefaultType() {\n return DefaultType$8;\n }\n\n static get NAME() {\n return NAME$9;\n } // Public\n\n\n show(callback) {\n if (!this._config.isVisible) {\n execute(callback);\n return;\n }\n\n this._append();\n\n const element = this._getElement();\n\n if (this._config.isAnimated) {\n reflow(element);\n }\n\n element.classList.add(CLASS_NAME_SHOW$5);\n\n this._emulateAnimation(() => {\n execute(callback);\n });\n }\n\n hide(callback) {\n if (!this._config.isVisible) {\n execute(callback);\n return;\n }\n\n this._getElement().classList.remove(CLASS_NAME_SHOW$5);\n\n this._emulateAnimation(() => {\n this.dispose();\n execute(callback);\n });\n }\n\n dispose() {\n if (!this._isAppended) {\n return;\n }\n\n EventHandler.off(this._element, EVENT_MOUSEDOWN);\n\n this._element.remove();\n\n this._isAppended = false;\n } // Private\n\n\n _getElement() {\n if (!this._element) {\n const backdrop = document.createElement('div');\n backdrop.className = this._config.className;\n\n if (this._config.isAnimated) {\n backdrop.classList.add(CLASS_NAME_FADE$4);\n }\n\n this._element = backdrop;\n }\n\n return this._element;\n }\n\n _configAfterMerge(config) {\n // use getElement() with the default \"body\" to get a fresh Element on each instantiation\n config.rootElement = getElement(config.rootElement);\n return config;\n }\n\n _append() {\n if (this._isAppended) {\n return;\n }\n\n const element = this._getElement();\n\n this._config.rootElement.append(element);\n\n EventHandler.on(element, EVENT_MOUSEDOWN, () => {\n execute(this._config.clickCallback);\n });\n this._isAppended = true;\n }\n\n _emulateAnimation(callback) {\n executeAfterTransition(callback, this._getElement(), this._config.isAnimated);\n }\n\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): util/focustrap.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$8 = 'focustrap';\nconst DATA_KEY$5 = 'bs.focustrap';\nconst EVENT_KEY$5 = `.${DATA_KEY$5}`;\nconst EVENT_FOCUSIN$2 = `focusin${EVENT_KEY$5}`;\nconst EVENT_KEYDOWN_TAB = `keydown.tab${EVENT_KEY$5}`;\nconst TAB_KEY = 'Tab';\nconst TAB_NAV_FORWARD = 'forward';\nconst TAB_NAV_BACKWARD = 'backward';\nconst Default$7 = {\n autofocus: true,\n trapElement: null // The element to trap focus inside of\n\n};\nconst DefaultType$7 = {\n autofocus: 'boolean',\n trapElement: 'element'\n};\n/**\n * Class definition\n */\n\nclass FocusTrap extends Config {\n constructor(config) {\n super();\n this._config = this._getConfig(config);\n this._isActive = false;\n this._lastTabNavDirection = null;\n } // Getters\n\n\n static get Default() {\n return Default$7;\n }\n\n static get DefaultType() {\n return DefaultType$7;\n }\n\n static get NAME() {\n return NAME$8;\n } // Public\n\n\n activate() {\n if (this._isActive) {\n return;\n }\n\n if (this._config.autofocus) {\n this._config.trapElement.focus();\n }\n\n EventHandler.off(document, EVENT_KEY$5); // guard against infinite focus loop\n\n EventHandler.on(document, EVENT_FOCUSIN$2, event => this._handleFocusin(event));\n EventHandler.on(document, EVENT_KEYDOWN_TAB, event => this._handleKeydown(event));\n this._isActive = true;\n }\n\n deactivate() {\n if (!this._isActive) {\n return;\n }\n\n this._isActive = false;\n EventHandler.off(document, EVENT_KEY$5);\n } // Private\n\n\n _handleFocusin(event) {\n const {\n trapElement\n } = this._config;\n\n if (event.target === document || event.target === trapElement || trapElement.contains(event.target)) {\n return;\n }\n\n const elements = SelectorEngine.focusableChildren(trapElement);\n\n if (elements.length === 0) {\n trapElement.focus();\n } else if (this._lastTabNavDirection === TAB_NAV_BACKWARD) {\n elements[elements.length - 1].focus();\n } else {\n elements[0].focus();\n }\n }\n\n _handleKeydown(event) {\n if (event.key !== TAB_KEY) {\n return;\n }\n\n this._lastTabNavDirection = event.shiftKey ? TAB_NAV_BACKWARD : TAB_NAV_FORWARD;\n }\n\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): modal.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$7 = 'modal';\nconst DATA_KEY$4 = 'bs.modal';\nconst EVENT_KEY$4 = `.${DATA_KEY$4}`;\nconst DATA_API_KEY$2 = '.data-api';\nconst ESCAPE_KEY$1 = 'Escape';\nconst EVENT_HIDE$4 = `hide${EVENT_KEY$4}`;\nconst EVENT_HIDE_PREVENTED$1 = `hidePrevented${EVENT_KEY$4}`;\nconst EVENT_HIDDEN$4 = `hidden${EVENT_KEY$4}`;\nconst EVENT_SHOW$4 = `show${EVENT_KEY$4}`;\nconst EVENT_SHOWN$4 = `shown${EVENT_KEY$4}`;\nconst EVENT_RESIZE$1 = `resize${EVENT_KEY$4}`;\nconst EVENT_CLICK_DISMISS = `click.dismiss${EVENT_KEY$4}`;\nconst EVENT_MOUSEDOWN_DISMISS = `mousedown.dismiss${EVENT_KEY$4}`;\nconst EVENT_KEYDOWN_DISMISS$1 = `keydown.dismiss${EVENT_KEY$4}`;\nconst EVENT_CLICK_DATA_API$2 = `click${EVENT_KEY$4}${DATA_API_KEY$2}`;\nconst CLASS_NAME_OPEN = 'modal-open';\nconst CLASS_NAME_FADE$3 = 'fade';\nconst CLASS_NAME_SHOW$4 = 'show';\nconst CLASS_NAME_STATIC = 'modal-static';\nconst OPEN_SELECTOR$1 = '.modal.show';\nconst SELECTOR_DIALOG = '.modal-dialog';\nconst SELECTOR_MODAL_BODY = '.modal-body';\nconst SELECTOR_DATA_TOGGLE$2 = '[data-bs-toggle=\"modal\"]';\nconst Default$6 = {\n backdrop: true,\n focus: true,\n keyboard: true\n};\nconst DefaultType$6 = {\n backdrop: '(boolean|string)',\n focus: 'boolean',\n keyboard: 'boolean'\n};\n/**\n * Class definition\n */\n\nclass Modal extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._dialog = SelectorEngine.findOne(SELECTOR_DIALOG, this._element);\n this._backdrop = this._initializeBackDrop();\n this._focustrap = this._initializeFocusTrap();\n this._isShown = false;\n this._isTransitioning = false;\n this._scrollBar = new ScrollBarHelper();\n\n this._addEventListeners();\n } // Getters\n\n\n static get Default() {\n return Default$6;\n }\n\n static get DefaultType() {\n return DefaultType$6;\n }\n\n static get NAME() {\n return NAME$7;\n } // Public\n\n\n toggle(relatedTarget) {\n return this._isShown ? this.hide() : this.show(relatedTarget);\n }\n\n show(relatedTarget) {\n if (this._isShown || this._isTransitioning) {\n return;\n }\n\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$4, {\n relatedTarget\n });\n\n if (showEvent.defaultPrevented) {\n return;\n }\n\n this._isShown = true;\n this._isTransitioning = true;\n\n this._scrollBar.hide();\n\n document.body.classList.add(CLASS_NAME_OPEN);\n\n this._adjustDialog();\n\n this._backdrop.show(() => this._showElement(relatedTarget));\n }\n\n hide() {\n if (!this._isShown || this._isTransitioning) {\n return;\n }\n\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$4);\n\n if (hideEvent.defaultPrevented) {\n return;\n }\n\n this._isShown = false;\n this._isTransitioning = true;\n\n this._focustrap.deactivate();\n\n this._element.classList.remove(CLASS_NAME_SHOW$4);\n\n this._queueCallback(() => this._hideModal(), this._element, this._isAnimated());\n }\n\n dispose() {\n for (const htmlElement of [window, this._dialog]) {\n EventHandler.off(htmlElement, EVENT_KEY$4);\n }\n\n this._backdrop.dispose();\n\n this._focustrap.deactivate();\n\n super.dispose();\n }\n\n handleUpdate() {\n this._adjustDialog();\n } // Private\n\n\n _initializeBackDrop() {\n return new Backdrop({\n isVisible: Boolean(this._config.backdrop),\n // 'static' option will be translated to true, and booleans will keep their value,\n isAnimated: this._isAnimated()\n });\n }\n\n _initializeFocusTrap() {\n return new FocusTrap({\n trapElement: this._element\n });\n }\n\n _showElement(relatedTarget) {\n // try to append dynamic modal\n if (!document.body.contains(this._element)) {\n document.body.append(this._element);\n }\n\n this._element.style.display = 'block';\n\n this._element.removeAttribute('aria-hidden');\n\n this._element.setAttribute('aria-modal', true);\n\n this._element.setAttribute('role', 'dialog');\n\n this._element.scrollTop = 0;\n const modalBody = SelectorEngine.findOne(SELECTOR_MODAL_BODY, this._dialog);\n\n if (modalBody) {\n modalBody.scrollTop = 0;\n }\n\n reflow(this._element);\n\n this._element.classList.add(CLASS_NAME_SHOW$4);\n\n const transitionComplete = () => {\n if (this._config.focus) {\n this._focustrap.activate();\n }\n\n this._isTransitioning = false;\n EventHandler.trigger(this._element, EVENT_SHOWN$4, {\n relatedTarget\n });\n };\n\n this._queueCallback(transitionComplete, this._dialog, this._isAnimated());\n }\n\n _addEventListeners() {\n EventHandler.on(this._element, EVENT_KEYDOWN_DISMISS$1, event => {\n if (event.key !== ESCAPE_KEY$1) {\n return;\n }\n\n if (this._config.keyboard) {\n event.preventDefault();\n this.hide();\n return;\n }\n\n this._triggerBackdropTransition();\n });\n EventHandler.on(window, EVENT_RESIZE$1, () => {\n if (this._isShown && !this._isTransitioning) {\n this._adjustDialog();\n }\n });\n EventHandler.on(this._element, EVENT_MOUSEDOWN_DISMISS, event => {\n // a bad trick to segregate clicks that may start inside dialog but end outside, and avoid listen to scrollbar clicks\n EventHandler.one(this._element, EVENT_CLICK_DISMISS, event2 => {\n if (this._element !== event.target || this._element !== event2.target) {\n return;\n }\n\n if (this._config.backdrop === 'static') {\n this._triggerBackdropTransition();\n\n return;\n }\n\n if (this._config.backdrop) {\n this.hide();\n }\n });\n });\n }\n\n _hideModal() {\n this._element.style.display = 'none';\n\n this._element.setAttribute('aria-hidden', true);\n\n this._element.removeAttribute('aria-modal');\n\n this._element.removeAttribute('role');\n\n this._isTransitioning = false;\n\n this._backdrop.hide(() => {\n document.body.classList.remove(CLASS_NAME_OPEN);\n\n this._resetAdjustments();\n\n this._scrollBar.reset();\n\n EventHandler.trigger(this._element, EVENT_HIDDEN$4);\n });\n }\n\n _isAnimated() {\n return this._element.classList.contains(CLASS_NAME_FADE$3);\n }\n\n _triggerBackdropTransition() {\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED$1);\n\n if (hideEvent.defaultPrevented) {\n return;\n }\n\n const isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;\n const initialOverflowY = this._element.style.overflowY; // return if the following background transition hasn't yet completed\n\n if (initialOverflowY === 'hidden' || this._element.classList.contains(CLASS_NAME_STATIC)) {\n return;\n }\n\n if (!isModalOverflowing) {\n this._element.style.overflowY = 'hidden';\n }\n\n this._element.classList.add(CLASS_NAME_STATIC);\n\n this._queueCallback(() => {\n this._element.classList.remove(CLASS_NAME_STATIC);\n\n this._queueCallback(() => {\n this._element.style.overflowY = initialOverflowY;\n }, this._dialog);\n }, this._dialog);\n\n this._element.focus();\n }\n /**\n * The following methods are used to handle overflowing modals\n */\n\n\n _adjustDialog() {\n const isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;\n\n const scrollbarWidth = this._scrollBar.getWidth();\n\n const isBodyOverflowing = scrollbarWidth > 0;\n\n if (isBodyOverflowing && !isModalOverflowing) {\n const property = isRTL() ? 'paddingLeft' : 'paddingRight';\n this._element.style[property] = `${scrollbarWidth}px`;\n }\n\n if (!isBodyOverflowing && isModalOverflowing) {\n const property = isRTL() ? 'paddingRight' : 'paddingLeft';\n this._element.style[property] = `${scrollbarWidth}px`;\n }\n }\n\n _resetAdjustments() {\n this._element.style.paddingLeft = '';\n this._element.style.paddingRight = '';\n } // Static\n\n\n static jQueryInterface(config, relatedTarget) {\n return this.each(function () {\n const data = Modal.getOrCreateInstance(this, config);\n\n if (typeof config !== 'string') {\n return;\n }\n\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n\n data[config](relatedTarget);\n });\n }\n\n}\n/**\n * Data API implementation\n */\n\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$2, SELECTOR_DATA_TOGGLE$2, function (event) {\n const target = getElementFromSelector(this);\n\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault();\n }\n\n EventHandler.one(target, EVENT_SHOW$4, showEvent => {\n if (showEvent.defaultPrevented) {\n // only register focus restorer if modal will actually get shown\n return;\n }\n\n EventHandler.one(target, EVENT_HIDDEN$4, () => {\n if (isVisible(this)) {\n this.focus();\n }\n });\n }); // avoid conflict when clicking modal toggler while another one is open\n\n const alreadyOpen = SelectorEngine.findOne(OPEN_SELECTOR$1);\n\n if (alreadyOpen) {\n Modal.getInstance(alreadyOpen).hide();\n }\n\n const data = Modal.getOrCreateInstance(target);\n data.toggle(this);\n});\nenableDismissTrigger(Modal);\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Modal);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): offcanvas.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$6 = 'offcanvas';\nconst DATA_KEY$3 = 'bs.offcanvas';\nconst EVENT_KEY$3 = `.${DATA_KEY$3}`;\nconst DATA_API_KEY$1 = '.data-api';\nconst EVENT_LOAD_DATA_API$2 = `load${EVENT_KEY$3}${DATA_API_KEY$1}`;\nconst ESCAPE_KEY = 'Escape';\nconst CLASS_NAME_SHOW$3 = 'show';\nconst CLASS_NAME_SHOWING$1 = 'showing';\nconst CLASS_NAME_HIDING = 'hiding';\nconst CLASS_NAME_BACKDROP = 'offcanvas-backdrop';\nconst OPEN_SELECTOR = '.offcanvas.show';\nconst EVENT_SHOW$3 = `show${EVENT_KEY$3}`;\nconst EVENT_SHOWN$3 = `shown${EVENT_KEY$3}`;\nconst EVENT_HIDE$3 = `hide${EVENT_KEY$3}`;\nconst EVENT_HIDE_PREVENTED = `hidePrevented${EVENT_KEY$3}`;\nconst EVENT_HIDDEN$3 = `hidden${EVENT_KEY$3}`;\nconst EVENT_RESIZE = `resize${EVENT_KEY$3}`;\nconst EVENT_CLICK_DATA_API$1 = `click${EVENT_KEY$3}${DATA_API_KEY$1}`;\nconst EVENT_KEYDOWN_DISMISS = `keydown.dismiss${EVENT_KEY$3}`;\nconst SELECTOR_DATA_TOGGLE$1 = '[data-bs-toggle=\"offcanvas\"]';\nconst Default$5 = {\n backdrop: true,\n keyboard: true,\n scroll: false\n};\nconst DefaultType$5 = {\n backdrop: '(boolean|string)',\n keyboard: 'boolean',\n scroll: 'boolean'\n};\n/**\n * Class definition\n */\n\nclass Offcanvas extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._isShown = false;\n this._backdrop = this._initializeBackDrop();\n this._focustrap = this._initializeFocusTrap();\n\n this._addEventListeners();\n } // Getters\n\n\n static get Default() {\n return Default$5;\n }\n\n static get DefaultType() {\n return DefaultType$5;\n }\n\n static get NAME() {\n return NAME$6;\n } // Public\n\n\n toggle(relatedTarget) {\n return this._isShown ? this.hide() : this.show(relatedTarget);\n }\n\n show(relatedTarget) {\n if (this._isShown) {\n return;\n }\n\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$3, {\n relatedTarget\n });\n\n if (showEvent.defaultPrevented) {\n return;\n }\n\n this._isShown = true;\n\n this._backdrop.show();\n\n if (!this._config.scroll) {\n new ScrollBarHelper().hide();\n }\n\n this._element.setAttribute('aria-modal', true);\n\n this._element.setAttribute('role', 'dialog');\n\n this._element.classList.add(CLASS_NAME_SHOWING$1);\n\n const completeCallBack = () => {\n if (!this._config.scroll || this._config.backdrop) {\n this._focustrap.activate();\n }\n\n this._element.classList.add(CLASS_NAME_SHOW$3);\n\n this._element.classList.remove(CLASS_NAME_SHOWING$1);\n\n EventHandler.trigger(this._element, EVENT_SHOWN$3, {\n relatedTarget\n });\n };\n\n this._queueCallback(completeCallBack, this._element, true);\n }\n\n hide() {\n if (!this._isShown) {\n return;\n }\n\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$3);\n\n if (hideEvent.defaultPrevented) {\n return;\n }\n\n this._focustrap.deactivate();\n\n this._element.blur();\n\n this._isShown = false;\n\n this._element.classList.add(CLASS_NAME_HIDING);\n\n this._backdrop.hide();\n\n const completeCallback = () => {\n this._element.classList.remove(CLASS_NAME_SHOW$3, CLASS_NAME_HIDING);\n\n this._element.removeAttribute('aria-modal');\n\n this._element.removeAttribute('role');\n\n if (!this._config.scroll) {\n new ScrollBarHelper().reset();\n }\n\n EventHandler.trigger(this._element, EVENT_HIDDEN$3);\n };\n\n this._queueCallback(completeCallback, this._element, true);\n }\n\n dispose() {\n this._backdrop.dispose();\n\n this._focustrap.deactivate();\n\n super.dispose();\n } // Private\n\n\n _initializeBackDrop() {\n const clickCallback = () => {\n if (this._config.backdrop === 'static') {\n EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED);\n return;\n }\n\n this.hide();\n }; // 'static' option will be translated to true, and booleans will keep their value\n\n\n const isVisible = Boolean(this._config.backdrop);\n return new Backdrop({\n className: CLASS_NAME_BACKDROP,\n isVisible,\n isAnimated: true,\n rootElement: this._element.parentNode,\n clickCallback: isVisible ? clickCallback : null\n });\n }\n\n _initializeFocusTrap() {\n return new FocusTrap({\n trapElement: this._element\n });\n }\n\n _addEventListeners() {\n EventHandler.on(this._element, EVENT_KEYDOWN_DISMISS, event => {\n if (event.key !== ESCAPE_KEY) {\n return;\n }\n\n if (!this._config.keyboard) {\n EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED);\n return;\n }\n\n this.hide();\n });\n } // Static\n\n\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Offcanvas.getOrCreateInstance(this, config);\n\n if (typeof config !== 'string') {\n return;\n }\n\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n\n data[config](this);\n });\n }\n\n}\n/**\n * Data API implementation\n */\n\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$1, SELECTOR_DATA_TOGGLE$1, function (event) {\n const target = getElementFromSelector(this);\n\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault();\n }\n\n if (isDisabled(this)) {\n return;\n }\n\n EventHandler.one(target, EVENT_HIDDEN$3, () => {\n // focus on trigger when it is closed\n if (isVisible(this)) {\n this.focus();\n }\n }); // avoid conflict when clicking a toggler of an offcanvas, while another is open\n\n const alreadyOpen = SelectorEngine.findOne(OPEN_SELECTOR);\n\n if (alreadyOpen && alreadyOpen !== target) {\n Offcanvas.getInstance(alreadyOpen).hide();\n }\n\n const data = Offcanvas.getOrCreateInstance(target);\n data.toggle(this);\n});\nEventHandler.on(window, EVENT_LOAD_DATA_API$2, () => {\n for (const selector of SelectorEngine.find(OPEN_SELECTOR)) {\n Offcanvas.getOrCreateInstance(selector).show();\n }\n});\nEventHandler.on(window, EVENT_RESIZE, () => {\n for (const element of SelectorEngine.find('[aria-modal][class*=show][class*=offcanvas-]')) {\n if (getComputedStyle(element).position !== 'fixed') {\n Offcanvas.getOrCreateInstance(element).hide();\n }\n }\n});\nenableDismissTrigger(Offcanvas);\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Offcanvas);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): util/sanitizer.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\nconst uriAttributes = new Set(['background', 'cite', 'href', 'itemtype', 'longdesc', 'poster', 'src', 'xlink:href']);\nconst ARIA_ATTRIBUTE_PATTERN = /^aria-[\\w-]*$/i;\n/**\n * A pattern that recognizes a commonly useful subset of URLs that are safe.\n *\n * Shout-out to Angular https://github.com/angular/angular/blob/12.2.x/packages/core/src/sanitization/url_sanitizer.ts\n */\n\nconst SAFE_URL_PATTERN = /^(?:(?:https?|mailto|ftp|tel|file|sms):|[^#&/:?]*(?:[#/?]|$))/i;\n/**\n * A pattern that matches safe data URLs. Only matches image, video and audio types.\n *\n * Shout-out to Angular https://github.com/angular/angular/blob/12.2.x/packages/core/src/sanitization/url_sanitizer.ts\n */\n\nconst DATA_URL_PATTERN = /^data:(?:image\\/(?:bmp|gif|jpeg|jpg|png|tiff|webp)|video\\/(?:mpeg|mp4|ogg|webm)|audio\\/(?:mp3|oga|ogg|opus));base64,[\\d+/a-z]+=*$/i;\n\nconst allowedAttribute = (attribute, allowedAttributeList) => {\n const attributeName = attribute.nodeName.toLowerCase();\n\n if (allowedAttributeList.includes(attributeName)) {\n if (uriAttributes.has(attributeName)) {\n return Boolean(SAFE_URL_PATTERN.test(attribute.nodeValue) || DATA_URL_PATTERN.test(attribute.nodeValue));\n }\n\n return true;\n } // Check if a regular expression validates the attribute.\n\n\n return allowedAttributeList.filter(attributeRegex => attributeRegex instanceof RegExp).some(regex => regex.test(attributeName));\n};\n\nconst DefaultAllowlist = {\n // Global attributes allowed on any supplied element below.\n '*': ['class', 'dir', 'id', 'lang', 'role', ARIA_ATTRIBUTE_PATTERN],\n a: ['target', 'href', 'title', 'rel'],\n area: [],\n b: [],\n br: [],\n col: [],\n code: [],\n div: [],\n em: [],\n hr: [],\n h1: [],\n h2: [],\n h3: [],\n h4: [],\n h5: [],\n h6: [],\n i: [],\n img: ['src', 'srcset', 'alt', 'title', 'width', 'height'],\n li: [],\n ol: [],\n p: [],\n pre: [],\n s: [],\n small: [],\n span: [],\n sub: [],\n sup: [],\n strong: [],\n u: [],\n ul: []\n};\nfunction sanitizeHtml(unsafeHtml, allowList, sanitizeFunction) {\n if (!unsafeHtml.length) {\n return unsafeHtml;\n }\n\n if (sanitizeFunction && typeof sanitizeFunction === 'function') {\n return sanitizeFunction(unsafeHtml);\n }\n\n const domParser = new window.DOMParser();\n const createdDocument = domParser.parseFromString(unsafeHtml, 'text/html');\n const elements = [].concat(...createdDocument.body.querySelectorAll('*'));\n\n for (const element of elements) {\n const elementName = element.nodeName.toLowerCase();\n\n if (!Object.keys(allowList).includes(elementName)) {\n element.remove();\n continue;\n }\n\n const attributeList = [].concat(...element.attributes);\n const allowedAttributes = [].concat(allowList['*'] || [], allowList[elementName] || []);\n\n for (const attribute of attributeList) {\n if (!allowedAttribute(attribute, allowedAttributes)) {\n element.removeAttribute(attribute.nodeName);\n }\n }\n }\n\n return createdDocument.body.innerHTML;\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): util/template-factory.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$5 = 'TemplateFactory';\nconst Default$4 = {\n allowList: DefaultAllowlist,\n content: {},\n // { selector : text , selector2 : text2 , }\n extraClass: '',\n html: false,\n sanitize: true,\n sanitizeFn: null,\n template: '
'\n};\nconst DefaultType$4 = {\n allowList: 'object',\n content: 'object',\n extraClass: '(string|function)',\n html: 'boolean',\n sanitize: 'boolean',\n sanitizeFn: '(null|function)',\n template: 'string'\n};\nconst DefaultContentType = {\n entry: '(string|element|function|null)',\n selector: '(string|element)'\n};\n/**\n * Class definition\n */\n\nclass TemplateFactory extends Config {\n constructor(config) {\n super();\n this._config = this._getConfig(config);\n } // Getters\n\n\n static get Default() {\n return Default$4;\n }\n\n static get DefaultType() {\n return DefaultType$4;\n }\n\n static get NAME() {\n return NAME$5;\n } // Public\n\n\n getContent() {\n return Object.values(this._config.content).map(config => this._resolvePossibleFunction(config)).filter(Boolean);\n }\n\n hasContent() {\n return this.getContent().length > 0;\n }\n\n changeContent(content) {\n this._checkContent(content);\n\n this._config.content = { ...this._config.content,\n ...content\n };\n return this;\n }\n\n toHtml() {\n const templateWrapper = document.createElement('div');\n templateWrapper.innerHTML = this._maybeSanitize(this._config.template);\n\n for (const [selector, text] of Object.entries(this._config.content)) {\n this._setContent(templateWrapper, text, selector);\n }\n\n const template = templateWrapper.children[0];\n\n const extraClass = this._resolvePossibleFunction(this._config.extraClass);\n\n if (extraClass) {\n template.classList.add(...extraClass.split(' '));\n }\n\n return template;\n } // Private\n\n\n _typeCheckConfig(config) {\n super._typeCheckConfig(config);\n\n this._checkContent(config.content);\n }\n\n _checkContent(arg) {\n for (const [selector, content] of Object.entries(arg)) {\n super._typeCheckConfig({\n selector,\n entry: content\n }, DefaultContentType);\n }\n }\n\n _setContent(template, content, selector) {\n const templateElement = SelectorEngine.findOne(selector, template);\n\n if (!templateElement) {\n return;\n }\n\n content = this._resolvePossibleFunction(content);\n\n if (!content) {\n templateElement.remove();\n return;\n }\n\n if (isElement(content)) {\n this._putElementInTemplate(getElement(content), templateElement);\n\n return;\n }\n\n if (this._config.html) {\n templateElement.innerHTML = this._maybeSanitize(content);\n return;\n }\n\n templateElement.textContent = content;\n }\n\n _maybeSanitize(arg) {\n return this._config.sanitize ? sanitizeHtml(arg, this._config.allowList, this._config.sanitizeFn) : arg;\n }\n\n _resolvePossibleFunction(arg) {\n return typeof arg === 'function' ? arg(this) : arg;\n }\n\n _putElementInTemplate(element, templateElement) {\n if (this._config.html) {\n templateElement.innerHTML = '';\n templateElement.append(element);\n return;\n }\n\n templateElement.textContent = element.textContent;\n }\n\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): tooltip.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$4 = 'tooltip';\nconst DISALLOWED_ATTRIBUTES = new Set(['sanitize', 'allowList', 'sanitizeFn']);\nconst CLASS_NAME_FADE$2 = 'fade';\nconst CLASS_NAME_MODAL = 'modal';\nconst CLASS_NAME_SHOW$2 = 'show';\nconst SELECTOR_TOOLTIP_INNER = '.tooltip-inner';\nconst SELECTOR_MODAL = `.${CLASS_NAME_MODAL}`;\nconst EVENT_MODAL_HIDE = 'hide.bs.modal';\nconst TRIGGER_HOVER = 'hover';\nconst TRIGGER_FOCUS = 'focus';\nconst TRIGGER_CLICK = 'click';\nconst TRIGGER_MANUAL = 'manual';\nconst EVENT_HIDE$2 = 'hide';\nconst EVENT_HIDDEN$2 = 'hidden';\nconst EVENT_SHOW$2 = 'show';\nconst EVENT_SHOWN$2 = 'shown';\nconst EVENT_INSERTED = 'inserted';\nconst EVENT_CLICK$1 = 'click';\nconst EVENT_FOCUSIN$1 = 'focusin';\nconst EVENT_FOCUSOUT$1 = 'focusout';\nconst EVENT_MOUSEENTER = 'mouseenter';\nconst EVENT_MOUSELEAVE = 'mouseleave';\nconst AttachmentMap = {\n AUTO: 'auto',\n TOP: 'top',\n RIGHT: isRTL() ? 'left' : 'right',\n BOTTOM: 'bottom',\n LEFT: isRTL() ? 'right' : 'left'\n};\nconst Default$3 = {\n allowList: DefaultAllowlist,\n animation: true,\n boundary: 'clippingParents',\n container: false,\n customClass: '',\n delay: 0,\n fallbackPlacements: ['top', 'right', 'bottom', 'left'],\n html: false,\n offset: [0, 0],\n placement: 'top',\n popperConfig: null,\n sanitize: true,\n sanitizeFn: null,\n selector: false,\n template: '
' + '
' + '
' + '
',\n title: '',\n trigger: 'hover focus'\n};\nconst DefaultType$3 = {\n allowList: 'object',\n animation: 'boolean',\n boundary: '(string|element)',\n container: '(string|element|boolean)',\n customClass: '(string|function)',\n delay: '(number|object)',\n fallbackPlacements: 'array',\n html: 'boolean',\n offset: '(array|string|function)',\n placement: '(string|function)',\n popperConfig: '(null|object|function)',\n sanitize: 'boolean',\n sanitizeFn: '(null|function)',\n selector: '(string|boolean)',\n template: 'string',\n title: '(string|element|function)',\n trigger: 'string'\n};\n/**\n * Class definition\n */\n\nclass Tooltip extends BaseComponent {\n constructor(element, config) {\n if (typeof Popper === 'undefined') {\n throw new TypeError('Bootstrap\\'s tooltips require Popper (https://popper.js.org)');\n }\n\n super(element, config); // Private\n\n this._isEnabled = true;\n this._timeout = 0;\n this._isHovered = null;\n this._activeTrigger = {};\n this._popper = null;\n this._templateFactory = null;\n this._newContent = null; // Protected\n\n this.tip = null;\n\n this._setListeners();\n\n if (!this._config.selector) {\n this._fixTitle();\n }\n } // Getters\n\n\n static get Default() {\n return Default$3;\n }\n\n static get DefaultType() {\n return DefaultType$3;\n }\n\n static get NAME() {\n return NAME$4;\n } // Public\n\n\n enable() {\n this._isEnabled = true;\n }\n\n disable() {\n this._isEnabled = false;\n }\n\n toggleEnabled() {\n this._isEnabled = !this._isEnabled;\n }\n\n toggle() {\n if (!this._isEnabled) {\n return;\n }\n\n this._activeTrigger.click = !this._activeTrigger.click;\n\n if (this._isShown()) {\n this._leave();\n\n return;\n }\n\n this._enter();\n }\n\n dispose() {\n clearTimeout(this._timeout);\n EventHandler.off(this._element.closest(SELECTOR_MODAL), EVENT_MODAL_HIDE, this._hideModalHandler);\n\n if (this._element.getAttribute('data-bs-original-title')) {\n this._element.setAttribute('title', this._element.getAttribute('data-bs-original-title'));\n }\n\n this._disposePopper();\n\n super.dispose();\n }\n\n show() {\n if (this._element.style.display === 'none') {\n throw new Error('Please use show on visible elements');\n }\n\n if (!(this._isWithContent() && this._isEnabled)) {\n return;\n }\n\n const showEvent = EventHandler.trigger(this._element, this.constructor.eventName(EVENT_SHOW$2));\n const shadowRoot = findShadowRoot(this._element);\n\n const isInTheDom = (shadowRoot || this._element.ownerDocument.documentElement).contains(this._element);\n\n if (showEvent.defaultPrevented || !isInTheDom) {\n return;\n } // todo v6 remove this OR make it optional\n\n\n this._disposePopper();\n\n const tip = this._getTipElement();\n\n this._element.setAttribute('aria-describedby', tip.getAttribute('id'));\n\n const {\n container\n } = this._config;\n\n if (!this._element.ownerDocument.documentElement.contains(this.tip)) {\n container.append(tip);\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_INSERTED));\n }\n\n this._popper = this._createPopper(tip);\n tip.classList.add(CLASS_NAME_SHOW$2); // If this is a touch-enabled device we add extra\n // empty mouseover listeners to the body's immediate children;\n // only needed because of broken event delegation on iOS\n // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html\n\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.on(element, 'mouseover', noop);\n }\n }\n\n const complete = () => {\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_SHOWN$2));\n\n if (this._isHovered === false) {\n this._leave();\n }\n\n this._isHovered = false;\n };\n\n this._queueCallback(complete, this.tip, this._isAnimated());\n }\n\n hide() {\n if (!this._isShown()) {\n return;\n }\n\n const hideEvent = EventHandler.trigger(this._element, this.constructor.eventName(EVENT_HIDE$2));\n\n if (hideEvent.defaultPrevented) {\n return;\n }\n\n const tip = this._getTipElement();\n\n tip.classList.remove(CLASS_NAME_SHOW$2); // If this is a touch-enabled device we remove the extra\n // empty mouseover listeners we added for iOS support\n\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.off(element, 'mouseover', noop);\n }\n }\n\n this._activeTrigger[TRIGGER_CLICK] = false;\n this._activeTrigger[TRIGGER_FOCUS] = false;\n this._activeTrigger[TRIGGER_HOVER] = false;\n this._isHovered = null; // it is a trick to support manual triggering\n\n const complete = () => {\n if (this._isWithActiveTrigger()) {\n return;\n }\n\n if (!this._isHovered) {\n this._disposePopper();\n }\n\n this._element.removeAttribute('aria-describedby');\n\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_HIDDEN$2));\n };\n\n this._queueCallback(complete, this.tip, this._isAnimated());\n }\n\n update() {\n if (this._popper) {\n this._popper.update();\n }\n } // Protected\n\n\n _isWithContent() {\n return Boolean(this._getTitle());\n }\n\n _getTipElement() {\n if (!this.tip) {\n this.tip = this._createTipElement(this._newContent || this._getContentForTemplate());\n }\n\n return this.tip;\n }\n\n _createTipElement(content) {\n const tip = this._getTemplateFactory(content).toHtml(); // todo: remove this check on v6\n\n\n if (!tip) {\n return null;\n }\n\n tip.classList.remove(CLASS_NAME_FADE$2, CLASS_NAME_SHOW$2); // todo: on v6 the following can be achieved with CSS only\n\n tip.classList.add(`bs-${this.constructor.NAME}-auto`);\n const tipId = getUID(this.constructor.NAME).toString();\n tip.setAttribute('id', tipId);\n\n if (this._isAnimated()) {\n tip.classList.add(CLASS_NAME_FADE$2);\n }\n\n return tip;\n }\n\n setContent(content) {\n this._newContent = content;\n\n if (this._isShown()) {\n this._disposePopper();\n\n this.show();\n }\n }\n\n _getTemplateFactory(content) {\n if (this._templateFactory) {\n this._templateFactory.changeContent(content);\n } else {\n this._templateFactory = new TemplateFactory({ ...this._config,\n // the `content` var has to be after `this._config`\n // to override config.content in case of popover\n content,\n extraClass: this._resolvePossibleFunction(this._config.customClass)\n });\n }\n\n return this._templateFactory;\n }\n\n _getContentForTemplate() {\n return {\n [SELECTOR_TOOLTIP_INNER]: this._getTitle()\n };\n }\n\n _getTitle() {\n return this._resolvePossibleFunction(this._config.title) || this._element.getAttribute('data-bs-original-title');\n } // Private\n\n\n _initializeOnDelegatedTarget(event) {\n return this.constructor.getOrCreateInstance(event.delegateTarget, this._getDelegateConfig());\n }\n\n _isAnimated() {\n return this._config.animation || this.tip && this.tip.classList.contains(CLASS_NAME_FADE$2);\n }\n\n _isShown() {\n return this.tip && this.tip.classList.contains(CLASS_NAME_SHOW$2);\n }\n\n _createPopper(tip) {\n const placement = typeof this._config.placement === 'function' ? this._config.placement.call(this, tip, this._element) : this._config.placement;\n const attachment = AttachmentMap[placement.toUpperCase()];\n return Popper.createPopper(this._element, tip, this._getPopperConfig(attachment));\n }\n\n _getOffset() {\n const {\n offset\n } = this._config;\n\n if (typeof offset === 'string') {\n return offset.split(',').map(value => Number.parseInt(value, 10));\n }\n\n if (typeof offset === 'function') {\n return popperData => offset(popperData, this._element);\n }\n\n return offset;\n }\n\n _resolvePossibleFunction(arg) {\n return typeof arg === 'function' ? arg.call(this._element) : arg;\n }\n\n _getPopperConfig(attachment) {\n const defaultBsPopperConfig = {\n placement: attachment,\n modifiers: [{\n name: 'flip',\n options: {\n fallbackPlacements: this._config.fallbackPlacements\n }\n }, {\n name: 'offset',\n options: {\n offset: this._getOffset()\n }\n }, {\n name: 'preventOverflow',\n options: {\n boundary: this._config.boundary\n }\n }, {\n name: 'arrow',\n options: {\n element: `.${this.constructor.NAME}-arrow`\n }\n }, {\n name: 'preSetPlacement',\n enabled: true,\n phase: 'beforeMain',\n fn: data => {\n // Pre-set Popper's placement attribute in order to read the arrow sizes properly.\n // Otherwise, Popper mixes up the width and height dimensions since the initial arrow style is for top placement\n this._getTipElement().setAttribute('data-popper-placement', data.state.placement);\n }\n }]\n };\n return { ...defaultBsPopperConfig,\n ...(typeof this._config.popperConfig === 'function' ? this._config.popperConfig(defaultBsPopperConfig) : this._config.popperConfig)\n };\n }\n\n _setListeners() {\n const triggers = this._config.trigger.split(' ');\n\n for (const trigger of triggers) {\n if (trigger === 'click') {\n EventHandler.on(this._element, this.constructor.eventName(EVENT_CLICK$1), this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event);\n\n context.toggle();\n });\n } else if (trigger !== TRIGGER_MANUAL) {\n const eventIn = trigger === TRIGGER_HOVER ? this.constructor.eventName(EVENT_MOUSEENTER) : this.constructor.eventName(EVENT_FOCUSIN$1);\n const eventOut = trigger === TRIGGER_HOVER ? this.constructor.eventName(EVENT_MOUSELEAVE) : this.constructor.eventName(EVENT_FOCUSOUT$1);\n EventHandler.on(this._element, eventIn, this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event);\n\n context._activeTrigger[event.type === 'focusin' ? TRIGGER_FOCUS : TRIGGER_HOVER] = true;\n\n context._enter();\n });\n EventHandler.on(this._element, eventOut, this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event);\n\n context._activeTrigger[event.type === 'focusout' ? TRIGGER_FOCUS : TRIGGER_HOVER] = context._element.contains(event.relatedTarget);\n\n context._leave();\n });\n }\n }\n\n this._hideModalHandler = () => {\n if (this._element) {\n this.hide();\n }\n };\n\n EventHandler.on(this._element.closest(SELECTOR_MODAL), EVENT_MODAL_HIDE, this._hideModalHandler);\n }\n\n _fixTitle() {\n const title = this._element.getAttribute('title');\n\n if (!title) {\n return;\n }\n\n if (!this._element.getAttribute('aria-label') && !this._element.textContent.trim()) {\n this._element.setAttribute('aria-label', title);\n }\n\n this._element.setAttribute('data-bs-original-title', title); // DO NOT USE IT. Is only for backwards compatibility\n\n\n this._element.removeAttribute('title');\n }\n\n _enter() {\n if (this._isShown() || this._isHovered) {\n this._isHovered = true;\n return;\n }\n\n this._isHovered = true;\n\n this._setTimeout(() => {\n if (this._isHovered) {\n this.show();\n }\n }, this._config.delay.show);\n }\n\n _leave() {\n if (this._isWithActiveTrigger()) {\n return;\n }\n\n this._isHovered = false;\n\n this._setTimeout(() => {\n if (!this._isHovered) {\n this.hide();\n }\n }, this._config.delay.hide);\n }\n\n _setTimeout(handler, timeout) {\n clearTimeout(this._timeout);\n this._timeout = setTimeout(handler, timeout);\n }\n\n _isWithActiveTrigger() {\n return Object.values(this._activeTrigger).includes(true);\n }\n\n _getConfig(config) {\n const dataAttributes = Manipulator.getDataAttributes(this._element);\n\n for (const dataAttribute of Object.keys(dataAttributes)) {\n if (DISALLOWED_ATTRIBUTES.has(dataAttribute)) {\n delete dataAttributes[dataAttribute];\n }\n }\n\n config = { ...dataAttributes,\n ...(typeof config === 'object' && config ? config : {})\n };\n config = this._mergeConfigObj(config);\n config = this._configAfterMerge(config);\n\n this._typeCheckConfig(config);\n\n return config;\n }\n\n _configAfterMerge(config) {\n config.container = config.container === false ? document.body : getElement(config.container);\n\n if (typeof config.delay === 'number') {\n config.delay = {\n show: config.delay,\n hide: config.delay\n };\n }\n\n if (typeof config.title === 'number') {\n config.title = config.title.toString();\n }\n\n if (typeof config.content === 'number') {\n config.content = config.content.toString();\n }\n\n return config;\n }\n\n _getDelegateConfig() {\n const config = {};\n\n for (const key in this._config) {\n if (this.constructor.Default[key] !== this._config[key]) {\n config[key] = this._config[key];\n }\n }\n\n config.selector = false;\n config.trigger = 'manual'; // In the future can be replaced with:\n // const keysWithDifferentValues = Object.entries(this._config).filter(entry => this.constructor.Default[entry[0]] !== this._config[entry[0]])\n // `Object.fromEntries(keysWithDifferentValues)`\n\n return config;\n }\n\n _disposePopper() {\n if (this._popper) {\n this._popper.destroy();\n\n this._popper = null;\n }\n\n if (this.tip) {\n this.tip.remove();\n this.tip = null;\n }\n } // Static\n\n\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Tooltip.getOrCreateInstance(this, config);\n\n if (typeof config !== 'string') {\n return;\n }\n\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n\n data[config]();\n });\n }\n\n}\n/**\n * jQuery\n */\n\n\ndefineJQueryPlugin(Tooltip);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): popover.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$3 = 'popover';\nconst SELECTOR_TITLE = '.popover-header';\nconst SELECTOR_CONTENT = '.popover-body';\nconst Default$2 = { ...Tooltip.Default,\n content: '',\n offset: [0, 8],\n placement: 'right',\n template: '
' + '
' + '

' + '
' + '
',\n trigger: 'click'\n};\nconst DefaultType$2 = { ...Tooltip.DefaultType,\n content: '(null|string|element|function)'\n};\n/**\n * Class definition\n */\n\nclass Popover extends Tooltip {\n // Getters\n static get Default() {\n return Default$2;\n }\n\n static get DefaultType() {\n return DefaultType$2;\n }\n\n static get NAME() {\n return NAME$3;\n } // Overrides\n\n\n _isWithContent() {\n return this._getTitle() || this._getContent();\n } // Private\n\n\n _getContentForTemplate() {\n return {\n [SELECTOR_TITLE]: this._getTitle(),\n [SELECTOR_CONTENT]: this._getContent()\n };\n }\n\n _getContent() {\n return this._resolvePossibleFunction(this._config.content);\n } // Static\n\n\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Popover.getOrCreateInstance(this, config);\n\n if (typeof config !== 'string') {\n return;\n }\n\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n\n data[config]();\n });\n }\n\n}\n/**\n * jQuery\n */\n\n\ndefineJQueryPlugin(Popover);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap (v5.2.3): scrollspy.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n/**\n * Constants\n */\n\nconst NAME$2 = 'scrollspy';\nconst DATA_KEY$2 = 'bs.scrollspy';\nconst EVENT_KEY$2 = `.${DATA_KEY$2}`;\nconst DATA_API_KEY = '.data-api';\nconst EVENT_ACTIVATE = `activate${EVENT_KEY$2}`;\nconst EVENT_CLICK = `click${EVENT_KEY$2}`;\nconst EVENT_LOAD_DATA_API$1 = `load${EVENT_KEY$2}${DATA_API_KEY}`;\nconst CLASS_NAME_DROPDOWN_ITEM = 'dropdown-item';\nconst CLASS_NAME_ACTIVE$1 = 'active';\nconst SELECTOR_DATA_SPY = '[data-bs-spy=\"scroll\"]';\nconst SELECTOR_TARGET_LINKS = '[href]';\nconst SELECTOR_NAV_LIST_GROUP = '.nav, .list-group';\nconst SELECTOR_NAV_LINKS = '.nav-link';\nconst SELECTOR_NAV_ITEMS = '.nav-item';\nconst SELECTOR_LIST_ITEMS = '.list-group-item';\nconst SELECTOR_LINK_ITEMS = `${SELECTOR_NAV_LINKS}, ${SELECTOR_NAV_ITEMS} > ${SELECTOR_NAV_LINKS}, ${SELECTOR_LIST_ITEMS}`;\nconst SELECTOR_DROPDOWN = '.dropdown';\nconst SELECTOR_DROPDOWN_TOGGLE$1 = '.dropdown-toggle';\nconst Default$1 = {\n offset: null,\n // TODO: v6 @deprecated, keep it for backwards compatibility reasons\n rootMargin: '0px 0px -25%',\n smoothScroll: false,\n target: null,\n threshold: [0.1, 0.5, 1]\n};\nconst DefaultType$1 = {\n offset: '(number|null)',\n // TODO v6 @deprecated, keep it for backwards compatibility reasons\n rootMargin: 'string',\n smoothScroll: 'boolean',\n target: 'element',\n threshold: 'array'\n};\n/**\n * Class definition\n */\n\nclass ScrollSpy extends BaseComponent {\n constructor(element, config) {\n super(element, config); // this._element is the observablesContainer and config.target the menu links wrapper\n\n this._targetLinks = new Map();\n this._observableSections = new Map();\n this._rootElement = getComputedStyle(this._element).overflowY === 'visible' ? null : this._element;\n this._activeTarget = null;\n this._observer = null;\n this._previousScrollData = {\n visibleEntryTop: 0,\n parentScrollTop: 0\n };\n this.refresh(); // initialize\n } // Getters\n\n\n static get Default() {\n return Default$1;\n }\n\n static get DefaultType() {\n return DefaultType$1;\n }\n\n static get NAME() {\n return NAME$2;\n } // Public\n\n\n refresh() {\n this._initializeTargetsAndObservables();\n\n this._maybeEnableSmoothScroll();\n\n if (this._observer) {\n this._observer.disconnect();\n } else {\n this._observer = this._getNewObserver();\n }\n\n for (const section of this._observableSections.values()) {\n this._observer.observe(section);\n }\n }\n\n dispose() {\n this._observer.disconnect();\n\n super.dispose();\n } // Private\n\n\n _configAfterMerge(config) {\n // TODO: on v6 target should be given explicitly & remove the {target: 'ss-target'} case\n config.target = getElement(config.target) || document.body; // TODO: v6 Only for backwards compatibility reasons. Use rootMargin only\n\n config.rootMargin = config.offset ? `${config.offset}px 0px -30%` : config.rootMargin;\n\n if (typeof config.threshold === 'string') {\n config.threshold = config.threshold.split(',').map(value => Number.parseFloat(value));\n }\n\n return config;\n }\n\n _maybeEnableSmoothScroll() {\n if (!this._config.smoothScroll) {\n return;\n } // unregister any previous listeners\n\n\n EventHandler.off(this._config.target, EVENT_CLICK);\n EventHandler.on(this._config.target, EVENT_CLICK, SELECTOR_TARGET_LINKS, event => {\n const observableSection = this._observableSections.get(event.target.hash);\n\n if (observableSection) {\n event.preventDefault();\n const root = this._rootElement || window;\n const height = observableSection.offsetTop - this._element.offsetTop;\n\n if (root.scrollTo) {\n root.scrollTo({\n top: height,\n behavior: 'smooth'\n });\n return;\n } // Chrome 60 doesn't support `scrollTo`\n\n\n root.scrollTop = height;\n }\n });\n }\n\n _getNewObserver() {\n const options = {\n root: this._rootElement,\n threshold: this._config.threshold,\n rootMargin: this._config.rootMargin\n };\n return new IntersectionObserver(entries => this._observerCallback(entries), options);\n } // The logic of selection\n\n\n _observerCallback(entries) {\n const targetElement = entry => this._targetLinks.get(`#${entry.target.id}`);\n\n const activate = entry => {\n this._previousScrollData.visibleEntryTop = entry.target.offsetTop;\n\n this._process(targetElement(entry));\n };\n\n const parentScrollTop = (this._rootElement || document.documentElement).scrollTop;\n const userScrollsDown = parentScrollTop >= this._previousScrollData.parentScrollTop;\n this._previousScrollData.parentScrollTop = parentScrollTop;\n\n for (const entry of entries) {\n if (!entry.isIntersecting) {\n this._activeTarget = null;\n\n this._clearActiveClass(targetElement(entry));\n\n continue;\n }\n\n const entryIsLowerThanPrevious = entry.target.offsetTop >= this._previousScrollData.visibleEntryTop; // if we are scrolling down, pick the bigger offsetTop\n\n if (userScrollsDown && entryIsLowerThanPrevious) {\n activate(entry); // if parent isn't scrolled, let's keep the first visible item, breaking the iteration\n\n if (!parentScrollTop) {\n return;\n }\n\n continue;\n } // if we are scrolling up, pick the smallest offsetTop\n\n\n if (!userScrollsDown && !entryIsLowerThanPrevious) {\n activate(entry);\n }\n }\n }\n\n _initializeTargetsAndObservables() {\n this._targetLinks = new Map();\n this._observableSections = new Map();\n const targetLinks = SelectorEngine.find(SELECTOR_TARGET_LINKS, this._config.target);\n\n for (const anchor of targetLinks) {\n // ensure that the anchor has an id and is not disabled\n if (!anchor.hash || isDisabled(anchor)) {\n continue;\n }\n\n const observableSection = SelectorEngine.findOne(anchor.hash, this._element); // ensure that the observableSection exists & is visible\n\n if (isVisible(observableSection)) {\n this._targetLinks.set(anchor.hash, anchor);\n\n this._observableSections.set(anchor.hash, observableSection);\n }\n }\n }\n\n _process(target) {\n if (this._activeTarget === target) {\n return;\n }\n\n this._clearActiveClass(this._config.target);\n\n this._activeTarget = target;\n target.classList.add(CLASS_NAME_ACTIVE$1);\n\n this._activateParents(target);\n\n EventHandler.trigger(this._element, EVENT_ACTIVATE, {\n relatedTarget: target\n });\n }\n\n _activateParents(target) {\n // Activate dropdown parents\n if (target.classList.contains(CLASS_NAME_DROPDOWN_ITEM)) {\n SelectorEngine.findOne(SELECTOR_DROPDOWN_TOGGLE$1, target.closest(SELECTOR_DROPDOWN)).classList.add(CLASS_NAME_ACTIVE$1);\n return;\n }\n\n for (const listGroup of SelectorEngine.parents(target, SELECTOR_NAV_LIST_GROUP)) {\n // Set triggered links parents as active\n // With both